![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | autoshape-img0009.png | 2021-04-05 22:49 | 135 | |
| autoshape-img0011.png | 2021-04-05 22:49 | 155 | |
| autoshape-img0008.png | 2021-04-05 22:49 | 183 | |
| multi-text-img0010.png | 2021-04-05 22:49 | 186 | |
| multi-text-img0017.png | 2021-04-05 22:49 | 209 | |
| calculator-palette-variables-palette-img0003.png | 2021-04-05 22:49 | 241 | |
| autoshape-img0010.png | 2021-04-05 22:49 | 245 | |
| multi-text-img0021.png | 2021-04-05 22:49 | 246 | |
| multi-text-img0007.png | 2021-04-05 22:49 | 251 | |
| autoshape-img0007.png | 2021-04-05 22:49 | 262 | |
| organizational-chart-img0003.png | 2021-04-05 22:49 | 264 | |
| organizational-chart-img0004.png | 2021-04-05 22:49 | 264 | |
| multi-text-img0008.png | 2021-04-05 22:49 | 267 | |
| autoshape-img0006.png | 2021-04-05 22:49 | 277 | |
| wcs-and-ucs-img0001.png | 2021-04-05 22:50 | 353 | |
| multi-text-img0009.png | 2021-04-05 22:49 | 356 | |
| mid-two-point-snap-img0001.png | 2021-04-05 22:49 | 358 | |
| 3d-slice-img0026.png | 2021-04-05 22:49 | 360 | |
| 3d-slice-img0027.png | 2021-04-05 22:49 | 360 | |
| wcs-and-ucs-img0002.png | 2021-04-05 22:50 | 364 | |
| arc-elliptical-fixed-ratio-img0001.png | 2021-04-05 22:49 | 376 | |
| arc-elliptical-fixed-ratio-img00021.png | 2021-04-05 22:49 | 376 | |
| autoshape-img0003.png | 2021-04-05 22:49 | 377 | |
| autoshape-img0005.png | 2021-04-05 22:49 | 380 | |
| arc-elliptical-fixed-ratio-img0004.png | 2021-04-05 22:49 | 385 | |
| arc-elliptical-fixed-ratio-img0005.png | 2021-04-05 22:49 | 385 | |
| arc-elliptical-fixed-ratio-img0002.png | 2021-04-05 22:49 | 388 | |
| arc-elliptical-fixed-ratio-img00031.png | 2021-04-05 22:49 | 388 | |
| stretch-img0004.png | 2021-04-05 22:50 | 390 | |
| multi-text-img0014.png | 2021-04-05 22:49 | 391 | |
| autoshape-img0001.png | 2021-04-05 22:49 | 410 | |
| autoshape-img0004.png | 2021-04-05 22:49 | 420 | |
| multi-text-img0003.png | 2021-04-05 22:49 | 466 | |
| organizational-chart-img0002.png | 2021-04-05 22:49 | 466 | |
| create-surface-from-profile-img0002.png | 2021-04-05 22:49 | 470 | |
| database-connection-palette-img0006.png | 2021-04-05 22:49 | 473 | |
| arc-elliptical-fixed-ratio-img0003.png | 2021-04-05 22:49 | 481 | |
| arc-elliptical-fixed-ratio-img00041.png | 2021-04-05 22:49 | 481 | |
| ifc-bim-data-1-2018-04-25-9.png | 2021-04-05 22:49 | 496 | |
| quicktime-movies-img0003.png | 2021-04-05 22:50 | 501 | |
| autoshape-img0013.png | 2021-04-05 22:49 | 507 | |
| autoshape-img0014.png | 2021-04-05 22:49 | 512 | |
| displaying-and-manipulating-the-grid-img0007.png | 2021-04-05 22:49 | 520 | |
| autoshape-img0012.png | 2021-04-05 22:49 | 525 | |
| quicktime-movies-img0002.png | 2021-04-05 22:50 | 537 | |
| prism-img0001.png | 2021-04-05 22:50 | 547 | |
| autoshape-img0015.png | 2021-04-05 22:49 | 567 | |
| using-the-lte-command-line-img0009.png | 2021-04-05 22:50 | 589 | |
| aligning-objects-img0004.png | 2021-04-05 22:49 | 633 | |
| spelling-tool-and-spell-options-img0002.png | 2021-04-05 22:50 | 667 | |
| insert-arc-img0005.png | 2021-04-05 22:49 | 668 | |
| arc-start-end-included-img0001.png | 2021-04-05 22:49 | 701 | |
| insert-arc-img0002.png | 2021-04-05 22:49 | 714 | |
| ellipse-elliptical-arc-img0001.png | 2021-04-05 22:49 | 718 | |
| insert-arc-img0004.png | 2021-04-05 22:49 | 721 | |
| insert-arc-img0001.png | 2021-04-05 22:49 | 727 | |
| spelling-tool-and-spell-options-img0006.png | 2021-04-05 22:50 | 731 | |
| arc-tangent-to-entities-img0008.png | 2021-04-05 22:49 | 769 | |
| arc-tangent-to-entities-img0010.png | 2021-04-05 22:49 | 769 | |
| arc-tangent-to-entities-img0006.png | 2021-04-05 22:49 | 771 | |
| arc-tangent-to-entities-img00081.png | 2021-04-05 22:49 | 771 | |
| ellipse-axis-end-img0001.png | 2021-04-05 22:49 | 782 | |
| vertical-img0003.png | 2021-04-05 22:50 | 785 | |
| arc-tangent-to-entities-img0007.png | 2021-04-05 22:49 | 807 | |
| arc-tangent-to-entities-img0009.png | 2021-04-05 22:49 | 807 | |
| arc-start-center-angle-img0001.png | 2021-04-05 22:49 | 819 | |
| ellipse-center-img0001.png | 2021-04-05 22:49 | 829 | |
| node-editing-roofs-img0004.png | 2021-04-05 22:49 | 876 | |
| trim-by-entity-img0001.png | 2021-04-05 22:50 | 895 | |
| rays-img0003.png | 2021-04-05 22:50 | 959 | |
| creating-construction-geometry-img0005.png | 2021-04-05 22:49 | 962 | |
| hatch-pattern-creator-img0002.png | 2021-04-05 22:49 | 1.0K | |
| insert-table-img0001.png | 2021-04-05 22:49 | 1.0K | |
| pressure-load-img0001.png | 2021-04-05 22:50 | 1.0K | |
| convert-to-arc-polyline-img0002.png | 2021-04-05 22:49 | 1.0K | |
| deform-to-point-img0001.png | 2021-04-05 22:49 | 1.0K | |
| rectangle-img0001.png | 2021-04-05 22:50 | 1.0K | |
| arc-start-end-radius-img0001.png | 2021-04-05 22:49 | 1.0K | |
| panning-img0002.png | 2021-04-05 22:50 | 1.0K | |
| trim-img0011.png | 2021-04-05 22:50 | 1.0K | |
| inserting-a-picture-img0008.png | 2021-04-05 22:49 | 1.0K | |
| rays-img0004.png | 2021-04-05 22:50 | 1.0K | |
| trim-img0001.png | 2021-04-05 22:50 | 1.0K | |
| tangent-from-arc-img0001.png | 2021-04-05 22:50 | 1.0K | |
| double-line-rectangle-img0001.png | 2021-04-05 22:49 | 1.0K | |
| schedule-img0001.png | 2021-04-05 22:50 | 1.0K | |
| creating-construction-geometry-img0004.png | 2021-04-05 22:49 | 1.0K | |
| multi-line-rectangle-img0001.png | 2021-04-05 22:49 | 1.0K | |
| panning-img0001.png | 2021-04-05 22:50 | 1.0K | |
| torus-img0001.png | 2021-04-05 22:50 | 1.0K | |
| zooming-img0006.png | 2021-04-05 22:50 | 1.0K | |
| add-slab-by-click-img0001.png | 2021-04-05 22:49 | 1.0K | |
| vertical-img0001.png | 2021-04-05 22:50 | 1.0K | |
| chain-polyline-img0001.png | 2021-04-05 22:49 | 1.0K | |
| vertex-snap-img0001.png | 2021-04-05 22:50 | 1.0K | |
| polygonal-prism-img0001.png | 2021-04-05 22:50 | 1.0K | |
| 3d-mesh-img0001.png | 2021-04-05 22:49 | 1.0K | |
| box-img0001.png | 2021-04-05 22:49 | 1.0K | |
| ellipse-axis-end-img0003.png | 2021-04-05 22:49 | 1.0K | |
| add-roof-img0001.png | 2021-04-05 22:49 | 1.0K | |
| cylinder-img0001.png | 2021-04-05 22:49 | 1.0K | |
| fillet-img0001.png | 2021-04-05 22:49 | 1.0K | |
| rotated-box-img0001.png | 2021-04-05 22:50 | 1.0K | |
| delete-hole-img0001.png | 2021-04-05 22:49 | 1.0K | |
| single-line-img0001.png | 2021-04-05 22:50 | 1.0K | |
| aerial-view-img0001.png | 2021-04-05 22:49 | 1.1K | |
| minimal-distance-img0001.png | 2021-04-05 22:49 | 1.1K | |
| wedge-img0001.png | 2021-04-05 22:50 | 1.1K | |
| arc-start-end-included-img0002.png | 2021-04-05 22:49 | 1.1K | |
| parametric-part-script-editor-palette-img0001.png | 2021-04-05 22:50 | 1.1K | |
| selection-info-img0001.png | 2021-04-05 22:50 | 1.1K | |
| show-compare-buttons-img0003.png | 2021-04-05 22:50 | 1.1K | |
| horizontal-img0001.png | 2021-04-05 22:49 | 1.1K | |
| splines-and-bezier-curves-img0002.png | 2021-04-05 22:50 | 1.1K | |
| transform-recorder-img0004.png | 2021-04-05 22:50 | 1.1K | |
| creating-construction-geometry-img0027.png | 2021-04-05 22:49 | 1.1K | |
| cone-img0001.png | 2021-04-05 22:49 | 1.1K | |
| rays-img0001.png | 2021-04-05 22:50 | 1.1K | |
| zooming-img0005.png | 2021-04-05 22:50 | 1.1K | |
| creating-construction-geometry-img0001.png | 2021-04-05 22:49 | 1.1K | |
| tools-palette-img0001.png | 2021-04-05 22:50 | 1.1K | |
| absolute-coordinates-img0001.png | 2021-04-05 22:49 | 1.1K | |
| door-img0001.png | 2021-04-05 22:49 | 1.1K | |
| show-compare-buttons-img0005.png | 2021-04-05 22:50 | 1.1K | |
| arc-3-points-img0001.png | 2021-04-05 22:49 | 1.1K | |
| measuring-area-img0001.png | 2021-04-05 22:49 | 1.1K | |
| 2d-geometric-parameters-img0008.png | 2021-04-05 22:49 | 1.1K | |
| arc-elliptical-img00011.png | 2021-04-05 22:49 | 1.1K | |
| arc-concentric-img00011.png | 2021-04-05 22:49 | 1.1K | |
| join-polyline-img0001.png | 2021-04-05 22:49 | 1.1K | |
| arc-start-center-end-img0001.png | 2021-04-05 22:49 | 1.1K | |
| changing-the-workplane-img0002.png | 2021-04-05 22:49 | 1.1K | |
| intersect-2-double-lines-img0001.png | 2021-04-05 22:49 | 1.1K | |
| block-attributes-img0001.png | 2021-04-05 22:49 | 1.1K | |
| protractor-img0002.png | 2021-04-05 22:50 | 1.1K | |
| arc-elliptical-fixed-ratio-img00011.png | 2021-04-05 22:49 | 1.1K | |
| multi-line-perpendicular-img0001.png | 2021-04-05 22:49 | 1.1K | |
| double-line-perpendicular-img0001.png | 2021-04-05 22:49 | 1.1K | |
| edit-opening-modifier-img0001.png | 2021-04-05 22:49 | 1.1K | |
| section-line-img0001.png | 2021-04-05 22:50 | 1.1K | |
| transform-recorder-img0006.png | 2021-04-05 22:50 | 1.1K | |
| arc-center-and-radius-img0001.png | 2021-04-05 22:49 | 1.1K | |
| exploding-solids-img0002.png | 2021-04-05 22:49 | 1.1K | |
| double-line-single-line-img0001.png | 2021-04-05 22:49 | 1.1K | |
| grid-snap-img0001.png | 2021-04-05 22:49 | 1.1K | |
| opposite-mirror-point-snap-img0001.png | 2021-04-05 22:49 | 1.1K | |
| changing-the-workplane-img0013.png | 2021-04-05 22:49 | 1.1K | |
| camera-objects-img0003.png | 2021-04-05 22:49 | 1.1K | |
| materials-palette-img0001.png | 2021-04-05 22:49 | 1.1K | |
| double-line-polygon-img0001.png | 2021-04-05 22:49 | 1.1K | |
| luminances-palette-img0001.png | 2021-04-05 22:49 | 1.1K | |
| transform-recorder-img0008.png | 2021-04-05 22:50 | 1.1K | |
| projection-snap-img0001.png | 2021-04-05 22:50 | 1.1K | |
| splines-and-bezier-curves-img0003.png | 2021-04-05 22:50 | 1.1K | |
| update-viewport-boundary-img0001.png | 2021-04-05 22:50 | 1.1K | |
| saving-and-recalling-workplanes-img0006.png | 2021-04-05 22:50 | 1.1K | |
| arc-tangent-to-2-entities-img00011.png | 2021-04-05 22:49 | 1.1K | |
| creating-lights-light-types-img0008.png | 2021-04-05 22:49 | 1.1K | |
| divide-point-snap-img0001.png | 2021-04-05 22:49 | 1.1K | |
| multi-line-polygon-img0001.png | 2021-04-05 22:49 | 1.1K | |
| blocks-palette-img0001.png | 2021-04-05 22:49 | 1.1K | |
| arc-start-end-direction-img0001.png | 2021-04-05 22:49 | 1.1K | |
| arc-start-end-included-img00011.png | 2021-04-05 22:49 | 1.1K | |
| ellipse-img0001.png | 2021-04-05 22:49 | 1.1K | |
| inserting-a-picture-img0007.png | 2021-04-05 22:49 | 1.1K | |
| transform-recorder-img0002.png | 2021-04-05 22:50 | 1.1K | |
| 3d-spline-by-fit-points-img0001.png | 2021-04-05 22:49 | 1.1K | |
| creating-construction-geometry-img0010.png | 2021-04-05 22:49 | 1.1K | |
| measuring-surface-area-img0001.png | 2021-04-05 22:49 | 1.1K | |
| splines-and-bezier-curves-img0001.png | 2021-04-05 22:50 | 1.1K | |
| style-manager-img00011.png | 2021-04-05 22:50 | 1.1K | |
| convert-to-slab-img0001.png | 2021-04-05 22:49 | 1.1K | |
| displaying-and-manipulating-the-grid-img0004.png | 2021-04-05 22:49 | 1.1K | |
| perpendicular-img0001.png | 2021-04-05 22:50 | 1.1K | |
| straight-stair-img0001.png | 2021-04-05 22:50 | 1.1K | |
| 2d-add-img0001.png | 2021-04-05 22:49 | 1.1K | |
| arc-double-point-img00011.png | 2021-04-05 22:49 | 1.1K | |
| changing-the-workplane-img0023.png | 2021-04-05 22:49 | 1.1K | |
| arc-tangent-to-entities-img00011.png | 2021-04-05 22:49 | 1.1K | |
| changing-the-workplane-img0008.png | 2021-04-05 22:49 | 1.1K | |
| inserting-walls-img0001.png | 2021-04-05 22:49 | 1.1K | |
| multi-line-polyline-img0001.png | 2021-04-05 22:49 | 1.1K | |
| multi-line-single-line-img0001.png | 2021-04-05 22:49 | 1.1K | |
| arc-rotated-elliptical-img00011.png | 2021-04-05 22:49 | 1.1K | |
| double-line-polyline-img0001.png | 2021-04-05 22:49 | 1.1K | |
| displaying-and-manipulating-the-grid-img0002.png | 2021-04-05 22:49 | 1.1K | |
| hemisphere-img0001.png | 2021-04-05 22:49 | 1.1K | |
| sphere-img0001.png | 2021-04-05 22:50 | 1.1K | |
| changing-the-workplane-img0027.png | 2021-04-05 22:49 | 1.1K | |
| detail-section-img0001.png | 2021-04-05 22:49 | 1.1K | |
| inserting-a-picture-img0006.png | 2021-04-05 22:49 | 1.1K | |
| irregular-polygon-img0001.png | 2021-04-05 22:49 | 1.1K | |
| measurement-info-img0001.png | 2021-04-05 22:49 | 1.1K | |
| arc-tangent-to-arc-img00011.png | 2021-04-05 22:49 | 1.1K | |
| relocate-origin-img0001.png | 2021-04-05 22:50 | 1.1K | |
| 3d-polyline-img00011.png | 2021-04-05 22:49 | 1.1K | |
| aligning-objects-img0002.png | 2021-04-05 22:49 | 1.1K | |
| convert-to-curve-img0001.png | 2021-04-05 22:49 | 1.1K | |
| double-line-parallel-img0001.png | 2021-04-05 22:49 | 1.1K | |
| import-terrain-img0001.png | 2021-04-05 22:49 | 1.1K | |
| pick-point-hatching-img0001.png | 2021-04-05 22:50 | 1.1K | |
| vector-copy-img0001.png | 2021-04-05 22:50 | 1.1K | |
| edit-tool-img0001.png | 2021-04-05 22:49 | 1.1K | |
| editing-the-workplane-img0001.png | 2021-04-05 22:49 | 1.1K | |
| ellipse-fixed-ratio-img00011.png | 2021-04-05 22:49 | 1.1K | |
| xclip-img0001.png | 2021-04-05 22:50 | 1.1K | |
| arc-start-center-length-img0001.png | 2021-04-05 22:49 | 1.1K | |
| named-view-img0001.png | 2021-04-05 22:49 | 1.1K | |
| object-trim-img0001.png | 2021-04-05 22:49 | 1.1K | |
| 3d-intersect-img0001.png | 2021-04-05 22:49 | 1.1K | |
| arc-start-end-angle-img0001.png | 2021-04-05 22:49 | 1.1K | |
| arc-tangent-to-3-arcs-img00011.png | 2021-04-05 22:49 | 1.1K | |
| camera-objects-img0007.png | 2021-04-05 22:49 | 1.1K | |
| sketch-img0001.png | 2021-04-05 22:50 | 1.1K | |
| arc-start-included-end-img0001.png | 2021-04-05 22:49 | 1.1K | |
| parallel-img0001.png | 2021-04-05 22:50 | 1.1K | |
| tangent-arc-point-img0001.png | 2021-04-05 22:50 | 1.1K | |
| prism-img0007.png | 2021-04-05 22:50 | 1.1K | |
| quick-dimensions-img0001.png | 2021-04-05 22:50 | 1.1K | |
| tangent-snap-img0001.png | 2021-04-05 22:50 | 1.1K | |
| circle-tangent-to-arc-img0001.png | 2021-04-05 22:49 | 1.1K | |
| multi-line-parallel-img0001.png | 2021-04-05 22:49 | 1.1K | |
| changing-the-workplane-img0005.png | 2021-04-05 22:49 | 1.1K | |
| creating-construction-geometry-img0016.png | 2021-04-05 22:49 | 1.1K | |
| multi-text-img0006.png | 2021-04-05 22:49 | 1.1K | |
| polygon-img0001.png | 2021-04-05 22:50 | 1.1K | |
| zooming-img0004.png | 2021-04-05 22:50 | 1.1K | |
| displaying-and-manipulating-the-grid-img0001.png | 2021-04-05 22:49 | 1.1K | |
| shrink-extend-line-img0001.png | 2021-04-05 22:50 | 1.1K | |
| changing-the-workplane-img0018.png | 2021-04-05 22:49 | 1.1K | |
| zooming-img0008.png | 2021-04-05 22:50 | 1.1K | |
| middle-point-snap-img0001.png | 2021-04-05 22:49 | 1.1K | |
| previous-view-img0001.png | 2021-04-05 22:50 | 1.1K | |
| creating-a-rendered-view-img0004.png | 2021-04-05 22:49 | 1.1K | |
| saving-and-recalling-workplanes-img0001.png | 2021-04-05 22:50 | 1.1K | |
| 3d-slice-img0002.png | 2021-04-05 22:49 | 1.1K | |
| controlling-lights-img0003.png | 2021-04-05 22:49 | 1.1K | |
| inserting-a-picture-img0005.png | 2021-04-05 22:49 | 1.1K | |
| circle-tangent-to-entities-img0001.png | 2021-04-05 22:49 | 1.1K | |
| creating-lights-light-types-img0004.png | 2021-04-05 22:49 | 1.1K | |
| arc-tangent-to-line-img00011.png | 2021-04-05 22:49 | 1.1K | |
| path-hatching-img0001.png | 2021-04-05 22:50 | 1.1K | |
| circle-tangent-to-arc-or-curve-img0001.png | 2021-04-05 22:49 | 1.1K | |
| display-intersections-with-3d-objects-img0001.png | 2021-04-05 22:49 | 1.1K | |
| revision-cloud-img0001.png | 2021-04-05 22:50 | 1.1K | |
| zooming-img0009.png | 2021-04-05 22:50 | 1.1K | |
| hyperlinks-img0001.png | 2021-04-05 22:49 | 1.1K | |
| relative-coordinates-img0001.png | 2021-04-05 22:50 | 1.1K | |
| circle-triple-point-img0001.png | 2021-04-05 22:49 | 1.1K | |
| double-line-irregular-polygon-img0001.png | 2021-04-05 22:49 | 1.1K | |
| intersection-and-projection-img0004.png | 2021-04-05 22:49 | 1.1K | |
| window-img0001.png | 2021-04-05 22:50 | 1.1K | |
| circle-tangent-to-3-arcs-img00011.png | 2021-04-05 22:49 | 1.1K | |
| meet-2-lines-img0001.png | 2021-04-05 22:49 | 1.1K | |
| nearest-on-facet-snap-img0001.png | 2021-04-05 22:49 | 1.1K | |
| double-line-rotated-rectangle-img0001.png | 2021-04-05 22:49 | 1.1K | |
| hatch-img0001.png | 2021-04-05 22:49 | 1.1K | |
| coordinates-of-a-point-img0001.png | 2021-04-05 22:49 | 1.1K | |
| zooming-img0003.png | 2021-04-05 22:50 | 1.1K | |
| camera-objects-img0004.png | 2021-04-05 22:49 | 1.1K | |
| creating-construction-geometry-img0007.png | 2021-04-05 22:49 | 1.1K | |
| creating-construction-geometry-img0023.png | 2021-04-05 22:49 | 1.1K | |
| edit-tool-img0006.png | 2021-04-05 22:49 | 1.1K | |
| inserting-a-file-img0001.png | 2021-04-05 22:49 | 1.1K | |
| nearest-on-graphic-snap-img0001.png | 2021-04-05 22:49 | 1.1K | |
| distributing-objects-img0002.png | 2021-04-05 22:49 | 1.1K | |
| profile-editing-img0017.png | 2021-04-05 22:50 | 1.1K | |
| camera-objects-img0005.png | 2021-04-05 22:49 | 1.1K | |
| creating-lights-light-types-img0006.png | 2021-04-05 22:49 | 1.1K | |
| environments-palette-img0001.png | 2021-04-05 22:49 | 1.1K | |
| circle-tangent-to-line-img00011.png | 2021-04-05 22:49 | 1.1K | |
| creating-a-rendered-view-img0002.png | 2021-04-05 22:49 | 1.1K | |
| zooming-img0002.png | 2021-04-05 22:50 | 1.1K | |
| 3d-subtract-img0001.png | 2021-04-05 22:49 | 1.2K | |
| displaying-and-manipulating-the-grid-img0006.png | 2021-04-05 22:49 | 1.2K | |
| 2d-intersect-img0001.png | 2021-04-05 22:49 | 1.2K | |
| fit-radial-copy-img0001.png | 2021-04-05 22:49 | 1.2K | |
| inserting-an-ole-object-img0001.png | 2021-04-05 22:49 | 1.2K | |
| center-snap-img0001.png | 2021-04-05 22:49 | 1.2K | |
| 2d-subtract-img0001.png | 2021-04-05 22:49 | 1.2K | |
| creating-a-rendered-view-img0008.png | 2021-04-05 22:49 | 1.2K | |
| creating-construction-geometry-img0013.png | 2021-04-05 22:49 | 1.2K | |
| creating-construction-geometry-img0019.png | 2021-04-05 22:49 | 1.2K | |
| assemble-by-3-points-img0001.png | 2021-04-05 22:49 | 1.2K | |
| creating-a-rendered-view-img0006.png | 2021-04-05 22:49 | 1.2K | |
| radial-copy-img0001.png | 2021-04-05 22:50 | 1.2K | |
| extended-ortho-snap-img0001.png | 2021-04-05 22:49 | 1.2K | |
| rotated-rectangle-img0001.png | 2021-04-05 22:50 | 1.2K | |
| smart-dimensions-img0001.png | 2021-04-05 22:50 | 1.2K | |
| array-copy-img0001.png | 2021-04-05 22:49 | 1.2K | |
| ortho-snap-img0001.png | 2021-04-05 22:49 | 1.2K | |
| apparent-intersection-snap-img0001.png | 2021-04-05 22:49 | 1.2K | |
| assemble-by-edge-and-point-img0001.png | 2021-04-05 22:49 | 1.2K | |
| fit-array-copy-img0001.png | 2021-04-05 22:49 | 1.2K | |
| magnetic-point-img0001.png | 2021-04-05 22:49 | 1.2K | |
| show-magnetic-point-img0001.png | 2021-04-05 22:50 | 1.2K | |
| creating-a-view-img0001.png | 2021-04-05 22:49 | 1.2K | |
| center-of-extents-snap-img0001.png | 2021-04-05 22:49 | 1.2K | |
| chamfer-img0010.png | 2021-04-05 22:49 | 1.2K | |
| intersection-snap-img0001.png | 2021-04-05 22:49 | 1.2K | |
| measuring-volume-img0001.png | 2021-04-05 22:49 | 1.2K | |
| multi-text-img0022.png | 2021-04-05 22:49 | 1.2K | |
| multi-line-rotated-rectangle-img0001.png | 2021-04-05 22:49 | 1.2K | |
| rotated-ellipse-img0001.png | 2021-04-05 22:50 | 1.2K | |
| curve-length-img0001.png | 2021-04-05 22:49 | 1.2K | |
| intersection-and-projection-img0001.png | 2021-04-05 22:49 | 1.2K | |
| chamfer-img0006.png | 2021-04-05 22:49 | 1.2K | |
| measuring-angles-img0001.png | 2021-04-05 22:49 | 1.2K | |
| scale-img0001.png | 2021-04-05 22:50 | 1.2K | |
| workplane-intersections-snap-img0001.png | 2021-04-05 22:50 | 1.2K | |
| viewports-img0001.png | 2021-04-05 22:50 | 1.2K | |
| exploding-a-block-img0001.png | 2021-04-05 22:49 | 1.2K | |
| exploding-a-group-img0001.png | 2021-04-05 22:49 | 1.2K | |
| measuring-distance-img0001.png | 2021-04-05 22:49 | 1.2K | |
| arc-complement-img0001.png | 2021-04-05 22:49 | 1.2K | |
| multi-line-irregular-polygon-img0001.png | 2021-04-05 22:49 | 1.2K | |
| arc-start-end-included-img0003.png | 2021-04-05 22:49 | 1.2K | |
| line-length-img0001.png | 2021-04-05 22:49 | 1.2K | |
| polar-coordinates-img0001.png | 2021-04-05 22:50 | 1.2K | |
| creating-lights-light-types-img0010.png | 2021-04-05 22:49 | 1.2K | |
| multi-shrink-extend-line-img0001.png | 2021-04-05 22:49 | 1.2K | |
| creating-lights-light-types-img0012.png | 2021-04-05 22:49 | 1.2K | |
| inserting-a-picture-img0001.png | 2021-04-05 22:49 | 1.2K | |
| move-img0001.png | 2021-04-05 22:49 | 1.2K | |
| t-meet-2-double-lines-img0001.png | 2021-04-05 22:50 | 1.2K | |
| circle-double-point-img0001.png | 2021-04-05 22:49 | 1.2K | |
| add-roof-by-walls-img0001.png | 2021-04-05 22:49 | 1.2K | |
| creating-a-group-img0001.png | 2021-04-05 22:49 | 1.2K | |
| chamfer-img0014.png | 2021-04-05 22:49 | 1.2K | |
| stretch-img0001.png | 2021-04-05 22:50 | 1.2K | |
| multi-text-img0016.png | 2021-04-05 22:49 | 1.2K | |
| creating-a-block-img0001.png | 2021-04-05 22:49 | 1.2K | |
| offset-with-law-img0005.png | 2021-04-05 22:49 | 1.2K | |
| split-img0001.png | 2021-04-05 22:50 | 1.2K | |
| circle-tangent-to-line-img0001.png | 2021-04-05 22:49 | 1.2K | |
| surveyor-dimensions-img0004.png | 2021-04-05 22:50 | 1.2K | |
| breaks-img0005.png | 2021-04-05 22:49 | 1.2K | |
| redsdk-global-environments-img00101.png | 2021-04-05 22:50 | 1.2K | |
| circle-center-and-point-img0001.png | 2021-04-05 22:49 | 1.2K | |
| circle-concentric-img00011.png | 2021-04-05 22:49 | 1.2K | |
| space-units-img0002.png | 2021-04-05 22:50 | 1.2K | |
| generic-img0001.png | 2021-04-05 22:49 | 1.2K | |
| fit-linear-copy-img0001.png | 2021-04-05 22:49 | 1.2K | |
| scale-from-two-points-img0001.png | 2021-04-05 22:50 | 1.2K | |
| quadrant-point-snap-img0001.png | 2021-04-05 22:50 | 1.2K | |
| ellipse-elliptical-arc-img0006.png | 2021-04-05 22:49 | 1.2K | |
| creating-lights-light-types-img0002.png | 2021-04-05 22:49 | 1.2K | |
| rotate-img0001.png | 2021-04-05 22:50 | 1.2K | |
| extract-entity-img0021.png | 2021-04-05 22:49 | 1.2K | |
| ellipse-rotated-elliptical-arc-img0001.png | 2021-04-05 22:49 | 1.2K | |
| other-controls-img0001.png | 2021-04-05 22:49 | 1.2K | |
| profile-editing-img0014.png | 2021-04-05 22:50 | 1.3K | |
| ellipse-elliptical-arc-img0005.png | 2021-04-05 22:49 | 1.3K | |
| thread-3d-img0001.png | 2021-04-05 22:50 | 1.3K | |
| isolate-object-img0005.png | 2021-04-05 22:49 | 1.3K | |
| ellipse-center-img0003.png | 2021-04-05 22:49 | 1.3K | |
| rail-sweep-img0002.png | 2021-04-05 22:50 | 1.3K | |
| sweep-img0002.png | 2021-04-05 22:50 | 1.3K | |
| controlling-lights-img0002.png | 2021-04-05 22:49 | 1.3K | |
| no-snap-img0001.png | 2021-04-05 22:49 | 1.3K | |
| twisted-extrude-img0001.png | 2021-04-05 22:50 | 1.3K | |
| arrow-tools-img0002.png | 2021-04-05 22:49 | 1.3K | |
| join-polyline-img0005.png | 2021-04-05 22:49 | 1.3K | |
| redsdk-volumetric-environment-img00011.png | 2021-04-05 22:50 | 1.3K | |
| using-the-advanced-render-styles-palette-img0002.png | 2021-04-05 22:50 | 1.3K | |
| using-the-environments-palette-img0003.png | 2021-04-05 22:50 | 1.3K | |
| using-the-luminances-palette-img0002.png | 2021-04-05 22:50 | 1.3K | |
| using-the-materials-palette-img0002.png | 2021-04-05 22:50 | 1.3K | |
| double-line-options-img0001.png | 2021-04-05 22:49 | 1.3K | |
| importing-point-clouds-img0003.png | 2021-04-05 22:49 | 1.3K | |
| isolate-object-img0004.png | 2021-04-05 22:49 | 1.3K | |
| arc-3-points-img0003.png | 2021-04-05 22:49 | 1.3K | |
| 2d-geometric-parameters-img0005.png | 2021-04-05 22:49 | 1.3K | |
| simple-extrude-img0001.png | 2021-04-05 22:50 | 1.3K | |
| 3d-slice-img0014.png | 2021-04-05 22:49 | 1.3K | |
| redsdk-materials-examples-img00021.png | 2021-04-05 22:50 | 1.3K | |
| 3d-slice-img0010.png | 2021-04-05 22:49 | 1.3K | |
| pressure-load-img0007.png | 2021-04-05 22:50 | 1.4K | |
| 3d-slice-img0004.png | 2021-04-05 22:49 | 1.4K | |
| image-manager-palette-img0003.png | 2021-04-05 22:49 | 1.4K | |
| pressure-load-img0009.png | 2021-04-05 22:50 | 1.4K | |
| editing-splines-and-bezier-curves-img0005.png | 2021-04-05 22:49 | 1.4K | |
| 3d-slice-img0007.png | 2021-04-05 22:49 | 1.4K | |
| 2d-geometric-parameters-img0004.png | 2021-04-05 22:49 | 1.4K | |
| editing-splines-and-bezier-curves-img0007.png | 2021-04-05 22:49 | 1.4K | |
| database-connection-palette-img0022.png | 2021-04-05 22:49 | 1.4K | |
| arc-center-start-length-img0002.png | 2021-04-05 22:49 | 1.4K | |
| display-2d-part-img0002.png | 2021-04-05 22:49 | 1.4K | |
| profile-along-path-img0004.png | 2021-04-05 22:50 | 1.4K | |
| creating-dimensions-img0002.png | 2021-04-05 22:49 | 1.4K | |
| pressure-load-img0011.png | 2021-04-05 22:50 | 1.4K | |
| 2d-intersect-img0003.png | 2021-04-05 22:49 | 1.4K | |
| double-line-rectangle-img0002.png | 2021-04-05 22:49 | 1.4K | |
| fillet-img0007.png | 2021-04-05 22:49 | 1.4K | |
| dynamic-cut-plane-img0002.png | 2021-04-05 22:49 | 1.4K | |
| snap-settings-img0001.png | 2021-04-05 22:50 | 1.4K | |
| colors-and-materials-img0003.png | 2021-04-05 22:49 | 1.4K | |
| isolate-object-img0001.png | 2021-04-05 22:49 | 1.4K | |
| calculator-palette-variables-palette-img0015.png | 2021-04-05 22:49 | 1.4K | |
| dynamic-cut-plane-img0004.png | 2021-04-05 22:49 | 1.4K | |
| autoshape-img0002.png | 2021-04-05 22:49 | 1.4K | |
| redsdk-global-environments-img00081.png | 2021-04-05 22:50 | 1.4K | |
| prism-img0002.png | 2021-04-05 22:50 | 1.4K | |
| section-by-closed-polyline-img0001.png | 2021-04-05 22:50 | 1.4K | |
| multi-view-blocks-img0005.png | 2021-04-05 22:49 | 1.5K | |
| creating-a-parametric-part-img0034.png | 2021-04-05 22:49 | 1.5K | |
| edit-tool-img0004.png | 2021-04-05 22:49 | 1.5K | |
| imprint-with-chamfer-or-fillet-img0003.png | 2021-04-05 22:49 | 1.5K | |
| section-by-plane-img0001.png | 2021-04-05 22:50 | 1.5K | |
| facet-edit-img0010.png | 2021-04-05 22:49 | 1.5K | |
| editing-walls-img0001.png | 2021-04-05 22:49 | 1.5K | |
| ellipse-elliptical-arc-img0002.png | 2021-04-05 22:49 | 1.5K | |
| polyline-img0016.png | 2021-04-05 22:50 | 1.5K | |
| redsdk-materials-examples-img00111.png | 2021-04-05 22:50 | 1.5K | |
| creating-a-parametric-part-img0035.png | 2021-04-05 22:49 | 1.5K | |
| section-by-line-img0001.png | 2021-04-05 22:50 | 1.5K | |
| creating-a-parametric-part-img0028.png | 2021-04-05 22:49 | 1.5K | |
| chamfer-img0003.png | 2021-04-05 22:49 | 1.5K | |
| creating-a-parametric-part-img0033.png | 2021-04-05 22:49 | 1.5K | |
| imprint-subtract-img0004.png | 2021-04-05 22:49 | 1.5K | |
| other-controls-img0002.png | 2021-04-05 22:49 | 1.5K | |
| editing-splines-and-bezier-curves-img0017.png | 2021-04-05 22:49 | 1.5K | |
| arc-center-start-length-img0001.png | 2021-04-05 22:49 | 1.5K | |
| imprint-add-img0005.png | 2021-04-05 22:49 | 1.5K | |
| multi-text-img0005.png | 2021-04-05 22:49 | 1.5K | |
| imprint-add-img0002.png | 2021-04-05 22:49 | 1.5K | |
| imprint-auto-detect-img0002.png | 2021-04-05 22:49 | 1.5K | |
| imprint-subtract-img0002.png | 2021-04-05 22:49 | 1.5K | |
| multilanding-stair-by-path-img0002.png | 2021-04-05 22:49 | 1.5K | |
| measuring-img0003.png | 2021-04-05 22:49 | 1.6K | |
| rectangle-img0004.png | 2021-04-05 22:50 | 1.6K | |
| 3d-slice-img0022.png | 2021-04-05 22:49 | 1.6K | |
| chamfer-with-round-vertices-img0002.png | 2021-04-05 22:49 | 1.6K | |
| rotated-rectangle-img0004.png | 2021-04-05 22:50 | 1.6K | |
| arc-start-end-included-img00021.png | 2021-04-05 22:49 | 1.6K | |
| chamfer-img0007.png | 2021-04-05 22:49 | 1.6K | |
| inspector-bar-img0007.png | 2021-04-05 22:49 | 1.6K | |
| map-img0003.png | 2021-04-05 22:49 | 1.6K | |
| single-line-img0002.png | 2021-04-05 22:50 | 1.6K | |
| facet-edit-img0008.png | 2021-04-05 22:49 | 1.6K | |
| ellipse-elliptical-arc-img0004.png | 2021-04-05 22:49 | 1.6K | |
| fillet-img0003.png | 2021-04-05 22:49 | 1.6K | |
| fillet-with-miter-vertices-img0010.png | 2021-04-05 22:49 | 1.6K | |
| fillet-with-round-vertices-img0002.png | 2021-04-05 22:49 | 1.6K | |
| fillet-3d-img0003.png | 2021-04-05 22:49 | 1.6K | |
| inspector-bar-img0008.png | 2021-04-05 22:49 | 1.6K | |
| revolve-img0007.png | 2021-04-05 22:50 | 1.6K | |
| edit-tool-img0005.png | 2021-04-05 22:49 | 1.6K | |
| add-slab-by-click-img0005.png | 2021-04-05 22:49 | 1.6K | |
| facet-edit-img0007.png | 2021-04-05 22:49 | 1.6K | |
| map-img0002.png | 2021-04-05 22:49 | 1.6K | |
| arc-3-points-img0002.png | 2021-04-05 22:49 | 1.6K | |
| chamfer-with-miter-vertices-img0002.png | 2021-04-05 22:49 | 1.6K | |
| divide-point-snap-img0003.png | 2021-04-05 22:49 | 1.6K | |
| fillet-img0002.png | 2021-04-05 22:49 | 1.6K | |
| running-and-local-snaps-img0002.png | 2021-04-05 22:50 | 1.6K | |
| walk-through-tools-img0006.png | 2021-04-05 22:50 | 1.6K | |
| double-line-options-img0005.png | 2021-04-05 22:49 | 1.6K | |
| arc-start-included-end-img0002.png | 2021-04-05 22:49 | 1.6K | |
| bend-by-sketch-img0008.png | 2021-04-05 22:49 | 1.6K | |
| ellipse-elliptical-arc-img0003.png | 2021-04-05 22:49 | 1.6K | |
| edit-tool-img0003.png | 2021-04-05 22:49 | 1.6K | |
| bend-by-sketch-img0009.png | 2021-04-05 22:49 | 1.6K | |
| walk-through-tools-img0005.png | 2021-04-05 22:50 | 1.6K | |
| chamfer-with-miter-vertices-img0010.png | 2021-04-05 22:49 | 1.7K | |
| editing-walls-img0006.png | 2021-04-05 22:49 | 1.7K | |
| constraining-geometry-img0004.png | 2021-04-05 22:49 | 1.7K | |
| arc-center-start-end-img0002.png | 2021-04-05 22:49 | 1.7K | |
| editing-stairs-img0001.png | 2021-04-05 22:49 | 1.7K | |
| ellipse-ellipse-standard-img0001.png | 2021-04-05 22:49 | 1.7K | |
| fillet-with-variable-radius-img0001.png | 2021-04-05 22:49 | 1.7K | |
| chamfer-with-round-vertices-img0003.png | 2021-04-05 22:49 | 1.7K | |
| walk-through-tools-img0003.png | 2021-04-05 22:50 | 1.7K | |
| curve-from-law-img0005.png | 2021-04-05 22:49 | 1.7K | |
| point-img0003.png | 2021-04-05 22:50 | 1.7K | |
| pulling-curved-faces-img0013.png | 2021-04-05 22:50 | 1.7K | |
| pulling-curved-faces-img0008.png | 2021-04-05 22:50 | 1.7K | |
| walk-through-tools-img0002.png | 2021-04-05 22:50 | 1.7K | |
| fillet-with-round-vertices-img0004.png | 2021-04-05 22:49 | 1.7K | |
| 2d-geometric-parameters-img0007.png | 2021-04-05 22:49 | 1.7K | |
| inserting-walls-img0007.png | 2021-04-05 22:49 | 1.7K | |
| measuring-area-img0005.png | 2021-04-05 22:49 | 1.7K | |
| chamfer-img0016.png | 2021-04-05 22:49 | 1.7K | |
| creating-a-parametric-part-img0046.png | 2021-04-05 22:49 | 1.7K | |
| multi-view-blocks-img0003.png | 2021-04-05 22:49 | 1.7K | |
| property-set-definitions-img0002.png | 2021-04-05 22:50 | 1.7K | |
| section-by-view-line-and-aligned-sectional-views-img0014.png | 2021-04-05 22:50 | 1.7K | |
| chamfer-img0012.png | 2021-04-05 22:49 | 1.7K | |
| circle-3-points-img0001.png | 2021-04-05 22:49 | 1.7K | |
| measuring-angles-img0005.png | 2021-04-05 22:49 | 1.7K | |
| fillet-with-miter-vertices-img0002.png | 2021-04-05 22:49 | 1.7K | |
| connect-constraint-img0005.png | 2021-04-05 22:49 | 1.7K | |
| walk-through-tools-img0004.png | 2021-04-05 22:50 | 1.7K | |
| profile-along-path-img0006.png | 2021-04-05 22:50 | 1.7K | |
| profile-along-path-img0005.png | 2021-04-05 22:50 | 1.7K | |
| using-the-lte-command-line-img0014.png | 2021-04-05 22:50 | 1.7K | |
| 3d-add-img0004.png | 2021-04-05 22:49 | 1.7K | |
| 3d-boolean-operations-img0003.png | 2021-04-05 22:49 | 1.7K | |
| 3d-slice-img0025.png | 2021-04-05 22:49 | 1.7K | |
| 3d-subtract-img0004.png | 2021-04-05 22:49 | 1.7K | |
| surface-from-laws-img0004.png | 2021-04-05 22:50 | 1.7K | |
| warp-by-law-img0005.png | 2021-04-05 22:50 | 1.7K | |
| split-img0004.png | 2021-04-05 22:50 | 1.7K | |
| database-connection-palette-img0014.png | 2021-04-05 22:49 | 1.7K | |
| editing-stairs-img0003.png | 2021-04-05 22:49 | 1.7K | |
| measuring-distance-img0007.png | 2021-04-05 22:49 | 1.7K | |
| changing-rows-and-columns-merging-cells-img0008.png | 2021-04-05 22:49 | 1.7K | |
| deform-to-point-img0012.png | 2021-04-05 22:49 | 1.7K | |
| hyperlinks-img0005.png | 2021-04-05 22:49 | 1.7K | |
| drafting-palette-toolbar-img0001.png | 2021-04-05 22:49 | 1.7K | |
| arc-start-end-angle-img0002.png | 2021-04-05 22:49 | 1.7K | |
| editing-segments-img0007.png | 2021-04-05 22:49 | 1.7K | |
| editing-segments-img0002.png | 2021-04-05 22:49 | 1.8K | |
| deform-to-point-img0011.png | 2021-04-05 22:49 | 1.8K | |
| deform-to-point-img0013.png | 2021-04-05 22:49 | 1.8K | |
| arc-3-points-img0006.png | 2021-04-05 22:49 | 1.8K | |
| chamfer-img0015.png | 2021-04-05 22:49 | 1.8K | |
| using-the-trim-tool-with-architectural-objects-img0001.png | 2021-04-05 22:50 | 1.8K | |
| importing-point-clouds-img0002.png | 2021-04-05 22:49 | 1.8K | |
| arc-start-end-direction-img0002.png | 2021-04-05 22:49 | 1.8K | |
| double-line-options-img0004.png | 2021-04-05 22:49 | 1.8K | |
| using-the-lte-command-line-img0016.png | 2021-04-05 22:50 | 1.8K | |
| hatching-img0001.png | 2021-04-05 22:49 | 1.8K | |
| polyline-img0018.png | 2021-04-05 22:50 | 1.8K | |
| chamfer-img0011.png | 2021-04-05 22:49 | 1.8K | |
| circle-tangent-to-line-img0003.png | 2021-04-05 22:49 | 1.8K | |
| iso-grid-img0001.png | 2021-04-05 22:49 | 1.8K | |
| page-setup-img0001.png | 2021-04-05 22:50 | 1.8K | |
| chamfer-edges-img0002.png | 2021-04-05 22:49 | 1.8K | |
| chamfer-img0008.png | 2021-04-05 22:49 | 1.8K | |
| inserting-objects-from-other-files-img0001.png | 2021-04-05 22:49 | 1.8K | |
| object-trim-img0012.png | 2021-04-05 22:49 | 1.9K | |
| smeshes-and-exploding-the-primitive-img0003.png | 2021-04-05 22:50 | 1.9K | |
| thread-img0001.png | 2021-04-05 22:50 | 1.9K | |
| arc-start-center-angle-img0002.png | 2021-04-05 22:49 | 1.9K | |
| hole-img0002.png | 2021-04-05 22:49 | 1.9K | |
| split-img0002.png | 2021-04-05 22:50 | 1.9K | |
| redsdk-global-environments-img00021.png | 2021-04-05 22:50 | 1.9K | |
| contact-manager-img0007.png | 2021-04-05 22:49 | 1.9K | |
| linking-data-to-graphics-img0005.png | 2021-04-05 22:49 | 1.9K | |
| polyline-img0011.png | 2021-04-05 22:50 | 1.9K | |
| tc-explorer-toolbar-img0001.png | 2021-04-05 22:50 | 1.9K | |
| imprint-with-dimple-sheet-metal-img0002.png | 2021-04-05 22:49 | 1.9K | |
| transforming-img0002.png | 2021-04-05 22:50 | 1.9K | |
| property-set-definitions-img0004.png | 2021-04-05 22:50 | 1.9K | |
| circle-tangent-to-arc-or-curve-img0003.png | 2021-04-05 22:49 | 1.9K | |
| assemble-by-axis-img0008.png | 2021-04-05 22:49 | 1.9K | |
| ellipse-rotated-elliptical-arc-img0004.png | 2021-04-05 22:49 | 1.9K | |
| node-editing-roofs-img0005.png | 2021-04-05 22:49 | 1.9K | |
| cone-img0008.png | 2021-04-05 22:49 | 1.9K | |
| arc-double-point-img0001.png | 2021-04-05 22:49 | 1.9K | |
| imprint-with-chamfer-or-fillet-img0002.png | 2021-04-05 22:49 | 1.9K | |
| assemble-by-axis-img0012.png | 2021-04-05 22:49 | 1.9K | |
| detail-section-img0002.png | 2021-04-05 22:49 | 1.9K | |
| cone-img0009.png | 2021-04-05 22:49 | 1.9K | |
| smart-dimensions-img0003.png | 2021-04-05 22:50 | 1.9K | |
| section-by-workplane-img0001.png | 2021-04-05 22:50 | 1.9K | |
| arc-start-center-end-img0002.png | 2021-04-05 22:49 | 2.0K | |
| editing-walls-img0003.png | 2021-04-05 22:49 | 2.0K | |
| arc-start-included-end-img0003.png | 2021-04-05 22:49 | 2.0K | |
| rectangle-img0003.png | 2021-04-05 22:50 | 2.0K | |
| polyline-img0003.png | 2021-04-05 22:50 | 2.0K | |
| fillet-with-variable-radius-img0002.png | 2021-04-05 22:49 | 2.0K | |
| polyline-img0005.png | 2021-04-05 22:50 | 2.0K | |
| exploding-solids-img0005.png | 2021-04-05 22:49 | 2.0K | |
| single-line-img0003.png | 2021-04-05 22:50 | 2.0K | |
| arc-3-points-img0005.png | 2021-04-05 22:49 | 2.0K | |
| changing-rows-and-columns-merging-cells-img0003.png | 2021-04-05 22:49 | 2.0K | |
| circle-3-points-img0003.png | 2021-04-05 22:49 | 2.0K | |
| circle-center-radius-img0001.png | 2021-04-05 22:49 | 2.0K | |
| chamfer-img0009.png | 2021-04-05 22:49 | 2.0K | |
| ellipse-axis-end-img0002.png | 2021-04-05 22:49 | 2.0K | |
| inserting-a-picture-img0002.png | 2021-04-05 22:49 | 2.0K | |
| map-img0004.png | 2021-04-05 22:49 | 2.0K | |
| database-connection-palette-img0015.png | 2021-04-05 22:49 | 2.0K | |
| transforming-img0005.png | 2021-04-05 22:50 | 2.0K | |
| fillet-img0005.png | 2021-04-05 22:49 | 2.0K | |
| zoom-buttons-img0004.png | 2021-04-05 22:50 | 2.0K | |
| zoom-buttons-img0005.png | 2021-04-05 22:50 | 2.0K | |
| ellipse-center-img0002.png | 2021-04-05 22:49 | 2.0K | |
| table-import-xlsx-img0002.png | 2021-04-05 22:50 | 2.0K | |
| constraining-pattern-copied-objects-img0003.png | 2021-04-05 22:49 | 2.1K | |
| transforming-img0004.png | 2021-04-05 22:50 | 2.1K | |
| synchronizing-data-and-graphics-img0004.png | 2021-04-05 22:50 | 2.1K | |
| arc-start-center-length-img0002.png | 2021-04-05 22:49 | 2.1K | |
| ellipse-elliptical-arc-fixed-ratio-img0004.png | 2021-04-05 22:49 | 2.1K | |
| arc-start-included-end-img0004.png | 2021-04-05 22:49 | 2.1K | |
| blocks-img0002.png | 2021-04-05 22:49 | 2.1K | |
| measuring-distance-img0012.png | 2021-04-05 22:49 | 2.1K | |
| circle-tangent-to-arc-or-curve-img0002.png | 2021-04-05 22:49 | 2.1K | |
| surface-and-solid-conversion-operations-img0001.png | 2021-04-05 22:50 | 2.1K | |
| polyline-img0007.png | 2021-04-05 22:50 | 2.1K | |
| zoom-buttons-img0003.png | 2021-04-05 22:50 | 2.1K | |
| auto-dimension-img0002.png | 2021-04-05 22:49 | 2.1K | |
| circular-slot-img0002.png | 2021-04-05 22:49 | 2.1K | |
| constraining-pattern-copied-objects-img0004.png | 2021-04-05 22:49 | 2.1K | |
| transforming-img0003.png | 2021-04-05 22:50 | 2.1K | |
| multi-text-img0001.png | 2021-04-05 22:49 | 2.1K | |
| chamfer-img0013.png | 2021-04-05 22:49 | 2.1K | |
| apparent-intersection-snap-img0002.png | 2021-04-05 22:49 | 2.1K | |
| inspector-bar-img0006.png | 2021-04-05 22:49 | 2.1K | |
| scale-from-two-points-img0002.png | 2021-04-05 22:50 | 2.1K | |
| zoom-buttons-img0001.png | 2021-04-05 22:50 | 2.1K | |
| arc-start-end-included-img00031.png | 2021-04-05 22:49 | 2.1K | |
| lofting-img0006.png | 2021-04-05 22:49 | 2.1K | |
| moving-a-node-img0005.png | 2021-04-05 22:49 | 2.1K | |
| zoom-buttons-img0002.png | 2021-04-05 22:50 | 2.1K | |
| circle-tan-tan-rad-img0001.png | 2021-04-05 22:49 | 2.1K | |
| chamfer-img0017.png | 2021-04-05 22:49 | 2.1K | |
| ellipse-ellipse-standard-img0002.png | 2021-04-05 22:49 | 2.1K | |
| schedule-styles-img0013.png | 2021-04-05 22:50 | 2.1K | |
| redsdk-global-environments-img00111.png | 2021-04-05 22:50 | 2.1K | |
| unwrapping-tc-surface-img0002.png | 2021-04-05 22:50 | 2.1K | |
| circle-2-points-img0001.png | 2021-04-05 22:49 | 2.1K | |
| arc-center-start-angle-img0002.png | 2021-04-05 22:49 | 2.1K | |
| blocks-img0001.png | 2021-04-05 22:49 | 2.1K | |
| multi-text-img0019.png | 2021-04-05 22:49 | 2.1K | |
| convert-to-curve-img0002.png | 2021-04-05 22:49 | 2.1K | |
| circle-center-radius-img0002.png | 2021-04-05 22:49 | 2.1K | |
| auto-dimension-img0001.png | 2021-04-05 22:49 | 2.1K | |
| pick-point-and-hatch-img0001.png | 2021-04-05 22:50 | 2.1K | |
| show-compare-buttons-img0001.png | 2021-04-05 22:50 | 2.1K | |
| multi-text-img0002.png | 2021-04-05 22:49 | 2.2K | |
| layer-management-img0002.png | 2021-04-05 22:49 | 2.2K | |
| chamfer-edges-img0004.png | 2021-04-05 22:49 | 2.2K | |
| arc-3-points-img0004.png | 2021-04-05 22:49 | 2.2K | |
| circle-tan-tan-rad-img0002.png | 2021-04-05 22:49 | 2.2K | |
| database-connection-palette-img0016.png | 2021-04-05 22:49 | 2.2K | |
| chamfer-edges-img0003.png | 2021-04-05 22:49 | 2.2K | |
| changing-room-size-while-inserting-img0001.png | 2021-04-05 22:49 | 2.2K | |
| circle-double-point-img0002.png | 2021-04-05 22:49 | 2.2K | |
| circle-tangent-to-line-img0002.png | 2021-04-05 22:49 | 2.2K | |
| arc-center-start-end-img0001.png | 2021-04-05 22:49 | 2.2K | |
| coordinates-of-a-point-img0002.png | 2021-04-05 22:49 | 2.2K | |
| unbend-sheet-img0002.png | 2021-04-05 22:50 | 2.2K | |
| ellipse-rotated-elliptical-arc-img0002.png | 2021-04-05 22:49 | 2.2K | |
| property-set-definitions-img0010.png | 2021-04-05 22:50 | 2.2K | |
| arc-rotated-elliptical-img0001.png | 2021-04-05 22:49 | 2.2K | |
| inserting-walls-img0003.png | 2021-04-05 22:49 | 2.2K | |
| customize-tool-groups-img0002.png | 2021-04-05 22:49 | 2.2K | |
| arc-start-end-included-img0004.png | 2021-04-05 22:49 | 2.2K | |
| table-import-xlsx-img0003.png | 2021-04-05 22:50 | 2.2K | |
| editing-hatch-patterns-img0003.png | 2021-04-05 22:49 | 2.2K | |
| database-connection-palette-img0002.png | 2021-04-05 22:49 | 2.2K | |
| scale-img0009.png | 2021-04-05 22:50 | 2.2K | |
| lofting-img0005.png | 2021-04-05 22:49 | 2.2K | |
| moving-a-node-img0008.png | 2021-04-05 22:49 | 2.2K | |
| change-chirality-constraint-img0003.png | 2021-04-05 22:49 | 2.2K | |
| redsdk-volumetric-environment-img00051.png | 2021-04-05 22:50 | 2.2K | |
| show-compare-buttons-img0002.png | 2021-04-05 22:50 | 2.2K | |
| editing-circles-ellipses-and-arcs-img0001.png | 2021-04-05 22:49 | 2.2K | |
| properties-window-img00011.png | 2021-04-05 22:50 | 2.2K | |
| change-chirality-constraint-img0005.png | 2021-04-05 22:49 | 2.2K | |
| rail-sweep-img0001.png | 2021-04-05 22:50 | 2.2K | |
| arc-double-point-img00021.png | 2021-04-05 22:49 | 2.2K | |
| hole-img0003.png | 2021-04-05 22:49 | 2.2K | |
| circle-3-points-img0002.png | 2021-04-05 22:49 | 2.2K | |
| arc-elliptical-img0001.png | 2021-04-05 22:49 | 2.2K | |
| unbend-sheet-img0007.png | 2021-04-05 22:50 | 2.2K | |
| coordinate-systems-img0001.png | 2021-04-05 22:49 | 2.2K | |
| arc-elliptical-img0003.png | 2021-04-05 22:49 | 2.2K | |
| arc-3-points-img0007.png | 2021-04-05 22:49 | 2.2K | |
| rotate-img0003.png | 2021-04-05 22:50 | 2.2K | |
| lofting-img0001.png | 2021-04-05 22:49 | 2.2K | |
| arc-rotated-elliptical-img0004.png | 2021-04-05 22:49 | 2.2K | |
| edit-tool-img0002.png | 2021-04-05 22:49 | 2.2K | |
| offset-with-law-img0007.png | 2021-04-05 22:49 | 2.2K | |
| solidify-img0002.png | 2021-04-05 22:50 | 2.2K | |
| perpendicular-constraint-img0006.png | 2021-04-05 22:50 | 2.3K | |
| coordinate-fields-img0001.png | 2021-04-05 22:49 | 2.3K | |
| creating-data-link-templates-img0002.png | 2021-04-05 22:49 | 2.3K | |
| extract-entity-img0008.png | 2021-04-05 22:49 | 2.3K | |
| circle-tangent-to-3-arcs-img0001.png | 2021-04-05 22:49 | 2.3K | |
| tables-img0001.png | 2021-04-05 22:50 | 2.3K | |
| text-img0003.png | 2021-04-05 22:50 | 2.3K | |
| polygon-img0004.png | 2021-04-05 22:50 | 2.3K | |
| moving-smesh-nodes-edges-and-faces-img0002.png | 2021-04-05 22:49 | 2.3K | |
| contact-manager-img0010.png | 2021-04-05 22:49 | 2.3K | |
| circle-2-points-img0002.png | 2021-04-05 22:49 | 2.3K | |
| revolve-img0022.png | 2021-04-05 22:50 | 2.3K | |
| sweep-img0005.png | 2021-04-05 22:50 | 2.3K | |
| imprint-img0002.png | 2021-04-05 22:49 | 2.3K | |
| rectangle-img0002.png | 2021-04-05 22:50 | 2.3K | |
| arc-double-point-img0004.png | 2021-04-05 22:49 | 2.3K | |
| arc-tangent-to-line-img0001.png | 2021-04-05 22:49 | 2.3K | |
| quicktime-movies-img0006.png | 2021-04-05 22:50 | 2.3K | |
| components-of-select-edit-mode-img0001.png | 2021-04-05 22:49 | 2.3K | |
| revolve-img0013.png | 2021-04-05 22:50 | 2.3K | |
| distributing-objects-img0006.png | 2021-04-05 22:49 | 2.3K | |
| starting-turbocad-img0004.png | 2021-04-05 22:50 | 2.3K | |
| 3d-slice-img0018.png | 2021-04-05 22:49 | 2.3K | |
| creating-dimensions-img0011.png | 2021-04-05 22:49 | 2.3K | |
| lofting-img0012.png | 2021-04-05 22:49 | 2.3K | |
| creating-data-link-templates-img0007.png | 2021-04-05 22:49 | 2.3K | |
| zooming-img0001.png | 2021-04-05 22:50 | 2.3K | |
| revolve-img0001.png | 2021-04-05 22:50 | 2.3K | |
| inspector-bar-img0005.png | 2021-04-05 22:49 | 2.4K | |
| circle-concentric-img0001.png | 2021-04-05 22:49 | 2.4K | |
| equal-length-constraint-img0003.png | 2021-04-05 22:49 | 2.4K | |
| revolve-img0010.png | 2021-04-05 22:50 | 2.4K | |
| circle-tangent-to-line-img00021.png | 2021-04-05 22:49 | 2.4K | |
| circle-center-and-point-img0002.png | 2021-04-05 22:49 | 2.4K | |
| chamfer-img0001.png | 2021-04-05 22:49 | 2.4K | |
| constraining-geometry-img0001.png | 2021-04-05 22:49 | 2.4K | |
| inserting-walls-img0006.png | 2021-04-05 22:49 | 2.4K | |
| arc-start-end-radius-img0002.png | 2021-04-05 22:49 | 2.4K | |
| shrink-extend-line-img0003.png | 2021-04-05 22:50 | 2.4K | |
| ellipse-rotated-elliptical-arc-img0003.png | 2021-04-05 22:49 | 2.4K | |
| fillet-img0006.png | 2021-04-05 22:49 | 2.4K | |
| scaling-objects-in-select-edit-img0006.png | 2021-04-05 22:50 | 2.4K | |
| drawing-markers-img0001.png | 2021-04-05 22:49 | 2.4K | |
| distributing-objects-img0005.png | 2021-04-05 22:49 | 2.4K | |
| quick-dimensions-img0002.png | 2021-04-05 22:50 | 2.4K | |
| editing-multi-text-img0001.png | 2021-04-05 22:49 | 2.4K | |
| convert-to-curve-img0007.png | 2021-04-05 22:49 | 2.4K | |
| revolve-img0023.png | 2021-04-05 22:50 | 2.4K | |
| using-the-advanced-render-styles-palette-img0006.png | 2021-04-05 22:50 | 2.4K | |
| using-the-environments-palette-img0006.png | 2021-04-05 22:50 | 2.4K | |
| inspector-bar-img0001.png | 2021-04-05 22:49 | 2.4K | |
| auto-dimension-img0004.png | 2021-04-05 22:49 | 2.4K | |
| other-cad-formats-img00181.png | 2021-04-05 22:49 | 2.4K | |
| points-coincident-constraint-img0001.png | 2021-04-05 22:50 | 2.4K | |
| inserting-walls-img0005.png | 2021-04-05 22:49 | 2.4K | |
| unfold-face-img0005.png | 2021-04-05 22:50 | 2.4K | |
| comparing-drawings-img0001.png | 2021-04-05 22:49 | 2.4K | |
| holdline-blend-img0004.png | 2021-04-05 22:49 | 2.4K | |
| other-cad-formats-img00041.png | 2021-04-05 22:49 | 2.4K | |
| property-set-definitions-img0008.png | 2021-04-05 22:50 | 2.4K | |
| generic-img0004.png | 2021-04-05 22:49 | 2.4K | |
| generic-img0002.png | 2021-04-05 22:49 | 2.4K | |
| using-the-advanced-render-styles-palette-img0004.png | 2021-04-05 22:50 | 2.4K | |
| using-the-environments-palette-img0004.png | 2021-04-05 22:50 | 2.4K | |
| using-the-advanced-render-styles-palette-img0003.png | 2021-04-05 22:50 | 2.4K | |
| generic-img0003.png | 2021-04-05 22:49 | 2.4K | |
| 2d-add-img0003.png | 2021-04-05 22:49 | 2.4K | |
| database-connection-palette-img0017.png | 2021-04-05 22:49 | 2.4K | |
| smesh-crease-img0004.png | 2021-04-05 22:50 | 2.4K | |
| thread-3d-img0002.png | 2021-04-05 22:50 | 2.4K | |
| circle-triple-point-img0002.png | 2021-04-05 22:49 | 2.4K | |
| dimension-properties-img0006.png | 2021-04-05 22:49 | 2.4K | |
| creating-data-link-templates-img0006.png | 2021-04-05 22:49 | 2.4K | |
| using-the-luminances-palette-img0007.png | 2021-04-05 22:50 | 2.4K | |
| using-the-materials-palette-img0008.png | 2021-04-05 22:50 | 2.4K | |
| locking-coordinates-img0001.png | 2021-04-05 22:49 | 2.4K | |
| editing-splines-and-bezier-curves-img0001.png | 2021-04-05 22:49 | 2.4K | |
| camera-objects-img0002.png | 2021-04-05 22:49 | 2.4K | |
| sheet-metal-gusset-img0009.png | 2021-04-05 22:50 | 2.4K | |
| connect-constraint-img0003.png | 2021-04-05 22:49 | 2.5K | |
| split-img0003.png | 2021-04-05 22:50 | 2.5K | |
| edit-slope-angle-img0003.png | 2021-04-05 22:49 | 2.5K | |
| dimension-properties-img0004.png | 2021-04-05 22:49 | 2.5K | |
| brush-styles-img0009.png | 2021-04-05 22:49 | 2.5K | |
| dimension-properties-img0007.png | 2021-04-05 22:49 | 2.5K | |
| schedule-styles-img0017.png | 2021-04-05 22:50 | 2.5K | |
| tc-explorer-toolbar-img0002.png | 2021-04-05 22:50 | 2.5K | |
| using-the-luminances-palette-img0003.png | 2021-04-05 22:50 | 2.5K | |
| using-the-luminances-palette-img0005.png | 2021-04-05 22:50 | 2.5K | |
| using-the-materials-palette-img0003.png | 2021-04-05 22:50 | 2.5K | |
| using-the-materials-palette-img0006.png | 2021-04-05 22:50 | 2.5K | |
| using-the-luminances-palette-img0004.png | 2021-04-05 22:50 | 2.5K | |
| using-the-materials-palette-img0005.png | 2021-04-05 22:50 | 2.5K | |
| hatch-pattern-creator-img0004.png | 2021-04-05 22:49 | 2.5K | |
| u-shaped-stair-img0002.png | 2021-04-05 22:50 | 2.5K | |
| circle-tangent-to-3-arcs-img0002.png | 2021-04-05 22:49 | 2.5K | |
| database-connection-palette-img0009.png | 2021-04-05 22:49 | 2.5K | |
| text-along-curve-img0002.png | 2021-04-05 22:50 | 2.5K | |
| revolve-img0024.png | 2021-04-05 22:50 | 2.5K | |
| sheet-metal-gusset-img0003.png | 2021-04-05 22:50 | 2.5K | |
| roof-slabs-and-converting-to-roof-slabs-img0002.png | 2021-04-05 22:50 | 2.5K | |
| circle-tan-tan-tan-img0001.png | 2021-04-05 22:49 | 2.5K | |
| center-line-img0001.png | 2021-04-05 22:49 | 2.5K | |
| walk-through-tools-img0001.png | 2021-04-05 22:50 | 2.5K | |
| inserting-walls-img0004.png | 2021-04-05 22:49 | 2.5K | |
| nudge-img0001.png | 2021-04-05 22:49 | 2.5K | |
| database-connection-palette-img0020.png | 2021-04-05 22:49 | 2.5K | |
| pulling-curved-faces-img0014.png | 2021-04-05 22:50 | 2.5K | |
| database-connection-palette-img0018.png | 2021-04-05 22:49 | 2.5K | |
| editing-splines-and-bezier-curves-img0002.png | 2021-04-05 22:49 | 2.5K | |
| multi-landing-stair-img0011.png | 2021-04-05 22:49 | 2.6K | |
| tc-explorer-toolbar-img0003.png | 2021-04-05 22:50 | 2.6K | |
| extract-entity-img0011.png | 2021-04-05 22:49 | 2.6K | |
| transform-recorder-img0009.png | 2021-04-05 22:50 | 2.6K | |
| protractor-img0003.png | 2021-04-05 22:50 | 2.6K | |
| camera-movements-img0001.png | 2021-04-05 22:49 | 2.6K | |
| offset-img0009.png | 2021-04-05 22:49 | 2.6K | |
| arc-center-start-angle-img0001.png | 2021-04-05 22:49 | 2.6K | |
| convert-to-curve-img0004.png | 2021-04-05 22:49 | 2.6K | |
| slot-img0002.png | 2021-04-05 22:50 | 2.6K | |
| using-the-lte-command-line-img0019.png | 2021-04-05 22:50 | 2.6K | |
| arc-elliptical-img00021.png | 2021-04-05 22:49 | 2.6K | |
| center-line-img0003.png | 2021-04-05 22:49 | 2.6K | |
| facet-offset-img0003.png | 2021-04-05 22:49 | 2.6K | |
| circle-center-radius-img0003.png | 2021-04-05 22:49 | 2.6K | |
| arc-tangent-to-arc-img0001.png | 2021-04-05 22:49 | 2.6K | |
| arc-rotated-elliptical-img0005.png | 2021-04-05 22:49 | 2.6K | |
| trim-img0013.png | 2021-04-05 22:50 | 2.6K | |
| other-cad-formats-img00261.png | 2021-04-05 22:49 | 2.6K | |
| arc-elliptical-img0004.png | 2021-04-05 22:49 | 2.6K | |
| arc-rotated-elliptical-img00021.png | 2021-04-05 22:49 | 2.6K | |
| circle-tangent-to-arc-img0002.png | 2021-04-05 22:49 | 2.6K | |
| distributing-objects-img0001.png | 2021-04-05 22:49 | 2.6K | |
| arc-double-point-img0005.png | 2021-04-05 22:49 | 2.6K | |
| slab-styles-img0003.png | 2021-04-05 22:50 | 2.6K | |
| customize-toolbars-img0002.png | 2021-04-05 22:49 | 2.6K | |
| redsdk-global-environments-img00061.png | 2021-04-05 22:50 | 2.6K | |
| ellipse-fixed-ratio-img0003.png | 2021-04-05 22:49 | 2.6K | |
| creating-dimensions-img0032.png | 2021-04-05 22:49 | 2.6K | |
| creating-lights-light-types-img0001.png | 2021-04-05 22:49 | 2.6K | |
| deform-to-point-img0005.png | 2021-04-05 22:49 | 2.7K | |
| other-cad-formats-img00161.png | 2021-04-05 22:49 | 2.7K | |
| toolbars-img0002.png | 2021-04-05 22:50 | 2.7K | |
| editing-circles-ellipses-and-arcs-img0005.png | 2021-04-05 22:49 | 2.7K | |
| revolve-img0016.png | 2021-04-05 22:50 | 2.7K | |
| arc-tangent-to-2-entities-img0001.png | 2021-04-05 22:49 | 2.7K | |
| ellipse-fixed-ratio-img0001.png | 2021-04-05 22:49 | 2.7K | |
| tc-explorer-toolbar-img0005.png | 2021-04-05 22:50 | 2.7K | |
| curves-img0001.png | 2021-04-05 22:49 | 2.7K | |
| editing-multiple-nodes-img0001.png | 2021-04-05 22:49 | 2.7K | |
| sheet-metal-gusset-img0005.png | 2021-04-05 22:50 | 2.7K | |
| transforming-img0001.png | 2021-04-05 22:50 | 2.7K | |
| tc-explorer-toolbar-img0006.png | 2021-04-05 22:50 | 2.7K | |
| node-editing-roof-slabs-img0011.png | 2021-04-05 22:49 | 2.7K | |
| arc-tangent-to-line-img00021.png | 2021-04-05 22:49 | 2.7K | |
| sheet-metal-gusset-img0002.png | 2021-04-05 22:50 | 2.7K | |
| projection-snap-img0002.png | 2021-04-05 22:50 | 2.7K | |
| shrink-extend-line-img0002.png | 2021-04-05 22:50 | 2.7K | |
| brush-styles-img0004.png | 2021-04-05 22:49 | 2.7K | |
| auto-constraint-img0001.png | 2021-04-05 22:49 | 2.7K | |
| deform-to-point-img0007.png | 2021-04-05 22:49 | 2.7K | |
| tc-explorer-toolbar-img0004.png | 2021-04-05 22:50 | 2.7K | |
| object-properties-img0001.png | 2021-04-05 22:49 | 2.7K | |
| using-the-lte-command-line-img0013.png | 2021-04-05 22:50 | 2.7K | |
| roof-slabs-and-converting-to-roof-slabs-img0006.png | 2021-04-05 22:50 | 2.7K | |
| arc-elliptical-img0002.png | 2021-04-05 22:49 | 2.7K | |
| dimension-properties-img0005.png | 2021-04-05 22:49 | 2.7K | |
| split-img0008.png | 2021-04-05 22:50 | 2.7K | |
| line-styles-img0002.png | 2021-04-05 22:49 | 2.7K | |
| convert-to-curve-img0003.png | 2021-04-05 22:49 | 2.7K | |
| ellipse-img0002.png | 2021-04-05 22:49 | 2.8K | |
| other-controls-img0003.png | 2021-04-05 22:50 | 2.8K | |
| chain-polyline-img0002.png | 2021-04-05 22:49 | 2.8K | |
| arc-rotated-elliptical-img0002.png | 2021-04-05 22:49 | 2.8K | |
| creating-a-group-img0003.png | 2021-04-05 22:49 | 2.8K | |
| creating-dimensions-img0001.png | 2021-04-05 22:49 | 2.8K | |
| ifc-import-img0006.png | 2021-04-05 22:49 | 2.8K | |
| surface-from-laws-img0006.png | 2021-04-05 22:50 | 2.8K | |
| warp-by-law-img0007.png | 2021-04-05 22:50 | 2.8K | |
| design-director-graphics-img0001.png | 2021-04-05 22:49 | 2.8K | |
| redsdk-global-environments-img00071.png | 2021-04-05 22:50 | 2.8K | |
| other-cad-formats-img00061.png | 2021-04-05 22:49 | 2.8K | |
| converting-solid-to-smesh-img0001.png | 2021-04-05 22:49 | 2.8K | |
| converting-solid-to-smesh-img0003.png | 2021-04-05 22:49 | 2.8K | |
| insert-opening-img0001.png | 2021-04-05 22:49 | 2.8K | |
| editing-a-block-img0006.png | 2021-04-05 22:49 | 2.8K | |
| select-by-query-img0013.png | 2021-04-05 22:50 | 2.8K | |
| extract-entity-img0014.png | 2021-04-05 22:49 | 2.8K | |
| dimension-properties-img0003.png | 2021-04-05 22:49 | 2.8K | |
| graphic-along-path-img0001.png | 2021-04-05 22:49 | 2.8K | |
| profile-along-path-img0001.png | 2021-04-05 22:50 | 2.8K | |
| circle-double-point-img0003.png | 2021-04-05 22:49 | 2.8K | |
| revolve-img0017.png | 2021-04-05 22:50 | 2.8K | |
| ellipse-elliptical-arc-fixed-ratio-img0002.png | 2021-04-05 22:49 | 2.8K | |
| table-import-xlsx-img0005.png | 2021-04-05 22:50 | 2.8K | |
| 2d-geometric-parameters-img0001.png | 2021-04-05 22:49 | 2.8K | |
| using-the-lte-command-line-img0015.png | 2021-04-05 22:50 | 2.9K | |
| assemble-by-axis-img0015.png | 2021-04-05 22:49 | 2.9K | |
| bend-by-sketch-img0006.png | 2021-04-05 22:49 | 2.9K | |
| ellipse-elliptical-arc-fixed-ratio-img0001.png | 2021-04-05 22:49 | 2.9K | |
| ellipse-elliptical-arc-fixed-ratio-img0003.png | 2021-04-05 22:49 | 2.9K | |
| select-by-query-img0002.png | 2021-04-05 22:50 | 2.9K | |
| creating-data-link-templates-img0005.png | 2021-04-05 22:49 | 2.9K | |
| sheet-metal-gusset-img0012.png | 2021-04-05 22:50 | 2.9K | |
| meet-2-lines-img0003.png | 2021-04-05 22:49 | 2.9K | |
| multi-text-img0018.png | 2021-04-05 22:49 | 2.9K | |
| coordinate-fields-img0003.png | 2021-04-05 22:49 | 2.9K | |
| sweep-img0001.png | 2021-04-05 22:50 | 2.9K | |
| meet-2-lines-img0002.png | 2021-04-05 22:49 | 2.9K | |
| other-cad-formats-img00311.png | 2021-04-05 22:49 | 2.9K | |
| editing-linear-objects-img0006.png | 2021-04-05 22:49 | 2.9K | |
| editing-segments-img0001.png | 2021-04-05 22:49 | 2.9K | |
| other-cad-formats-img00201.png | 2021-04-05 22:49 | 2.9K | |
| coordinate-fields-img0002.png | 2021-04-05 22:49 | 2.9K | |
| inspector-bar-img0004.png | 2021-04-05 22:49 | 2.9K | |
| pressure-load-img0002.png | 2021-04-05 22:50 | 2.9K | |
| extract-entity-img0019.png | 2021-04-05 22:49 | 2.9K | |
| converting-solid-to-smesh-img0004.png | 2021-04-05 22:49 | 2.9K | |
| inspector-bar-img0003.png | 2021-04-05 22:49 | 2.9K | |
| geomarks-and-tap-files-img0001.png | 2021-04-05 22:49 | 2.9K | |
| creating-dimensions-img0033.png | 2021-04-05 22:49 | 2.9K | |
| profile-editing-img0009.png | 2021-04-05 22:50 | 2.9K | |
| editing-circles-ellipses-and-arcs-img0003.png | 2021-04-05 22:49 | 2.9K | |
| selection-info-palette-img0030.png | 2021-04-05 22:50 | 2.9K | |
| 2d-subtract-img0004.png | 2021-04-05 22:49 | 2.9K | |
| surface-roughness-img0003.png | 2021-04-05 22:50 | 2.9K | |
| inspector-bar-img0002.png | 2021-04-05 22:49 | 2.9K | |
| settings-img0001.png | 2021-04-05 22:50 | 2.9K | |
| unbend-sheet-img0018.png | 2021-04-05 22:50 | 3.0K | |
| dimension-styles-img0003.png | 2021-04-05 22:49 | 3.0K | |
| creating-a-parametric-part-img0031.png | 2021-04-05 22:49 | 3.0K | |
| arc-complement-img0003.png | 2021-04-05 22:49 | 3.0K | |
| arc-tangent-to-line-img0002.png | 2021-04-05 22:49 | 3.0K | |
| redsdk-img00051.png | 2021-04-05 22:50 | 3.0K | |
| rotated-ellipse-img0002.png | 2021-04-05 22:50 | 3.0K | |
| creating-dimensions-img0034.png | 2021-04-05 22:49 | 3.0K | |
| polyline-img0019.png | 2021-04-05 22:50 | 3.0K | |
| change-chirality-constraint-img0001.png | 2021-04-05 22:49 | 3.0K | |
| creating-construction-geometry-img0028.png | 2021-04-05 22:49 | 3.0K | |
| irregular-polygon-img0006.png | 2021-04-05 22:49 | 3.0K | |
| double-line-single-line-img0002.png | 2021-04-05 22:49 | 3.0K | |
| circle-tan-tan-rad-img0003.png | 2021-04-05 22:49 | 3.0K | |
| arc-concentric-img0002.png | 2021-04-05 22:49 | 3.0K | |
| copying-objects-in-select-edit-img0011.png | 2021-04-05 22:49 | 3.0K | |
| imprint-with-chamfer-or-fillet-img0004.png | 2021-04-05 22:49 | 3.0K | |
| circle-center-and-point-img0003.png | 2021-04-05 22:49 | 3.0K | |
| fix-geometry-constraint-img0007.png | 2021-04-05 22:49 | 3.0K | |
| ellipse-fixed-ratio-img0002.png | 2021-04-05 22:49 | 3.0K | |
| other-cad-formats-img00081.png | 2021-04-05 22:49 | 3.0K | |
| revolve-img0018.png | 2021-04-05 22:50 | 3.0K | |
| facet-offset-img0006.png | 2021-04-05 22:49 | 3.1K | |
| arc-tangent-to-line-img0005.png | 2021-04-05 22:49 | 3.1K | |
| schedule-styles-img0019.png | 2021-04-05 22:50 | 3.1K | |
| image-manager-palette-img0004.png | 2021-04-05 22:49 | 3.1K | |
| line-length-img0002.png | 2021-04-05 22:49 | 3.1K | |
| creating-dimensions-img0038.png | 2021-04-05 22:49 | 3.1K | |
| event-viewer-img0003.png | 2021-04-05 22:49 | 3.1K | |
| roof-wall-modifier-img0001.png | 2021-04-05 22:50 | 3.1K | |
| double-line-img0001.png | 2021-04-05 22:49 | 3.1K | |
| arc-tangent-to-line-img0003.png | 2021-04-05 22:49 | 3.1K | |
| creating-dimensions-img0008.png | 2021-04-05 22:49 | 3.1K | |
| arc-rotated-elliptical-img0003.png | 2021-04-05 22:49 | 3.1K | |
| standard-views-img0002.png | 2021-04-05 22:50 | 3.1K | |
| design-director-categories-img0001.png | 2021-04-05 22:49 | 3.1K | |
| connect-constraint-img0001.png | 2021-04-05 22:49 | 3.1K | |
| unbend-sheet-img0015.png | 2021-04-05 22:50 | 3.1K | |
| creating-dimensions-img0013.png | 2021-04-05 22:49 | 3.1K | |
| creating-a-parametric-part-img0030.png | 2021-04-05 22:49 | 3.1K | |
| arc-tangent-to-arc-img00021.png | 2021-04-05 22:49 | 3.1K | |
| circle-concentric-img0002.png | 2021-04-05 22:49 | 3.1K | |
| drafting-palette-toolbar-img0003.png | 2021-04-05 22:49 | 3.1K | |
| auto-constraint-img0004.png | 2021-04-05 22:49 | 3.1K | |
| arc-tangent-to-2-entities-img0004.png | 2021-04-05 22:49 | 3.1K | |
| other-cad-formats-img00241.png | 2021-04-05 22:49 | 3.1K | |
| rail-sweep-img0005.png | 2021-04-05 22:50 | 3.1K | |
| associative-dimensions-img0002.png | 2021-04-05 22:49 | 3.1K | |
| other-cad-formats-img00271.png | 2021-04-05 22:49 | 3.1K | |
| editing-a-group-img0004.png | 2021-04-05 22:49 | 3.1K | |
| select-by-query-img0012.png | 2021-04-05 22:50 | 3.1K | |
| shrink-extend-line-img0004.png | 2021-04-05 22:50 | 3.1K | |
| trim-by-entity-img0003.png | 2021-04-05 22:50 | 3.1K | |
| customize-toolbars-img0003.png | 2021-04-05 22:49 | 3.1K | |
| table-import-xlsx-img0006.png | 2021-04-05 22:50 | 3.1K | |
| select-by-query-img0008.png | 2021-04-05 22:50 | 3.1K | |
| creating-dimensions-img0022.png | 2021-04-05 22:49 | 3.1K | |
| gear-contour-img0005.png | 2021-04-05 22:49 | 3.1K | |
| center-mark-img0002.png | 2021-04-05 22:49 | 3.1K | |
| arc-center-and-radius-img0004.png | 2021-04-05 22:49 | 3.2K | |
| multi-line-img0001.png | 2021-04-05 22:49 | 3.2K | |
| multi-landing-stair-img0003.png | 2021-04-05 22:49 | 3.2K | |
| using-the-materials-palette-img0004.png | 2021-04-05 22:50 | 3.2K | |
| creating-dimensions-img0006.png | 2021-04-05 22:49 | 3.2K | |
| ellipse-fixed-ratio-img00021.png | 2021-04-05 22:49 | 3.2K | |
| other-cad-formats-img00251.png | 2021-04-05 22:49 | 3.2K | |
| stellated-polygon-img0005.png | 2021-04-05 22:50 | 3.2K | |
| inserting-an-underlay-in-a-drawing-img0001.png | 2021-04-05 22:49 | 3.2K | |
| other-cad-formats-img00231.png | 2021-04-05 22:49 | 3.2K | |
| revision-cloud-img0002.png | 2021-04-05 22:50 | 3.2K | |
| 2d-3d-selector-img0001.png | 2021-04-05 22:49 | 3.2K | |
| arc-elliptical-img00031.png | 2021-04-05 22:49 | 3.2K | |
| other-cad-formats-img00141.png | 2021-04-05 22:49 | 3.2K | |
| stellated-polygon-img0007.png | 2021-04-05 22:50 | 3.2K | |
| shrink-extend-line-img0005.png | 2021-04-05 22:50 | 3.2K | |
| using-the-lte-command-line-img0011.png | 2021-04-05 22:50 | 3.2K | |
| unbend-sheet-img0017.png | 2021-04-05 22:50 | 3.2K | |
| editing-3d-objects-using-selection-info-img0005.png | 2021-04-05 22:49 | 3.2K | |
| bend-by-sketch-img0001.png | 2021-04-05 22:49 | 3.2K | |
| associative-hatching-img0003.png | 2021-04-05 22:49 | 3.2K | |
| loading-an-individual-symbol-into-the-library-img0001.png | 2021-04-05 22:49 | 3.3K | |
| selection-info-palette-img0001.png | 2021-04-05 22:50 | 3.3K | |
| imprint-img0013.png | 2021-04-05 22:49 | 3.3K | |
| smesh-symmetry-tools-img0001.png | 2021-04-05 22:50 | 3.3K | |
| smart-dimensions-img0002.png | 2021-04-05 22:50 | 3.3K | |
| revolve-img0002.png | 2021-04-05 22:50 | 3.3K | |
| split-face-by-isoline-img0001.png | 2021-04-05 22:50 | 3.3K | |
| show-compare-buttons-img0004.png | 2021-04-05 22:50 | 3.3K | |
| arc-double-point-img0002.png | 2021-04-05 22:49 | 3.3K | |
| arc-concentric-img0001.png | 2021-04-05 22:49 | 3.3K | |
| moving-objects-in-select-edit-img0003.png | 2021-04-05 22:49 | 3.3K | |
| thick-profile-img0001.png | 2021-04-05 22:50 | 3.3K | |
| imprint-img0019.png | 2021-04-05 22:49 | 3.3K | |
| multi-landing-stair-img0012.png | 2021-04-05 22:49 | 3.3K | |
| drawing-markers-img0002.png | 2021-04-05 22:49 | 3.3K | |
| the-style-manager-palette-img0001.png | 2021-04-05 22:50 | 3.3K | |
| 3d-spline-by-control-points-img0001.png | 2021-04-05 22:49 | 3.3K | |
| offset-img0008.png | 2021-04-05 22:49 | 3.3K | |
| imprint-img0010.png | 2021-04-05 22:49 | 3.3K | |
| arc-tangent-to-2-entities-img00021.png | 2021-04-05 22:49 | 3.3K | |
| point-img0001.png | 2021-04-05 22:50 | 3.3K | |
| quick-dimensions-img0004.png | 2021-04-05 22:50 | 3.3K | |
| selection-info-palette-img0027.png | 2021-04-05 22:50 | 3.3K | |
| measuring-img0001.png | 2021-04-05 22:49 | 3.3K | |
| coincident-constraint-img0003.png | 2021-04-05 22:49 | 3.3K | |
| creating-dimensions-img0007.png | 2021-04-05 22:49 | 3.3K | |
| purge-img0002.png | 2021-04-05 22:50 | 3.3K | |
| arc-double-point-img0003.png | 2021-04-05 22:49 | 3.3K | |
| vector-copy-img0004.png | 2021-04-05 22:50 | 3.3K | |
| copying-objects-img0001.png | 2021-04-05 22:49 | 3.3K | |
| creating-dimensions-img0003.png | 2021-04-05 22:49 | 3.3K | |
| graphic-along-path-img0002.png | 2021-04-05 22:49 | 3.3K | |
| profile-along-path-img0002.png | 2021-04-05 22:50 | 3.3K | |
| coincident-constraint-img0005.png | 2021-04-05 22:49 | 3.3K | |
| editing-splines-and-bezier-curves-img0003.png | 2021-04-05 22:49 | 3.3K | |
| 2d-3d-selector-img0002.png | 2021-04-05 22:49 | 3.3K | |
| using-lte-dynamic-input-img0002.png | 2021-04-05 22:50 | 3.3K | |
| opposite-mirror-point-snap-img0002.png | 2021-04-05 22:49 | 3.3K | |
| fillet-img0004.png | 2021-04-05 22:49 | 3.3K | |
| line-length-img0004.png | 2021-04-05 22:49 | 3.3K | |
| arc-center-and-radius-img0002.png | 2021-04-05 22:49 | 3.4K | |
| sheet-metal-gusset-img0008.png | 2021-04-05 22:50 | 3.4K | |
| multi-view-blocks-img0006.png | 2021-04-05 22:49 | 3.4K | |
| fix-geometry-constraint-img0006.png | 2021-04-05 22:49 | 3.4K | |
| offset-img0004.png | 2021-04-05 22:49 | 3.4K | |
| editing-circles-ellipses-and-arcs-img0007.png | 2021-04-05 22:49 | 3.4K | |
| editing-linear-objects-img0007.png | 2021-04-05 22:49 | 3.4K | |
| auto-constraint-img0002.png | 2021-04-05 22:49 | 3.4K | |
| image-manager-palette-img0005.png | 2021-04-05 22:49 | 3.4K | |
| creating-an-underlay-style-img0001.png | 2021-04-05 22:49 | 3.4K | |
| divide-point-snap-img0004.png | 2021-04-05 22:49 | 3.4K | |
| arc-concentric-img0003.png | 2021-04-05 22:49 | 3.4K | |
| displaying-the-workplane-img0002.png | 2021-04-05 22:49 | 3.4K | |
| extended-ortho-snap-img0002.png | 2021-04-05 22:49 | 3.4K | |
| workplanes-img0006.png | 2021-04-05 22:50 | 3.4K | |
| chamfer-img0004.png | 2021-04-05 22:49 | 3.4K | |
| auto-constraint-img0003.png | 2021-04-05 22:49 | 3.4K | |
| copying-objects-in-select-edit-img0019.png | 2021-04-05 22:49 | 3.4K | |
| fix-geometry-constraint-img0005.png | 2021-04-05 22:49 | 3.4K | |
| dimension-properties-img0012.png | 2021-04-05 22:49 | 3.4K | |
| revolve-img0011.png | 2021-04-05 22:50 | 3.4K | |
| other-cad-formats-img00021.png | 2021-04-05 22:49 | 3.4K | |
| rail-sweep-img0007.png | 2021-04-05 22:50 | 3.4K | |
| connect-constraint-img0002.png | 2021-04-05 22:49 | 3.4K | |
| roof-slabs-and-converting-to-roof-slabs-img0003.png | 2021-04-05 22:50 | 3.4K | |
| associative-dimensions-img0001.png | 2021-04-05 22:49 | 3.4K | |
| select-by-layer-img0001.png | 2021-04-05 22:50 | 3.4K | |
| quick-dimensions-img0003.png | 2021-04-05 22:50 | 3.4K | |
| bisector-img0002.png | 2021-04-05 22:49 | 3.5K | |
| 2d-3d-selector-img0014.png | 2021-04-05 22:49 | 3.5K | |
| tangent-constraint-img0004.png | 2021-04-05 22:50 | 3.5K | |
| arc-rotated-elliptical-img00031.png | 2021-04-05 22:49 | 3.5K | |
| arc-tangent-to-arc-img0005.png | 2021-04-05 22:49 | 3.5K | |
| house-wizard-toolset-img0002.png | 2021-04-05 22:49 | 3.5K | |
| trim-img0012.png | 2021-04-05 22:50 | 3.5K | |
| parallel-img0004.png | 2021-04-05 22:50 | 3.5K | |
| 2d-3d-selector-img0015.png | 2021-04-05 22:49 | 3.5K | |
| dimension-properties-img0013.png | 2021-04-05 22:49 | 3.5K | |
| colors-and-brushes-img0002.png | 2021-04-05 22:49 | 3.5K | |
| extract-entity-img0020.png | 2021-04-05 22:49 | 3.5K | |
| editing-a-group-img0002.png | 2021-04-05 22:49 | 3.5K | |
| arc-tangent-to-line-img0004.png | 2021-04-05 22:49 | 3.5K | |
| circle-tangent-to-3-arcs-img0003.png | 2021-04-05 22:49 | 3.5K | |
| auto-constraint-img0006.png | 2021-04-05 22:49 | 3.5K | |
| brush-styles-img0001.png | 2021-04-05 22:49 | 3.5K | |
| circle-tangent-to-line-img0004.png | 2021-04-05 22:49 | 3.6K | |
| circle-tangent-to-line-img00031.png | 2021-04-05 22:49 | 3.6K | |
| sweep-img0009.png | 2021-04-05 22:50 | 3.6K | |
| smart-dimensions-img0007.png | 2021-04-05 22:50 | 3.6K | |
| aligning-objects-img0001.png | 2021-04-05 22:49 | 3.6K | |
| circle-triple-point-img0004.png | 2021-04-05 22:49 | 3.6K | |
| hyperlinks-img0004.png | 2021-04-05 22:49 | 3.6K | |
| absolute-coordinates-img0002.png | 2021-04-05 22:49 | 3.6K | |
| components-of-select-edit-mode-img0009.png | 2021-04-05 22:49 | 3.6K | |
| connect-constraint-img0004.png | 2021-04-05 22:49 | 3.6K | |
| dimension-properties-img0014.png | 2021-04-05 22:49 | 3.6K | |
| pulling-curved-faces-img0003.png | 2021-04-05 22:50 | 3.6K | |
| move-text-for-dimensions-img0002.png | 2021-04-05 22:49 | 3.6K | |
| move-text-for-dimensions-img0003.png | 2021-04-05 22:49 | 3.6K | |
| curve-from-law-img0011.png | 2021-04-05 22:49 | 3.6K | |
| multi-landing-stair-img0006.png | 2021-04-05 22:49 | 3.6K | |
| text-properties-img0002.png | 2021-04-05 22:50 | 3.6K | |
| copying-objects-in-select-edit-img0015.png | 2021-04-05 22:49 | 3.6K | |
| copying-objects-in-select-edit-img0007.png | 2021-04-05 22:49 | 3.6K | |
| line-styles-img0004.png | 2021-04-05 22:49 | 3.6K | |
| center-line-img0004.png | 2021-04-05 22:49 | 3.6K | |
| profile-styles-img0009.png | 2021-04-05 22:50 | 3.6K | |
| profile-styles-img0007.png | 2021-04-05 22:50 | 3.6K | |
| split-face-by-isoline-img0003.png | 2021-04-05 22:50 | 3.6K | |
| arc-concentric-img00031.png | 2021-04-05 22:49 | 3.6K | |
| 2d-intersect-img0002.png | 2021-04-05 22:49 | 3.6K | |
| split-img0009.png | 2021-04-05 22:50 | 3.6K | |
| redsdk-materials-examples-img00031.png | 2021-04-05 22:50 | 3.6K | |
| editing-circles-ellipses-and-arcs-img0009.png | 2021-04-05 22:49 | 3.6K | |
| splines-and-bezier-curves-img0004.png | 2021-04-05 22:50 | 3.6K | |
| creating-dimensions-img0037.png | 2021-04-05 22:49 | 3.6K | |
| colors-and-brushes-img0008.png | 2021-04-05 22:49 | 3.6K | |
| text-img0002.png | 2021-04-05 22:50 | 3.7K | |
| inserting-walls-img0011.png | 2021-04-05 22:49 | 3.7K | |
| arc-rotated-elliptical-img00041.png | 2021-04-05 22:49 | 3.7K | |
| components-of-select-edit-mode-img0013.png | 2021-04-05 22:49 | 3.7K | |
| rotated-rectangle-img0002.png | 2021-04-05 22:50 | 3.7K | |
| scaling-objects-in-select-edit-img0002.png | 2021-04-05 22:50 | 3.7K | |
| 2d-boolean-operations-img0001.png | 2021-04-05 22:49 | 3.7K | |
| 3d-boolean-operations-img0001.png | 2021-04-05 22:49 | 3.7K | |
| constraining-geometry-img0005.png | 2021-04-05 22:49 | 3.7K | |
| unbend-sheet-img0014.png | 2021-04-05 22:50 | 3.7K | |
| circle-triple-point-img0003.png | 2021-04-05 22:49 | 3.7K | |
| circle-concentric-img00021.png | 2021-04-05 22:49 | 3.7K | |
| render-manager-img0011.png | 2021-04-05 22:50 | 3.7K | |
| arc-center-and-radius-img0003.png | 2021-04-05 22:49 | 3.7K | |
| parallel-img0002.png | 2021-04-05 22:50 | 3.7K | |
| distributing-objects-img0003.png | 2021-04-05 22:49 | 3.7K | |
| join-polyline-img0003.png | 2021-04-05 22:49 | 3.7K | |
| internet-palette-img0001.png | 2021-04-05 22:49 | 3.7K | |
| copying-objects-in-select-edit-img0002.png | 2021-04-05 22:49 | 3.7K | |
| refining-img0001.png | 2021-04-05 22:50 | 3.7K | |
| along-facet-normal-img0001.png | 2021-04-05 22:49 | 3.7K | |
| extruding-smesh-faces-img0004.png | 2021-04-05 22:49 | 3.7K | |
| brush-styles-img0003.png | 2021-04-05 22:49 | 3.7K | |
| smesh-merging-img0001.png | 2021-04-05 22:50 | 3.7K | |
| components-of-select-edit-mode-img0005.png | 2021-04-05 22:49 | 3.7K | |
| stair-by-linework-img0005.png | 2021-04-05 22:50 | 3.7K | |
| stellated-polygon-img0004.png | 2021-04-05 22:50 | 3.7K | |
| object-trim-img0014.png | 2021-04-05 22:49 | 3.7K | |
| split-img0020.png | 2021-04-05 22:50 | 3.7K | |
| arc-tangent-to-2-entities-img0008.png | 2021-04-05 22:49 | 3.7K | |
| room-box-properties-img0002.png | 2021-04-05 22:50 | 3.7K | |
| equal-length-constraint-img0004.png | 2021-04-05 22:49 | 3.7K | |
| saving-views-1-2018-04-17.png | 2021-04-05 22:50 | 3.7K | |
| property-set-definitions-img0005.png | 2021-04-05 22:50 | 3.7K | |
| perpendicular-img0002.png | 2021-04-05 22:50 | 3.7K | |
| arc-tangent-to-2-entities-img00061.png | 2021-04-05 22:49 | 3.7K | |
| blocks-img0003.png | 2021-04-05 22:49 | 3.7K | |
| arc-tangent-to-line-img00031.png | 2021-04-05 22:49 | 3.7K | |
| creating-dimensions-img0023.png | 2021-04-05 22:49 | 3.7K | |
| drawing-area-model-space-and-paper-space-img0003.png | 2021-04-05 22:49 | 3.7K | |
| map-img0008.png | 2021-04-05 22:49 | 3.8K | |
| text-img0001.png | 2021-04-05 22:50 | 3.8K | |
| synchronizing-data-and-graphics-img0006.png | 2021-04-05 22:50 | 3.8K | |
| arc-tangent-to-line-img0006.png | 2021-04-05 22:49 | 3.8K | |
| path-hatching-img0003.png | 2021-04-05 22:50 | 3.8K | |
| brush-styles-img0005.png | 2021-04-05 22:49 | 3.8K | |
| arc-tangent-to-2-entities-img0005.png | 2021-04-05 22:49 | 3.8K | |
| copying-objects-in-select-edit-img0008.png | 2021-04-05 22:49 | 3.8K | |
| brush-styles-img0011.png | 2021-04-05 22:49 | 3.8K | |
| auto-dimension-img0003.png | 2021-04-05 22:49 | 3.8K | |
| perpendicular-constraint-img0004.png | 2021-04-05 22:50 | 3.8K | |
| format-painter-img0007.png | 2021-04-05 22:49 | 3.8K | |
| arc-tangent-to-line-img00041.png | 2021-04-05 22:49 | 3.8K | |
| creating-a-parametric-part-img0032.png | 2021-04-05 22:49 | 3.8K | |
| creating-dimensions-img0004.png | 2021-04-05 22:49 | 3.8K | |
| sheet-metal-gusset-img0013.png | 2021-04-05 22:50 | 3.8K | |
| acis-img0005.png | 2021-04-05 22:49 | 3.8K | |
| moving-a-node-img0004.png | 2021-04-05 22:49 | 3.8K | |
| layer-sets-img0002.png | 2021-04-05 22:49 | 3.8K | |
| redsdk-materials-examples-img00121.png | 2021-04-05 22:50 | 3.8K | |
| copying-objects-in-select-edit-img0001.png | 2021-04-05 22:49 | 3.8K | |
| creating-dimensions-img0028.png | 2021-04-05 22:49 | 3.8K | |
| trace-by-rectangle-img0009.png | 2021-04-05 22:50 | 3.8K | |
| arc-tangent-to-arc-img0003.png | 2021-04-05 22:49 | 3.8K | |
| advanced-preferences-img0002.png | 2021-04-05 22:49 | 3.8K | |
| tone-mapping-control-img0001.png | 2021-04-05 22:50 | 3.8K | |
| constraining-dimensions-img0003.png | 2021-04-05 22:49 | 3.8K | |
| creating-dimensions-img0014.png | 2021-04-05 22:49 | 3.8K | |
| rail-sweep-img0003.png | 2021-04-05 22:50 | 3.8K | |
| sweep-img0003.png | 2021-04-05 22:50 | 3.8K | |
| construction-geometry-img0002.png | 2021-04-05 22:49 | 3.8K | |
| rotating-objects-in-select-edit-img0003.png | 2021-04-05 22:50 | 3.9K | |
| equal-radius-constraint-img0003.png | 2021-04-05 22:49 | 3.9K | |
| mirror-copy-img0003.png | 2021-04-05 22:49 | 3.9K | |
| trim-by-entity-img0005.png | 2021-04-05 22:50 | 3.9K | |
| insert-opening-img0002.png | 2021-04-05 22:49 | 3.9K | |
| redsdk-global-environments-img00031.png | 2021-04-05 22:50 | 3.9K | |
| colors-and-brushes-img0005.png | 2021-04-05 22:49 | 3.9K | |
| arc-double-point-img00031.png | 2021-04-05 22:49 | 3.9K | |
| circle-tan-tan-tan-img0003.png | 2021-04-05 22:49 | 3.9K | |
| colors-and-brushes-img0006.png | 2021-04-05 22:49 | 3.9K | |
| block-attributes-img0002.png | 2021-04-05 22:49 | 3.9K | |
| circle-tan-tan-tan-img0002.png | 2021-04-05 22:49 | 3.9K | |
| point-cloud-properties-img0002.png | 2021-04-05 22:50 | 3.9K | |
| trim-img0007.png | 2021-04-05 22:50 | 3.9K | |
| offset-with-law-img0009.png | 2021-04-05 22:49 | 3.9K | |
| trace-by-point-img0001.png | 2021-04-05 22:50 | 3.9K | |
| creating-dimensions-img0025.png | 2021-04-05 22:49 | 3.9K | |
| arc-img0001.png | 2021-04-05 22:49 | 3.9K | |
| window-styles-img0014.png | 2021-04-05 22:50 | 3.9K | |
| distributing-objects-img0004.png | 2021-04-05 22:49 | 3.9K | |
| editing-segments-img0003.png | 2021-04-05 22:49 | 3.9K | |
| circle-concentric-img0003.png | 2021-04-05 22:49 | 3.9K | |
| circle-ellipse-img0001.png | 2021-04-05 22:49 | 3.9K | |
| arc-tangent-to-arc-img0002.png | 2021-04-05 22:49 | 3.9K | |
| hyperlinks-img0002.png | 2021-04-05 22:49 | 3.9K | |
| rotated-ellipse-img0003.png | 2021-04-05 22:50 | 3.9K | |
| surveyor-dimensions-img0002.png | 2021-04-05 22:50 | 3.9K | |
| tangent-constraint-img0006.png | 2021-04-05 22:50 | 3.9K | |
| creating-dimensions-img0030.png | 2021-04-05 22:49 | 3.9K | |
| perpendicular-img0005.png | 2021-04-05 22:50 | 3.9K | |
| smart-dimensions-img0006.png | 2021-04-05 22:50 | 3.9K | |
| smart-dimensions-img0008.png | 2021-04-05 22:50 | 3.9K | |
| colors-and-brushes-img0004.png | 2021-04-05 22:49 | 3.9K | |
| arc-double-point-img00041.png | 2021-04-05 22:49 | 3.9K | |
| creating-dimensions-img0024.png | 2021-04-05 22:49 | 3.9K | |
| fix-geometry-constraint-img0001.png | 2021-04-05 22:49 | 4.0K | |
| arc-tangent-to-2-entities-img0002.png | 2021-04-05 22:49 | 4.0K | |
| drawing-compare-file-types-img0001.png | 2021-04-05 22:49 | 4.0K | |
| circle-tangent-to-arc-img0003.png | 2021-04-05 22:49 | 4.0K | |
| inserting-walls-img0013.png | 2021-04-05 22:49 | 4.0K | |
| inserting-walls-img0018.png | 2021-04-05 22:49 | 4.0K | |
| parallel-constraint-img0004.png | 2021-04-05 22:50 | 4.0K | |
| select-by-query-img0010.png | 2021-04-05 22:50 | 4.0K | |
| simple-extrude-img0003.png | 2021-04-05 22:50 | 4.0K | |
| double-line-polyline-img0002.png | 2021-04-05 22:49 | 4.0K | |
| smart-dimensions-img0004.png | 2021-04-05 22:50 | 4.0K | |
| join-polyline-img0002.png | 2021-04-05 22:49 | 4.0K | |
| arc-tangent-to-2-entities-img0003.png | 2021-04-05 22:49 | 4.0K | |
| selection-info-palette-img0039.png | 2021-04-05 22:50 | 4.0K | |
| switching-to-paper-space-1-2018-04-22-3.png | 2021-04-05 22:50 | 4.0K | |
| isocircle-img0002.png | 2021-04-05 22:49 | 4.0K | |
| equal-length-constraint-img0001.png | 2021-04-05 22:49 | 4.0K | |
| arc-tangent-to-2-entities-img0007.png | 2021-04-05 22:49 | 4.0K | |
| pulling-curved-faces-img0001.png | 2021-04-05 22:50 | 4.0K | |
| points-coincident-constraint-img0002.png | 2021-04-05 22:50 | 4.0K | |
| creating-an-underlay-style-img0005.png | 2021-04-05 22:49 | 4.0K | |
| using-the-lte-command-line-img0012.png | 2021-04-05 22:50 | 4.0K | |
| arc-concentric-img00021.png | 2021-04-05 22:49 | 4.0K | |
| stacking-objects-img0001.png | 2021-04-05 22:50 | 4.1K | |
| graphic-along-path-img0003.png | 2021-04-05 22:49 | 4.1K | |
| profile-along-path-img0003.png | 2021-04-05 22:50 | 4.1K | |
| fix-geometry-constraint-img0002.png | 2021-04-05 22:49 | 4.1K | |
| tangent-from-arc-img0002.png | 2021-04-05 22:50 | 4.1K | |
| irregular-polygon-img0002.png | 2021-04-05 22:49 | 4.1K | |
| creating-dimensions-img0031.png | 2021-04-05 22:49 | 4.1K | |
| perpendicular-img0003.png | 2021-04-05 22:50 | 4.1K | |
| quick-dimensions-img0011.png | 2021-04-05 22:50 | 4.1K | |
| convert-to-wall-img0001.png | 2021-04-05 22:49 | 4.1K | |
| changing-the-workplane-img0009.png | 2021-04-05 22:49 | 4.1K | |
| chamfer-img0005.png | 2021-04-05 22:49 | 4.1K | |
| editing-linear-objects-img0005.png | 2021-04-05 22:49 | 4.1K | |
| redsdk-volumetric-environment-img00021.png | 2021-04-05 22:50 | 4.1K | |
| points-coincident-constraint-img0003.png | 2021-04-05 22:50 | 4.1K | |
| circle-tangent-to-arc-img0004.png | 2021-04-05 22:49 | 4.1K | |
| 2d-add-img0002.png | 2021-04-05 22:49 | 4.1K | |
| coincident-constraint-img0001.png | 2021-04-05 22:49 | 4.1K | |
| point-img0002.png | 2021-04-05 22:50 | 4.1K | |
| using-the-materials-palette-img0010.png | 2021-04-05 22:50 | 4.1K | |
| arc-concentric-img00041.png | 2021-04-05 22:49 | 4.1K | |
| creating-dimensions-img0005.png | 2021-04-05 22:49 | 4.1K | |
| 2d-subtract-img0003.png | 2021-04-05 22:49 | 4.2K | |
| creating-dimensions-img0039.png | 2021-04-05 22:49 | 4.2K | |
| stair-by-linework-img0003.png | 2021-04-05 22:50 | 4.2K | |
| tangent-arc-point-img0002.png | 2021-04-05 22:50 | 4.2K | |
| measuring-area-img0004.png | 2021-04-05 22:49 | 4.2K | |
| apparent-intersection-snap-img0003.png | 2021-04-05 22:49 | 4.2K | |
| quick-dimensions-img0012.png | 2021-04-05 22:50 | 4.2K | |
| gear-contour-img0004.png | 2021-04-05 22:49 | 4.2K | |
| absolute-coordinates-img0003.png | 2021-04-05 22:49 | 4.2K | |
| trim-img0004.png | 2021-04-05 22:50 | 4.2K | |
| lofting-img0019.png | 2021-04-05 22:49 | 4.2K | |
| double-line-properties-img0003.png | 2021-04-05 22:49 | 4.2K | |
| coincident-constraint-img0007.png | 2021-04-05 22:49 | 4.2K | |
| curve-from-law-img0007.png | 2021-04-05 22:49 | 4.2K | |
| node-editing-perpendicular-vectors-img0002.png | 2021-04-05 22:49 | 4.2K | |
| loading-a-parametric-part-into-the-library-img0004.png | 2021-04-05 22:49 | 4.2K | |
| fix-geometry-constraint-img0004.png | 2021-04-05 22:49 | 4.2K | |
| cone-img0007.png | 2021-04-05 22:49 | 4.2K | |
| creating-dimensions-img0029.png | 2021-04-05 22:49 | 4.3K | |
| editing-multiple-nodes-img0004.png | 2021-04-05 22:49 | 4.3K | |
| arc-tangent-to-entities-img0001.png | 2021-04-05 22:49 | 4.3K | |
| palettes-img0001.png | 2021-04-05 22:50 | 4.3K | |
| brush-styles-img0007.png | 2021-04-05 22:49 | 4.3K | |
| curve-from-law-img0012.png | 2021-04-05 22:49 | 4.3K | |
| arc-tangent-to-2-entities-img0006.png | 2021-04-05 22:49 | 4.3K | |
| surface-from-laws-img0009.png | 2021-04-05 22:50 | 4.3K | |
| chain-polyline-img0003.png | 2021-04-05 22:49 | 4.3K | |
| move-text-for-dimensions-img0001.png | 2021-04-05 22:49 | 4.3K | |
| design-director-layers-img0001.png | 2021-04-05 22:49 | 4.3K | |
| editing-linear-objects-img0001.png | 2021-04-05 22:49 | 4.3K | |
| workplanes-img0008.png | 2021-04-05 22:50 | 4.3K | |
| vertex-snap-img0002.png | 2021-04-05 22:50 | 4.3K | |
| loading-a-parametric-part-into-the-library-img0001.png | 2021-04-05 22:49 | 4.3K | |
| change-chirality-constraint-img0008.png | 2021-04-05 22:49 | 4.3K | |
| changing-room-size-while-inserting-img0002.png | 2021-04-05 22:49 | 4.3K | |
| sphere-img0005.png | 2021-04-05 22:50 | 4.3K | |
| exporting-point-clouds-img0002.png | 2021-04-05 22:49 | 4.3K | |
| importing-point-clouds-img0005.png | 2021-04-05 22:49 | 4.3K | |
| trace-by-rectangle-img0010.png | 2021-04-05 22:50 | 4.3K | |
| select-by-query-img0005.png | 2021-04-05 22:50 | 4.3K | |
| workplanes-img0007.png | 2021-04-05 22:50 | 4.3K | |
| arc-tangent-to-line-img00051.png | 2021-04-05 22:49 | 4.3K | |
| double-line-properties-img0002.png | 2021-04-05 22:49 | 4.3K | |
| format-painter-img0009.png | 2021-04-05 22:49 | 4.3K | |
| stair-by-linework-img0001.png | 2021-04-05 22:50 | 4.3K | |
| chamfer-img0002.png | 2021-04-05 22:49 | 4.3K | |
| multileader-properties-img0003.png | 2021-04-05 22:49 | 4.3K | |
| parallel-constraint-img0001.png | 2021-04-05 22:50 | 4.4K | |
| arc-tangent-to-3-arcs-img0001.png | 2021-04-05 22:49 | 4.4K | |
| inserting-walls-img0012.png | 2021-04-05 22:49 | 4.4K | |
| fix-geometry-constraint-img0008.png | 2021-04-05 22:49 | 4.4K | |
| editing-linear-objects-img0004.png | 2021-04-05 22:49 | 4.4K | |
| 2d-geometric-parameters-img0002.png | 2021-04-05 22:49 | 4.4K | |
| format-painter-img0008.png | 2021-04-05 22:49 | 4.4K | |
| dimensions-img0001.png | 2021-04-05 22:49 | 4.4K | |
| constraining-geometry-img0002.png | 2021-04-05 22:49 | 4.4K | |
| smart-dimensions-img0009.png | 2021-04-05 22:50 | 4.4K | |
| stair-by-linework-img0004.png | 2021-04-05 22:50 | 4.4K | |
| constraining-dimensions-img0001.png | 2021-04-05 22:49 | 4.4K | |
| arc-tangent-to-arc-img0006.png | 2021-04-05 22:49 | 4.4K | |
| circle-concentric-img00031.png | 2021-04-05 22:49 | 4.4K | |
| curve-properties-img0003.png | 2021-04-05 22:49 | 4.4K | |
| equal-radius-constraint-img0001.png | 2021-04-05 22:49 | 4.4K | |
| arc-tangent-to-3-arcs-img0002.png | 2021-04-05 22:49 | 4.4K | |
| moving-a-node-img0010.png | 2021-04-05 22:49 | 4.4K | |
| arc-tangent-to-arc-img0004.png | 2021-04-05 22:49 | 4.4K | |
| brush-styles-img0010.png | 2021-04-05 22:49 | 4.4K | |
| points-coincident-constraint-img0004.png | 2021-04-05 22:50 | 4.4K | |
| customize-popup-toolbars-img0004.png | 2021-04-05 22:49 | 4.4K | |
| fillet-img0008.png | 2021-04-05 22:49 | 4.4K | |
| curve-properties-img0002.png | 2021-04-05 22:49 | 4.4K | |
| door-styles-img0014.png | 2021-04-05 22:49 | 4.5K | |
| other-cad-formats-img00111.png | 2021-04-05 22:49 | 4.5K | |
| double-line-perpendicular-img0002.png | 2021-04-05 22:49 | 4.5K | |
| 2d-intersect-img0004.png | 2021-04-05 22:49 | 4.5K | |
| trim-by-entity-img0006.png | 2021-04-05 22:50 | 4.5K | |
| redsdk-volumetric-environment-img00111.png | 2021-04-05 22:50 | 4.5K | |
| join-polyline-img0004.png | 2021-04-05 22:49 | 4.5K | |
| print-options-img0004.png | 2021-04-05 22:50 | 4.5K | |
| breaks-img0002.png | 2021-04-05 22:49 | 4.5K | |
| polygon-img0002.png | 2021-04-05 22:50 | 4.5K | |
| arc-tangent-to-arc-img00041.png | 2021-04-05 22:49 | 4.5K | |
| perpendicular-constraint-img0005.png | 2021-04-05 22:50 | 4.5K | |
| linking-data-to-graphics-img0004.png | 2021-04-05 22:49 | 4.5K | |
| meet-2-lines-img0004.png | 2021-04-05 22:49 | 4.5K | |
| path-hatching-img0002.png | 2021-04-05 22:50 | 4.5K | |
| insert-table-img0014.png | 2021-04-05 22:49 | 4.5K | |
| using-the-environments-palette-img0008.png | 2021-04-05 22:50 | 4.5K | |
| brush-styles-img0013.png | 2021-04-05 22:49 | 4.5K | |
| brush-styles-img0002.png | 2021-04-05 22:49 | 4.5K | |
| split-img0005.png | 2021-04-05 22:50 | 4.5K | |
| fit-linear-copy-img0004.png | 2021-04-05 22:49 | 4.5K | |
| lofting-img0003.png | 2021-04-05 22:49 | 4.5K | |
| auto-dimension-img0006.png | 2021-04-05 22:49 | 4.5K | |
| object-trim-img0005.png | 2021-04-05 22:49 | 4.5K | |
| using-the-luminances-palette-img0009.png | 2021-04-05 22:50 | 4.5K | |
| synchronizing-data-and-graphics-img0001.png | 2021-04-05 22:50 | 4.5K | |
| curve-properties-img0005.png | 2021-04-05 22:49 | 4.5K | |
| points-coincident-constraint-img0005.png | 2021-04-05 22:50 | 4.5K | |
| editing-linear-objects-img0002.png | 2021-04-05 22:49 | 4.6K | |
| 2d-intersect-img0005.png | 2021-04-05 22:49 | 4.6K | |
| brush-styles-img0006.png | 2021-04-05 22:49 | 4.6K | |
| convert-to-slab-img0002.png | 2021-04-05 22:49 | 4.6K | |
| multi-landing-stair-img0004.png | 2021-04-05 22:49 | 4.6K | |
| scaling-objects-in-select-edit-img0004.png | 2021-04-05 22:50 | 4.6K | |
| tangent-constraint-img0005.png | 2021-04-05 22:50 | 4.6K | |
| using-the-lte-command-line-img0017.png | 2021-04-05 22:50 | 4.6K | |
| editing-linear-objects-img0003.png | 2021-04-05 22:49 | 4.6K | |
| adding-a-node-img0001.png | 2021-04-05 22:49 | 4.6K | |
| quick-dimensions-img0007.png | 2021-04-05 22:50 | 4.6K | |
| synchronizing-data-and-graphics-img0005.png | 2021-04-05 22:50 | 4.6K | |
| convert-to-curve-img0006.png | 2021-04-05 22:49 | 4.6K | |
| splines-and-bezier-curves-img0005.png | 2021-04-05 22:50 | 4.6K | |
| creating-dimensions-img0015.png | 2021-04-05 22:49 | 4.6K | |
| weld-symbols-img0003.png | 2021-04-05 22:50 | 4.6K | |
| using-the-lte-command-line-img0006.png | 2021-04-05 22:50 | 4.6K | |
| polar-coordinates-img0002.png | 2021-04-05 22:50 | 4.6K | |
| viewing-and-editing-data-in-tables-img0001.png | 2021-04-05 22:50 | 4.6K | |
| sheet-metal-gusset-img0010.png | 2021-04-05 22:50 | 4.6K | |
| rotating-objects-in-select-edit-img0001.png | 2021-04-05 22:50 | 4.6K | |
| using-the-lte-command-line-img0018.png | 2021-04-05 22:50 | 4.6K | |
| render-manager-img0008.png | 2021-04-05 22:50 | 4.6K | |
| copying-objects-in-select-edit-img0016.png | 2021-04-05 22:49 | 4.7K | |
| triangulating-point-clouds-img0002.png | 2021-04-05 22:50 | 4.7K | |
| t-meet-2-double-lines-img0004.png | 2021-04-05 22:50 | 4.7K | |
| object-trim-img0008.png | 2021-04-05 22:49 | 4.7K | |
| perpendicular-constraint-img0001.png | 2021-04-05 22:50 | 4.7K | |
| copying-objects-in-select-edit-img0009.png | 2021-04-05 22:49 | 4.7K | |
| arc-tangent-to-2-entities-img0009.png | 2021-04-05 22:49 | 4.7K | |
| connect-constraint-img0006.png | 2021-04-05 22:49 | 4.7K | |
| apparent-intersection-snap-img0004.png | 2021-04-05 22:49 | 4.7K | |
| smeshes-and-exploding-the-primitive-img0004.png | 2021-04-05 22:50 | 4.7K | |
| double-line-parallel-img0002.png | 2021-04-05 22:49 | 4.7K | |
| lofting-img0007.png | 2021-04-05 22:49 | 4.7K | |
| creating-construction-geometry-img0008.png | 2021-04-05 22:49 | 4.7K | |
| managing-materials-in-the-render-manager-img0003.png | 2021-04-05 22:49 | 4.7K | |
| revolve-img0008.png | 2021-04-05 22:50 | 4.7K | |
| contact-manager-img0003.png | 2021-04-05 22:49 | 4.7K | |
| calculator-palette-variables-palette-img0018.png | 2021-04-05 22:49 | 4.7K | |
| map-img0010.png | 2021-04-05 22:49 | 4.7K | |
| auto-constraint-img0005.png | 2021-04-05 22:49 | 4.7K | |
| export-2d-part-objects-img0001.png | 2021-04-05 22:49 | 4.7K | |
| unbend-sheet-img0019.png | 2021-04-05 22:50 | 4.7K | |
| insert-table-img0008.png | 2021-04-05 22:49 | 4.7K | |
| inserting-a-file-img0003.png | 2021-04-05 22:49 | 4.7K | |
| line-length-img0003.png | 2021-04-05 22:49 | 4.7K | |
| sketch-style-img0005.png | 2021-04-05 22:50 | 4.7K | |
| quick-pull-img0005.png | 2021-04-05 22:50 | 4.7K | |
| chain-polyline-img0006.png | 2021-04-05 22:49 | 4.7K | |
| parallel-constraint-img0002.png | 2021-04-05 22:50 | 4.7K | |
| coincident-constraint-img0009.png | 2021-04-05 22:49 | 4.8K | |
| arc-tangent-to-entities-img0004.png | 2021-04-05 22:49 | 4.8K | |
| unbend-sheet-img0016.png | 2021-04-05 22:50 | 4.8K | |
| perpendicular-img0004.png | 2021-04-05 22:50 | 4.8K | |
| tangent-to-arc-img0001.png | 2021-04-05 22:50 | 4.8K | |
| creating-dimensions-img0035.png | 2021-04-05 22:49 | 4.8K | |
| multi-line-properties-img0001.png | 2021-04-05 22:49 | 4.8K | |
| select-by-query-img0003.png | 2021-04-05 22:50 | 4.8K | |
| adding-a-node-img0002.png | 2021-04-05 22:49 | 4.8K | |
| join-coplanar-faces-img0004.png | 2021-04-05 22:49 | 4.8K | |
| fix-geometry-constraint-img0003.png | 2021-04-05 22:49 | 4.8K | |
| arc-tangent-to-entities-img0002.png | 2021-04-05 22:49 | 4.8K | |
| equal-length-constraint-img0002.png | 2021-04-05 22:49 | 4.8K | |
| arc-tangent-to-2-entities-img00041.png | 2021-04-05 22:49 | 4.8K | |
| solidify-img0001.png | 2021-04-05 22:50 | 4.8K | |
| native-draw-img0002.png | 2021-04-05 22:49 | 4.8K | |
| workplanes-img0001.png | 2021-04-05 22:50 | 4.8K | |
| arc-tangent-to-2-entities-img00071.png | 2021-04-05 22:49 | 4.8K | |
| scaling-objects-in-select-edit-img0005.png | 2021-04-05 22:50 | 4.8K | |
| insert-opening-img0005.png | 2021-04-05 22:49 | 4.8K | |
| creating-dimensions-img0009.png | 2021-04-05 22:49 | 4.8K | |
| node-editing-perpendicular-vectors-img0001.png | 2021-04-05 22:49 | 4.8K | |
| perpendicular-constraint-img0003.png | 2021-04-05 22:50 | 4.8K | |
| convert-to-curve-img0005.png | 2021-04-05 22:49 | 4.8K | |
| 2d-subtract-img0002.png | 2021-04-05 22:49 | 4.8K | |
| standard-views-img0004.png | 2021-04-05 22:50 | 4.8K | |
| sketch-img0002.png | 2021-04-05 22:50 | 4.9K | |
| coincident-constraint-img0004.png | 2021-04-05 22:49 | 4.9K | |
| customize-options-img0002.png | 2021-04-05 22:49 | 4.9K | |
| trace-by-rectangle-img0006.png | 2021-04-05 22:50 | 4.9K | |
| render-manager-img0009.png | 2021-04-05 22:50 | 4.9K | |
| edit-tool-in-3d-img0003.png | 2021-04-05 22:49 | 4.9K | |
| properties-window-img00041.png | 2021-04-05 22:50 | 4.9K | |
| insert-table-img0010.png | 2021-04-05 22:49 | 4.9K | |
| join-coplanar-faces-img0001.png | 2021-04-05 22:49 | 4.9K | |
| equal-distance-constraint-img0005.png | 2021-04-05 22:49 | 4.9K | |
| cone-img0002.png | 2021-04-05 22:49 | 4.9K | |
| fit-radial-copy-img0004.png | 2021-04-05 22:49 | 4.9K | |
| editing-linear-objects-img0008.png | 2021-04-05 22:49 | 4.9K | |
| database-connection-palette-img0010.png | 2021-04-05 22:49 | 4.9K | |
| geometric-tolerance-img0001.png | 2021-04-05 22:49 | 4.9K | |
| brush-styles-img0008.png | 2021-04-05 22:49 | 4.9K | |
| arc-tangent-to-2-entities-img00051.png | 2021-04-05 22:49 | 4.9K | |
| drawing-setup-img0001.png | 2021-04-05 22:49 | 5.0K | |
| curve-from-law-img0001.png | 2021-04-05 22:49 | 5.0K | |
| line-styles-img0005.png | 2021-04-05 22:49 | 5.0K | |
| scaling-objects-in-select-edit-img0001.png | 2021-04-05 22:50 | 5.0K | |
| perpendicular-constraint-img0002.png | 2021-04-05 22:50 | 5.0K | |
| rail-sweep-img0004.png | 2021-04-05 22:50 | 5.0K | |
| creating-an-underlay-style-img0002.png | 2021-04-05 22:49 | 5.0K | |
| tweak-face-img0003.png | 2021-04-05 22:50 | 5.0K | |
| sketch-style-img0007.png | 2021-04-05 22:50 | 5.0K | |
| quick-dimensions-img0008.png | 2021-04-05 22:50 | 5.0K | |
| adding-a-node-img0003.png | 2021-04-05 22:49 | 5.0K | |
| converting-solid-to-smesh-img0002.png | 2021-04-05 22:49 | 5.0K | |
| creating-dimensions-img0010.png | 2021-04-05 22:49 | 5.0K | |
| pulling-curved-faces-img0012.png | 2021-04-05 22:50 | 5.0K | |
| arc-tangent-to-2-entities-img00031.png | 2021-04-05 22:49 | 5.0K | |
| tc-surface-properties-img0001.png | 2021-04-05 22:50 | 5.0K | |
| point-properties-img0001.png | 2021-04-05 22:50 | 5.1K | |
| creating-dimensions-img0019.png | 2021-04-05 22:49 | 5.1K | |
| editing-a-block-img0001.png | 2021-04-05 22:49 | 5.1K | |
| creating-dimensions-img0036.png | 2021-04-05 22:49 | 5.1K | |
| workplanes-img0003.png | 2021-04-05 22:50 | 5.1K | |
| using-the-lte-command-line-img0010.png | 2021-04-05 22:50 | 5.1K | |
| arc-tangent-to-entities-img0003.png | 2021-04-05 22:49 | 5.1K | |
| changing-the-workplane-img0011.png | 2021-04-05 22:49 | 5.1K | |
| object-trim-img0004.png | 2021-04-05 22:49 | 5.1K | |
| select-by-query-img0009.png | 2021-04-05 22:50 | 5.1K | |
| hyperlinks-img0003.png | 2021-04-05 22:49 | 5.1K | |
| using-the-advanced-render-styles-palette-img0008.png | 2021-04-05 22:50 | 5.1K | |
| concentric-constraint-img0004.png | 2021-04-05 22:49 | 5.1K | |
| page-layout-wizard-img0014.png | 2021-04-05 22:50 | 5.1K | |
| drawing-area-model-space-and-paper-space-img0002.png | 2021-04-05 22:49 | 5.1K | |
| pulling-curved-faces-img0011.png | 2021-04-05 22:50 | 5.1K | |
| arc-tangent-to-arc-img00031.png | 2021-04-05 22:49 | 5.1K | |
| profile-editing-img0001.png | 2021-04-05 22:50 | 5.1K | |
| linear-copy-img0003.png | 2021-04-05 22:49 | 5.1K | |
| t-meet-2-double-lines-img0002.png | 2021-04-05 22:50 | 5.1K | |
| circle-tangent-to-entities-img0002.png | 2021-04-05 22:49 | 5.1K | |
| pick-point-and-hatch-img0002.png | 2021-04-05 22:50 | 5.1K | |
| imprint-img0009.png | 2021-04-05 22:49 | 5.2K | |
| sketch-style-img0013.png | 2021-04-05 22:50 | 5.2K | |
| object-trim-img0007.png | 2021-04-05 22:49 | 5.2K | |
| selection-info-palette-img0004.png | 2021-04-05 22:50 | 5.2K | |
| join-coplanar-faces-img0006.png | 2021-04-05 22:49 | 5.2K | |
| cone-img0004.png | 2021-04-05 22:49 | 5.2K | |
| tangent-constraint-img0008.png | 2021-04-05 22:50 | 5.2K | |
| copying-objects-in-select-edit-img0006.png | 2021-04-05 22:49 | 5.2K | |
| torus-img0005.png | 2021-04-05 22:50 | 5.2K | |
| parallel-constraint-img0003.png | 2021-04-05 22:50 | 5.2K | |
| 3d-boolean-operations-img0002.png | 2021-04-05 22:49 | 5.2K | |
| imprint-img0007.png | 2021-04-05 22:49 | 5.2K | |
| curve-properties-img0004.png | 2021-04-05 22:49 | 5.2K | |
| irregular-polygon-img0003.png | 2021-04-05 22:49 | 5.2K | |
| arc-tangent-to-2-entities-img00081.png | 2021-04-05 22:49 | 5.2K | |
| unwrapping-the-mesh-img0005.png | 2021-04-05 22:50 | 5.2K | |
| copying-objects-in-select-edit-img0012.png | 2021-04-05 22:49 | 5.2K | |
| house-wizard-img0001.png | 2021-04-05 22:49 | 5.2K | |
| t-meet-2-double-lines-img0003.png | 2021-04-05 22:50 | 5.2K | |
| revolve-img0006.png | 2021-04-05 22:50 | 5.2K | |
| center-mark-img0004.png | 2021-04-05 22:49 | 5.2K | |
| using-the-lte-command-line-img0007.png | 2021-04-05 22:50 | 5.2K | |
| divide-point-snap-img0002.png | 2021-04-05 22:49 | 5.2K | |
| center-mark-img0001.png | 2021-04-05 22:49 | 5.2K | |
| modifying-geometry-img0001.png | 2021-04-05 22:49 | 5.2K | |
| double-line-properties-img0001.png | 2021-04-05 22:49 | 5.3K | |
| polyline-img0010.png | 2021-04-05 22:50 | 5.3K | |
| using-the-lte-command-line-img0008.png | 2021-04-05 22:50 | 5.3K | |
| double-line-irregular-polygon-img0002.png | 2021-04-05 22:49 | 5.3K | |
| object-trim-img0011.png | 2021-04-05 22:49 | 5.3K | |
| trim-img0010.png | 2021-04-05 22:50 | 5.3K | |
| constraining-dimensions-img0002.png | 2021-04-05 22:49 | 5.3K | |
| drawing-area-model-space-and-paper-space-img0001.png | 2021-04-05 22:49 | 5.3K | |
| segment-and-entity-dimensioning-img0001.png | 2021-04-05 22:50 | 5.3K | |
| creating-construction-geometry-img0011.png | 2021-04-05 22:49 | 5.3K | |
| tc-surface-properties-img0002.png | 2021-04-05 22:50 | 5.3K | |
| creating-dimensions-img0012.png | 2021-04-05 22:49 | 5.3K | |
| concentric-constraint-img0003.png | 2021-04-05 22:49 | 5.3K | |
| pulling-curved-faces-img0006.png | 2021-04-05 22:50 | 5.3K | |
| breaking-opening-closed-objects-img0001.png | 2021-04-05 22:49 | 5.3K | |
| multi-line-properties-img0009.png | 2021-04-05 22:49 | 5.3K | |
| creating-construction-geometry-img0017.png | 2021-04-05 22:49 | 5.3K | |
| profile-styles-img0017.png | 2021-04-05 22:50 | 5.3K | |
| calculator-palette-variables-palette-img0005.png | 2021-04-05 22:49 | 5.3K | |
| 2d-3d-selector-img0006.png | 2021-04-05 22:49 | 5.3K | |
| selector-2d-parts-img0002.png | 2021-04-05 22:50 | 5.3K | |
| arc-tangent-to-entities-img00021.png | 2021-04-05 22:49 | 5.3K | |
| relative-coordinates-img0004.png | 2021-04-05 22:50 | 5.3K | |
| unbend-sheet-img0020.png | 2021-04-05 22:50 | 5.3K | |
| text-along-curve-img0004.png | 2021-04-05 22:50 | 5.3K | |
| creating-dimensions-img0026.png | 2021-04-05 22:49 | 5.4K | |
| arc-concentric-img0004.png | 2021-04-05 22:49 | 5.4K | |
| inserting-text-img0001.png | 2021-04-05 22:49 | 5.4K | |
| extrude-to-face-img0008.png | 2021-04-05 22:49 | 5.4K | |
| render-manager-img0010.png | 2021-04-05 22:50 | 5.4K | |
| multi-landing-stair-img0007.png | 2021-04-05 22:49 | 5.4K | |
| box-img0004.png | 2021-04-05 22:49 | 5.4K | |
| splines-and-bezier-curves-img0008.png | 2021-04-05 22:50 | 5.4K | |
| bend-by-sketch-img0002.png | 2021-04-05 22:49 | 5.4K | |
| quick-dimensions-img0013.png | 2021-04-05 22:50 | 5.4K | |
| arc-tangent-to-3-arcs-img00021.png | 2021-04-05 22:49 | 5.4K | |
| terrain-img0004.png | 2021-04-05 22:50 | 5.4K | |
| creating-dimensions-img0017.png | 2021-04-05 22:49 | 5.4K | |
| editing-a-group-img0001.png | 2021-04-05 22:49 | 5.4K | |
| gear-contour-img0003.png | 2021-04-05 22:49 | 5.4K | |
| inserting-text-img0004.png | 2021-04-05 22:49 | 5.4K | |
| object-trim-img0003.png | 2021-04-05 22:49 | 5.4K | |
| hole-img0004.png | 2021-04-05 22:49 | 5.4K | |
| arc-tangent-to-3-arcs-img00031.png | 2021-04-05 22:49 | 5.4K | |
| fit-linear-copy-img0002.png | 2021-04-05 22:49 | 5.4K | |
| purge-img00011.png | 2021-04-05 22:50 | 5.4K | |
| stair-by-linework-img0006.png | 2021-04-05 22:50 | 5.4K | |
| docking-palettes-img0001.png | 2021-04-05 22:49 | 5.4K | |
| editing-dimensions-img0003.png | 2021-04-05 22:49 | 5.5K | |
| inserting-walls-img0009.png | 2021-04-05 22:49 | 5.5K | |
| exploding-objects-img0001.png | 2021-04-05 22:49 | 5.5K | |
| selection-info-palette-img0009.png | 2021-04-05 22:50 | 5.5K | |
| auto-dimension-img0005.png | 2021-04-05 22:49 | 5.5K | |
| closing-open-objects-img0001.png | 2021-04-05 22:49 | 5.5K | |
| coincident-constraint-img0002.png | 2021-04-05 22:49 | 5.5K | |
| render-manager-img0007.png | 2021-04-05 22:50 | 5.5K | |
| grid-img0001.png | 2021-04-05 22:49 | 5.5K | |
| changing-the-workplane-img0006.png | 2021-04-05 22:49 | 5.5K | |
| revolve-img0028.png | 2021-04-05 22:50 | 5.5K | |
| tangent-from-arc-img0005.png | 2021-04-05 22:50 | 5.5K | |
| construction-geometry-img0003.png | 2021-04-05 22:49 | 5.5K | |
| measuring-area-img0008.png | 2021-04-05 22:49 | 5.5K | |
| dimension-properties-img0002.png | 2021-04-05 22:49 | 5.5K | |
| t-meet-2-double-lines-img0005.png | 2021-04-05 22:50 | 5.5K | |
| equal-radius-constraint-img0002.png | 2021-04-05 22:49 | 5.5K | |
| managing-render-styles-in-the-render-manager-img0003.png | 2021-04-05 22:49 | 5.5K | |
| polyline-img0002.png | 2021-04-05 22:50 | 5.5K | |
| select-by-query-img0001.png | 2021-04-05 22:50 | 5.5K | |
| colors-and-brushes-img0022.png | 2021-04-05 22:49 | 5.5K | |
| polyline-img0015.png | 2021-04-05 22:50 | 5.6K | |
| spelling-tool-and-spell-options-img0005.png | 2021-04-05 22:50 | 5.6K | |
| smart-dimensions-img0010.png | 2021-04-05 22:50 | 5.6K | |
| imprint-edge-img0007.png | 2021-04-05 22:49 | 5.6K | |
| polygonal-prism-img0005.png | 2021-04-05 22:50 | 5.6K | |
| layer-sorting-img0001.png | 2021-04-05 22:49 | 5.6K | |
| linking-data-to-graphics-img0001.png | 2021-04-05 22:49 | 5.6K | |
| connect-constraint-img0007.png | 2021-04-05 22:49 | 5.6K | |
| arranging-and-snapping-room-boxes-img0006.png | 2021-04-05 22:49 | 5.6K | |
| equal-distance-constraint-img0001.png | 2021-04-05 22:49 | 5.6K | |
| concentric-constraint-img0005.png | 2021-04-05 22:49 | 5.6K | |
| editing-circles-ellipses-and-arcs-img0006.png | 2021-04-05 22:49 | 5.6K | |
| tangent-from-arc-img0004.png | 2021-04-05 22:50 | 5.6K | |
| organizational-chart-img0005.png | 2021-04-05 22:49 | 5.6K | |
| zooming-img0007.png | 2021-04-05 22:50 | 5.6K | |
| imprint-img0004.png | 2021-04-05 22:49 | 5.6K | |
| circle-tangent-to-entities-img0004.png | 2021-04-05 22:49 | 5.6K | |
| object-trim-img0002.png | 2021-04-05 22:49 | 5.6K | |
| convert-to-wall-img0002.png | 2021-04-05 22:49 | 5.6K | |
| arc-tangent-to-arc-img00051.png | 2021-04-05 22:49 | 5.6K | |
| editing-multiple-nodes-img0002.png | 2021-04-05 22:49 | 5.7K | |
| moving-a-node-img0009.png | 2021-04-05 22:49 | 5.7K | |
| thick-profile-1-2018-04-20-3.png | 2021-04-05 22:50 | 5.7K | |
| moving-a-node-img0007.png | 2021-04-05 22:49 | 5.7K | |
| circle-tangent-to-entities-img0008.png | 2021-04-05 22:49 | 5.7K | |
| running-and-local-snaps-img0001.png | 2021-04-05 22:50 | 5.7K | |
| bisector-img0001.png | 2021-04-05 22:49 | 5.7K | |
| slot-img0004.png | 2021-04-05 22:50 | 5.7K | |
| using-lte-dynamic-input-img0004.png | 2021-04-05 22:50 | 5.7K | |
| split-img0006.png | 2021-04-05 22:50 | 5.7K | |
| workplanes-img0005.png | 2021-04-05 22:50 | 5.7K | |
| editing-linear-objects-img0010.png | 2021-04-05 22:49 | 5.7K | |
| custom-blocks-for-windows-and-doors-img0002.png | 2021-04-05 22:49 | 5.7K | |
| circle-tangent-to-entities-img0003.png | 2021-04-05 22:49 | 5.7K | |
| adding-a-node-img0004.png | 2021-04-05 22:49 | 5.8K | |
| calculator-palette-variables-palette-img0016.png | 2021-04-05 22:49 | 5.8K | |
| extrude-to-face-img0009.png | 2021-04-05 22:49 | 5.8K | |
| unbend-sheet-img0012.png | 2021-04-05 22:50 | 5.8K | |
| using-the-lte-command-line-img0005.png | 2021-04-05 22:50 | 5.8K | |
| using-lte-dynamic-input-img0005.png | 2021-04-05 22:50 | 5.8K | |
| chain-polyline-img0005.png | 2021-04-05 22:49 | 5.8K | |
| radial-copy-img0004.png | 2021-04-05 22:50 | 5.8K | |
| segment-and-entity-dimensioning-img0004.png | 2021-04-05 22:50 | 5.8K | |
| inserting-walls-img0008.png | 2021-04-05 22:49 | 5.8K | |
| splines-and-bezier-curves-img0006.png | 2021-04-05 22:50 | 5.8K | |
| arc-tangent-to-entities-img00041.png | 2021-04-05 22:49 | 5.8K | |
| circle-tangent-to-entities-img0006.png | 2021-04-05 22:49 | 5.8K | |
| creating-dimensions-img0027.png | 2021-04-05 22:49 | 5.8K | |
| cone-img0005.png | 2021-04-05 22:49 | 5.8K | |
| editing-segments-img0004.png | 2021-04-05 22:49 | 5.9K | |
| multi-text-img0023.png | 2021-04-05 22:49 | 5.9K | |
| circle-tangent-to-entities-img0007.png | 2021-04-05 22:49 | 5.9K | |
| redsdk-volumetric-environment-img00031.png | 2021-04-05 22:50 | 5.9K | |
| tangent-constraint-img0003.png | 2021-04-05 22:50 | 5.9K | |
| terrain-img0001.png | 2021-04-05 22:50 | 5.9K | |
| managing-environments-in-the-render-manager-img0011.png | 2021-04-05 22:49 | 5.9K | |
| managing-luminances-in-the-render-manager-img0008.png | 2021-04-05 22:49 | 5.9K | |
| managing-render-styles-in-the-render-manager-img0008.png | 2021-04-05 22:49 | 5.9K | |
| arc-concentric-img0005.png | 2021-04-05 22:49 | 5.9K | |
| prism-img0008.png | 2021-04-05 22:50 | 5.9K | |
| equal-distance-constraint-img0004.png | 2021-04-05 22:49 | 5.9K | |
| copying-objects-in-select-edit-img0017.png | 2021-04-05 22:49 | 5.9K | |
| editing-multi-text-img0002.png | 2021-04-05 22:49 | 5.9K | |
| unfold-face-img0001.png | 2021-04-05 22:50 | 5.9K | |
| equal-distance-constraint-img0002.png | 2021-04-05 22:49 | 5.9K | |
| line-styles-img0006.png | 2021-04-05 22:49 | 5.9K | |
| splines-and-bezier-curves-img0007.png | 2021-04-05 22:50 | 5.9K | |
| segment-and-entity-dimensioning-img0002.png | 2021-04-05 22:50 | 5.9K | |
| select-by-query-img0007.png | 2021-04-05 22:50 | 5.9K | |
| double-line-polygon-img0002.png | 2021-04-05 22:49 | 5.9K | |
| using-lte-dynamic-input-img0003.png | 2021-04-05 22:50 | 6.0K | |
| editing-circles-ellipses-and-arcs-img0008.png | 2021-04-05 22:49 | 6.0K | |
| components-of-select-edit-mode-img0003.png | 2021-04-05 22:49 | 6.0K | |
| node-editing-roof-slabs-img0006.png | 2021-04-05 22:49 | 6.0K | |
| arranging-and-snapping-room-boxes-img0001.png | 2021-04-05 22:49 | 6.0K | |
| minimal-distance-img0002.png | 2021-04-05 22:49 | 6.0K | |
| components-of-select-edit-mode-img0002.png | 2021-04-05 22:49 | 6.0K | |
| editing-circles-ellipses-and-arcs-img0002.png | 2021-04-05 22:49 | 6.0K | |
| relocate-origin-img0002.png | 2021-04-05 22:50 | 6.0K | |
| extruding-smesh-faces-img0005.png | 2021-04-05 22:49 | 6.0K | |
| quick-dimensions-img0014.png | 2021-04-05 22:50 | 6.0K | |
| change-chirality-constraint-img0004.png | 2021-04-05 22:49 | 6.0K | |
| selection-info-palette-img0011.png | 2021-04-05 22:50 | 6.0K | |
| equal-radius-constraint-img0004.png | 2021-04-05 22:49 | 6.0K | |
| scale-img0010.png | 2021-04-05 22:50 | 6.1K | |
| editing-dimensions-img0002.png | 2021-04-05 22:49 | 6.1K | |
| colors-and-brushes-img0009.png | 2021-04-05 22:49 | 6.1K | |
| using-a-selection-window-img0003.png | 2021-04-05 22:50 | 6.1K | |
| imprint-img0008.png | 2021-04-05 22:49 | 6.1K | |
| sweep-img0007.png | 2021-04-05 22:50 | 6.1K | |
| arranging-and-snapping-room-boxes-img0008.png | 2021-04-05 22:49 | 6.1K | |
| sheet-metal-gusset-img0007.png | 2021-04-05 22:50 | 6.1K | |
| split-img0011.png | 2021-04-05 22:50 | 6.1K | |
| other-cad-formats-img00101.png | 2021-04-05 22:49 | 6.1K | |
| tangent-from-arc-img0003.png | 2021-04-05 22:50 | 6.1K | |
| inserting-2d-blocks-in-walls-img0003.png | 2021-04-05 22:49 | 6.1K | |
| polyline-img0009.png | 2021-04-05 22:50 | 6.1K | |
| arc-tangent-to-entities-img00031.png | 2021-04-05 22:49 | 6.1K | |
| prism-img0006.png | 2021-04-05 22:50 | 6.1K | |
| double-line-options-img0002.png | 2021-04-05 22:49 | 6.1K | |
| selection-info-palette-img0025.png | 2021-04-05 22:50 | 6.1K | |
| parallel-img0003.png | 2021-04-05 22:50 | 6.1K | |
| sweep-img0004.png | 2021-04-05 22:50 | 6.1K | |
| cone-img0010.png | 2021-04-05 22:49 | 6.1K | |
| chain-polyline-img0004.png | 2021-04-05 22:49 | 6.2K | |
| dimension-properties-img0016.png | 2021-04-05 22:49 | 6.2K | |
| imprint-img0005.png | 2021-04-05 22:49 | 6.2K | |
| selection-info-palette-img0006.png | 2021-04-05 22:50 | 6.2K | |
| copying-objects-in-select-edit-img0010.png | 2021-04-05 22:49 | 6.2K | |
| circle-tangent-to-3-arcs-img0004.png | 2021-04-05 22:49 | 6.2K | |
| redsdk-highlighting-img00011.png | 2021-04-05 22:50 | 6.2K | |
| helix-img0004.png | 2021-04-05 22:49 | 6.2K | |
| object-trim-img0010.png | 2021-04-05 22:49 | 6.2K | |
| trim-img0009.png | 2021-04-05 22:50 | 6.2K | |
| imprint-img0011.png | 2021-04-05 22:49 | 6.2K | |
| editing-segments-img0012.png | 2021-04-05 22:49 | 6.2K | |
| page-layout-wizard-img0013.png | 2021-04-05 22:50 | 6.2K | |
| inserting-walls-img0015.png | 2021-04-05 22:49 | 6.2K | |
| bend-sheet-img0002.png | 2021-04-05 22:49 | 6.2K | |
| multi-landing-stair-img0005.png | 2021-04-05 22:49 | 6.2K | |
| adding-a-node-img0005.png | 2021-04-05 22:49 | 6.2K | |
| cylinder-img0005.png | 2021-04-05 22:49 | 6.3K | |
| arc-tangent-to-entities-img00061.png | 2021-04-05 22:49 | 6.3K | |
| editing-linear-objects-img0012.png | 2021-04-05 22:49 | 6.3K | |
| change-chirality-constraint-img0002.png | 2021-04-05 22:49 | 6.3K | |
| irregular-polygon-img0004.png | 2021-04-05 22:49 | 6.3K | |
| insert-table-img0004.png | 2021-04-05 22:49 | 6.3K | |
| print-options-img0001.png | 2021-04-05 22:50 | 6.3K | |
| polyline-img0017.png | 2021-04-05 22:50 | 6.3K | |
| calculator-palette-variables-palette-img0007.png | 2021-04-05 22:49 | 6.3K | |
| circular-slot-by-center-and-radius-img0005.png | 2021-04-05 22:49 | 6.3K | |
| polyline-img0001.png | 2021-04-05 22:50 | 6.3K | |
| assembling-img0002.png | 2021-04-05 22:49 | 6.3K | |
| bending-and-unbending-img0001.png | 2021-04-05 22:49 | 6.3K | |
| projection-snap-img0003.png | 2021-04-05 22:50 | 6.3K | |
| editing-splines-and-bezier-curves-img0006.png | 2021-04-05 22:49 | 6.3K | |
| render-scene-environment-img0002.png | 2021-04-05 22:50 | 6.3K | |
| additional-manipulation-options-img0001.png | 2021-04-05 22:49 | 6.3K | |
| editing-a-group-img0003.png | 2021-04-05 22:49 | 6.3K | |
| tangent-to-2-arcs-img0001.png | 2021-04-05 22:50 | 6.3K | |
| bend-by-sketch-img0015.png | 2021-04-05 22:49 | 6.3K | |
| text-along-curve-img0003.png | 2021-04-05 22:50 | 6.3K | |
| inserting-text-img0003.png | 2021-04-05 22:49 | 6.3K | |
| sweep-img0008.png | 2021-04-05 22:50 | 6.3K | |
| print-style-options-img0001.png | 2021-04-05 22:50 | 6.3K | |
| tube-flange-img0005.png | 2021-04-05 22:50 | 6.4K | |
| creating-construction-geometry-img0020.png | 2021-04-05 22:49 | 6.4K | |
| multi-line-single-line-img0002.png | 2021-04-05 22:49 | 6.4K | |
| double-line-options-img0003.png | 2021-04-05 22:49 | 6.4K | |
| editing-lights-img0002.png | 2021-04-05 22:49 | 6.4K | |
| multi-shrink-extend-line-img0004.png | 2021-04-05 22:49 | 6.4K | |
| scale-img0008.png | 2021-04-05 22:50 | 6.4K | |
| editing-multiple-nodes-img0003.png | 2021-04-05 22:49 | 6.4K | |
| minimal-distance-img0005.png | 2021-04-05 22:49 | 6.4K | |
| revision-cloud-img0003.png | 2021-04-05 22:50 | 6.4K | |
| interactive-tone-adjustments-img0010.png | 2021-04-05 22:49 | 6.4K | |
| tangent-constraint-img0001.png | 2021-04-05 22:50 | 6.4K | |
| super-selector-modes-img0006.png | 2021-04-05 22:50 | 6.4K | |
| inserting-2d-blocks-in-walls-img0002.png | 2021-04-05 22:49 | 6.4K | |
| arc-tangent-to-entities-img00051.png | 2021-04-05 22:49 | 6.4K | |
| pulling-curved-faces-img0009.png | 2021-04-05 22:50 | 6.4K | |
| double-line-rotated-rectangle-img0002.png | 2021-04-05 22:49 | 6.4K | |
| house-wizard-img0003.png | 2021-04-05 22:49 | 6.4K | |
| extract-entity-img0010.png | 2021-04-05 22:49 | 6.5K | |
| interactive-tone-adjustments-img0011.png | 2021-04-05 22:49 | 6.5K | |
| create-solid-from-face-s-img0006.png | 2021-04-05 22:49 | 6.5K | |
| create-surface-from-face-s-img0006.png | 2021-04-05 22:49 | 6.5K | |
| creating-a-parametric-part-img0036.png | 2021-04-05 22:49 | 6.5K | |
| editing-segments-img0005.png | 2021-04-05 22:49 | 6.5K | |
| super-selector-modes-img0009.png | 2021-04-05 22:50 | 6.5K | |
| split-face-by-isoline-img0002.png | 2021-04-05 22:50 | 6.5K | |
| lofting-img0010.png | 2021-04-05 22:49 | 6.5K | |
| viewport-properties-img0004.png | 2021-04-05 22:50 | 6.5K | |
| multileader-properties-img0002.png | 2021-04-05 22:49 | 6.5K | |
| creating-dimensions-img0016.png | 2021-04-05 22:49 | 6.5K | |
| publish-to-html-options-img0001.png | 2021-04-05 22:50 | 6.5K | |
| select-by-fence-img0002.png | 2021-04-05 22:50 | 6.5K | |
| concentric-constraint-img0001.png | 2021-04-05 22:49 | 6.5K | |
| branched-lofting-img0001.png | 2021-04-05 22:49 | 6.5K | |
| tangent-to-arc-img0004.png | 2021-04-05 22:50 | 6.5K | |
| redsdk-highlighting-img00021.png | 2021-04-05 22:50 | 6.5K | |
| editing-multi-text-img0005.png | 2021-04-05 22:49 | 6.5K | |
| tangent-to-arc-img0002.png | 2021-04-05 22:50 | 6.5K | |
| changing-the-workplane-img0010.png | 2021-04-05 22:49 | 6.5K | |
| node-editing-roof-slabs-img0007.png | 2021-04-05 22:49 | 6.6K | |
| step-4-create-the-report-img0008.png | 2021-04-05 22:50 | 6.6K | |
| nudge-img0003.png | 2021-04-05 22:49 | 6.6K | |
| add-face-img0003.png | 2021-04-05 22:49 | 6.6K | |
| quick-pull-img0003.png | 2021-04-05 22:50 | 6.6K | |
| multi-line-properties-img0007.png | 2021-04-05 22:49 | 6.6K | |
| minimal-distance-img0004.png | 2021-04-05 22:49 | 6.6K | |
| colors-and-brushes-img0013.png | 2021-04-05 22:49 | 6.6K | |
| offset-img0002.png | 2021-04-05 22:49 | 6.6K | |
| flange-img0005.png | 2021-04-05 22:49 | 6.6K | |
| changing-the-workplane-img0019.png | 2021-04-05 22:49 | 6.6K | |
| bend-by-sketch-img0011.png | 2021-04-05 22:49 | 6.6K | |
| bend-by-sketch-img0007.png | 2021-04-05 22:49 | 6.6K | |
| 2d-geometric-parameters-img0006.png | 2021-04-05 22:49 | 6.6K | |
| minimal-distance-img0003.png | 2021-04-05 22:49 | 6.7K | |
| object-trim-img0006.png | 2021-04-05 22:49 | 6.7K | |
| vector-copy-img0002.png | 2021-04-05 22:50 | 6.7K | |
| gear-contour-img0002.png | 2021-04-05 22:49 | 6.7K | |
| multi-shrink-extend-line-img0003.png | 2021-04-05 22:49 | 6.7K | |
| profile-editing-img0013.png | 2021-04-05 22:50 | 6.7K | |
| moving-a-node-img0006.png | 2021-04-05 22:49 | 6.7K | |
| segment-and-entity-dimensioning-img0003.png | 2021-04-05 22:50 | 6.7K | |
| page-setup-wizard-img0006.png | 2021-04-05 22:50 | 6.7K | |
| hemisphere-img0004.png | 2021-04-05 22:49 | 6.7K | |
| calculator-palette-variables-palette-img0010.png | 2021-04-05 22:49 | 6.7K | |
| moving-objects-in-select-edit-img0001.png | 2021-04-05 22:49 | 6.7K | |
| standard-views-img0001.png | 2021-04-05 22:50 | 6.7K | |
| circle-tangent-to-3-arcs-img00021.png | 2021-04-05 22:49 | 6.7K | |
| trace-by-rectangle-img0005.png | 2021-04-05 22:50 | 6.7K | |
| door-styles-img0029.png | 2021-04-05 22:49 | 6.7K | |
| select-by-entity-type-img0001.png | 2021-04-05 22:50 | 6.7K | |
| multileader-properties-img0001.png | 2021-04-05 22:49 | 6.7K | |
| bend-by-sketch-img0016.png | 2021-04-05 22:49 | 6.7K | |
| pulling-curved-faces-img0002.png | 2021-04-05 22:50 | 6.7K | |
| copying-objects-in-select-edit-img0018.png | 2021-04-05 22:49 | 6.8K | |
| calculator-palette-variables-palette-img0002.png | 2021-04-05 22:49 | 6.8K | |
| constraining-dimensions-img0012.png | 2021-04-05 22:49 | 6.8K | |
| bend-by-sketch-img0010.png | 2021-04-05 22:49 | 6.8K | |
| editing-redsdk-luminances-img00011.png | 2021-04-05 22:49 | 6.8K | |
| sketch-img0003.png | 2021-04-05 22:50 | 6.8K | |
| transform-recorder-img0010.png | 2021-04-05 22:50 | 6.8K | |
| table-import-xlsx-img0007.png | 2021-04-05 22:50 | 6.8K | |
| rail-sweep-img0006.png | 2021-04-05 22:50 | 6.8K | |
| components-of-select-edit-mode-img0004.png | 2021-04-05 22:49 | 6.8K | |
| point-clouds-img0001.png | 2021-04-05 22:50 | 6.8K | |
| lofting-img0004.png | 2021-04-05 22:49 | 6.8K | |
| sweep-img0011.png | 2021-04-05 22:50 | 6.8K | |
| simple-extrude-img0008.png | 2021-04-05 22:50 | 6.8K | |
| sweep-img0020.png | 2021-04-05 22:50 | 6.8K | |
| twisted-extrude-img0008.png | 2021-04-05 22:50 | 6.8K | |
| polyline-img0004.png | 2021-04-05 22:50 | 6.8K | |
| editing-text-img0002.png | 2021-04-05 22:49 | 6.8K | |
| pulling-curved-faces-img0010.png | 2021-04-05 22:50 | 6.8K | |
| splines-and-bezier-curves-img0009.png | 2021-04-05 22:50 | 6.8K | |
| tube-flange-img0006.png | 2021-04-05 22:50 | 6.8K | |
| arc-tangent-to-3-arcs-img0005.png | 2021-04-05 22:49 | 6.9K | |
| branched-lofting-img0004.png | 2021-04-05 22:49 | 6.9K | |
| sweep-img0018.png | 2021-04-05 22:50 | 6.9K | |
| calculator-palette-variables-palette-img0011.png | 2021-04-05 22:49 | 6.9K | |
| sketch-style-img0012.png | 2021-04-05 22:50 | 6.9K | |
| coincident-constraint-img0008.png | 2021-04-05 22:49 | 6.9K | |
| extended-ortho-snap-img0004.png | 2021-04-05 22:49 | 6.9K | |
| measuring-angles-img0004.png | 2021-04-05 22:49 | 6.9K | |
| tube-flange-img0003.png | 2021-04-05 22:50 | 6.9K | |
| concentric-constraint-img0002.png | 2021-04-05 22:49 | 6.9K | |
| redsdk-materials-examples-img00131.png | 2021-04-05 22:50 | 6.9K | |
| minimal-distance-img0008.png | 2021-04-05 22:49 | 6.9K | |
| super-selector-modes-img0003.png | 2021-04-05 22:50 | 6.9K | |
| aligning-objects-img0003.png | 2021-04-05 22:49 | 6.9K | |
| circle-tangent-to-3-arcs-img00031.png | 2021-04-05 22:49 | 6.9K | |
| creating-hatch-patterns-img0002.png | 2021-04-05 22:49 | 6.9K | |
| branched-lofting-img0003.png | 2021-04-05 22:49 | 6.9K | |
| multi-landing-stair-img0013.png | 2021-04-05 22:49 | 6.9K | |
| multi-line-rectangle-img0002.png | 2021-04-05 22:49 | 6.9K | |
| extend-roof-slab-img0008.png | 2021-04-05 22:49 | 6.9K | |
| offset-img0001.png | 2021-04-05 22:49 | 6.9K | |
| multi-line-properties-img0002.png | 2021-04-05 22:49 | 6.9K | |
| projection-snap-img0004.png | 2021-04-05 22:50 | 7.0K | |
| tangent-to-arc-img0003.png | 2021-04-05 22:50 | 7.0K | |
| insert-table-img0011.png | 2021-04-05 22:49 | 7.0K | |
| adding-a-node-img0006.png | 2021-04-05 22:49 | 7.0K | |
| revolve-img0029.png | 2021-04-05 22:50 | 7.0K | |
| page-setup-wizard-img0002.png | 2021-04-05 22:50 | 7.0K | |
| minimal-distance-img0007.png | 2021-04-05 22:49 | 7.0K | |
| variable-blend-img0008.png | 2021-04-05 22:50 | 7.0K | |
| other-cad-formats-img00171.png | 2021-04-05 22:49 | 7.0K | |
| breaking-opening-closed-objects-img0002.png | 2021-04-05 22:49 | 7.0K | |
| render-camera-properties-img0008.png | 2021-04-05 22:50 | 7.0K | |
| sweep-img0017.png | 2021-04-05 22:50 | 7.0K | |
| smoothness-level-img0003.png | 2021-04-05 22:50 | 7.0K | |
| equal-distance-constraint-img0006.png | 2021-04-05 22:49 | 7.0K | |
| other-cad-formats-img00131.png | 2021-04-05 22:49 | 7.0K | |
| block-attributes-img0008.png | 2021-04-05 22:49 | 7.0K | |
| circle-concentric-img0004.png | 2021-04-05 22:49 | 7.0K | |
| multi-shrink-extend-line-img0002.png | 2021-04-05 22:49 | 7.0K | |
| multi-line-properties-img0005.png | 2021-04-05 22:49 | 7.1K | |
| surface-from-laws-img0001.png | 2021-04-05 22:50 | 7.1K | |
| warp-by-law-img0001.png | 2021-04-05 22:50 | 7.1K | |
| add-face-img0004.png | 2021-04-05 22:49 | 7.1K | |
| managing-render-styles-in-the-render-manager-img0004.png | 2021-04-05 22:49 | 7.1K | |
| 2d-3d-selector-img0007.png | 2021-04-05 22:49 | 7.1K | |
| selector-2d-parts-img0003.png | 2021-04-05 22:50 | 7.1K | |
| the-camera-img0002.png | 2021-04-05 22:50 | 7.1K | |
| closing-open-objects-img0002.png | 2021-04-05 22:49 | 7.1K | |
| sweep-img0016.png | 2021-04-05 22:50 | 7.1K | |
| tangent-to-2-arcs-img0003.png | 2021-04-05 22:50 | 7.1K | |
| insert-table-img0009.png | 2021-04-05 22:49 | 7.1K | |
| branched-lofting-img0002.png | 2021-04-05 22:49 | 7.1K | |
| table-import-xlsx-img0001.png | 2021-04-05 22:50 | 7.1K | |
| arranging-and-snapping-room-boxes-img0003.png | 2021-04-05 22:49 | 7.1K | |
| using-a-selection-window-img0006.png | 2021-04-05 22:50 | 7.1K | |
| snap-settings-img0002.png | 2021-04-05 22:50 | 7.1K | |
| creating-dimensions-img0020.png | 2021-04-05 22:49 | 7.1K | |
| tangent-arc-point-img0003.png | 2021-04-05 22:50 | 7.1K | |
| interactive-tone-adjustments-img0001.png | 2021-04-05 22:49 | 7.1K | |
| colors-and-brushes-img0012.png | 2021-04-05 22:49 | 7.1K | |
| constraining-dimensions-img0019.png | 2021-04-05 22:49 | 7.1K | |
| change-chirality-constraint-img0006.png | 2021-04-05 22:49 | 7.1K | |
| sheet-metal-gusset-img0006.png | 2021-04-05 22:50 | 7.1K | |
| moving-a-node-img0001.png | 2021-04-05 22:49 | 7.1K | |
| assemble-by-tangents-img0006.png | 2021-04-05 22:49 | 7.1K | |
| other-cad-formats-img00121.png | 2021-04-05 22:49 | 7.1K | |
| creating-construction-geometry-img0002.png | 2021-04-05 22:49 | 7.2K | |
| multi-line-properties-img0004.png | 2021-04-05 22:49 | 7.2K | |
| interactive-tone-adjustments-img0017.png | 2021-04-05 22:49 | 7.2K | |
| model-shaders-and-applications-shaders-img0002.png | 2021-04-05 22:49 | 7.2K | |
| split-img0013.png | 2021-04-05 22:50 | 7.2K | |
| interactive-tone-adjustments-img0013.png | 2021-04-05 22:49 | 7.2K | |
| coincident-constraint-img0006.png | 2021-04-05 22:49 | 7.2K | |
| mirror-copy-img0001.png | 2021-04-05 22:49 | 7.2K | |
| native-draw-img0001.png | 2021-04-05 22:49 | 7.2K | |
| minimal-distance-img0006.png | 2021-04-05 22:49 | 7.2K | |
| interactive-tone-adjustments-img0006.png | 2021-04-05 22:49 | 7.2K | |
| quick-dimensions-img0010.png | 2021-04-05 22:50 | 7.2K | |
| hatch-img0003.png | 2021-04-05 22:49 | 7.2K | |
| 2d-add-img0004.png | 2021-04-05 22:49 | 7.2K | |
| inserting-viewports-img0005.png | 2021-04-05 22:49 | 7.2K | |
| editing-a-block-img0003.png | 2021-04-05 22:49 | 7.2K | |
| redsdk-img00011.png | 2021-04-05 22:50 | 7.2K | |
| extend-roof-slab-img0010.png | 2021-04-05 22:49 | 7.2K | |
| tangent-arc-point-img0004.png | 2021-04-05 22:50 | 7.2K | |
| managing-materials-in-the-render-manager-img0004.png | 2021-04-05 22:49 | 7.2K | |
| multi-text-img0020.png | 2021-04-05 22:49 | 7.2K | |
| other-cad-formats-img00191.png | 2021-04-05 22:49 | 7.2K | |
| 3d-slice-img0015.png | 2021-04-05 22:49 | 7.2K | |
| bend-by-sketch-img0017.png | 2021-04-05 22:49 | 7.2K | |
| add-face-img0005.png | 2021-04-05 22:49 | 7.2K | |
| 3d-slice-img0017.png | 2021-04-05 22:49 | 7.2K | |
| interactive-tone-adjustments-img0015.png | 2021-04-05 22:49 | 7.2K | |
| interactive-tone-adjustments-img0004.png | 2021-04-05 22:49 | 7.2K | |
| additional-manipulation-options-img0002.png | 2021-04-05 22:49 | 7.2K | |
| design-director-views-img0001.png | 2021-04-05 22:49 | 7.3K | |
| 2d-subtract-img0005.png | 2021-04-05 22:49 | 7.3K | |
| tangent-snap-img0002.png | 2021-04-05 22:50 | 7.3K | |
| interactive-tone-adjustments-img0008.png | 2021-04-05 22:49 | 7.3K | |
| changing-the-workplane-img0012.png | 2021-04-05 22:49 | 7.3K | |
| lofting-img0022.png | 2021-04-05 22:49 | 7.3K | |
| creating-a-parametric-part-img0002.png | 2021-04-05 22:49 | 7.3K | |
| equal-distance-constraint-img0007.png | 2021-04-05 22:49 | 7.3K | |
| quick-dimensions-img0009.png | 2021-04-05 22:50 | 7.3K | |
| imprint-edge-img0004.png | 2021-04-05 22:49 | 7.3K | |
| auto-constraint-img0008.png | 2021-04-05 22:49 | 7.3K | |
| customize-options-img0003.png | 2021-04-05 22:49 | 7.3K | |
| smart-dimensions-img0005.png | 2021-04-05 22:50 | 7.3K | |
| changing-the-workplane-img0020.png | 2021-04-05 22:49 | 7.3K | |
| imprint-img0001.png | 2021-04-05 22:49 | 7.3K | |
| add-face-img0006.png | 2021-04-05 22:49 | 7.3K | |
| revolve-img0025.png | 2021-04-05 22:50 | 7.3K | |
| arc-tangent-to-entities-img00071.png | 2021-04-05 22:49 | 7.4K | |
| arrow-arc-img0001.png | 2021-04-05 22:49 | 7.4K | |
| surface-from-laws-img0002.png | 2021-04-05 22:50 | 7.4K | |
| warp-by-law-img0002.png | 2021-04-05 22:50 | 7.4K | |
| constraining-dimensions-img0008.png | 2021-04-05 22:49 | 7.4K | |
| imprint-img0006.png | 2021-04-05 22:49 | 7.4K | |
| bend-sheet-img0009.png | 2021-04-05 22:49 | 7.4K | |
| selecting-smesh-faces-img0002.png | 2021-04-05 22:50 | 7.4K | |
| selecting-smesh-nodes-img0004.png | 2021-04-05 22:50 | 7.4K | |
| advanced-preferences-img0003.png | 2021-04-05 22:49 | 7.4K | |
| constraining-dimensions-img0004.png | 2021-04-05 22:49 | 7.4K | |
| polyline-img0012.png | 2021-04-05 22:50 | 7.4K | |
| format-painter-img0002.png | 2021-04-05 22:49 | 7.4K | |
| symmetric-constraint-img0011.png | 2021-04-05 22:50 | 7.4K | |
| image-map-general-img0002.png | 2021-04-05 22:49 | 7.4K | |
| wire-wrap-img0007.png | 2021-04-05 22:50 | 7.4K | |
| revolve-img0026.png | 2021-04-05 22:50 | 7.4K | |
| arrow-line-img0001.png | 2021-04-05 22:49 | 7.4K | |
| polyline-img0013.png | 2021-04-05 22:50 | 7.4K | |
| multi-text-img0004.png | 2021-04-05 22:49 | 7.4K | |
| customize-palettes-img0001.png | 2021-04-05 22:49 | 7.4K | |
| vector-copy-img0003.png | 2021-04-05 22:50 | 7.4K | |
| curve-from-law-img0002.png | 2021-04-05 22:49 | 7.4K | |
| database-connection-palette-img0005.png | 2021-04-05 22:49 | 7.4K | |
| u-shaped-stair-img0003.png | 2021-04-05 22:50 | 7.4K | |
| closing-open-objects-img0003.png | 2021-04-05 22:49 | 7.4K | |
| create-surface-from-solid-img0002.png | 2021-04-05 22:49 | 7.5K | |
| merge-smesh-img0001.png | 2021-04-05 22:49 | 7.5K | |
| associative-hatching-img0001.png | 2021-04-05 22:49 | 7.5K | |
| tube-bend-img0006.png | 2021-04-05 22:50 | 7.5K | |
| pick-point-and-hatch-img0003.png | 2021-04-05 22:50 | 7.5K | |
| multi-landing-stair-img0008.png | 2021-04-05 22:49 | 7.5K | |
| variable-blend-img0005.png | 2021-04-05 22:50 | 7.5K | |
| other-cad-formats-img00221.png | 2021-04-05 22:49 | 7.5K | |
| tangent-to-2-arcs-img0002.png | 2021-04-05 22:50 | 7.5K | |
| creating-standard-views-img0012.png | 2021-04-05 22:49 | 7.5K | |
| other-cad-formats-img00291.png | 2021-04-05 22:49 | 7.5K | |
| inserting-text-img0006.png | 2021-04-05 22:49 | 7.5K | |
| editing-dimensions-img0001.png | 2021-04-05 22:49 | 7.5K | |
| rotated-rectangle-img0003.png | 2021-04-05 22:50 | 7.5K | |
| edit-tool-in-3d-img0004.png | 2021-04-05 22:49 | 7.5K | |
| editing-linear-objects-img0009.png | 2021-04-05 22:49 | 7.5K | |
| insert-table-img0015.png | 2021-04-05 22:49 | 7.5K | |
| add-roof-img0003.png | 2021-04-05 22:49 | 7.5K | |
| editing-linear-objects-img0011.png | 2021-04-05 22:49 | 7.5K | |
| smoothness-level-img0001.png | 2021-04-05 22:50 | 7.5K | |
| block-attributes-img0003.png | 2021-04-05 22:49 | 7.5K | |
| stacking-objects-img0005.png | 2021-04-05 22:50 | 7.5K | |
| split-img0012.png | 2021-04-05 22:50 | 7.6K | |
| array-copy-img0004.png | 2021-04-05 22:49 | 7.6K | |
| multi-landing-stair-img0014.png | 2021-04-05 22:49 | 7.6K | |
| add-face-img0008.png | 2021-04-05 22:49 | 7.6K | |
| editing-multi-text-img0003.png | 2021-04-05 22:49 | 7.6K | |
| moving-a-node-img0002.png | 2021-04-05 22:49 | 7.6K | |
| fit-linear-copy-img0003.png | 2021-04-05 22:49 | 7.6K | |
| multi-line-perpendicular-img0002.png | 2021-04-05 22:49 | 7.6K | |
| quick-dimensions-img0005.png | 2021-04-05 22:50 | 7.6K | |
| slab-styles-img0001.png | 2021-04-05 22:50 | 7.6K | |
| select-by-attribute-img0001.png | 2021-04-05 22:50 | 7.6K | |
| creating-construction-geometry-img0021.png | 2021-04-05 22:49 | 7.6K | |
| editing-dimensions-img0004.png | 2021-04-05 22:49 | 7.6K | |
| managing-materials-in-the-render-manager-img0006.png | 2021-04-05 22:49 | 7.6K | |
| revolve-img0027.png | 2021-04-05 22:50 | 7.6K | |
| design-director-lights-img0001.png | 2021-04-05 22:49 | 7.6K | |
| layer-sets-img0001.png | 2021-04-05 22:49 | 7.6K | |
| inserting-a-block-img0001.png | 2021-04-05 22:49 | 7.6K | |
| image-manager-palette-img0001.png | 2021-04-05 22:49 | 7.7K | |
| tube-bend-img0002.png | 2021-04-05 22:50 | 7.7K | |
| sweep-img0019.png | 2021-04-05 22:50 | 7.7K | |
| using-the-environments-palette-img0007.png | 2021-04-05 22:50 | 7.7K | |
| tangent-to-arc-img0005.png | 2021-04-05 22:50 | 7.7K | |
| slab-styles-img0002.png | 2021-04-05 22:50 | 7.7K | |
| constraining-dimensions-img0006.png | 2021-04-05 22:49 | 7.7K | |
| constraining-dimensions-img0017.png | 2021-04-05 22:49 | 7.7K | |
| measuring-distance-img0002.png | 2021-04-05 22:49 | 7.7K | |
| surveyor-dimensions-img0005.png | 2021-04-05 22:50 | 7.7K | |
| move-img0005.png | 2021-04-05 22:49 | 7.7K | |
| profile-styles-img0006.png | 2021-04-05 22:50 | 7.7K | |
| dimension-properties-img0010.png | 2021-04-05 22:49 | 7.7K | |
| associative-hatching-img0002.png | 2021-04-05 22:49 | 7.8K | |
| revision-cloud-img0004.png | 2021-04-05 22:50 | 7.8K | |
| trim-img0008.png | 2021-04-05 22:50 | 7.8K | |
| angle-options-img0001.png | 2021-04-05 22:49 | 7.8K | |
| add-face-img0007.png | 2021-04-05 22:49 | 7.8K | |
| creating-construction-geometry-img0009.png | 2021-04-05 22:49 | 7.8K | |
| editing-linear-objects-img0013.png | 2021-04-05 22:49 | 7.8K | |
| object-trim-img0009.png | 2021-04-05 22:49 | 7.8K | |
| equal-distance-constraint-img0008.png | 2021-04-05 22:49 | 7.8K | |
| using-the-materials-palette-img0009.png | 2021-04-05 22:50 | 7.8K | |
| arranging-and-snapping-room-boxes-img0004.png | 2021-04-05 22:49 | 7.8K | |
| offset-img0003.png | 2021-04-05 22:49 | 7.8K | |
| editing-imprint-parameters-img0002.png | 2021-04-05 22:49 | 7.8K | |
| tangent-constraint-img0002.png | 2021-04-05 22:50 | 7.9K | |
| stacking-objects-img0002.png | 2021-04-05 22:50 | 7.9K | |
| tangent-constraint-img0007.png | 2021-04-05 22:50 | 7.9K | |
| object-trim-img0018.png | 2021-04-05 22:49 | 7.9K | |
| creating-standard-views-img0009.png | 2021-04-05 22:49 | 7.9K | |
| multilanding-stair-by-path-img0005.png | 2021-04-05 22:49 | 7.9K | |
| dimension-properties-img0011.png | 2021-04-05 22:49 | 7.9K | |
| stacking-objects-img0006.png | 2021-04-05 22:50 | 7.9K | |
| offset-with-law-img0003.png | 2021-04-05 22:49 | 7.9K | |
| weld-symbols-img0002.png | 2021-04-05 22:50 | 7.9K | |
| tube-bend-img0005.png | 2021-04-05 22:50 | 7.9K | |
| curve-properties-img0010.png | 2021-04-05 22:49 | 7.9K | |
| assemble-by-tangents-img0013.png | 2021-04-05 22:49 | 7.9K | |
| equal-distance-constraint-img0009.png | 2021-04-05 22:49 | 7.9K | |
| constraining-dimensions-img0014.png | 2021-04-05 22:49 | 7.9K | |
| arranging-and-snapping-room-boxes-img0005.png | 2021-04-05 22:49 | 7.9K | |
| editing-dimensions-img0006.png | 2021-04-05 22:49 | 7.9K | |
| fit-array-copy-img0002.png | 2021-04-05 22:49 | 7.9K | |
| insert-table-img0017.png | 2021-04-05 22:49 | 7.9K | |
| step-4-create-the-report-img0007.png | 2021-04-05 22:50 | 8.0K | |
| symmetric-constraint-img0012.png | 2021-04-05 22:50 | 8.0K | |
| selection-info-palette-img0008.png | 2021-04-05 22:50 | 8.0K | |
| nudge-img0004.png | 2021-04-05 22:49 | 8.0K | |
| center-snap-img0002.png | 2021-04-05 22:49 | 8.0K | |
| offset-with-law-img0004.png | 2021-04-05 22:49 | 8.0K | |
| multi-line-properties-img0003.png | 2021-04-05 22:49 | 8.0K | |
| symmetric-constraint-img0013.png | 2021-04-05 22:50 | 8.0K | |
| text-properties-img0001.png | 2021-04-05 22:50 | 8.0K | |
| editing-splines-and-bezier-curves-img0004.png | 2021-04-05 22:49 | 8.0K | |
| profile-styles-img0020.png | 2021-04-05 22:50 | 8.0K | |
| select-by-fence-img0004.png | 2021-04-05 22:50 | 8.0K | |
| arc-tangent-to-3-arcs-img0004.png | 2021-04-05 22:49 | 8.0K | |
| place-on-workplane-img0002.png | 2021-04-05 22:50 | 8.0K | |
| rail-sweep-img0008.png | 2021-04-05 22:50 | 8.0K | |
| stacking-objects-img0003.png | 2021-04-05 22:50 | 8.0K | |
| creating-dimensions-img0021.png | 2021-04-05 22:49 | 8.0K | |
| irregular-polygon-img0005.png | 2021-04-05 22:49 | 8.0K | |
| colors-and-brushes-img0014.png | 2021-04-05 22:49 | 8.0K | |
| nudge-img0002.png | 2021-04-05 22:49 | 8.1K | |
| selection-info-palette-img0032.png | 2021-04-05 22:50 | 8.1K | |
| symmetric-constraint-img0010.png | 2021-04-05 22:50 | 8.1K | |
| lofting-img0002.png | 2021-04-05 22:49 | 8.1K | |
| sweep-img0006.png | 2021-04-05 22:50 | 8.1K | |
| nudge-img0005.png | 2021-04-05 22:49 | 8.1K | |
| edit-tool-in-3d-img0012.png | 2021-04-05 22:49 | 8.1K | |
| hatch-img0002.png | 2021-04-05 22:49 | 8.1K | |
| circular-slot-img0004.png | 2021-04-05 22:49 | 8.1K | |
| calculator-palette-variables-palette-img0008.png | 2021-04-05 22:49 | 8.1K | |
| editing-dimensions-img0005.png | 2021-04-05 22:49 | 8.1K | |
| editing-splines-and-bezier-curves-img0015.png | 2021-04-05 22:49 | 8.2K | |
| dimension-properties-img0009.png | 2021-04-05 22:49 | 8.2K | |
| extrude-to-face-img0004.png | 2021-04-05 22:49 | 8.2K | |
| split-img0010.png | 2021-04-05 22:50 | 8.2K | |
| skylight-portals-img0001.png | 2021-04-05 22:50 | 8.2K | |
| using-the-luminances-palette-img0008.png | 2021-04-05 22:50 | 8.2K | |
| polyline-img0006.png | 2021-04-05 22:50 | 8.2K | |
| polyline-img0014.png | 2021-04-05 22:50 | 8.2K | |
| creating-dimensions-img0018.png | 2021-04-05 22:49 | 8.2K | |
| creating-a-rendered-view-img0007.png | 2021-04-05 22:49 | 8.2K | |
| other-cad-formats-img00071.png | 2021-04-05 22:49 | 8.2K | |
| quicktime-movies-img0001.png | 2021-04-05 22:50 | 8.2K | |
| editing-multiple-nodes-img0007.png | 2021-04-05 22:49 | 8.2K | |
| sheet-metal-gusset-img0011.png | 2021-04-05 22:50 | 8.2K | |
| creating-a-parametric-part-img0004.png | 2021-04-05 22:49 | 8.2K | |
| fit-array-copy-img0004.png | 2021-04-05 22:49 | 8.2K | |
| array-copy-img0002.png | 2021-04-05 22:49 | 8.2K | |
| constraining-dimensions-img0020.png | 2021-04-05 22:49 | 8.2K | |
| aligning-objects-img0005.png | 2021-04-05 22:49 | 8.2K | |
| sheet-metal-gusset-img0014.png | 2021-04-05 22:50 | 8.2K | |
| calculator-palette-variables-palette-img0012.png | 2021-04-05 22:49 | 8.2K | |
| revolve-img0003.png | 2021-04-05 22:50 | 8.3K | |
| arc-tangent-to-3-arcs-img0003.png | 2021-04-05 22:49 | 8.3K | |
| inserting-text-img0002.png | 2021-04-05 22:49 | 8.3K | |
| simple-extrude-img0005.png | 2021-04-05 22:50 | 8.3K | |
| geo-location-img0001.png | 2021-04-05 22:49 | 8.3K | |
| database-connection-palette-img0004.png | 2021-04-05 22:49 | 8.3K | |
| tc-surface-properties-img0003.png | 2021-04-05 22:50 | 8.3K | |
| extract-entity-img0009.png | 2021-04-05 22:49 | 8.3K | |
| line-styles-img0003.png | 2021-04-05 22:49 | 8.3K | |
| constraining-dimensions-img0026.png | 2021-04-05 22:49 | 8.3K | |
| preferences-img0002.png | 2021-04-05 22:50 | 8.3K | |
| construction-geometry-img0001.png | 2021-04-05 22:49 | 8.3K | |
| add-roof-img0005.png | 2021-04-05 22:49 | 8.3K | |
| changing-the-workplane-img0004.png | 2021-04-05 22:49 | 8.3K | |
| inserting-text-img0005.png | 2021-04-05 22:49 | 8.4K | |
| cone-img0015.png | 2021-04-05 22:49 | 8.4K | |
| calculator-palette-variables-palette-img0013.png | 2021-04-05 22:49 | 8.4K | |
| creating-a-parametric-part-img0026.png | 2021-04-05 22:49 | 8.4K | |
| terrain-img0013.png | 2021-04-05 22:50 | 8.4K | |
| arc-tangent-to-entities-img0005.png | 2021-04-05 22:49 | 8.4K | |
| terrain-img0015.png | 2021-04-05 22:50 | 8.4K | |
| other-cad-formats-img00151.png | 2021-04-05 22:49 | 8.4K | |
| imprint-img0020.png | 2021-04-05 22:49 | 8.4K | |
| managing-render-styles-in-the-render-manager-img0006.png | 2021-04-05 22:49 | 8.4K | |
| colors-and-brushes-img0016.png | 2021-04-05 22:49 | 8.4K | |
| simple-extrude-img0002.png | 2021-04-05 22:50 | 8.4K | |
| pulling-curved-faces-img0004.png | 2021-04-05 22:50 | 8.4K | |
| multi-landing-stair-img0015.png | 2021-04-05 22:49 | 8.5K | |
| quick-pull-img0006.png | 2021-04-05 22:50 | 8.5K | |
| selection-info-palette-img0013.png | 2021-04-05 22:50 | 8.5K | |
| u-shaped-stair-img0005.png | 2021-04-05 22:50 | 8.5K | |
| split-img0014.png | 2021-04-05 22:50 | 8.5K | |
| join-coplanar-faces-img0003.png | 2021-04-05 22:49 | 8.5K | |
| creating-a-parametric-part-img0010.png | 2021-04-05 22:49 | 8.5K | |
| inserting-walls-img0014.png | 2021-04-05 22:49 | 8.6K | |
| change-chirality-constraint-img0007.png | 2021-04-05 22:49 | 8.6K | |
| imprint-edge-img0003.png | 2021-04-05 22:49 | 8.6K | |
| workplanes-img0002.png | 2021-04-05 22:50 | 8.6K | |
| join-coplanar-faces-img0002.png | 2021-04-05 22:49 | 8.6K | |
| status-bar-img0001.png | 2021-04-05 22:50 | 8.6K | |
| creating-construction-geometry-img0024.png | 2021-04-05 22:49 | 8.6K | |
| managing-render-styles-in-the-render-manager-img0005.png | 2021-04-05 22:49 | 8.6K | |
| split-img0015.png | 2021-04-05 22:50 | 8.6K | |
| moving-a-node-img0003.png | 2021-04-05 22:49 | 8.6K | |
| other-cad-formats-img00281.png | 2021-04-05 22:49 | 8.6K | |
| intersect-2-double-lines-img0003.png | 2021-04-05 22:49 | 8.6K | |
| managing-materials-in-the-render-manager-img0005.png | 2021-04-05 22:49 | 8.6K | |
| turbocad-formats-1-2018-10-05.png | 2021-04-05 22:50 | 8.6K | |
| arc-tangent-to-3-arcs-img0006.png | 2021-04-05 22:49 | 8.6K | |
| surface-roughness-img0002.png | 2021-04-05 22:50 | 8.6K | |
| workplane-intersections-snap-img0003.png | 2021-04-05 22:50 | 8.6K | |
| creating-standard-views-img0014.png | 2021-04-05 22:49 | 8.6K | |
| fit-radial-copy-img0003.png | 2021-04-05 22:49 | 8.7K | |
| create-surface-from-solid-img0005.png | 2021-04-05 22:49 | 8.7K | |
| acis-img0003.png | 2021-04-05 22:49 | 8.7K | |
| surveyor-dimensions-img0003.png | 2021-04-05 22:50 | 8.7K | |
| rotated-box-img0003.png | 2021-04-05 22:50 | 8.8K | |
| rays-img0002.png | 2021-04-05 22:50 | 8.8K | |
| brush-styles-img0012.png | 2021-04-05 22:49 | 8.8K | |
| quick-dimensions-img0006.png | 2021-04-05 22:50 | 8.8K | |
| multi-line-properties-img0010.png | 2021-04-05 22:49 | 8.8K | |
| stacking-objects-img0004.png | 2021-04-05 22:50 | 8.8K | |
| terrain-modifier-img0004.png | 2021-04-05 22:50 | 8.8K | |
| fix-geometry-constraint-img0009.png | 2021-04-05 22:49 | 8.8K | |
| transform-recorder-img0005.png | 2021-04-05 22:50 | 8.8K | |
| custom-blocks-for-windows-and-doors-img0001.png | 2021-04-05 22:49 | 8.9K | |
| trace-by-rectangle-img0011.png | 2021-04-05 22:50 | 8.9K | |
| copying-objects-in-select-edit-img0013.png | 2021-04-05 22:49 | 8.9K | |
| terrain-img0011.png | 2021-04-05 22:50 | 8.9K | |
| macro-recorder-img0002.png | 2021-04-05 22:49 | 8.9K | |
| breaking-opening-closed-objects-img0003.png | 2021-04-05 22:49 | 8.9K | |
| imprint-img0018.png | 2021-04-05 22:49 | 8.9K | |
| ifc-bim-data-1-2018-04-25-12.png | 2021-04-05 22:49 | 8.9K | |
| macro-recorder-img0004.png | 2021-04-05 22:49 | 8.9K | |
| multilanding-stair-by-path-img0004.png | 2021-04-05 22:49 | 8.9K | |
| insert-table-img0016.png | 2021-04-05 22:49 | 8.9K | |
| tc-coordinates-export-1-2018-04-23.png | 2021-04-05 22:50 | 9.0K | |
| thread-3d-img0004.png | 2021-04-05 22:50 | 9.0K | |
| toolbars-img0003.png | 2021-04-05 22:50 | 9.0K | |
| using-the-advanced-render-styles-palette-img0007.png | 2021-04-05 22:50 | 9.0K | |
| drafting-palette-toolbar-img0002.png | 2021-04-05 22:49 | 9.0K | |
| extended-ortho-snap-img0003.png | 2021-04-05 22:49 | 9.0K | |
| imprint-subtract-img0003.png | 2021-04-05 22:49 | 9.0K | |
| linear-copy-img0001.png | 2021-04-05 22:49 | 9.0K | |
| changing-the-workplane-img0014.png | 2021-04-05 22:49 | 9.0K | |
| lofting-img0009.png | 2021-04-05 22:49 | 9.0K | |
| join-coplanar-faces-img0005.png | 2021-04-05 22:49 | 9.0K | |
| constraining-dimensions-img0007.png | 2021-04-05 22:49 | 9.0K | |
| house-wizard-img0004.png | 2021-04-05 22:49 | 9.0K | |
| bend-by-sketch-img0014.png | 2021-04-05 22:49 | 9.0K | |
| creating-a-parametric-part-img0019.png | 2021-04-05 22:49 | 9.0K | |
| projection-snap-img0005.png | 2021-04-05 22:50 | 9.1K | |
| constraining-dimensions-img0021.png | 2021-04-05 22:49 | 9.1K | |
| auto-constraint-img0009.png | 2021-04-05 22:49 | 9.1K | |
| trim-img0002.png | 2021-04-05 22:50 | 9.1K | |
| database-connection-palette-img0008.png | 2021-04-05 22:49 | 9.1K | |
| edit-tool-in-3d-img0010.png | 2021-04-05 22:49 | 9.1K | |
| 2d-add-img0005.png | 2021-04-05 22:49 | 9.1K | |
| split-face-img0002.png | 2021-04-05 22:50 | 9.1K | |
| tc-explorer-toolbar-img0009.png | 2021-04-05 22:50 | 9.1K | |
| opposite-mirror-point-snap-img0003.png | 2021-04-05 22:49 | 9.1K | |
| architecture-tools-img0001.png | 2021-04-05 22:49 | 9.1K | |
| page-setup-wizard-img0003.png | 2021-04-05 22:50 | 9.1K | |
| curve-from-law-img0008.png | 2021-04-05 22:49 | 9.2K | |
| surface-from-laws-img0010.png | 2021-04-05 22:50 | 9.2K | |
| warp-by-law-img0008.png | 2021-04-05 22:50 | 9.2K | |
| multi-view-blocks-img0004.png | 2021-04-05 22:49 | 9.2K | |
| add-roof-img0004.png | 2021-04-05 22:49 | 9.2K | |
| relative-coordinates-img0002.png | 2021-04-05 22:50 | 9.2K | |
| node-editing-roof-slabs-img0002.png | 2021-04-05 22:49 | 9.2K | |
| mirror-copy-img0002.png | 2021-04-05 22:49 | 9.2K | |
| camera-objects-img0006.png | 2021-04-05 22:49 | 9.2K | |
| copying-objects-in-select-edit-img0014.png | 2021-04-05 22:49 | 9.2K | |
| house-wizard-img0002.png | 2021-04-05 22:49 | 9.3K | |
| rail-styles-img0001.png | 2021-04-05 22:50 | 9.3K | |
| create-surface-from-face-s-img0004.png | 2021-04-05 22:49 | 9.3K | |
| add-bottom-wall-modifiers-img0002.png | 2021-04-05 22:49 | 9.3K | |
| circular-slot-by-center-and-radius-img0003.png | 2021-04-05 22:49 | 9.3K | |
| format-painter-img0006.png | 2021-04-05 22:49 | 9.3K | |
| editing-3d-objects-using-selection-info-img0024.png | 2021-04-05 22:49 | 9.3K | |
| colors-and-brushes-img0003.png | 2021-04-05 22:49 | 9.3K | |
| door-styles-img0009.png | 2021-04-05 22:49 | 9.3K | |
| relative-coordinates-img0003.png | 2021-04-05 22:50 | 9.3K | |
| page-layout-wizard-img0009.png | 2021-04-05 22:50 | 9.4K | |
| torus-img0007.png | 2021-04-05 22:50 | 9.4K | |
| displaying-and-manipulating-the-grid-img0003.png | 2021-04-05 22:49 | 9.4K | |
| exploding-objects-img0004.png | 2021-04-05 22:49 | 9.4K | |
| bend-by-sketch-img0012.png | 2021-04-05 22:49 | 9.4K | |
| modify-table-img0004.png | 2021-04-05 22:49 | 9.4K | |
| multi-line-polyline-img0002.png | 2021-04-05 22:49 | 9.4K | |
| publish-as-html-img0001.png | 2021-04-05 22:50 | 9.4K | |
| opposite-mirror-point-snap-img0004.png | 2021-04-05 22:49 | 9.5K | |
| place-on-workplane-img0001.png | 2021-04-05 22:50 | 9.5K | |
| linear-copy-img0002.png | 2021-04-05 22:49 | 9.5K | |
| redsdk-materials-examples-img00041.png | 2021-04-05 22:50 | 9.5K | |
| using-a-selection-window-img0005.png | 2021-04-05 22:50 | 9.5K | |
| format-painter-img0004.png | 2021-04-05 22:49 | 9.5K | |
| imprint-img0003.png | 2021-04-05 22:49 | 9.5K | |
| property-set-definitions-img0003.png | 2021-04-05 22:50 | 9.5K | |
| lofting-img0015.png | 2021-04-05 22:49 | 9.5K | |
| bend-sheet-img0007.png | 2021-04-05 22:49 | 9.5K | |
| arrow-polyline-img0001.png | 2021-04-05 22:49 | 9.5K | |
| measuring-distance-img0004.png | 2021-04-05 22:49 | 9.5K | |
| geometric-tolerance-img0002.png | 2021-04-05 22:49 | 9.6K | |
| lofting-img0020.png | 2021-04-05 22:49 | 9.6K | |
| cone-img0013.png | 2021-04-05 22:49 | 9.6K | |
| create-solid-from-face-s-img0004.png | 2021-04-05 22:49 | 9.6K | |
| split-img0017.png | 2021-04-05 22:50 | 9.6K | |
| workplanes-img0004.png | 2021-04-05 22:50 | 9.6K | |
| offset-img0007.png | 2021-04-05 22:49 | 9.6K | |
| torus-img0006.png | 2021-04-05 22:50 | 9.6K | |
| dynamic-cut-plane-img0003.png | 2021-04-05 22:49 | 9.6K | |
| creating-a-parametric-part-img0040.png | 2021-04-05 22:49 | 9.6K | |
| extrude-to-face-img0013.png | 2021-04-05 22:49 | 9.6K | |
| redsdk-img00041.png | 2021-04-05 22:50 | 9.6K | |
| offset-img0006.png | 2021-04-05 22:49 | 9.6K | |
| revolve-img0030.png | 2021-04-05 22:50 | 9.6K | |
| advanced-preferences-img0001.png | 2021-04-05 22:49 | 9.6K | |
| intersect-2-double-lines-img0002.png | 2021-04-05 22:49 | 9.6K | |
| section-by-view-line-and-aligned-sectional-views-img0006.png | 2021-04-05 22:50 | 9.6K | |
| creating-a-parametric-part-img0005.png | 2021-04-05 22:49 | 9.7K | |
| other-cad-formats-img00091.png | 2021-04-05 22:49 | 9.7K | |
| pulling-curved-faces-img0005.png | 2021-04-05 22:50 | 9.7K | |
| revolve-img0033.png | 2021-04-05 22:50 | 9.7K | |
| section-by-view-line-and-aligned-sectional-views-img0005.png | 2021-04-05 22:50 | 9.7K | |
| stairs-styles-img0001.png | 2021-04-05 22:50 | 9.7K | |
| edit-tool-in-3d-img0002.png | 2021-04-05 22:49 | 9.7K | |
| polyline-img0008.png | 2021-04-05 22:50 | 9.7K | |
| other-controls-img0004.png | 2021-04-05 22:50 | 9.7K | |
| curve-properties-img0006.png | 2021-04-05 22:49 | 9.7K | |
| section-by-view-line-and-aligned-sectional-views-img0004.png | 2021-04-05 22:50 | 9.8K | |
| split-face-img0005.png | 2021-04-05 22:50 | 9.8K | |
| auto-constraint-img0012.png | 2021-04-05 22:49 | 9.8K | |
| midpoint-constraint-img0004.png | 2021-04-05 22:49 | 9.8K | |
| 3d-mesh-img0002.png | 2021-04-05 22:49 | 9.8K | |
| constraining-dimensions-img0024.png | 2021-04-05 22:49 | 9.8K | |
| synchronizing-data-and-graphics-img0003.png | 2021-04-05 22:50 | 9.8K | |
| rulers-img0001.png | 2021-04-05 22:50 | 9.8K | |
| middle-point-snap-img0002.png | 2021-04-05 22:49 | 9.8K | |
| customize-popup-toolbars-img0001.png | 2021-04-05 22:49 | 9.8K | |
| bend-by-sketch-img0013.png | 2021-04-05 22:49 | 9.8K | |
| extract-entity-img0017.png | 2021-04-05 22:49 | 9.8K | |
| using-the-trim-tool-with-architectural-objects-img0005.png | 2021-04-05 22:50 | 9.8K | |
| arrow-curve-img0001.png | 2021-04-05 22:49 | 9.9K | |
| split-img0019.png | 2021-04-05 22:50 | 9.9K | |
| measuring-distance-img0008.png | 2021-04-05 22:49 | 9.9K | |
| exploding-objects-img0002.png | 2021-04-05 22:49 | 9.9K | |
| constraining-dimensions-img0009.png | 2021-04-05 22:49 | 9.9K | |
| multi-line-parallel-img0002.png | 2021-04-05 22:49 | 9.9K | |
| flange-img0007.png | 2021-04-05 22:49 | 9.9K | |
| creating-a-parametric-part-img0006.png | 2021-04-05 22:49 | 9.9K | |
| rotate-view-with-viewport-img0002.png | 2021-04-05 22:50 | 9.9K | |
| measuring-area-img0003.png | 2021-04-05 22:49 | 9.9K | |
| wedge-img0003.png | 2021-04-05 22:50 | 9.9K | |
| terrain-modifier-img0002.png | 2021-04-05 22:50 | 9.9K | |
| editing-segments-img0006.png | 2021-04-05 22:49 | 9.9K | |
| format-painter-img0005.png | 2021-04-05 22:49 | 9.9K | |
| rotate-img0007.png | 2021-04-05 22:50 | 10K | |
| changing-the-workplane-img0016.png | 2021-04-05 22:49 | 10K | |
| measuring-distance-img0015.png | 2021-04-05 22:49 | 10K | |
| creating-a-parametric-part-img0001.png | 2021-04-05 22:49 | 10K | |
| macro-recorder-img0001.png | 2021-04-05 22:49 | 10K | |
| midpoint-constraint-img0001.png | 2021-04-05 22:49 | 10K | |
| constraining-dimensions-img0010.png | 2021-04-05 22:49 | 10K | |
| calculator-palette-variables-palette-img0017.png | 2021-04-05 22:49 | 10K | |
| standard-views-img0003.png | 2021-04-05 22:50 | 10K | |
| macro-recorder-img0005.png | 2021-04-05 22:49 | 10K | |
| customize-toolbars-img0001.png | 2021-04-05 22:49 | 10K | |
| circle-tangent-to-entities-img0005.png | 2021-04-05 22:49 | 10K | |
| macro-recorder-img0003.png | 2021-04-05 22:49 | 10K | |
| creating-an-underlay-style-img0003.png | 2021-04-05 22:49 | 10K | |
| moving-objects-in-select-edit-img0002.png | 2021-04-05 22:49 | 10K | |
| surface-from-laws-img0008.png | 2021-04-05 22:50 | 10K | |
| rotate-view-with-viewport-img0004.png | 2021-04-05 22:50 | 10K | |
| creating-construction-geometry-img0003.png | 2021-04-05 22:49 | 10K | |
| rotated-box-img0004.png | 2021-04-05 22:50 | 10K | |
| sweep-img0013.png | 2021-04-05 22:50 | 10K | |
| convert-to-curve-img0008.png | 2021-04-05 22:49 | 10K | |
| constraining-pattern-copied-objects-img0002.png | 2021-04-05 22:49 | 10K | |
| imprint-subtract-img0005.png | 2021-04-05 22:49 | 10K | |
| create-surface-from-profile-img0004.png | 2021-04-05 22:49 | 10K | |
| page-setup-wizard-img0005.png | 2021-04-05 22:50 | 10K | |
| sheet-metal-gusset-img0015.png | 2021-04-05 22:50 | 10K | |
| constraining-dimensions-img0011.png | 2021-04-05 22:49 | 10K | |
| exploding-objects-img0003.png | 2021-04-05 22:49 | 10K | |
| constraining-dimensions-img0023.png | 2021-04-05 22:49 | 10K | |
| creating-construction-geometry-img0012.png | 2021-04-05 22:49 | 10K | |
| creating-standard-views-img0007.png | 2021-04-05 22:49 | 10K | |
| auto-constraint-img0010.png | 2021-04-05 22:49 | 10K | |
| tweak-face-img0004.png | 2021-04-05 22:50 | 10K | |
| editing-3d-objects-using-selection-info-img0002.png | 2021-04-05 22:49 | 10K | |
| split-img0007.png | 2021-04-05 22:50 | 10K | |
| creating-a-parametric-part-img0003.png | 2021-04-05 22:49 | 10K | |
| lofting-img0013.png | 2021-04-05 22:49 | 10K | |
| measuring-distance-img0013.png | 2021-04-05 22:49 | 10K | |
| tube-bend-img0007.png | 2021-04-05 22:50 | 10K | |
| symmetric-constraint-img0001.png | 2021-04-05 22:50 | 10K | |
| customize-tool-groups-img0003.png | 2021-04-05 22:49 | 10K | |
| convert-to-arc-polyline-img0005.png | 2021-04-05 22:49 | 10K | |
| creating-construction-geometry-img0014.png | 2021-04-05 22:49 | 10K | |
| modify-table-img0007.png | 2021-04-05 22:49 | 10K | |
| split-img0018.png | 2021-04-05 22:50 | 10K | |
| quadrant-point-snap-img0002.png | 2021-04-05 22:50 | 10K | |
| multi-text-img0015.png | 2021-04-05 22:49 | 10K | |
| page-layout-wizard-img0008.png | 2021-04-05 22:50 | 10K | |
| window-img0002.png | 2021-04-05 22:50 | 10K | |
| extrude-to-face-img0011.png | 2021-04-05 22:49 | 10K | |
| editing-3d-objects-using-selection-info-img0023.png | 2021-04-05 22:49 | 10K | |
| changing-the-workplane-img0007.png | 2021-04-05 22:49 | 10K | |
| section-by-view-line-and-aligned-sectional-views-img0003.png | 2021-04-05 22:50 | 10K | |
| node-editing-roofs-img0003.png | 2021-04-05 22:49 | 10K | |
| aec-dimension-styles-img0001.png | 2021-04-05 22:49 | 10K | |
| miter-two-roof-slabs-img0008.png | 2021-04-05 22:49 | 10K | |
| helix-img0003.png | 2021-04-05 22:49 | 10K | |
| copy-faces-img0001.png | 2021-04-05 22:49 | 10K | |
| delete-faces-img0001.png | 2021-04-05 22:49 | 10K | |
| helix-img0001.png | 2021-04-05 22:49 | 10K | |
| constraining-pattern-copied-objects-img0007.png | 2021-04-05 22:49 | 11K | |
| fillet-with-miter-vertices-img0007.png | 2021-04-05 22:49 | 11K | |
| opening-properties-img0001.png | 2021-04-05 22:49 | 11K | |
| select-by-fence-img0001.png | 2021-04-05 22:50 | 11K | |
| fillet-with-miter-vertices-img0001.png | 2021-04-05 22:49 | 11K | |
| copy-faces-img0002.png | 2021-04-05 22:49 | 11K | |
| delete-faces-img0002.png | 2021-04-05 22:49 | 11K | |
| step-2-attach-custom-properties-to-objects-img0004.png | 2021-04-05 22:50 | 11K | |
| select-by-query-img0014.png | 2021-04-05 22:50 | 11K | |
| midpoint-constraint-img0003.png | 2021-04-05 22:49 | 11K | |
| prism-img0009.png | 2021-04-05 22:50 | 11K | |
| straight-stair-img0002.png | 2021-04-05 22:50 | 11K | |
| editing-segments-img0009.png | 2021-04-05 22:49 | 11K | |
| lofting-img0011.png | 2021-04-05 22:49 | 11K | |
| bend-to-path-img0010.png | 2021-04-05 22:49 | 11K | |
| auto-constraint-img0011.png | 2021-04-05 22:49 | 11K | |
| creating-construction-geometry-img0006.png | 2021-04-05 22:49 | 11K | |
| exploding-objects-img0005.png | 2021-04-05 22:49 | 11K | |
| object-trim-img0019.png | 2021-04-05 22:49 | 11K | |
| changing-the-workplane-img0024.png | 2021-04-05 22:49 | 11K | |
| split-img0016.png | 2021-04-05 22:50 | 11K | |
| turbocad-formats-1-2018-10-05-2.png | 2021-04-05 22:50 | 11K | |
| prism-img0005.png | 2021-04-05 22:50 | 11K | |
| constraining-pattern-copied-objects-img0006.png | 2021-04-05 22:49 | 11K | |
| database-connection-palette-img0007.png | 2021-04-05 22:49 | 11K | |
| redsdk-volumetric-environment-img00121.png | 2021-04-05 22:50 | 11K | |
| center-of-extents-snap-img0002.png | 2021-04-05 22:49 | 11K | |
| surface-from-laws-img0016.png | 2021-04-05 22:50 | 11K | |
| copy-faces-img0003.png | 2021-04-05 22:49 | 11K | |
| trace-by-rectangle-img0008.png | 2021-04-05 22:50 | 11K | |
| page-layout-wizard-img0010.png | 2021-04-05 22:50 | 11K | |
| creating-an-underlay-style-img0004.png | 2021-04-05 22:49 | 11K | |
| simple-extrude-img0004.png | 2021-04-05 22:50 | 11K | |
| creating-a-parametric-part-img0009.png | 2021-04-05 22:49 | 11K | |
| bend-by-sketch-img0005.png | 2021-04-05 22:49 | 11K | |
| opposite-mirror-point-snap-img0005.png | 2021-04-05 22:49 | 11K | |
| bend-sheet-img0008.png | 2021-04-05 22:49 | 11K | |
| calculator-palette-variables-palette-img0014.png | 2021-04-05 22:49 | 11K | |
| chamfer-with-miter-vertices-img0001.png | 2021-04-05 22:49 | 11K | |
| components-of-select-edit-mode-img0007.png | 2021-04-05 22:49 | 11K | |
| arc-tangent-to-3-arcs-img00051.png | 2021-04-05 22:49 | 11K | |
| dimension-properties-img0017.png | 2021-04-05 22:49 | 11K | |
| the-camera-img0003.png | 2021-04-05 22:50 | 11K | |
| changing-the-workplane-img0003.png | 2021-04-05 22:49 | 11K | |
| editing-circles-ellipses-and-arcs-img0004.png | 2021-04-05 22:49 | 11K | |
| measuring-area-img0007.png | 2021-04-05 22:49 | 11K | |
| redsdk-volumetric-environment-img00131.png | 2021-04-05 22:50 | 11K | |
| page-setup-wizard-img0004.png | 2021-04-05 22:50 | 11K | |
| exploding-objects-img0008.png | 2021-04-05 22:49 | 11K | |
| constraining-pattern-copied-objects-img0005.png | 2021-04-05 22:49 | 11K | |
| extract-entity-img0018.png | 2021-04-05 22:49 | 11K | |
| rail-styles-img0015.png | 2021-04-05 22:50 | 11K | |
| fillet-with-round-vertices-img0001.png | 2021-04-05 22:49 | 11K | |
| surveyor-dimensions-img0007.png | 2021-04-05 22:50 | 11K | |
| customize-popup-toolbars-img0002.png | 2021-04-05 22:49 | 11K | |
| local-menu-img0001.png | 2021-04-05 22:49 | 11K | |
| midpoint-constraint-img0002.png | 2021-04-05 22:49 | 11K | |
| unwrapping-tc-surface-img0007.png | 2021-04-05 22:50 | 11K | |
| chamfer-edges-img0001.png | 2021-04-05 22:49 | 11K | |
| roof-properties-img0002.png | 2021-04-05 22:50 | 11K | |
| warp-by-law-img0012.png | 2021-04-05 22:50 | 11K | |
| editing-segments-img0008.png | 2021-04-05 22:49 | 11K | |
| select-by-fence-img0003.png | 2021-04-05 22:50 | 11K | |
| revolve-img0009.png | 2021-04-05 22:50 | 11K | |
| editing-hatch-patterns-img0001.png | 2021-04-05 22:49 | 11K | |
| using-a-selection-window-img0007.png | 2021-04-05 22:50 | 11K | |
| displaying-the-workplane-img0003.png | 2021-04-05 22:49 | 11K | |
| calculator-palette-variables-palette-img0001.png | 2021-04-05 22:49 | 11K | |
| hole-img0001.png | 2021-04-05 22:49 | 11K | |
| fillet-edges-img0001.png | 2021-04-05 22:49 | 11K | |
| inserting-walls-img0002.png | 2021-04-05 22:49 | 11K | |
| storing-created-patterns-img0001.png | 2021-04-05 22:50 | 11K | |
| profile-editing-img0004.png | 2021-04-05 22:50 | 11K | |
| tc-explorer-toolbar-img0008.png | 2021-04-05 22:50 | 11K | |
| points-coincident-constraint-img0007.png | 2021-04-05 22:50 | 11K | |
| constraining-dimensions-img0013.png | 2021-04-05 22:49 | 11K | |
| warp-by-law-img0013.png | 2021-04-05 22:50 | 11K | |
| bend-by-sketch-img0004.png | 2021-04-05 22:49 | 11K | |
| inserting-a-parametric-part-from-the-library-img0007.png | 2021-04-05 22:49 | 11K | |
| 3d-slice-img0016.png | 2021-04-05 22:49 | 11K | |
| interactive-handles-img0006.png | 2021-04-05 22:49 | 11K | |
| imprint-add-img0004.png | 2021-04-05 22:49 | 11K | |
| contact-manager-img0009.png | 2021-04-05 22:49 | 12K | |
| multilanding-stair-by-path-img0006.png | 2021-04-05 22:49 | 12K | |
| projection-snap-img0006.png | 2021-04-05 22:50 | 12K | |
| creating-a-parametric-part-img0011.png | 2021-04-05 22:49 | 12K | |
| redsdk-volumetric-environment-img00041.png | 2021-04-05 22:50 | 12K | |
| surveyor-dimensions-img0006.png | 2021-04-05 22:50 | 12K | |
| fillet-with-miter-vertices-img0004.png | 2021-04-05 22:49 | 12K | |
| symmetric-constraint-img0003.png | 2021-04-05 22:50 | 12K | |
| 3d-slice-img0003.png | 2021-04-05 22:49 | 12K | |
| page-layout-wizard-img0007.png | 2021-04-05 22:50 | 12K | |
| thick-profile-1-2018-04-20-5.png | 2021-04-05 22:50 | 12K | |
| grid-img0002.png | 2021-04-05 22:49 | 12K | |
| using-the-ruby-console-img0001.png | 2021-04-05 22:50 | 12K | |
| editing-a-block-img0008.png | 2021-04-05 22:49 | 12K | |
| breaks-img0003.png | 2021-04-05 22:49 | 12K | |
| schedule-styles-img0022.png | 2021-04-05 22:50 | 12K | |
| imprint-with-chamfer-or-fillet-img0001.png | 2021-04-05 22:49 | 12K | |
| thick-profile-1-2018-04-20.png | 2021-04-05 22:50 | 12K | |
| step-2-attach-custom-properties-to-objects-img0006.png | 2021-04-05 22:50 | 12K | |
| torus-img0004.png | 2021-04-05 22:50 | 12K | |
| colors-and-brushes-img0017.png | 2021-04-05 22:49 | 12K | |
| creating-standard-views-img0013.png | 2021-04-05 22:49 | 12K | |
| simple-extrude-img0006.png | 2021-04-05 22:50 | 12K | |
| circular-slot-by-center-and-radius-img0002.png | 2021-04-05 22:49 | 12K | |
| multi-line-polygon-img0002.png | 2021-04-05 22:49 | 12K | |
| auto-constraint-img0007.png | 2021-04-05 22:49 | 12K | |
| colors-and-brushes-img0019.png | 2021-04-05 22:49 | 12K | |
| extrude-to-face-img0007.png | 2021-04-05 22:49 | 12K | |
| bend-to-path-img0003.png | 2021-04-05 22:49 | 12K | |
| u-shaped-stair-img0004.png | 2021-04-05 22:50 | 12K | |
| spiral-stair-img0003.png | 2021-04-05 22:50 | 12K | |
| tc-explorer-toolbar-img0007.png | 2021-04-05 22:50 | 12K | |
| center-mark-img0003.png | 2021-04-05 22:49 | 12K | |
| modify-table-img0009.png | 2021-04-05 22:49 | 12K | |
| editing-a-block-img0009.png | 2021-04-05 22:49 | 12K | |
| chamfer-with-miter-vertices-img0007.png | 2021-04-05 22:49 | 12K | |
| door-img0002.png | 2021-04-05 22:49 | 12K | |
| spiral-stair-img0002.png | 2021-04-05 22:50 | 12K | |
| bend-by-sketch-img0003.png | 2021-04-05 22:49 | 12K | |
| polygon-img0003.png | 2021-04-05 22:50 | 12K | |
| node-editing-roof-slabs-img0008.png | 2021-04-05 22:49 | 12K | |
| switching-to-paper-space-1-2018-04-22-2.png | 2021-04-05 22:50 | 12K | |
| measuring-area-img0002.png | 2021-04-05 22:49 | 12K | |
| editing-lightworks-material-img0005.png | 2021-04-05 22:49 | 12K | |
| creating-a-new-redsdk-material-img00011.png | 2021-04-05 22:49 | 12K | |
| redsdk-global-environments-img00011.png | 2021-04-05 22:50 | 12K | |
| redsdk-materials-examples-img00011.png | 2021-04-05 22:50 | 12K | |
| redsdk-render-style-components-img00011.png | 2021-04-05 22:50 | 12K | |
| display-intersections-with-3d-objects-img0002.png | 2021-04-05 22:49 | 12K | |
| 3d-print-img0001.png | 2021-04-05 22:49 | 12K | |
| 3d-properties-img0002.png | 2021-04-05 22:49 | 12K | |
| 3d-slice-img0001.png | 2021-04-05 22:49 | 12K | |
| 3d-subtract-img0005.png | 2021-04-05 22:49 | 12K | |
| 3d-views-img0001.png | 2021-04-05 22:49 | 12K | |
| acis-img0001.png | 2021-04-05 22:49 | 12K | |
| annotation-img0001.png | 2021-04-05 22:49 | 12K | |
| arc-tools-for-the-lte-workspace-img0001.png | 2021-04-05 22:49 | 12K | |
| arrow-tools-img0001.png | 2021-04-05 22:49 | 12K | |
| assigning-property-sets-to-objects-img0001.png | 2021-04-05 22:49 | 12K | |
| breaks-img0001.png | 2021-04-05 22:49 | 12K | |
| camera-objects-img0001.png | 2021-04-05 22:49 | 12K | |
| circular-slot-by-center-and-radius-img0001.png | 2021-04-05 22:49 | 12K | |
| circular-slot-img0001.png | 2021-04-05 22:49 | 12K | |
| convert-to-arc-polyline-img0001.png | 2021-04-05 22:49 | 12K | |
| copy-in-place-img0001.png | 2021-04-05 22:49 | 12K | |
| copying-objects-img0002.png | 2021-04-05 22:49 | 12K | |
| create-solid-from-face-s-img0001.png | 2021-04-05 22:49 | 12K | |
| create-solid-from-surface-img0001.png | 2021-04-05 22:49 | 12K | |
| create-surface-from-face-s-img0001.png | 2021-04-05 22:49 | 12K | |
| create-surface-from-profile-img0001.png | 2021-04-05 22:49 | 12K | |
| create-surface-from-solid-img0001.png | 2021-04-05 22:49 | 12K | |
| creating-3d-objects-img0001.png | 2021-04-05 22:49 | 12K | |
| creating-a-rendered-view-img0001.png | 2021-04-05 22:49 | 12K | |
| customized-programming-img0001.png | 2021-04-05 22:49 | 12K | |
| database-tables-and-reports-img0001.png | 2021-04-05 22:49 | 12K | |
| design-director-img0001.png | 2021-04-05 22:49 | 12K | |
| design-director-layers-img0002.png | 2021-04-05 22:49 | 12K | |
| displaying-the-workplane-img0001.png | 2021-04-05 22:49 | 12K | |
| drafting-palette-creating-standard-views-img0001.png | 2021-04-05 22:49 | 12K | |
| drafting-palette-img0001.png | 2021-04-05 22:49 | 12K | |
| drafting-reference-point-img0001.png | 2021-04-05 22:49 | 12K | |
| drawing-aids-img0001.png | 2021-04-05 22:49 | 12K | |
| dynamic-cut-plane-img0001.png | 2021-04-05 22:49 | 12K | |
| editing-and-modifying-2d-objects-img0001.png | 2021-04-05 22:49 | 12K | |
| editing-in-3d-img0001.png | 2021-04-05 22:49 | 12K | |
| editing-lightworks-material-img0001.png | 2021-04-05 22:49 | 12K | |
| entity-marks-and-attributes-img0001.png | 2021-04-05 22:49 | 12K | |
| entity-marks-img0001.png | 2021-04-05 22:49 | 12K | |
| environments-img0001.png | 2021-04-05 22:49 | 12K | |
| example-ppm-symbol-img0001.png | 2021-04-05 22:49 | 12K | |
| exploding-solids-img0001.png | 2021-04-05 22:49 | 12K | |
| exporting-point-clouds-img0001.png | 2021-04-05 22:49 | 12K | |
| extend-roof-slab-img0001.png | 2021-04-05 22:49 | 12K | |
| extrude-face-img0001.png | 2021-04-05 22:49 | 12K | |
| format-painter-img0001.png | 2021-04-05 22:49 | 12K | |
| gear-contour-img0001.png | 2021-04-05 22:49 | 12K | |
| getting-started-with-turbocad-2018-img0001.png | 2021-04-05 22:49 | 12K | |
| groups-blocks-and-the-library-img0001.png | 2021-04-05 22:49 | 12K | |
| hatch-pattern-creator-img0001.png | 2021-04-05 22:49 | 12K | |
| holdline-blend-img0001.png | 2021-04-05 22:49 | 12K | |
| hole-patterns-img0001.png | 2021-04-05 22:49 | 12K | |
| horizontal-vertical-constraint-img0001.png | 2021-04-05 22:49 | 12K | |
| house-wizard-toolset-img0001.png | 2021-04-05 22:49 | 12K | |
| ifc-export-and-bim-img0001.png | 2021-04-05 22:49 | 12K | |
| importing-point-clouds-img0001.png | 2021-04-05 22:49 | 12K | |
| imprint-edge-img0001.png | 2021-04-05 22:49 | 12K | |
| inserting-2d-objects-img0001.png | 2021-04-05 22:49 | 12K | |
| inserting-entity-marks-img0001.png | 2021-04-05 22:49 | 12K | |
| isocircle-img0001.png | 2021-04-05 22:49 | 12K | |
| lights-img0001.png | 2021-04-05 22:49 | 12K | |
| lightworks-material-properties-img0001.png | 2021-04-05 22:49 | 12K | |
| line-img0001.png | 2021-04-05 22:49 | 12K | |
| loading-and-saving-environments-img0001.png | 2021-04-05 22:49 | 12K | |
| loading-and-saving-luminances-img0001.png | 2021-04-05 22:49 | 12K | |
| loading-and-saving-materials-img0001.png | 2021-04-05 22:49 | 12K | |
| loading-and-saving-render-styles-img0001.png | 2021-04-05 22:49 | 12K | |
| lte-command-line-img0001.png | 2021-04-05 22:49 | 12K | |
| lte-workspace-circle-ellipse-tools-img0001.png | 2021-04-05 22:49 | 12K | |
| luminance-img0001.png | 2021-04-05 22:49 | 12K | |
| luminance-properties-img0001.png | 2021-04-05 22:49 | 12K | |
| macrorecorder-palette-img0001.png | 2021-04-05 22:49 | 12K | |
| managing-environments-in-the-render-manager-img0001.png | 2021-04-05 22:49 | 12K | |
| managing-luminances-in-the-render-manager-img0001.png | 2021-04-05 22:49 | 12K | |
| managing-materials-in-the-render-manager-img0001.png | 2021-04-05 22:49 | 12K | |
| managing-render-styles-in-the-render-manager-img0001.png | 2021-04-05 22:49 | 12K | |
| manipulating-the-display-img0001.png | 2021-04-05 22:49 | 12K | |
| mirror-copy-img0007.png | 2021-04-05 22:49 | 12K | |
| multi-view-blocks-img0001.png | 2021-04-05 22:49 | 12K | |
| multilanding-stair-by-path-img0001.png | 2021-04-05 22:49 | 12K | |
| other-cad-formats-img00012.png | 2021-04-05 22:49 | 12K | |
| paper-space-and-printing-img0001.png | 2021-04-05 22:50 | 12K | |
| point-cloud-properties-img0001.png | 2021-04-05 22:50 | 12K | |
| protractor-img0001.png | 2021-04-05 22:50 | 12K | |
| railings-img0001.png | 2021-04-05 22:50 | 12K | |
| render-camera-properties-img0001.png | 2021-04-05 22:50 | 12K | |
| render-scene-environment-img0001.png | 2021-04-05 22:50 | 12K | |
| render-scene-luminance-img0001.png | 2021-04-05 22:50 | 12K | |
| render-styles-img0001.png | 2021-04-05 22:50 | 12K | |
| roofs-img0001.png | 2021-04-05 22:50 | 12K | |
| room-box-properties-img0001.png | 2021-04-05 22:50 | 12K | |
| selecting-and-transforming-objects-img0001.png | 2021-04-05 22:50 | 12K | |
| show-normals-img0001.png | 2021-04-05 22:50 | 12K | |
| single-line-img0004.png | 2021-04-05 22:50 | 12K | |
| slot-img0001.png | 2021-04-05 22:50 | 12K | |
| split-face-img0001.png | 2021-04-05 22:50 | 12K | |
| stellated-polygon-img0001.png | 2021-04-05 22:50 | 12K | |
| subsetting-point-clouds-img0001.png | 2021-04-05 22:50 | 12K | |
| sun-position-img0001.png | 2021-04-05 22:50 | 12K | |
| surface-roughness-img0001.png | 2021-04-05 22:50 | 12K | |
| text-along-curve-img0001.png | 2021-04-05 22:50 | 12K | |
| the-camera-img0001.png | 2021-04-05 22:50 | 12K | |
| the-tc-explorer-palette-img0001.png | 2021-04-05 22:50 | 12K | |
| trim-roof-slab-img0001.png | 2021-04-05 22:50 | 12K | |
| user-interface-img0001.png | 2021-04-05 22:50 | 12K | |
| using-lte-dynamic-input-img0001.png | 2021-04-05 22:50 | 12K | |
| using-the-environments-palette-img0001.png | 2021-04-05 22:50 | 12K | |
| wall-dimension-img0001.png | 2021-04-05 22:50 | 12K | |
| weld-symbols-img0001.png | 2021-04-05 22:50 | 12K | |
| wire-wrap-img0001.png | 2021-04-05 22:50 | 12K | |
| woodworking-img0001.png | 2021-04-05 22:50 | 12K | |
| working-in-3d-img0001.png | 2021-04-05 22:50 | 12K | |
| workplane-by-3d-object-img0001.png | 2021-04-05 22:50 | 12K | |
| intersection-snap-img0002.png | 2021-04-05 22:49 | 12K | |
| measuring-area-img0006.png | 2021-04-05 22:49 | 12K | |
| creating-a-new-lightworks-material-img0014.png | 2021-04-05 22:49 | 12K | |
| switching-to-paper-space-1-2018-04-22.png | 2021-04-05 22:50 | 12K | |
| creating-a-parametric-part-img0024.png | 2021-04-05 22:49 | 12K | |
| insert-table-img0005.png | 2021-04-05 22:49 | 12K | |
| insert-table-img0012.png | 2021-04-05 22:49 | 12K | |
| miter-two-roof-slabs-img0010.png | 2021-04-05 22:49 | 12K | |
| symmetric-constraint-img0006.png | 2021-04-05 22:50 | 12K | |
| extrude-to-face-img0003.png | 2021-04-05 22:49 | 12K | |
| selection-info-palette-img0034.png | 2021-04-05 22:50 | 12K | |
| constraining-dimensions-img0015.png | 2021-04-05 22:49 | 12K | |
| thick-profile-1-2018-04-20-4.png | 2021-04-05 22:50 | 12K | |
| miter-two-roof-slabs-img0005.png | 2021-04-05 22:49 | 12K | |
| circular-slot-by-center-and-radius-img0004.png | 2021-04-05 22:49 | 12K | |
| 3d-slice-img0021.png | 2021-04-05 22:49 | 12K | |
| selection-info-palette-img0035.png | 2021-04-05 22:50 | 12K | |
| symmetric-constraint-img0005.png | 2021-04-05 22:50 | 12K | |
| imprint-img0016.png | 2021-04-05 22:49 | 12K | |
| fillet-with-round-vertices-img0006.png | 2021-04-05 22:49 | 12K | |
| miter-two-roof-slabs-img0009.png | 2021-04-05 22:49 | 12K | |
| unwrapping-surfaces-img0003.png | 2021-04-05 22:50 | 12K | |
| fillet-with-miter-vertices-img0009.png | 2021-04-05 22:49 | 12K | |
| pulling-curved-faces-img0015.png | 2021-04-05 22:50 | 12K | |
| 3d-slice-img0024.png | 2021-04-05 22:49 | 12K | |
| facet-offset-img0001.png | 2021-04-05 22:49 | 12K | |
| using-a-selection-window-img0004.png | 2021-04-05 22:50 | 12K | |
| prism-img0004.png | 2021-04-05 22:50 | 12K | |
| splitting-and-joining-walls-img0001.png | 2021-04-05 22:50 | 12K | |
| roof-slabs-and-converting-to-roof-slabs-img0005.png | 2021-04-05 22:50 | 12K | |
| chamfer-with-miter-vertices-img0009.png | 2021-04-05 22:49 | 12K | |
| other-cad-formats-img00031.png | 2021-04-05 22:49 | 12K | |
| chamfer-with-round-vertices-img0001.png | 2021-04-05 22:49 | 12K | |
| rotated-box-img0005.png | 2021-04-05 22:50 | 12K | |
| step-2-attach-custom-properties-to-objects-img0007.png | 2021-04-05 22:50 | 12K | |
| imprint-add-img0006.png | 2021-04-05 22:49 | 12K | |
| constraining-dimensions-img0016.png | 2021-04-05 22:49 | 12K | |
| assemble-by-edge-and-point-img0009.png | 2021-04-05 22:49 | 13K | |
| displaying-and-manipulating-the-grid-img0005.png | 2021-04-05 22:49 | 13K | |
| sweep-img0012.png | 2021-04-05 22:50 | 13K | |
| spiral-stair-img0005.png | 2021-04-05 22:50 | 13K | |
| map-img0005.png | 2021-04-05 22:49 | 13K | |
| symmetric-constraint-img0002.png | 2021-04-05 22:50 | 13K | |
| dimension-properties-img0008.png | 2021-04-05 22:49 | 13K | |
| 11.png | 2021-04-05 22:49 | 13K | |
| assemble-by-facet-img0003.png | 2021-04-05 22:49 | 13K | |
| geomarks-and-tap-files-img0002.png | 2021-04-05 22:49 | 13K | |
| lte-command-line-options-img0003.png | 2021-04-05 22:49 | 13K | |
| changing-the-workplane-img0026.png | 2021-04-05 22:49 | 13K | |
| breaks-img0007.png | 2021-04-05 22:49 | 13K | |
| tcw-profiles-img0005.png | 2021-04-05 22:50 | 13K | |
| section-img0003.png | 2021-04-05 22:50 | 13K | |
| fillet-with-miter-vertices-img0006.png | 2021-04-05 22:49 | 13K | |
| unwrapping-surfaces-img0004.png | 2021-04-05 22:50 | 13K | |
| page-setup-img0003.png | 2021-04-05 22:50 | 13K | |
| selection-info-palette-img0031.png | 2021-04-05 22:50 | 13K | |
| step-4-create-the-report-img0011.png | 2021-04-05 22:50 | 13K | |
| loading-symbol-folders-into-the-library-img0004.png | 2021-04-05 22:49 | 13K | |
| manipulating-layers-and-properties-img0001.png | 2021-04-05 22:49 | 13K | |
| miter-two-roof-slabs-img0001.png | 2021-04-05 22:49 | 13K | |
| profile-editing-img0012.png | 2021-04-05 22:50 | 13K | |
| creating-a-parametric-part-img0007.png | 2021-04-05 22:49 | 13K | |
| drawing-markers-img0003.png | 2021-04-05 22:49 | 13K | |
| breaks-img0004.png | 2021-04-05 22:49 | 13K | |
| add-top-wall-modifiers-img0004.png | 2021-04-05 22:49 | 13K | |
| 3d-slice-img0006.png | 2021-04-05 22:49 | 13K | |
| fillet-with-setbacks-img0005.png | 2021-04-05 22:49 | 13K | |
| inserting-walls-img0017.png | 2021-04-05 22:49 | 13K | |
| redsdk-volumetric-environment-img00061.png | 2021-04-05 22:50 | 13K | |
| unwrapping-the-mesh-img0013.png | 2021-04-05 22:50 | 13K | |
| chamfer-with-miter-vertices-img0012.png | 2021-04-05 22:49 | 13K | |
| other-cad-formats-img00301.png | 2021-04-05 22:49 | 13K | |
| warp-by-law-img0016.png | 2021-04-05 22:50 | 13K | |
| points-coincident-constraint-img0006.png | 2021-04-05 22:50 | 13K | |
| bend-sheet-img0010.png | 2021-04-05 22:49 | 13K | |
| breaks-img0008.png | 2021-04-05 22:49 | 13K | |
| sweep-img0010.png | 2021-04-05 22:50 | 13K | |
| array-pattern-img0004.png | 2021-04-05 22:49 | 13K | |
| editing-segments-img0010.png | 2021-04-05 22:49 | 13K | |
| selection-info-palette-img0036.png | 2021-04-05 22:50 | 13K | |
| facet-offset-img0007.png | 2021-04-05 22:49 | 13K | |
| array-copy-img0003.png | 2021-04-05 22:49 | 13K | |
| arrow-properties-img0001.png | 2021-04-05 22:49 | 13K | |
| dimension-formatting-codes-img0002.png | 2021-04-05 22:49 | 13K | |
| chamfer-with-miter-vertices-img0006.png | 2021-04-05 22:49 | 13K | |
| rail-styles-img0014.png | 2021-04-05 22:50 | 13K | |
| creating-the-uv-material-1-2018-04-22.png | 2021-04-05 22:49 | 13K | |
| fillet-with-miter-vertices-img0012.png | 2021-04-05 22:49 | 13K | |
| offset-img0010.png | 2021-04-05 22:49 | 13K | |
| using-the-advanced-render-styles-palette-1-2018-03-02.png | 2021-04-05 22:50 | 13K | |
| drawing-settings-img0001.png | 2021-04-05 22:49 | 13K | |
| bend-sheet-img0003.png | 2021-04-05 22:49 | 13K | |
| fillet-with-setbacks-img0004.png | 2021-04-05 22:49 | 13K | |
| edit-tool-in-3d-img0014.png | 2021-04-05 22:49 | 13K | |
| displaying-the-workplane-img0004.png | 2021-04-05 22:49 | 13K | |
| arc-complement-img0002.png | 2021-04-05 22:49 | 13K | |
| twisted-extrude-img0003.png | 2021-04-05 22:50 | 13K | |
| lte-command-line-options-img0002.png | 2021-04-05 22:49 | 13K | |
| imprint-auto-detect-img0005.png | 2021-04-05 22:49 | 13K | |
| rotating-objects-in-select-edit-img0002.png | 2021-04-05 22:50 | 13K | |
| 3d-slice-img0009.png | 2021-04-05 22:49 | 13K | |
| show-normals-img0005.png | 2021-04-05 22:50 | 13K | |
| step-1-define-custom-fields-img0002.png | 2021-04-05 22:50 | 13K | |
| sketch-style-img0002.png | 2021-04-05 22:50 | 13K | |
| visual-representation-img0004.png | 2021-04-05 22:50 | 13K | |
| constraining-dimensions-img0018.png | 2021-04-05 22:49 | 13K | |
| stellated-polygon-img0002.png | 2021-04-05 22:50 | 13K | |
| using-the-advanced-render-styles-palette-1-2018-03-02-1.png | 2021-04-05 22:50 | 13K | |
| torus-img0003.png | 2021-04-05 22:50 | 13K | |
| smesh-symmetry-tools-img0009.png | 2021-04-05 22:50 | 13K | |
| step-1-define-custom-fields-img0001.png | 2021-04-05 22:50 | 13K | |
| curve-properties-img0007.png | 2021-04-05 22:49 | 13K | |
| radial-copy-img0002.png | 2021-04-05 22:50 | 13K | |
| assemble-by-tangents-img0011.png | 2021-04-05 22:49 | 13K | |
| creating-construction-geometry-img0022.png | 2021-04-05 22:49 | 13K | |
| inserting-a-parametric-part-from-the-library-img0005.png | 2021-04-05 22:49 | 13K | |
| constraining-pattern-copied-objects-img0001.png | 2021-04-05 22:49 | 13K | |
| using-a-selection-window-img0002.png | 2021-04-05 22:50 | 13K | |
| editing-the-workplane-img0002.png | 2021-04-05 22:49 | 13K | |
| preferences-img0001.png | 2021-04-05 22:50 | 13K | |
| variable-blend-img0001.png | 2021-04-05 22:50 | 14K | |
| roof-properties-img0003.png | 2021-04-05 22:50 | 14K | |
| selection-info-palette-img0020.png | 2021-04-05 22:50 | 14K | |
| creating-construction-geometry-img0025.png | 2021-04-05 22:49 | 14K | |
| unwrapping-surfaces-img0001.png | 2021-04-05 22:50 | 14K | |
| pattern-by-polyline-img0002.png | 2021-04-05 22:50 | 14K | |
| unwrapping-surfaces-img0002.png | 2021-04-05 22:50 | 14K | |
| offset-with-law-img0012.png | 2021-04-05 22:49 | 14K | |
| changing-the-workplane-img0015.png | 2021-04-05 22:49 | 14K | |
| colors-and-brushes-img0021.png | 2021-04-05 22:49 | 14K | |
| bend-to-path-img0008.png | 2021-04-05 22:49 | 14K | |
| imprint-auto-detect-img0004.png | 2021-04-05 22:49 | 14K | |
| deleting-nodes-img0003.png | 2021-04-05 22:49 | 14K | |
| parametric-part-script-editor-img0001.png | 2021-04-05 22:50 | 14K | |
| redsdk-material-concepts-and-properties-img00131.png | 2021-04-05 22:50 | 14K | |
| standard-views-img0005.png | 2021-04-05 22:50 | 14K | |
| creating-a-block-img0002.png | 2021-04-05 22:49 | 14K | |
| creating-sectional-and-iso-views-img0004.png | 2021-04-05 22:49 | 14K | |
| editing-a-block-img0010.png | 2021-04-05 22:49 | 14K | |
| warp-by-law-img0015.png | 2021-04-05 22:50 | 14K | |
| symmetric-constraint-img0008.png | 2021-04-05 22:50 | 14K | |
| redsdk-material-concepts-and-properties-img00141.png | 2021-04-05 22:50 | 14K | |
| stellated-polygon-img0003.png | 2021-04-05 22:50 | 14K | |
| controlling-lights-img0004.png | 2021-04-05 22:49 | 14K | |
| editing-a-block-img0004.png | 2021-04-05 22:49 | 14K | |
| section-by-view-line-and-aligned-sectional-views-img0011.png | 2021-04-05 22:50 | 14K | |
| fit-array-copy-img0003.png | 2021-04-05 22:49 | 14K | |
| roof-slabs-and-converting-to-roof-slabs-img0004.png | 2021-04-05 22:50 | 14K | |
| multi-text-img0011.png | 2021-04-05 22:49 | 14K | |
| pressure-load-img0006.png | 2021-04-05 22:50 | 14K | |
| rotate-img0002.png | 2021-04-05 22:50 | 14K | |
| prism-img0003.png | 2021-04-05 22:50 | 14K | |
| hemisphere-img0002.png | 2021-04-05 22:49 | 14K | |
| select-by-query-img0011.png | 2021-04-05 22:50 | 14K | |
| constraining-dimensions-img0022.png | 2021-04-05 22:49 | 14K | |
| colors-and-brushes-img0011.png | 2021-04-05 22:49 | 14K | |
| edit-tool-in-3d-img0013.png | 2021-04-05 22:49 | 14K | |
| symmetric-constraint-img0004.png | 2021-04-05 22:50 | 14K | |
| creating-a-parametric-part-img0021.png | 2021-04-05 22:49 | 14K | |
| creating-a-parametric-part-img0014.png | 2021-04-05 22:49 | 14K | |
| door-styles-img0011.png | 2021-04-05 22:49 | 14K | |
| triangulating-point-clouds-img0003.png | 2021-04-05 22:50 | 14K | |
| creating-construction-geometry-img0018.png | 2021-04-05 22:49 | 14K | |
| slab-styles-img0005.png | 2021-04-05 22:50 | 14K | |
| fit-radial-copy-img0002.png | 2021-04-05 22:49 | 14K | |
| colors-and-brushes-img0010.png | 2021-04-05 22:49 | 14K | |
| add-roof-img0002.png | 2021-04-05 22:49 | 14K | |
| loading-a-parametric-part-into-the-library-img0007.png | 2021-04-05 22:49 | 14K | |
| facet-offset-img0004.png | 2021-04-05 22:49 | 14K | |
| splitting-and-joining-walls-img0002.png | 2021-04-05 22:50 | 14K | |
| equal-distance-constraint-img0003.png | 2021-04-05 22:49 | 14K | |
| revolve-img0021.png | 2021-04-05 22:50 | 14K | |
| terrain-img0002.png | 2021-04-05 22:50 | 14K | |
| multi-landing-stair-img0009.png | 2021-04-05 22:49 | 14K | |
| bend-to-path-img0007.png | 2021-04-05 22:49 | 14K | |
| using-a-selection-window-img0001.png | 2021-04-05 22:50 | 14K | |
| calculator-palette-variables-palette-img0006.png | 2021-04-05 22:49 | 14K | |
| step-2-attach-custom-properties-to-objects-img0002.png | 2021-04-05 22:50 | 14K | |
| miter-two-roof-slabs-img0004.png | 2021-04-05 22:49 | 14K | |
| creating-a-parametric-part-img0043.png | 2021-04-05 22:49 | 15K | |
| section-line-img0002.png | 2021-04-05 22:50 | 15K | |
| curve-from-law-img0006.png | 2021-04-05 22:49 | 15K | |
| offset-with-law-img0006.png | 2021-04-05 22:49 | 15K | |
| surface-from-laws-img0005.png | 2021-04-05 22:50 | 15K | |
| warp-by-law-img0006.png | 2021-04-05 22:50 | 15K | |
| wall-properties-img0002.png | 2021-04-05 22:50 | 15K | |
| shelling-solids-img0001.png | 2021-04-05 22:50 | 15K | |
| display-intersections-with-3d-objects-img0003.png | 2021-04-05 22:49 | 15K | |
| section-by-closed-polyline-img0005.png | 2021-04-05 22:50 | 15K | |
| redsdk-material-concepts-and-properties-img00161.png | 2021-04-05 22:50 | 15K | |
| move-img0006.png | 2021-04-05 22:49 | 15K | |
| wire-wrap-img0002.png | 2021-04-05 22:50 | 15K | |
| symmetric-constraint-img0009.png | 2021-04-05 22:50 | 15K | |
| re-patching-img0001.png | 2021-04-05 22:50 | 15K | |
| redsdk-material-concepts-and-properties-img00041.png | 2021-04-05 22:50 | 15K | |
| editing-the-workplane-img0003.png | 2021-04-05 22:49 | 15K | |
| add-roof-img0006.png | 2021-04-05 22:49 | 15K | |
| property-toolbar-img0001.png | 2021-04-05 22:50 | 15K | |
| show-normals-img0003.png | 2021-04-05 22:50 | 15K | |
| uv-material-wizard-img0001.png | 2021-04-05 22:50 | 15K | |
| customize-tool-groups-img0001.png | 2021-04-05 22:49 | 15K | |
| offset-img0005.png | 2021-04-05 22:49 | 15K | |
| slot-img0003.png | 2021-04-05 22:50 | 15K | |
| selection-info-palette-img0033.png | 2021-04-05 22:50 | 15K | |
| curve-properties-img0008.png | 2021-04-05 22:49 | 15K | |
| creating-a-parametric-part-img0012.png | 2021-04-05 22:49 | 15K | |
| other-cad-formats-img00321.png | 2021-04-05 22:49 | 15K | |
| constraining-dimensions-img0025.png | 2021-04-05 22:49 | 15K | |
| quick-pull-img0011.png | 2021-04-05 22:50 | 15K | |
| multileader-dimensions-img0001.png | 2021-04-05 22:49 | 15K | |
| creating-a-parametric-part-img0022.png | 2021-04-05 22:49 | 15K | |
| conceptual-selector-boundary-box-img0002.png | 2021-04-05 22:49 | 15K | |
| creating-sectional-and-iso-views-img0008.png | 2021-04-05 22:49 | 15K | |
| flange-img0008.png | 2021-04-05 22:49 | 15K | |
| symmetric-constraint-img0007.png | 2021-04-05 22:50 | 15K | |
| chamfer-with-round-vertices-img0006.png | 2021-04-05 22:49 | 15K | |
| auto-dimension-img0007.png | 2021-04-05 22:49 | 15K | |
| click-test-img0001.png | 2021-04-05 22:49 | 15K | |
| event-viewer-img0001.png | 2021-04-05 22:49 | 15K | |
| arc-tangent-to-3-arcs-img00041.png | 2021-04-05 22:49 | 15K | |
| xclip-img0004.png | 2021-04-05 22:50 | 15K | |
| design-director-lights-img0002.png | 2021-04-05 22:49 | 15K | |
| toolbars-img0004.png | 2021-04-05 22:50 | 15K | |
| redsdk-material-concepts-and-properties-img00031.png | 2021-04-05 22:50 | 15K | |
| splitting-and-joining-walls-img0003.png | 2021-04-05 22:50 | 15K | |
| colors-and-brushes-img0018.png | 2021-04-05 22:49 | 15K | |
| creating-standard-views-img0003.png | 2021-04-05 22:49 | 15K | |
| measuring-distance-img0016.png | 2021-04-05 22:49 | 15K | |
| exploding-objects-img0007.png | 2021-04-05 22:49 | 15K | |
| curve-from-law-img0004.png | 2021-04-05 22:49 | 15K | |
| creating-3d-objects-by-editing-2d-objects-img0003.png | 2021-04-05 22:49 | 15K | |
| creating-a-parametric-part-img0025.png | 2021-04-05 22:49 | 15K | |
| extrude-face-img0002.png | 2021-04-05 22:49 | 15K | |
| creating-a-parametric-part-img0020.png | 2021-04-05 22:49 | 15K | |
| create-solid-from-face-s-img0002.png | 2021-04-05 22:49 | 15K | |
| changing-the-workplane-img0025.png | 2021-04-05 22:49 | 15K | |
| fillet-with-round-vertices-img0010.png | 2021-04-05 22:49 | 15K | |
| extrude-to-face-img0010.png | 2021-04-05 22:49 | 15K | |
| create-surface-from-face-s-img0002.png | 2021-04-05 22:49 | 15K | |
| using-the-lte-command-line-img0004.png | 2021-04-05 22:50 | 15K | |
| inserting-viewports-img0002.png | 2021-04-05 22:49 | 15K | |
| surface-from-laws-img0015.png | 2021-04-05 22:50 | 15K | |
| imprint-add-img0001.png | 2021-04-05 22:49 | 15K | |
| measuring-distance-img0009.png | 2021-04-05 22:49 | 16K | |
| imprint-subtract-img0001.png | 2021-04-05 22:49 | 16K | |
| face2face-lofting-img0001.png | 2021-04-05 22:49 | 16K | |
| editing-lightworks-material-img0017.png | 2021-04-05 22:49 | 16K | |
| imprint-with-chamfer-or-fillet-img0005.png | 2021-04-05 22:49 | 16K | |
| assemble-by-tangents-img0009.png | 2021-04-05 22:49 | 16K | |
| using-the-lte-command-line-img0002.png | 2021-04-05 22:50 | 16K | |
| stairs-styles-img0003.png | 2021-04-05 22:50 | 16K | |
| twisted-extrude-img0002.png | 2021-04-05 22:50 | 16K | |
| slab-styles-img0006.png | 2021-04-05 22:50 | 16K | |
| stairs-styles-img0004.png | 2021-04-05 22:50 | 16K | |
| quick-pull-img0008.png | 2021-04-05 22:50 | 16K | |
| uv-material-wizard-1-2018-04-22-1.png | 2021-04-05 22:50 | 16K | |
| face2face-lofting-img0002.png | 2021-04-05 22:49 | 16K | |
| 3d-mesh-img0004.png | 2021-04-05 22:49 | 16K | |
| helix-img0002.png | 2021-04-05 22:49 | 16K | |
| insert-table-img0013.png | 2021-04-05 22:49 | 16K | |
| components-of-select-edit-mode-img0008.png | 2021-04-05 22:49 | 16K | |
| layer-management-img0001.png | 2021-04-05 22:49 | 16K | |
| exploding-objects-img0006.png | 2021-04-05 22:49 | 16K | |
| constraining-geometry-img0003.png | 2021-04-05 22:49 | 16K | |
| rail-styles-img0004.png | 2021-04-05 22:50 | 16K | |
| extrude-face-img0003.png | 2021-04-05 22:49 | 16K | |
| variable-blend-img0004.png | 2021-04-05 22:50 | 16K | |
| scale-img0007.png | 2021-04-05 22:50 | 16K | |
| warp-by-law-img0004.png | 2021-04-05 22:50 | 16K | |
| using-the-lte-command-line-img0003.png | 2021-04-05 22:50 | 16K | |
| torus-img0002.png | 2021-04-05 22:50 | 16K | |
| selection-info-palette-img0038.png | 2021-04-05 22:50 | 16K | |
| text-styles-img0003.png | 2021-04-05 22:50 | 16K | |
| rotate-img0004.png | 2021-04-05 22:50 | 16K | |
| schedule-styles-img0004.png | 2021-04-05 22:50 | 16K | |
| bend-to-path-img0009.png | 2021-04-05 22:49 | 16K | |
| thread-3d-img0003.png | 2021-04-05 22:50 | 16K | |
| dimension-styles-img0002.png | 2021-04-05 22:49 | 16K | |
| changing-the-workplane-img0017.png | 2021-04-05 22:49 | 16K | |
| creating-a-new-lightworks-material-img0002.png | 2021-04-05 22:49 | 16K | |
| rail-styles-img0003.png | 2021-04-05 22:50 | 16K | |
| creating-construction-geometry-img0015.png | 2021-04-05 22:49 | 16K | |
| wire-wrap-img0008.png | 2021-04-05 22:50 | 16K | |
| transform-recorder-img0003.png | 2021-04-05 22:50 | 16K | |
| redsdk-material-concepts-and-properties-img00151.png | 2021-04-05 22:50 | 16K | |
| selection-info-palette-img0015.png | 2021-04-05 22:50 | 16K | |
| subsetting-point-clouds-img0005.png | 2021-04-05 22:50 | 16K | |
| creating-a-parametric-part-img0029.png | 2021-04-05 22:49 | 16K | |
| table-export-xlsx-img0001.png | 2021-04-05 22:50 | 16K | |
| door-styles-img0003.png | 2021-04-05 22:49 | 16K | |
| bend-to-path-img0011.png | 2021-04-05 22:49 | 16K | |
| arranging-and-snapping-room-boxes-img0007.png | 2021-04-05 22:49 | 16K | |
| trace-by-rectangle-img0002.png | 2021-04-05 22:50 | 16K | |
| warp-by-law-img0003.png | 2021-04-05 22:50 | 16K | |
| multileader-dimensions-img0003.png | 2021-04-05 22:49 | 17K | |
| stellated-polygon-img0006.png | 2021-04-05 22:50 | 17K | |
| copying-objects-in-select-edit-img0004.png | 2021-04-05 22:49 | 17K | |
| changing-the-workplane-img0022.png | 2021-04-05 22:49 | 17K | |
| parametric-part-script-editor-img0004.png | 2021-04-05 22:50 | 17K | |
| transform-recorder-img0001.png | 2021-04-05 22:50 | 17K | |
| unwrapping-the-mesh-img0012.png | 2021-04-05 22:50 | 17K | |
| tracing-img0005.png | 2021-04-05 22:50 | 17K | |
| measuring-distance-img0014.png | 2021-04-05 22:49 | 17K | |
| page-layout-wizard-img0017.png | 2021-04-05 22:50 | 17K | |
| components-of-select-edit-mode-img0006.png | 2021-04-05 22:49 | 17K | |
| polygonal-prism-img0004.png | 2021-04-05 22:50 | 17K | |
| window-styles-img0003.png | 2021-04-05 22:50 | 17K | |
| database-connection-palette-img0003.png | 2021-04-05 22:49 | 17K | |
| sphere-img0002.png | 2021-04-05 22:50 | 17K | |
| bend-to-path-img0005.png | 2021-04-05 22:49 | 17K | |
| inserting-a-parametric-part-from-the-library-img0004.png | 2021-04-05 22:49 | 17K | |
| tracing-img0004.png | 2021-04-05 22:50 | 17K | |
| moving-objects-in-select-edit-img0004.png | 2021-04-05 22:49 | 17K | |
| tc-surface-properties-img0004.png | 2021-04-05 22:50 | 17K | |
| selection-info-palette-img0017.png | 2021-04-05 22:50 | 17K | |
| tc-surface-segmentation-general-img0002.png | 2021-04-05 22:50 | 17K | |
| unwrapping-the-mesh-img0003.png | 2021-04-05 22:50 | 17K | |
| add-roof-modifier-img0001.png | 2021-04-05 22:49 | 17K | |
| smesh-merging-img0002.png | 2021-04-05 22:50 | 17K | |
| sketch-style-img0010.png | 2021-04-05 22:50 | 17K | |
| scale-img0002.png | 2021-04-05 22:50 | 17K | |
| scale-img0003.png | 2021-04-05 22:50 | 17K | |
| radial-copy-img0003.png | 2021-04-05 22:50 | 17K | |
| creating-a-parametric-part-img0037.png | 2021-04-05 22:49 | 17K | |
| terrain-img0003.png | 2021-04-05 22:50 | 17K | |
| modify-table-img0011.png | 2021-04-05 22:49 | 17K | |
| creating-sectional-and-iso-views-img0003.png | 2021-04-05 22:49 | 17K | |
| colors-and-brushes-img0023.png | 2021-04-05 22:49 | 17K | |
| center-line-img0002.png | 2021-04-05 22:49 | 17K | |
| rotate-img0008.png | 2021-04-05 22:50 | 17K | |
| creating-standard-views-img0008.png | 2021-04-05 22:49 | 17K | |
| array-pattern-img0003.png | 2021-04-05 22:49 | 17K | |
| assemble-by-3-points-img0005.png | 2021-04-05 22:49 | 17K | |
| tracing-img0006.png | 2021-04-05 22:50 | 17K | |
| editing-splines-and-bezier-curves-img0011.png | 2021-04-05 22:49 | 17K | |
| editing-multiple-nodes-img0005.png | 2021-04-05 22:49 | 17K | |
| tweak-face-img0001.png | 2021-04-05 22:50 | 17K | |
| model-shaders-and-applications-shaders-img0004.png | 2021-04-05 22:49 | 17K | |
| revolve-img0005.png | 2021-04-05 22:50 | 17K | |
| cylinder-img0002.png | 2021-04-05 22:49 | 17K | |
| woodworking-img0011.png | 2021-04-05 22:50 | 17K | |
| aec-dimension-styles-img0007.png | 2021-04-05 22:49 | 17K | |
| measuring-distance-img0010.png | 2021-04-05 22:49 | 17K | |
| multi-line-rotated-rectangle-img0002.png | 2021-04-05 22:49 | 17K | |
| measuring-angles-img0007.png | 2021-04-05 22:49 | 17K | |
| bend-sheet-img0013.png | 2021-04-05 22:49 | 17K | |
| measuring-angles-img0009.png | 2021-04-05 22:49 | 17K | |
| insert-table-img0006.png | 2021-04-05 22:49 | 17K | |
| page-layout-wizard-img0018.png | 2021-04-05 22:50 | 17K | |
| editing-walls-img0002.png | 2021-04-05 22:49 | 17K | |
| the-style-manager-palette-img0004.png | 2021-04-05 22:50 | 17K | |
| unbend-sheet-img0008.png | 2021-04-05 22:50 | 17K | |
| design-director-options-1-2018-04-16.png | 2021-04-05 22:49 | 17K | |
| multi-line-irregular-polygon-img0002.png | 2021-04-05 22:49 | 17K | |
| select-by-color-img0001.png | 2021-04-05 22:50 | 17K | |
| assigning-property-sets-to-objects-img0003.png | 2021-04-05 22:49 | 17K | |
| redsdk-img00021.png | 2021-04-05 22:50 | 17K | |
| pattern-by-curve-img0002.png | 2021-04-05 22:50 | 17K | |
| inserting-a-parametric-part-from-the-library-img0003.png | 2021-04-05 22:49 | 17K | |
| add-face-img0001.png | 2021-04-05 22:49 | 17K | |
| drafting-palette-toolbar-img0006.png | 2021-04-05 22:49 | 17K | |
| creating-a-parametric-part-img0023.png | 2021-04-05 22:49 | 18K | |
| step-1-define-custom-fields-img0003.png | 2021-04-05 22:50 | 18K | |
| move-img0002.png | 2021-04-05 22:49 | 18K | |
| magnetic-point-img0002.png | 2021-04-05 22:49 | 18K | |
| constraining-dimensions-img0005.png | 2021-04-05 22:49 | 18K | |
| page-layout-wizard-img0019.png | 2021-04-05 22:50 | 18K | |
| creating-sectional-and-iso-views-img0002.png | 2021-04-05 22:49 | 18K | |
| colors-and-brushes-img0015.png | 2021-04-05 22:49 | 18K | |
| unwrapping-the-mesh-img0007.png | 2021-04-05 22:50 | 18K | |
| insert-table-img0007.png | 2021-04-05 22:49 | 18K | |
| step-2-attach-custom-properties-to-objects-img0009.png | 2021-04-05 22:50 | 18K | |
| creating-standard-views-img0005.png | 2021-04-05 22:49 | 18K | |
| measuring-angles-img0002.png | 2021-04-05 22:49 | 18K | |
| creating-3d-objects-by-editing-2d-objects-img0002.png | 2021-04-05 22:49 | 18K | |
| editing-lightworks-material-img0003.png | 2021-04-05 22:49 | 18K | |
| trim-img0006.png | 2021-04-05 22:50 | 18K | |
| bend-sheet-img0014.png | 2021-04-05 22:49 | 18K | |
| step-3-define-fields-for-the-report-img0001.png | 2021-04-05 22:50 | 18K | |
| aerial-view-img0002.png | 2021-04-05 22:49 | 18K | |
| extrude-face-img0004.png | 2021-04-05 22:49 | 18K | |
| step-2-attach-custom-properties-to-objects-img0003.png | 2021-04-05 22:50 | 18K | |
| 3d-spline-by-control-points-img0002.png | 2021-04-05 22:49 | 18K | |
| refining-the-image-img0001.png | 2021-04-05 22:50 | 18K | |
| update-the-selected-image-img0001.png | 2021-04-05 22:50 | 18K | |
| parts-and-assemblies-img0010.png | 2021-04-05 22:50 | 18K | |
| components-of-select-edit-mode-img0010.png | 2021-04-05 22:49 | 18K | |
| holdline-blend-img0008.png | 2021-04-05 22:49 | 18K | |
| block-attributes-img0018.png | 2021-04-05 22:49 | 18K | |
| bend-to-path-img0001.png | 2021-04-05 22:49 | 18K | |
| sketch-style-img0001.png | 2021-04-05 22:50 | 18K | |
| insert-opening-img0003.png | 2021-04-05 22:49 | 18K | |
| editing-a-group-img0005.png | 2021-04-05 22:49 | 18K | |
| sphere-img0004.png | 2021-04-05 22:50 | 18K | |
| warp-by-law-img0011.png | 2021-04-05 22:50 | 18K | |
| print-options-img0005.png | 2021-04-05 22:50 | 18K | |
| loading-a-parametric-part-into-the-library-img0003.png | 2021-04-05 22:49 | 18K | |
| changing-the-workplane-img0001.png | 2021-04-05 22:49 | 18K | |
| aerial-view-img0003.png | 2021-04-05 22:49 | 18K | |
| parts-and-assemblies-img0011.png | 2021-04-05 22:50 | 18K | |
| selecting-smesh-edges-img0002.png | 2021-04-05 22:50 | 18K | |
| editing-the-workplane-img0004.png | 2021-04-05 22:49 | 18K | |
| array-pattern-img0007.png | 2021-04-05 22:49 | 18K | |
| scale-img0005.png | 2021-04-05 22:50 | 18K | |
| cone-img0011.png | 2021-04-05 22:49 | 18K | |
| imprint-add-img0003.png | 2021-04-05 22:49 | 19K | |
| extract-entity-img0007.png | 2021-04-05 22:49 | 19K | |
| block-attributes-img0004.png | 2021-04-05 22:49 | 19K | |
| redsdk-volumetric-environment-img00091.png | 2021-04-05 22:50 | 19K | |
| assemble-by-edge-and-point-img0005.png | 2021-04-05 22:49 | 19K | |
| section-by-view-line-and-aligned-sectional-views-img0009.png | 2021-04-05 22:50 | 19K | |
| revolve-img0032.png | 2021-04-05 22:50 | 19K | |
| acis-img0004.png | 2021-04-05 22:49 | 19K | |
| insert-opening-img0004.png | 2021-04-05 22:49 | 19K | |
| measuring-angles-img0003.png | 2021-04-05 22:49 | 19K | |
| changing-the-workplane-img0021.png | 2021-04-05 22:49 | 19K | |
| model-shaders-and-applications-shaders-img0001.png | 2021-04-05 22:49 | 19K | |
| block-attributes-img0005.png | 2021-04-05 22:49 | 19K | |
| measuring-angles-img0006.png | 2021-04-05 22:49 | 19K | |
| measuring-angles-img0008.png | 2021-04-05 22:49 | 19K | |
| porting-of-redsdk-render-attributes-to-lightworks-2018-04-25-1.png | 2021-04-05 22:50 | 19K | |
| changing-the-workplane-img0029.png | 2021-04-05 22:49 | 19K | |
| edit-opening-modifier-img0006.png | 2021-04-05 22:49 | 19K | |
| database-connection-palette-img0011.png | 2021-04-05 22:49 | 19K | |
| scroll-bars-img0001.png | 2021-04-05 22:50 | 19K | |
| favorites-img0002.png | 2021-04-05 22:49 | 19K | |
| surface-from-laws-img0013.png | 2021-04-05 22:50 | 19K | |
| rotate-img0005.png | 2021-04-05 22:50 | 19K | |
| ifc-import-img0009.png | 2021-04-05 22:49 | 19K | |
| roof-properties-img0005.png | 2021-04-05 22:50 | 19K | |
| spelling-tool-and-spell-options-img0007.png | 2021-04-05 22:50 | 19K | |
| cylinder-img0006.png | 2021-04-05 22:49 | 19K | |
| chamfer-with-round-vertices-img0007.png | 2021-04-05 22:49 | 19K | |
| 2d-geometric-parameters-1-2018-10-13.png | 2021-04-05 22:49 | 19K | |
| polygonal-prism-img0002.png | 2021-04-05 22:50 | 19K | |
| convert-to-slab-img0003.png | 2021-04-05 22:49 | 19K | |
| holdline-blend-img0006.png | 2021-04-05 22:49 | 19K | |
| pulling-curved-faces-img0007.png | 2021-04-05 22:50 | 19K | |
| ifc-bim-data-1-2018-04-25-11.png | 2021-04-05 22:49 | 19K | |
| curve-from-law-img0003.png | 2021-04-05 22:49 | 19K | |
| object-trim-img0015.png | 2021-04-05 22:49 | 19K | |
| variable-blend-img0006.png | 2021-04-05 22:50 | 19K | |
| edit-opening-modifier-img0002.png | 2021-04-05 22:49 | 19K | |
| copying-objects-in-select-edit-img0003.png | 2021-04-05 22:49 | 19K | |
| terrain-img0014.png | 2021-04-05 22:50 | 19K | |
| terrain-img0012.png | 2021-04-05 22:50 | 19K | |
| tracing-img0007.png | 2021-04-05 22:50 | 19K | |
| terrain-img0010.png | 2021-04-05 22:50 | 19K | |
| multi-landing-stair-img0001.png | 2021-04-05 22:49 | 19K | |
| contact-manager-img0005.png | 2021-04-05 22:49 | 19K | |
| deleting-nodes-img0001.png | 2021-04-05 22:49 | 19K | |
| section-by-view-line-and-aligned-sectional-views-img0001.png | 2021-04-05 22:50 | 19K | |
| revolve-img0015.png | 2021-04-05 22:50 | 19K | |
| 3d-spline-by-fit-points-img0002.png | 2021-04-05 22:49 | 19K | |
| object-trim-img0013.png | 2021-04-05 22:49 | 19K | |
| selection-info-palette-img0021.png | 2021-04-05 22:50 | 19K | |
| polygonal-prism-img0006.png | 2021-04-05 22:50 | 20K | |
| insert-table-img0018.png | 2021-04-05 22:49 | 20K | |
| schedule-styles-img0012.png | 2021-04-05 22:50 | 20K | |
| design-director-workplanes-img0001.png | 2021-04-05 22:49 | 20K | |
| 3d-mesh-img0006.png | 2021-04-05 22:49 | 20K | |
| geomarks-and-tap-files-img0003.png | 2021-04-05 22:49 | 20K | |
| selection-info-palette-img0019.png | 2021-04-05 22:50 | 20K | |
| scale-img0006.png | 2021-04-05 22:50 | 20K | |
| holdline-blend-img0002.png | 2021-04-05 22:49 | 20K | |
| add-bottom-wall-modifiers-img0004.png | 2021-04-05 22:49 | 20K | |
| breaks-img0006.png | 2021-04-05 22:49 | 20K | |
| hemisphere-img0003.png | 2021-04-05 22:49 | 20K | |
| the-style-manager-palette-img0006.png | 2021-04-05 22:50 | 20K | |
| polygonal-prism-img0007.png | 2021-04-05 22:50 | 20K | |
| unfold-face-img0004.png | 2021-04-05 22:50 | 20K | |
| creating-sectional-and-iso-views-img0006.png | 2021-04-05 22:49 | 20K | |
| assemble-by-3-points-img0008.png | 2021-04-05 22:49 | 20K | |
| section-by-plane-img0004.png | 2021-04-05 22:50 | 20K | |
| scale-img0004.png | 2021-04-05 22:50 | 20K | |
| hole-patterns-img0002.png | 2021-04-05 22:49 | 20K | |
| tools-palette-img0010.png | 2021-04-05 22:50 | 20K | |
| step-4-create-the-report-img0002.png | 2021-04-05 22:50 | 20K | |
| holdline-blend-img0011.png | 2021-04-05 22:49 | 20K | |
| multileader-dimensions-img0002.png | 2021-04-05 22:49 | 20K | |
| measuring-distance-img0003.png | 2021-04-05 22:49 | 20K | |
| pattern-by-curve-img0001.png | 2021-04-05 22:50 | 20K | |
| edit-opening-modifier-img0005.png | 2021-04-05 22:49 | 20K | |
| transform-recorder-img0007.png | 2021-04-05 22:50 | 20K | |
| saving-and-recalling-workplanes-img0002.png | 2021-04-05 22:50 | 20K | |
| advanced-grid-options-img0002.png | 2021-04-05 22:49 | 20K | |
| section-by-line-img0004.png | 2021-04-05 22:50 | 20K | |
| cone-img0003.png | 2021-04-05 22:49 | 20K | |
| create-surface-from-solid-img0007.png | 2021-04-05 22:49 | 20K | |
| tube-flange-img0002.png | 2021-04-05 22:50 | 20K | |
| dimension-styles-img0004.png | 2021-04-05 22:49 | 20K | |
| super-selector-modes-img0001.png | 2021-04-05 22:50 | 20K | |
| radial-pattern-img0004.png | 2021-04-05 22:50 | 20K | |
| trace-by-rectangle-img0004.png | 2021-04-05 22:50 | 20K | |
| drafting-palette-toolbar-img0005.png | 2021-04-05 22:49 | 20K | |
| deleting-nodes-img0002.png | 2021-04-05 22:49 | 20K | |
| creating-a-group-img0005.png | 2021-04-05 22:49 | 20K | |
| curve-from-law-img0014.png | 2021-04-05 22:49 | 20K | |
| trim-by-entity-img0002.png | 2021-04-05 22:50 | 20K | |
| editing-lightworks-material-img0015.png | 2021-04-05 22:49 | 20K | |
| redsdk-material-concepts-and-properties-img00081.png | 2021-04-05 22:50 | 20K | |
| changing-the-workplane-img0028.png | 2021-04-05 22:49 | 20K | |
| changing-rows-and-columns-merging-cells-1-2018-04-23.png | 2021-04-05 22:49 | 20K | |
| using-the-lte-command-line-img0001.png | 2021-04-05 22:50 | 20K | |
| step-4-create-the-report-img0005.png | 2021-04-05 22:50 | 20K | |
| editing-splines-and-bezier-curves-img0010.png | 2021-04-05 22:49 | 21K | |
| stair-by-linework-img0002.png | 2021-04-05 22:50 | 21K | |
| bend-sheet-img0012.png | 2021-04-05 22:49 | 21K | |
| tweak-face-img0002.png | 2021-04-05 22:50 | 21K | |
| scaling-objects-in-select-edit-img0003.png | 2021-04-05 22:50 | 21K | |
| section-img0001.png | 2021-04-05 22:50 | 21K | |
| block-attributes-img0011.png | 2021-04-05 22:49 | 21K | |
| edit-tool-in-3d-img0005.png | 2021-04-05 22:49 | 21K | |
| imprint-edge-img0008.png | 2021-04-05 22:49 | 21K | |
| viewport-properties-img0002.png | 2021-04-05 22:50 | 21K | |
| twisted-extrude-img0004.png | 2021-04-05 22:50 | 21K | |
| revolve-img0004.png | 2021-04-05 22:50 | 21K | |
| editing-text-img0001.png | 2021-04-05 22:49 | 21K | |
| parts-and-assemblies-img0003.png | 2021-04-05 22:50 | 21K | |
| editing-splines-and-bezier-curves-img0013.png | 2021-04-05 22:49 | 21K | |
| ifc-import-img0015.png | 2021-04-05 22:49 | 21K | |
| ifc-import-img0013.png | 2021-04-05 22:49 | 21K | |
| assemble-by-axis-img0006.png | 2021-04-05 22:49 | 21K | |
| inserting-entity-marks-img0002.png | 2021-04-05 22:49 | 21K | |
| drawing-settings-img0004.png | 2021-04-05 22:49 | 21K | |
| text-styles-img0002.png | 2021-04-05 22:50 | 21K | |
| editing-segments-img0011.png | 2021-04-05 22:49 | 21K | |
| parts-and-assemblies-img0012.png | 2021-04-05 22:50 | 21K | |
| creating-and-displaying-windows-img0004.png | 2021-04-05 22:49 | 21K | |
| creating-a-new-lightworks-material-img0013.png | 2021-04-05 22:49 | 21K | |
| add-roof-by-walls-img0003.png | 2021-04-05 22:49 | 21K | |
| parts-and-assemblies-img0016.png | 2021-04-05 22:50 | 21K | |
| saving-and-recalling-workplanes-img0004.png | 2021-04-05 22:50 | 21K | |
| loading-symbol-folders-into-the-library-img0003.png | 2021-04-05 22:49 | 21K | |
| creating-a-new-redsdk-material-img00031.png | 2021-04-05 22:49 | 21K | |
| split-face-img0003.png | 2021-04-05 22:50 | 21K | |
| creating-a-parametric-part-img0044.png | 2021-04-05 22:49 | 21K | |
| rotate-img0006.png | 2021-04-05 22:50 | 21K | |
| render-camera-properties-img0003.png | 2021-04-05 22:50 | 21K | |
| loading-a-parametric-part-into-the-library-img0010.png | 2021-04-05 22:49 | 21K | |
| spiral-stair-img0004.png | 2021-04-05 22:50 | 21K | |
| simple-extrude-img0007.png | 2021-04-05 22:50 | 21K | |
| inserting-a-symbol-from-the-library-into-the-drawing-img0002.png | 2021-04-05 22:49 | 21K | |
| docking-palettes-img0002.png | 2021-04-05 22:49 | 21K | |
| ifc-import-img0012.png | 2021-04-05 22:49 | 21K | |
| creating-a-group-img0002.png | 2021-04-05 22:49 | 21K | |
| miter-two-roof-slabs-img0006.png | 2021-04-05 22:49 | 22K | |
| creating-a-parametric-part-img0042.png | 2021-04-05 22:49 | 22K | |
| offset-with-law-img0008.png | 2021-04-05 22:49 | 22K | |
| curve-properties-img0009.png | 2021-04-05 22:49 | 22K | |
| cone-img0014.png | 2021-04-05 22:49 | 22K | |
| surface-from-laws-img0014.png | 2021-04-05 22:50 | 22K | |
| assemble-by-3-points-1-2018-04-24-4.png | 2021-04-05 22:49 | 22K | |
| redsdk-material-concepts-and-properties-img00021.png | 2021-04-05 22:50 | 22K | |
| favorites-img0005.png | 2021-04-05 22:49 | 22K | |
| move-img0004.png | 2021-04-05 22:49 | 22K | |
| using-the-luminances-palette-img0001.png | 2021-04-05 22:50 | 22K | |
| creating-standard-views-img0011.png | 2021-04-05 22:49 | 22K | |
| editing-splines-and-bezier-curves-img0008.png | 2021-04-05 22:49 | 22K | |
| redsdk-volumetric-environment-img00271.png | 2021-04-05 22:50 | 22K | |
| property-set-definitions-img0009.png | 2021-04-05 22:50 | 22K | |
| create-surface-from-solid-img0006.png | 2021-04-05 22:49 | 22K | |
| menu-bar-img0001.png | 2021-04-05 22:49 | 22K | |
| shelling-solids-img0004.png | 2021-04-05 22:50 | 22K | |
| deform-to-point-img0002.png | 2021-04-05 22:49 | 22K | |
| tools-palette-img0011.png | 2021-04-05 22:50 | 22K | |
| wcs-and-ucs-img0004.png | 2021-04-05 22:50 | 22K | |
| bend-sheet-img0004.png | 2021-04-05 22:49 | 22K | |
| measuring-distance-img0011.png | 2021-04-05 22:49 | 22K | |
| inserting-2d-blocks-in-walls-img0001.png | 2021-04-05 22:49 | 22K | |
| wcs-and-ucs-img0003.png | 2021-04-05 22:50 | 22K | |
| design-director-toolbar-and-menu-1-2018-04-16.png | 2021-04-05 22:49 | 22K | |
| lte-command-line-options-img0005.png | 2021-04-05 22:49 | 22K | |
| cone-img0006.png | 2021-04-05 22:49 | 22K | |
| section-by-view-line-and-aligned-sectional-views-img0012.png | 2021-04-05 22:50 | 22K | |
| external-references-img0003.png | 2021-04-05 22:49 | 22K | |
| fillet-edges-img0002.png | 2021-04-05 22:49 | 22K | |
| variable-blend-img0002.png | 2021-04-05 22:50 | 22K | |
| library-folders-img0007.png | 2021-04-05 22:49 | 22K | |
| cylindrical-pattern-img0005.png | 2021-04-05 22:49 | 22K | |
| window-styles-img0011.png | 2021-04-05 22:50 | 22K | |
| unfold-face-img0009.png | 2021-04-05 22:50 | 22K | |
| lofting-img0008.png | 2021-04-05 22:49 | 22K | |
| ifc-import-img0007.png | 2021-04-05 22:49 | 22K | |
| imprint-with-dimple-sheet-metal-img0004.png | 2021-04-05 22:49 | 22K | |
| pattern-by-polyline-img0001.png | 2021-04-05 22:50 | 22K | |
| fillet-with-round-vertices-img0011.png | 2021-04-05 22:49 | 22K | |
| holdline-blend-img0009.png | 2021-04-05 22:49 | 22K | |
| facet-edit-img0006.png | 2021-04-05 22:49 | 22K | |
| page-layout-wizard-img0024.png | 2021-04-05 22:50 | 22K | |
| working-with-multiple-windows-1-2018-04-16.png | 2021-04-05 22:50 | 22K | |
| editing-lights-1-2018-04-22.png | 2021-04-05 22:49 | 22K | |
| re-patching-img0002.png | 2021-04-05 22:50 | 22K | |
| lte-command-line-options-img0004.png | 2021-04-05 22:49 | 22K | |
| creating-and-displaying-windows-1-2018-04-16-7.png | 2021-04-05 22:49 | 22K | |
| editing-splines-and-bezier-curves-img0009.png | 2021-04-05 22:49 | 22K | |
| creating-and-displaying-windows-1-2018-04-16-4.png | 2021-04-05 22:49 | 22K | |
| creating-and-displaying-windows-1-2018-04-16-6.png | 2021-04-05 22:49 | 22K | |
| multiple-windows-of-the-same-file-1-2018-04-16-1.png | 2021-04-05 22:49 | 22K | |
| page-layout-wizard-img0020.png | 2021-04-05 22:50 | 22K | |
| creating-and-displaying-windows-1-2018-04-16.png | 2021-04-05 22:49 | 22K | |
| thread-img0003.png | 2021-04-05 22:50 | 22K | |
| database-connection-palette-img0012.png | 2021-04-05 22:49 | 22K | |
| creating-and-displaying-windows-1-2018-04-16-1.png | 2021-04-05 22:49 | 22K | |
| creating-and-displaying-windows-1-2018-04-16-3.png | 2021-04-05 22:49 | 22K | |
| creating-and-displaying-windows-1-2018-04-16-5.png | 2021-04-05 22:49 | 22K | |
| thick-profile-1-2018-04-20-1.png | 2021-04-05 22:50 | 22K | |
| ifc-import-img0016.png | 2021-04-05 22:49 | 22K | |
| creating-and-displaying-windows-1-2018-04-16-2.png | 2021-04-05 22:49 | 22K | |
| variable-blend-img0007.png | 2021-04-05 22:50 | 22K | |
| ifc-import-img0014.png | 2021-04-05 22:49 | 22K | |
| creating-lights-light-types-img0013.png | 2021-04-05 22:49 | 22K | |
| tcw-profiles-img0002.png | 2021-04-05 22:50 | 22K | |
| flatten-on-workplane-img0001.png | 2021-04-05 22:49 | 22K | |
| step-3-define-fields-for-the-report-img0002.png | 2021-04-05 22:50 | 23K | |
| step-4-create-the-report-img0004.png | 2021-04-05 22:50 | 23K | |
| viewing-and-editing-data-in-tables-img0002.png | 2021-04-05 22:50 | 23K | |
| customize-options-img0001.png | 2021-04-05 22:49 | 23K | |
| creating-a-new-lightworks-material-img0007.png | 2021-04-05 22:49 | 23K | |
| step-4-create-the-report-img0003.png | 2021-04-05 22:50 | 23K | |
| profile-styles-img0008.png | 2021-04-05 22:50 | 23K | |
| trim-roof-slab-img0006.png | 2021-04-05 22:50 | 23K | |
| select-by-query-img0004.png | 2021-04-05 22:50 | 23K | |
| parts-and-assemblies-img0002.png | 2021-04-05 22:50 | 23K | |
| sheet-metal-gusset-img0004.png | 2021-04-05 22:50 | 23K | |
| assemble-by-axis-img0004.png | 2021-04-05 22:49 | 23K | |
| drawing-settings-img0006.png | 2021-04-05 22:49 | 23K | |
| creating-standard-views-img0004.png | 2021-04-05 22:49 | 23K | |
| section-by-view-line-and-aligned-sectional-views-img0013.png | 2021-04-05 22:50 | 23K | |
| move-img0003.png | 2021-04-05 22:49 | 23K | |
| aec-dimension-styles-img0010.png | 2021-04-05 22:49 | 23K | |
| redsdk-material-concepts-and-properties-img00091.png | 2021-04-05 22:50 | 23K | |
| revolve-img0012.png | 2021-04-05 22:50 | 23K | |
| cylindrical-pattern-img0001.png | 2021-04-05 22:49 | 23K | |
| render-camera-properties-1-2018-04-18-1.png | 2021-04-05 22:50 | 23K | |
| aec-dimension-styles-img0009.png | 2021-04-05 22:49 | 23K | |
| door-styles-img0012.png | 2021-04-05 22:49 | 23K | |
| fillet-with-variable-radius-img0004.png | 2021-04-05 22:49 | 23K | |
| woodworking-img0002.png | 2021-04-05 22:50 | 23K | |
| measuring-distance-img0005.png | 2021-04-05 22:49 | 23K | |
| step-3-define-fields-for-the-report-img0010.png | 2021-04-05 22:50 | 23K | |
| bend-to-path-img0004.png | 2021-04-05 22:49 | 23K | |
| creating-a-new-lightworks-material-img0009.png | 2021-04-05 22:49 | 23K | |
| step-4-create-the-report-img0010.png | 2021-04-05 22:50 | 23K | |
| design-director-options-1-2018-04-16-1.png | 2021-04-05 22:49 | 23K | |
| copying-objects-in-select-edit-img0005.png | 2021-04-05 22:49 | 23K | |
| creating-a-rendered-view-1-2018-04-18.png | 2021-04-05 22:49 | 23K | |
| assemble-by-axis-img0010.png | 2021-04-05 22:49 | 23K | |
| mouse-controls-img0001.png | 2021-04-05 22:49 | 23K | |
| twisted-extrude-img0005.png | 2021-04-05 22:50 | 23K | |
| super-selector-modes-img0004.png | 2021-04-05 22:50 | 23K | |
| database-connection-palette-img0001.png | 2021-04-05 22:49 | 23K | |
| creating-a-parametric-part-img0015.png | 2021-04-05 22:49 | 23K | |
| general-properties-img0001.png | 2021-04-05 22:49 | 23K | |
| quick-pull-img0002.png | 2021-04-05 22:50 | 23K | |
| editing-a-block-img0012.png | 2021-04-05 22:49 | 23K | |
| bend-sheet-img0005.png | 2021-04-05 22:49 | 23K | |
| profile-editing-img0019.png | 2021-04-05 22:50 | 23K | |
| terrain-img0016.png | 2021-04-05 22:50 | 23K | |
| warp-by-law-img0014.png | 2021-04-05 22:50 | 23K | |
| rail-styles-img0012.png | 2021-04-05 22:50 | 23K | |
| rotated-box-img0002.png | 2021-04-05 22:50 | 23K | |
| protractor-img0004.png | 2021-04-05 22:50 | 23K | |
| redsdk-material-concepts-and-properties-img00071.png | 2021-04-05 22:50 | 23K | |
| database-connection-palette-img0019.png | 2021-04-05 22:49 | 23K | |
| creating-construction-geometry-img0026.png | 2021-04-05 22:49 | 24K | |
| creating-a-new-lightworks-material-img0004.png | 2021-04-05 22:49 | 24K | |
| parts-and-assemblies-img0013.png | 2021-04-05 22:50 | 24K | |
| miter-two-roof-slabs-img0002.png | 2021-04-05 22:49 | 24K | |
| render-camera-properties-img0002.png | 2021-04-05 22:50 | 24K | |
| loading-a-parametric-part-into-the-library-img0009.png | 2021-04-05 22:49 | 24K | |
| points-coincident-constraint-img0008.png | 2021-04-05 22:50 | 24K | |
| section-by-line-img0005.png | 2021-04-05 22:50 | 24K | |
| assemble-by-axis-img0017.png | 2021-04-05 22:49 | 24K | |
| loading-symbol-folders-into-the-library-img0007.png | 2021-04-05 22:49 | 24K | |
| deleting-nodes-img0004.png | 2021-04-05 22:49 | 24K | |
| measuring-distance-img0006.png | 2021-04-05 22:49 | 24K | |
| tools-palette-img0009.png | 2021-04-05 22:50 | 24K | |
| inspector-bar-img0009.png | 2021-04-05 22:49 | 24K | |
| hole-img0007.png | 2021-04-05 22:49 | 24K | |
| vertical-img0004.png | 2021-04-05 22:50 | 24K | |
| woodworking-img0007.png | 2021-04-05 22:50 | 24K | |
| selection-info-palette-img0022.png | 2021-04-05 22:50 | 24K | |
| bend-to-path-img0002.png | 2021-04-05 22:49 | 24K | |
| viewing-and-editing-data-in-tables-img0003.png | 2021-04-05 22:50 | 24K | |
| loading-a-parametric-part-into-the-library-img0006.png | 2021-04-05 22:49 | 24K | |
| cylinder-img0004.png | 2021-04-05 22:49 | 24K | |
| profile-styles-img0004.png | 2021-04-05 22:50 | 24K | |
| sheet-metal-gusset-img0001.png | 2021-04-05 22:50 | 24K | |
| audit.png | 2021-04-05 22:49 | 24K | |
| multi-view-blocks-img0007.png | 2021-04-05 22:49 | 24K | |
| wire-wrap-img0009.png | 2021-04-05 22:50 | 24K | |
| editing-a-block-img0015.png | 2021-04-05 22:49 | 24K | |
| managing-luminances-in-the-render-manager-img0003.png | 2021-04-05 22:49 | 24K | |
| customize-popup-toolbars-img0003.png | 2021-04-05 22:49 | 24K | |
| editing-splines-and-bezier-curves-img0012.png | 2021-04-05 22:49 | 24K | |
| creating-standard-views-img0006.png | 2021-04-05 22:49 | 24K | |
| editing-a-block-img0005.png | 2021-04-05 22:49 | 24K | |
| create-surface-from-solid-img0004.png | 2021-04-05 22:49 | 24K | |
| camera-objects-img0010.png | 2021-04-05 22:49 | 24K | |
| step-3-define-fields-for-the-report-img0003.png | 2021-04-05 22:50 | 24K | |
| multi-line-properties-img0008.png | 2021-04-05 22:49 | 24K | |
| inserting-walls-img0016.png | 2021-04-05 22:49 | 24K | |
| getting-help-1-2018-04-22.png | 2021-04-05 22:49 | 24K | |
| wall-properties-img0001.png | 2021-04-05 22:50 | 24K | |
| add-face-img0002.png | 2021-04-05 22:49 | 24K | |
| web-tutorials-1-2018-04-22.png | 2021-04-05 22:50 | 24K | |
| help-on-the-internet-1-2018-04-22.png | 2021-04-05 22:49 | 24K | |
| creating-a-block-img0004.png | 2021-04-05 22:49 | 24K | |
| drawing-settings-img0002.png | 2021-04-05 22:49 | 24K | |
| drawing-settings-img0008.png | 2021-04-05 22:49 | 24K | |
| assemble-by-facet-img0001.png | 2021-04-05 22:49 | 24K | |
| format-painter-img0003.png | 2021-04-05 22:49 | 25K | |
| creating-a-block-img0006.png | 2021-04-05 22:49 | 25K | |
| meet-2-lines-1-2018-04-24.png | 2021-04-05 22:49 | 25K | |
| t-meet-2-double-lines-1-2018-04-24.png | 2021-04-05 22:50 | 25K | |
| window-styles-img0002.png | 2021-04-05 22:50 | 25K | |
| arc-complement-1-2018-04-24.png | 2021-04-05 22:49 | 25K | |
| trim-1-2018-04-24.png | 2021-04-05 22:50 | 25K | |
| line-length-1-2018-04-24.png | 2021-04-05 22:49 | 25K | |
| split-1-2018-04-24.png | 2021-04-05 22:50 | 25K | |
| 2d-boolean-operations-1-2018-04-24.png | 2021-04-05 22:49 | 25K | |
| offset-1-2018-04-24.png | 2021-04-05 22:49 | 25K | |
| chamfer-1-2018-04-24.png | 2021-04-05 22:49 | 25K | |
| detail-section-1-2018-04-24.png | 2021-04-05 22:49 | 25K | |
| intersect-2-double-lines-1-2018-04-24.png | 2021-04-05 22:49 | 25K | |
| join-polyline-1-2018-04-24.png | 2021-04-05 22:49 | 25K | |
| multi-shrink-extend-line-1-2018-04-24.png | 2021-04-05 22:49 | 25K | |
| cylinder-img0007.png | 2021-04-05 22:49 | 25K | |
| shrink-extend-line-1-2018-04-24.png | 2021-04-05 22:50 | 25K | |
| stretch-1-2018-04-24.png | 2021-04-05 22:50 | 25K | |
| object-trim-1-2018-04-24.png | 2021-04-05 22:49 | 25K | |
| redsdk-volumetric-environment-img00101.png | 2021-04-05 22:50 | 25K | |
| stretch-1-2018-04-24-1.png | 2021-04-05 22:50 | 25K | |
| thick-profile-1-2018-04-24.png | 2021-04-05 22:50 | 25K | |
| editing-walls-img0004.png | 2021-04-05 22:49 | 25K | |
| chain-polyline-1-2018-04-24.png | 2021-04-05 22:49 | 25K | |
| xclip-1-2018-04-24.png | 2021-04-05 22:50 | 25K | |
| trim-by-entity-1-2018-04-24.png | 2021-04-05 22:50 | 25K | |
| profile-editing-img0007.png | 2021-04-05 22:50 | 25K | |
| variable-blend-img0003.png | 2021-04-05 22:50 | 25K | |
| loading-a-parametric-part-into-the-library-img0005.png | 2021-04-05 22:49 | 25K | |
| creating-a-new-lightworks-material-img0008.png | 2021-04-05 22:49 | 25K | |
| inserting-a-block-img0003.png | 2021-04-05 22:49 | 25K | |
| printing-1-2018-04-12-2.png | 2021-04-05 22:50 | 25K | |
| wedge-img0002.png | 2021-04-05 22:50 | 25K | |
| selecting-smesh-nodes-img0003.png | 2021-04-05 22:50 | 25K | |
| creating-hatch-patterns-img0001.png | 2021-04-05 22:49 | 25K | |
| selection-info-palette-img0002.png | 2021-04-05 22:50 | 25K | |
| cone-img0012.png | 2021-04-05 22:49 | 25K | |
| twist-entity-img0005.png | 2021-04-05 22:50 | 25K | |
| unbend-sheet-img0009.png | 2021-04-05 22:50 | 25K | |
| paper-space-properties-img0002.png | 2021-04-05 22:50 | 25K | |
| publish-as-html-1-2018-04-12.png | 2021-04-05 22:50 | 25K | |
| inserting-walls-img0010.png | 2021-04-05 22:49 | 25K | |
| editing-multiple-nodes-img0008.png | 2021-04-05 22:49 | 25K | |
| parts-and-assemblies-img0004.png | 2021-04-05 22:50 | 25K | |
| creating-a-parametric-part-img0016.png | 2021-04-05 22:49 | 25K | |
| managing-environments-in-the-render-manager-img0009.png | 2021-04-05 22:49 | 25K | |
| extend-roof-slab-img0009.png | 2021-04-05 22:49 | 25K | |
| revolve-img0020.png | 2021-04-05 22:50 | 25K | |
| selection-info-palette-img0003.png | 2021-04-05 22:50 | 25K | |
| editing-walls-img0005.png | 2021-04-05 22:49 | 25K | |
| block-attributes-img0022.png | 2021-04-05 22:49 | 25K | |
| components-of-select-edit-mode-img0012.png | 2021-04-05 22:49 | 25K | |
| delete-faces-img0003.png | 2021-04-05 22:49 | 25K | |
| lightworks-img0001.png | 2021-04-05 22:49 | 25K | |
| the-style-manager-palette-img0002.png | 2021-04-05 22:50 | 25K | |
| slab-styles-img0007.png | 2021-04-05 22:50 | 25K | |
| multi-line-properties-img0006.png | 2021-04-05 22:49 | 25K | |
| assemble-by-axis-img0011.png | 2021-04-05 22:49 | 25K | |
| tools-palette-img0013.png | 2021-04-05 22:50 | 25K | |
| extrude-to-face-img0001.png | 2021-04-05 22:49 | 25K | |
| selection-info-palette-img0010.png | 2021-04-05 22:50 | 25K | |
| visual-representation-img0005.png | 2021-04-05 22:50 | 25K | |
| circular-slot-img0003.png | 2021-04-05 22:49 | 25K | |
| creating-a-new-lightworks-material-img0001.png | 2021-04-05 22:49 | 25K | |
| block-attributes-img0015.png | 2021-04-05 22:49 | 25K | |
| selection-info-palette-img0007.png | 2021-04-05 22:50 | 25K | |
| redsdk-material-concepts-and-properties-img00061.png | 2021-04-05 22:50 | 25K | |
| loading-symbol-folders-into-the-library-img0008.png | 2021-04-05 22:49 | 25K | |
| holdline-blend-img0010.png | 2021-04-05 22:49 | 25K | |
| selection-info-palette-img0014.png | 2021-04-05 22:50 | 26K | |
| terrain-img0005.png | 2021-04-05 22:50 | 26K | |
| properties-of-section-lines-img0001.png | 2021-04-05 22:50 | 26K | |
| redsdk-material-concepts-and-properties-img00111.png | 2021-04-05 22:50 | 26K | |
| stair-properties-img0001.png | 2021-04-05 22:50 | 26K | |
| the-style-manager-palette-img0005.png | 2021-04-05 22:50 | 26K | |
| door-styles-img0010.png | 2021-04-05 22:49 | 26K | |
| step-4-create-the-report-img0006.png | 2021-04-05 22:50 | 26K | |
| palette-area-img0001.png | 2021-04-05 22:50 | 26K | |
| page-layout-wizard-img0003.png | 2021-04-05 22:50 | 26K | |
| redsdk-material-concepts-and-properties-img00051.png | 2021-04-05 22:50 | 26K | |
| vertical-img0002.png | 2021-04-05 22:50 | 26K | |
| rotate-view-with-viewport-1-2018-04-22-1.png | 2021-04-05 22:50 | 26K | |
| updating-the-database-and-report-1-2018-02-23-4.png | 2021-04-05 22:50 | 26K | |
| unbend-sheet-img0010.png | 2021-04-05 22:50 | 26K | |
| polygonal-prism-img0003.png | 2021-04-05 22:50 | 26K | |
| convert-to-arc-polyline-img0003.png | 2021-04-05 22:49 | 26K | |
| page-setup-1-2018-04-18.png | 2021-04-05 22:50 | 26K | |
| controlling-lights-img0001.png | 2021-04-05 22:49 | 26K | |
| print-options-1-2018-04-18.png | 2021-04-05 22:50 | 26K | |
| printing-from-model-space-1-2018-04-18.png | 2021-04-05 22:50 | 26K | |
| lofting-img0018.png | 2021-04-05 22:49 | 26K | |
| print-style-options-1-2018-04-18.png | 2021-04-05 22:50 | 26K | |
| creating-a-parametric-part-img0027.png | 2021-04-05 22:49 | 26K | |
| render-scene-luminance-img0002.png | 2021-04-05 22:50 | 26K | |
| ifc-import-img0011.png | 2021-04-05 22:49 | 26K | |
| profile-styles-img0016.png | 2021-04-05 22:50 | 26K | |
| assemble-by-axis-img0013.png | 2021-04-05 22:49 | 26K | |
| edit-opening-modifier-img0004.png | 2021-04-05 22:49 | 26K | |
| 3d-tools-for-smesh-creation-img0002.png | 2021-04-05 22:49 | 26K | |
| cylinder-img0003.png | 2021-04-05 22:49 | 26K | |
| extruding-smesh-faces-img0002.png | 2021-04-05 22:49 | 26K | |
| assemble-by-tangents-img0007.png | 2021-04-05 22:49 | 26K | |
| door-styles-img0030.png | 2021-04-05 22:49 | 26K | |
| editing-multiple-nodes-img0009.png | 2021-04-05 22:49 | 26K | |
| render-camera-properties-img0005.png | 2021-04-05 22:50 | 26K | |
| calculator-palette-variables-palette-img0004.png | 2021-04-05 22:49 | 26K | |
| select-by-query-img0015.png | 2021-04-05 22:50 | 26K | |
| rail-styles-img0013.png | 2021-04-05 22:50 | 26K | |
| trim-img0005.png | 2021-04-05 22:50 | 26K | |
| slab-styles-img0004.png | 2021-04-05 22:50 | 26K | |
| trim-img0003.png | 2021-04-05 22:50 | 26K | |
| dimension-styles-img0001.png | 2021-04-05 22:49 | 26K | |
| render-camera-properties-1-2018-04-18-2.png | 2021-04-05 22:50 | 26K | |
| modify-table-img0005.png | 2021-04-05 22:49 | 26K | |
| section-by-closed-polyline-img0004.png | 2021-04-05 22:50 | 26K | |
| twist-entity-img0004.png | 2021-04-05 22:50 | 26K | |
| drawing-settings-img0009.png | 2021-04-05 22:49 | 26K | |
| ifc-import-img0010.png | 2021-04-05 22:49 | 26K | |
| colors-and-brushes-img0007.png | 2021-04-05 22:49 | 26K | |
| schedule-styles-img0007.png | 2021-04-05 22:50 | 26K | |
| wedge-img0004.png | 2021-04-05 22:50 | 26K | |
| drafting-palette-toolbar-img0004.png | 2021-04-05 22:49 | 26K | |
| flange-img0002.png | 2021-04-05 22:49 | 26K | |
| general-settings-img0004.png | 2021-04-05 22:49 | 26K | |
| starting-turbocad-img0006.png | 2021-04-05 22:50 | 26K | |
| bend-sheet-img0006.png | 2021-04-05 22:49 | 26K | |
| edit-opening-modifier-img0003.png | 2021-04-05 22:49 | 27K | |
| creating-a-new-lightworks-material-img0003.png | 2021-04-05 22:49 | 27K | |
| viewport-properties-img0003.png | 2021-04-05 22:50 | 27K | |
| redsdk-material-concepts-and-properties-img00101.png | 2021-04-05 22:50 | 27K | |
| redsdk-material-concepts-and-properties-img00011.png | 2021-04-05 22:50 | 27K | |
| block-attributes-img0016.png | 2021-04-05 22:49 | 27K | |
| components-of-select-edit-mode-img0011.png | 2021-04-05 22:49 | 27K | |
| quick-pull-img0009.png | 2021-04-05 22:50 | 27K | |
| multi-landing-stair-img0010.png | 2021-04-05 22:49 | 27K | |
| thick-profile-1-2018-04-20-2.png | 2021-04-05 22:50 | 27K | |
| super-selector-modes-img0007.png | 2021-04-05 22:50 | 27K | |
| multi-landing-stair-img0002.png | 2021-04-05 22:49 | 27K | |
| spiral-stair-img0001.png | 2021-04-05 22:50 | 27K | |
| step-4-create-the-report-img0001.png | 2021-04-05 22:50 | 27K | |
| editing-walls-img0007.png | 2021-04-05 22:49 | 27K | |
| schedule-styles-img0020.png | 2021-04-05 22:50 | 27K | |
| tc-mesh-simplification-img0003.png | 2021-04-05 22:50 | 27K | |
| lofting-img0021.png | 2021-04-05 22:49 | 27K | |
| repositioning-control-handles-of-the-selector-img0005.png | 2021-04-05 22:50 | 27K | |
| tools-palette-img0012.png | 2021-04-05 22:50 | 27K | |
| extend-roof-slab-img0007.png | 2021-04-05 22:49 | 27K | |
| assemble-by-axis-img0005.png | 2021-04-05 22:49 | 27K | |
| image-manager-palette-img0002.png | 2021-04-05 22:49 | 27K | |
| step-3-define-fields-for-the-report-img0004.png | 2021-04-05 22:50 | 27K | |
| loading-a-parametric-part-into-the-library-img0002.png | 2021-04-05 22:49 | 27K | |
| tc-mesh-simplification-img0002.png | 2021-04-05 22:50 | 27K | |
| profile-styles-img0010.png | 2021-04-05 22:50 | 27K | |
| miter-two-roof-slabs-img0007.png | 2021-04-05 22:49 | 27K | |
| creating-a-parametric-part-img0008.png | 2021-04-05 22:49 | 27K | |
| sketch-style-img0006.png | 2021-04-05 22:50 | 27K | |
| creating-and-displaying-windows-img0003.png | 2021-04-05 22:49 | 27K | |
| spherical-pattern-img0004.png | 2021-04-05 22:50 | 27K | |
| loading-symbol-folders-into-the-library-img0006.png | 2021-04-05 22:49 | 27K | |
| editing-walls-img0010.png | 2021-04-05 22:49 | 27K | |
| add-bottom-wall-modifiers-img0003.png | 2021-04-05 22:49 | 27K | |
| triangulating-point-clouds-img0001.png | 2021-04-05 22:50 | 27K | |
| workplane-intersections-snap-img0002.png | 2021-04-05 22:50 | 27K | |
| drawing-settings-img0007.png | 2021-04-05 22:49 | 27K | |
| epack-1-2018-04-14.png | 2021-04-05 22:49 | 27K | |
| page-setup-wizard-1-2018-04-14.png | 2021-04-05 22:50 | 27K | |
| split-face-img0004.png | 2021-04-05 22:50 | 27K | |
| purge-1-2018-04-14.png | 2021-04-05 22:50 | 27K | |
| library-folders-img0009.png | 2021-04-05 22:49 | 27K | |
| saving-files-1-2018-04-14.png | 2021-04-05 22:50 | 27K | |
| opening-files-1-2018-04-14.png | 2021-04-05 22:49 | 27K | |
| curve-properties-img0001.png | 2021-04-05 22:49 | 27K | |
| multi-view-blocks-img0009.png | 2021-04-05 22:49 | 27K | |
| library-folders-img0011.png | 2021-04-05 22:49 | 27K | |
| property-set-definitions-img0007.png | 2021-04-05 22:50 | 27K | |
| extend-roof-slab-img0002.png | 2021-04-05 22:49 | 27K | |
| assemble-by-tangents-img0012.png | 2021-04-05 22:49 | 27K | |
| cone-img0016.png | 2021-04-05 22:49 | 28K | |
| assemble-by-tangents-img0008.png | 2021-04-05 22:49 | 28K | |
| parts-and-assemblies-img0006.png | 2021-04-05 22:50 | 28K | |
| u-shaped-stair-img0001.png | 2021-04-05 22:50 | 28K | |
| selection-info-palette-img0023.png | 2021-04-05 22:50 | 28K | |
| edit-tool-in-3d-img0006.png | 2021-04-05 22:49 | 28K | |
| deform-to-point-img0010.png | 2021-04-05 22:49 | 28K | |
| creating-standard-views-img0010.png | 2021-04-05 22:49 | 28K | |
| profile-editing-img0021.png | 2021-04-05 22:50 | 28K | |
| loading-symbol-folders-into-the-library-img0001.png | 2021-04-05 22:49 | 28K | |
| fragmental-views-img0002.png | 2021-04-05 22:49 | 28K | |
| editing-a-block-img0007.png | 2021-04-05 22:49 | 28K | |
| map-img0009.png | 2021-04-05 22:49 | 28K | |
| lightworks-luminance-properties-img0003.png | 2021-04-05 22:49 | 28K | |
| selector-mode-img0001.png | 2021-04-05 22:50 | 28K | |
| general-settings-img0001.png | 2021-04-05 22:49 | 28K | |
| sphere-img0003.png | 2021-04-05 22:50 | 28K | |
| assemble-by-axis-img0003.png | 2021-04-05 22:49 | 28K | |
| workplane-by-3d-object-img0002.png | 2021-04-05 22:50 | 28K | |
| selection-info-palette-img0040.png | 2021-04-05 22:50 | 28K | |
| miter-two-roof-slabs-img0003.png | 2021-04-05 22:49 | 28K | |
| schedule-styles-img0011.png | 2021-04-05 22:50 | 28K | |
| organizational-chart-img0001.png | 2021-04-05 22:49 | 28K | |
| flange-img0001.png | 2021-04-05 22:49 | 28K | |
| offset-with-law-img0010.png | 2021-04-05 22:49 | 28K | |
| selection-info-palette-img0041.png | 2021-04-05 22:50 | 28K | |
| 2d-3d-selector-img0017.png | 2021-04-05 22:49 | 28K | |
| fragmental-views-img0003.png | 2021-04-05 22:49 | 28K | |
| editing-a-block-img0002.png | 2021-04-05 22:49 | 28K | |
| 2d-3d-selector-img0016.png | 2021-04-05 22:49 | 28K | |
| inserting-a-symbol-from-the-library-into-the-drawing-img0004.png | 2021-04-05 22:49 | 28K | |
| table-styles-img0001.png | 2021-04-05 22:50 | 28K | |
| creating-sectional-and-iso-views-img0007.png | 2021-04-05 22:49 | 28K | |
| redsdk-global-environments-img00121.png | 2021-04-05 22:50 | 28K | |
| conceptual-selector-boundary-box-img0001.png | 2021-04-05 22:49 | 28K | |
| loading-symbol-folders-into-the-library-img0009.png | 2021-04-05 22:49 | 28K | |
| epack-1-2018-04-22.png | 2021-04-05 22:49 | 28K | |
| ifc-import-img0017.png | 2021-04-05 22:49 | 28K | |
| event-viewer-img0002.png | 2021-04-05 22:49 | 28K | |
| design-director-options-img0001.png | 2021-04-05 22:49 | 28K | |
| page-layout-wizard-img0016.png | 2021-04-05 22:50 | 28K | |
| trim-roof-slab-img0003.png | 2021-04-05 22:50 | 28K | |
| conceptual-selector-boundary-box-img0004.png | 2021-04-05 22:49 | 28K | |
| select-by-query-img0006.png | 2021-04-05 22:50 | 28K | |
| extract-entity-img0001.png | 2021-04-05 22:49 | 28K | |
| revolve-img0019.png | 2021-04-05 22:50 | 28K | |
| cylindrical-pattern-img0004.png | 2021-04-05 22:49 | 28K | |
| brush-styles-img0020.png | 2021-04-05 22:49 | 29K | |
| selection-info-palette-img0037.png | 2021-04-05 22:50 | 29K | |
| insert-arc-img0003.png | 2021-04-05 22:49 | 29K | |
| managing-luminances-in-the-render-manager-img0004.png | 2021-04-05 22:49 | 29K | |
| creating-a-new-redsdk-material-img00021.png | 2021-04-05 22:49 | 29K | |
| ray-traced-1-2018-04-24.png | 2021-04-05 22:50 | 29K | |
| loading-symbol-folders-into-the-library-img0010.png | 2021-04-05 22:49 | 29K | |
| conceptual-selector-boundary-box-img0007.png | 2021-04-05 22:49 | 29K | |
| wire-wrap-img0011.png | 2021-04-05 22:50 | 29K | |
| thick-profile-img0003.png | 2021-04-05 22:50 | 29K | |
| mirror-copy-img0004.png | 2021-04-05 22:49 | 29K | |
| editing-redsdk-luminances-img00031.png | 2021-04-05 22:49 | 29K | |
| interactive-handles-img0004.png | 2021-04-05 22:49 | 29K | |
| twist-entity-img0003.png | 2021-04-05 22:50 | 29K | |
| creating-a-parametric-part-img0038.png | 2021-04-05 22:49 | 29K | |
| bend-sheet-img0011.png | 2021-04-05 22:49 | 29K | |
| extend-roof-slab-img0003.png | 2021-04-05 22:49 | 29K | |
| creating-a-group-img0004.png | 2021-04-05 22:49 | 29K | |
| inserting-a-picture-img0011.png | 2021-04-05 22:49 | 29K | |
| intersection-and-projection-img0007.png | 2021-04-05 22:49 | 29K | |
| offset-with-law-img0011.png | 2021-04-05 22:49 | 29K | |
| extract-entity-img0016.png | 2021-04-05 22:49 | 29K | |
| property-toolbar-1-2018-04-16.png | 2021-04-05 22:50 | 29K | |
| editing-3d-objects-using-selection-info-img0004.png | 2021-04-05 22:49 | 29K | |
| editing-a-block-img0016.png | 2021-04-05 22:49 | 29K | |
| revolve-img0014.png | 2021-04-05 22:50 | 29K | |
| external-references-img0001.png | 2021-04-05 22:49 | 29K | |
| pressure-load-img0014.png | 2021-04-05 22:50 | 29K | |
| extrude-to-face-img0002.png | 2021-04-05 22:49 | 29K | |
| multi-text-properties-img0002.png | 2021-04-05 22:49 | 29K | |
| bend-sheet-img0001.png | 2021-04-05 22:49 | 29K | |
| create-surface-from-profile-img0003.png | 2021-04-05 22:49 | 29K | |
| extract-entity-img0015.png | 2021-04-05 22:49 | 29K | |
| page-layout-wizard-img0025.png | 2021-04-05 22:50 | 29K | |
| door-styles-img0002.png | 2021-04-05 22:49 | 29K | |
| re-patching-img0006.png | 2021-04-05 22:50 | 30K | |
| offset-with-law-img0013.png | 2021-04-05 22:49 | 30K | |
| 3d-slice-img0005.png | 2021-04-05 22:49 | 30K | |
| creating-a-block-img0003.png | 2021-04-05 22:49 | 30K | |
| weather-1-2018-04-24-4.png | 2021-04-05 22:50 | 30K | |
| extend-roof-slab-img0004.png | 2021-04-05 22:49 | 30K | |
| circular-slot-by-center-and-radius-img0006.png | 2021-04-05 22:49 | 30K | |
| circular-slot-img0005.png | 2021-04-05 22:49 | 30K | |
| bend-to-path-img0006.png | 2021-04-05 22:49 | 30K | |
| step-4-create-the-report-img0009.png | 2021-04-05 22:50 | 30K | |
| unbend-sheet-img0005.png | 2021-04-05 22:50 | 30K | |
| window-styles-img0001.png | 2021-04-05 22:50 | 30K | |
| loading-symbol-folders-into-the-library-img0012.png | 2021-04-05 22:49 | 30K | |
| editing-a-block-img0018.png | 2021-04-05 22:49 | 30K | |
| editing-a-block-img0014.png | 2021-04-05 22:49 | 30K | |
| editing-multi-text-img0004.png | 2021-04-05 22:49 | 30K | |
| unfold-face-img0002.png | 2021-04-05 22:50 | 30K | |
| saving-as-templates-1-2018-04-24.png | 2021-04-05 22:50 | 30K | |
| click-test-1-2018-04-17.png | 2021-04-05 22:49 | 30K | |
| protractor-img0005.png | 2021-04-05 22:50 | 30K | |
| extend-roof-slab-img0006.png | 2021-04-05 22:49 | 30K | |
| creating-a-block-img0005.png | 2021-04-05 22:49 | 30K | |
| schedule-styles-img0021.png | 2021-04-05 22:50 | 30K | |
| macro-recorder-img0007.png | 2021-04-05 22:49 | 30K | |
| schedule-styles-img0003.png | 2021-04-05 22:50 | 30K | |
| super-selector-modes-img0008.png | 2021-04-05 22:50 | 30K | |
| general-settings-img0002.png | 2021-04-05 22:49 | 30K | |
| unbend-sheet-img0006.png | 2021-04-05 22:50 | 30K | |
| tweak-face-img0005.png | 2021-04-05 22:50 | 30K | |
| section-by-view-line-and-aligned-sectional-views-img0010.png | 2021-04-05 22:50 | 30K | |
| lightworks-luminance-properties-img0008.png | 2021-04-05 22:49 | 30K | |
| render-camera-properties-img0004.png | 2021-04-05 22:50 | 30K | |
| creating-a-block-img0007.png | 2021-04-05 22:49 | 30K | |
| parts-and-assemblies-img0009.png | 2021-04-05 22:50 | 30K | |
| wall-side-img0001.png | 2021-04-05 22:50 | 30K | |
| editing-walls-img0008.png | 2021-04-05 22:49 | 30K | |
| twisted-extrude-img0007.png | 2021-04-05 22:50 | 30K | |
| summary-info-1-2018-02-15.png | 2021-04-05 22:50 | 30K | |
| time-stamp-1-2018-02-15.png | 2021-04-05 22:50 | 30K | |
| editing-redsdk-luminances-img00161.png | 2021-04-05 22:49 | 30K | |
| tile-area-img0001.png | 2021-04-05 22:50 | 30K | |
| customize-keyboard-1-2018-10-13-1.png | 2021-04-05 22:49 | 30K | |
| profile-editing-img0006.png | 2021-04-05 22:50 | 30K | |
| extract-entity-img0002.png | 2021-04-05 22:49 | 30K | |
| calculator-palette-variables-palette-img0009.png | 2021-04-05 22:49 | 30K | |
| assemble-by-tangents-img0010.png | 2021-04-05 22:49 | 30K | |
| revolve-img0031.png | 2021-04-05 22:50 | 30K | |
| render-manager-img0015.png | 2021-04-05 22:50 | 30K | |
| pressure-load-img0013.png | 2021-04-05 22:50 | 30K | |
| slot-img0005.png | 2021-04-05 22:50 | 30K | |
| brush-styles-1-2018-04-16-1.png | 2021-04-05 22:49 | 30K | |
| assemble-by-tangents-img0003.png | 2021-04-05 22:49 | 30K | |
| box-img0002.png | 2021-04-05 22:49 | 30K | |
| conceptual-selector-boundary-box-img0003.png | 2021-04-05 22:49 | 31K | |
| edit-tool-in-3d-img0009.png | 2021-04-05 22:49 | 31K | |
| assemble-by-axis-img0009.png | 2021-04-05 22:49 | 31K | |
| tools-palette-img0003.png | 2021-04-05 22:50 | 31K | |
| profile-editing-img0020.png | 2021-04-05 22:50 | 31K | |
| re-patching-img0004.png | 2021-04-05 22:50 | 31K | |
| controlling-lights-1-2018-04-18.png | 2021-04-05 22:49 | 31K | |
| assemble-by-tangents-img0001.png | 2021-04-05 22:49 | 31K | |
| editing-walls-img0009.png | 2021-04-05 22:49 | 31K | |
| redsdk-volumetric-environment-img00081.png | 2021-04-05 22:50 | 31K | |
| aec-dimension-styles-img0012.png | 2021-04-05 22:49 | 31K | |
| tc-mesh-simplification-img0001.png | 2021-04-05 22:50 | 31K | |
| assemble-by-axis-img0007.png | 2021-04-05 22:49 | 31K | |
| design-director-options-img0002.png | 2021-04-05 22:49 | 31K | |
| inserting-a-symbol-from-the-library-into-the-drawing-img0003.png | 2021-04-05 22:49 | 31K | |
| door-styles-img0026.png | 2021-04-05 22:49 | 31K | |
| assemble-by-axis-img0016.png | 2021-04-05 22:49 | 31K | |
| step-3-define-fields-for-the-report-img0007.png | 2021-04-05 22:50 | 31K | |
| surface-from-laws-img0007.png | 2021-04-05 22:50 | 31K | |
| 3d-slice-img0013.png | 2021-04-05 22:49 | 31K | |
| lightworks-material-properties-img0002.png | 2021-04-05 22:49 | 31K | |
| 2d-3d-selector-img0011.png | 2021-04-05 22:49 | 31K | |
| wire-wrap-img0010.png | 2021-04-05 22:50 | 31K | |
| page-layout-wizard-img0021.png | 2021-04-05 22:50 | 31K | |
| editing-a-block-img0017.png | 2021-04-05 22:49 | 31K | |
| section-by-view-line-and-aligned-sectional-views-img0008.png | 2021-04-05 22:50 | 31K | |
| customize-keyboard-1-2018-10-13.png | 2021-04-05 22:49 | 31K | |
| editing-splines-and-bezier-curves-img0016.png | 2021-04-05 22:49 | 31K | |
| drawing-settings-img0005.png | 2021-04-05 22:49 | 31K | |
| stretch-img0002.png | 2021-04-05 22:50 | 31K | |
| block-attributes-img0020.png | 2021-04-05 22:49 | 31K | |
| step-3-define-fields-for-the-report-img0008.png | 2021-04-05 22:50 | 31K | |
| profile-styles-img0003.png | 2021-04-05 22:50 | 31K | |
| polygonal-prism-1-2018-04-18.png | 2021-04-05 22:50 | 31K | |
| sphere-1-2018-04-18.png | 2021-04-05 22:50 | 31K | |
| rotated-box-1-2018-04-18.png | 2021-04-05 22:50 | 31K | |
| cone-1-2018-04-18.png | 2021-04-05 22:49 | 31K | |
| pressure-load-img0010.png | 2021-04-05 22:50 | 31K | |
| step-3-define-fields-for-the-report-img0009.png | 2021-04-05 22:50 | 31K | |
| torus-1-2018-04-18.png | 2021-04-05 22:50 | 31K | |
| box-1-2018-04-18.png | 2021-04-05 22:49 | 31K | |
| ifc-import-img0008.png | 2021-04-05 22:49 | 31K | |
| loading-symbol-folders-into-the-library-img0014.png | 2021-04-05 22:49 | 31K | |
| hemisphere-1-2018-04-18.png | 2021-04-05 22:49 | 31K | |
| cylinder-1-2018-04-18.png | 2021-04-05 22:49 | 31K | |
| wedge-1-2018-04-18.png | 2021-04-05 22:50 | 31K | |
| terrain-img0009.png | 2021-04-05 22:50 | 31K | |
| unbend-sheet-img0013.png | 2021-04-05 22:50 | 31K | |
| assemble-by-facet-img0002.png | 2021-04-05 22:49 | 31K | |
| create-solid-from-face-s-img0005.png | 2021-04-05 22:49 | 31K | |
| 3d-mesh-1-2018-04-11.png | 2021-04-05 22:49 | 31K | |
| intersection-and-projection-1-2018-04-12.png | 2021-04-05 22:49 | 31K | |
| twisted-extrude-1-2018-04-11.png | 2021-04-05 22:50 | 31K | |
| helix-1-2018-04-12.png | 2021-04-05 22:49 | 31K | |
| prism-1-2018-04-11.png | 2021-04-05 22:50 | 31K | |
| sweep-1-2018-04-11-1.png | 2021-04-05 22:50 | 31K | |
| intersection-and-projection-1-2018-04-12-1.png | 2021-04-05 22:49 | 31K | |
| brush-styles-img0018.png | 2021-04-05 22:49 | 31K | |
| wire-wrap-1-2018-04-12.png | 2021-04-05 22:50 | 31K | |
| revolve-1-2018-04-11.png | 2021-04-05 22:50 | 31K | |
| simple-extrude-1-2018-04-11.png | 2021-04-05 22:50 | 31K | |
| render-camera-properties-img0006.png | 2021-04-05 22:50 | 31K | |
| 3d-polyline-1-2018-04-11.png | 2021-04-05 22:49 | 31K | |
| editing-gear-contours-img0001.png | 2021-04-05 22:49 | 31K | |
| assemble-by-tangents-img0004.png | 2021-04-05 22:49 | 31K | |
| construction-geometry-1-2018-04-12.png | 2021-04-05 22:49 | 31K | |
| rail-sweep-1-2018-04-11.png | 2021-04-05 22:50 | 31K | |
| facet-edit-img0001.png | 2021-04-05 22:49 | 31K | |
| smoothness-level-img0004.png | 2021-04-05 22:50 | 31K | |
| aec-dimension-styles-img0014.png | 2021-04-05 22:49 | 31K | |
| creating-hatch-patterns-img0003.png | 2021-04-05 22:49 | 31K | |
| interactive-handles-img0001.png | 2021-04-05 22:49 | 31K | |
| trace-by-rectangle-img0007.png | 2021-04-05 22:50 | 31K | |
| block-attributes-img0006.png | 2021-04-05 22:49 | 31K | |
| table-styles-img0002.png | 2021-04-05 22:50 | 31K | |
| editing-splines-and-bezier-curves-img0014.png | 2021-04-05 22:49 | 32K | |
| multi-view-blocks-img0002.png | 2021-04-05 22:49 | 32K | |
| trim-roof-slab-img0005.png | 2021-04-05 22:50 | 32K | |
| redsdk-img00031.png | 2021-04-05 22:50 | 32K | |
| rail-styles-img0011.png | 2021-04-05 22:50 | 32K | |
| managing-environments-in-the-render-manager-img0008.png | 2021-04-05 22:49 | 32K | |
| multiple-windows-of-the-same-file-img0001.png | 2021-04-05 22:49 | 32K | |
| snaps-1-2018-04-12.png | 2021-04-05 22:50 | 32K | |
| standard-3d-objects-1-2018-04-11.png | 2021-04-05 22:50 | 32K | |
| table-styles-img0004.png | 2021-04-05 22:50 | 32K | |
| database-connection-palette-img0013.png | 2021-04-05 22:49 | 32K | |
| step-3-define-fields-for-the-report-img0011.png | 2021-04-05 22:50 | 32K | |
| editing-3d-objects-using-selection-info-img0001.png | 2021-04-05 22:49 | 32K | |
| coordinate-systems-1-2018-04-12.png | 2021-04-05 22:49 | 32K | |
| flange-img0003.png | 2021-04-05 22:49 | 32K | |
| trim-roof-slab-img0004.png | 2021-04-05 22:50 | 32K | |
| conceptual-selector-details-img0001.png | 2021-04-05 22:49 | 32K | |
| 2d-3d-selector-img0013.png | 2021-04-05 22:49 | 32K | |
| quick-pull-img0001.png | 2021-04-05 22:50 | 32K | |
| inserting-a-picture-img0003.png | 2021-04-05 22:49 | 32K | |
| profile-styles-img0011.png | 2021-04-05 22:50 | 32K | |
| managing-luminances-in-the-render-manager-img0006.png | 2021-04-05 22:49 | 32K | |
| spherical-pattern-img0003.png | 2021-04-05 22:50 | 32K | |
| refining-the-image-img0002.png | 2021-04-05 22:50 | 32K | |
| table-styles-img0003.png | 2021-04-05 22:50 | 32K | |
| property-set-definitions-img0001.png | 2021-04-05 22:50 | 32K | |
| multi-line-1-2018-04-10.png | 2021-04-05 22:49 | 32K | |
| curves-1-2018-04-10.png | 2021-04-05 22:49 | 32K | |
| slots-1-2018-04-10.png | 2021-04-05 22:50 | 32K | |
| circle-ellipse-1-2018-04-10.png | 2021-04-05 22:49 | 32K | |
| double-line-1-2018-04-10.png | 2021-04-05 22:49 | 32K | |
| stellated-polygon-1-2018-04-10.png | 2021-04-05 22:50 | 32K | |
| 3d-slice-img0011.png | 2021-04-05 22:49 | 32K | |
| arrow-tools-1-2018-04-10.png | 2021-04-05 22:49 | 32K | |
| insert-table-img0003.png | 2021-04-05 22:49 | 32K | |
| gear-contour-1-2018-04-10.png | 2021-04-05 22:49 | 32K | |
| surface-from-laws-img0011.png | 2021-04-05 22:50 | 32K | |
| extruding-smesh-faces-img0003.png | 2021-04-05 22:49 | 32K | |
| arc-1-2018-04-10.png | 2021-04-05 22:49 | 32K | |
| assemble-by-edge-and-point-img0006.png | 2021-04-05 22:49 | 32K | |
| forums-1-2018-04-22.png | 2021-04-05 22:49 | 32K | |
| technical-support-1-2018-04-22.png | 2021-04-05 22:50 | 32K | |
| text-1-2018-04-10.png | 2021-04-05 22:50 | 32K | |
| multi-text-1-2018-04-10.png | 2021-04-05 22:49 | 32K | |
| library-folders-img0004.png | 2021-04-05 22:49 | 32K | |
| loading-symbol-folders-into-the-library-img0005.png | 2021-04-05 22:49 | 32K | |
| deform-to-point-img0006.png | 2021-04-05 22:49 | 32K | |
| re-patching-img0007.png | 2021-04-05 22:50 | 32K | |
| cylindrical-pattern-img0003.png | 2021-04-05 22:49 | 32K | |
| editing-3d-objects-using-selection-info-img0028.png | 2021-04-05 22:49 | 32K | |
| rail-styles-img0005.png | 2021-04-05 22:50 | 32K | |
| favorites-img0003.png | 2021-04-05 22:49 | 32K | |
| visual-representation-img0003.png | 2021-04-05 22:50 | 32K | |
| 3d-slice-img0020.png | 2021-04-05 22:49 | 32K | |
| aec-dimension-styles-img0005.png | 2021-04-05 22:49 | 32K | |
| re-patching-img0005.png | 2021-04-05 22:50 | 32K | |
| extrude-face-img0005.png | 2021-04-05 22:49 | 32K | |
| extrude-to-face-img0005.png | 2021-04-05 22:49 | 32K | |
| 3d-slice-img0019.png | 2021-04-05 22:49 | 32K | |
| rail-styles-img0016.png | 2021-04-05 22:50 | 32K | |
| lofting-img0014.png | 2021-04-05 22:49 | 32K | |
| sun-position-img0002.png | 2021-04-05 22:50 | 32K | |
| object-trim-img0016.png | 2021-04-05 22:49 | 32K | |
| interactive-tone-adjustments-img0014.png | 2021-04-05 22:49 | 32K | |
| stretch-img0003.png | 2021-04-05 22:50 | 32K | |
| window-styles-img0009.png | 2021-04-05 22:50 | 32K | |
| show-normals-img0004.png | 2021-04-05 22:50 | 32K | |
| update-viewport-boundary-img0002.png | 2021-04-05 22:50 | 32K | |
| conceptual-selector-boundary-box-img0009.png | 2021-04-05 22:49 | 32K | |
| door-1-2018-04-19.png | 2021-04-05 22:49 | 32K | |
| splitting-and-joining-walls-1-2018-04-19.png | 2021-04-05 22:50 | 32K | |
| wall-dimension-1-2018-04-19.png | 2021-04-05 22:50 | 32K | |
| horizontal-1-2018-04-19.png | 2021-04-05 22:49 | 33K | |
| schedule-styles-img0016.png | 2021-04-05 22:50 | 33K | |
| lofting-img0017.png | 2021-04-05 22:49 | 33K | |
| dimension-properties-img0001.png | 2021-04-05 22:49 | 33K | |
| visual-representation-img0006.png | 2021-04-05 22:50 | 33K | |
| re-patching-img0008.png | 2021-04-05 22:50 | 33K | |
| vertical-1-2018-04-19.png | 2021-04-05 22:50 | 33K | |
| page-layout-wizard-img0005.png | 2021-04-05 22:50 | 33K | |
| edit-opening-modifier-1-2018-04-19.png | 2021-04-05 22:49 | 33K | |
| section-line-1-2018-04-19.png | 2021-04-05 22:50 | 33K | |
| section-elevation-1-2018-04-19.png | 2021-04-05 22:50 | 33K | |
| insert-opening-1-2018-04-19.png | 2021-04-05 22:49 | 33K | |
| window-1-2018-04-19.png | 2021-04-05 22:50 | 33K | |
| wall-tools-1-2018-04-19.png | 2021-04-05 22:50 | 33K | |
| roofs-1-2018-04-19.png | 2021-04-05 22:50 | 33K | |
| editing-a-block-img0011.png | 2021-04-05 22:49 | 33K | |
| radial-pattern-img0003.png | 2021-04-05 22:50 | 33K | |
| schedule-1-2018-04-19.png | 2021-04-05 22:50 | 33K | |
| radial-pattern-img0002.png | 2021-04-05 22:50 | 33K | |
| creating-a-new-redsdk-material-img00051.png | 2021-04-05 22:49 | 33K | |
| openings-1-2018-04-19.png | 2021-04-05 22:49 | 33K | |
| page-setup-img0004.png | 2021-04-05 22:50 | 33K | |
| absolute-coordinates-1-2018-04-16-1.png | 2021-04-05 22:49 | 33K | |
| line-styles-img0001.png | 2021-04-05 22:49 | 33K | |
| door-styles-img0001.png | 2021-04-05 22:49 | 33K | |
| undo-redo-file-buffer-2018-04-24.png | 2021-04-05 22:50 | 33K | |
| saving-and-recalling-workplanes-img0003.png | 2021-04-05 22:50 | 33K | |
| tube-flange-img0004.png | 2021-04-05 22:50 | 33K | |
| dimension-properties-img0019.png | 2021-04-05 22:49 | 33K | |
| properties-of-standard-views-img0001.png | 2021-04-05 22:50 | 33K | |
| relative-coordinates-1-2018-04-16.png | 2021-04-05 22:50 | 33K | |
| multilanding-stair-by-path-img0003.png | 2021-04-05 22:49 | 33K | |
| managing-materials-in-the-render-manager-img0008.png | 2021-04-05 22:49 | 33K | |
| relocate-origin-1-2018-04-16.png | 2021-04-05 22:50 | 33K | |
| multi-text-properties-img0001.png | 2021-04-05 22:49 | 33K | |
| stairs-styles-img0007.png | 2021-04-05 22:50 | 33K | |
| polar-coordinates-1-2018-04-16.png | 2021-04-05 22:50 | 33K | |
| block-attributes-img0010.png | 2021-04-05 22:49 | 33K | |
| creating-a-new-lightworks-material-img0015.png | 2021-04-05 22:49 | 33K | |
| aec-dimension-styles-img0006.png | 2021-04-05 22:49 | 33K | |
| add-roof-modifier-img0009.png | 2021-04-05 22:49 | 33K | |
| cylindrical-pattern-img0002.png | 2021-04-05 22:49 | 33K | |
| using-the-trim-tool-with-architectural-objects-img0002.png | 2021-04-05 22:50 | 33K | |
| ifc-import-img0001.png | 2021-04-05 22:49 | 33K | |
| thread-img0002.png | 2021-04-05 22:50 | 33K | |
| repositioning-control-handles-of-the-selector-img0002.png | 2021-04-05 22:50 | 33K | |
| components-of-select-edit-mode-img0014.png | 2021-04-05 22:49 | 33K | |
| add-top-wall-modifiers-img0003.png | 2021-04-05 22:49 | 33K | |
| dimension-properties-img0018.png | 2021-04-05 22:49 | 33K | |
| spherical-pattern-img0002.png | 2021-04-05 22:50 | 33K | |
| tools-palette-img0014.png | 2021-04-05 22:50 | 33K | |
| editing-lightworks-material-img0014.png | 2021-04-05 22:49 | 33K | |
| table-styles-img0005.png | 2021-04-05 22:50 | 33K | |
| schedule-styles-img0015.png | 2021-04-05 22:50 | 33K | |
| extend-roof-slab-img0005.png | 2021-04-05 22:49 | 34K | |
| architecture-tools-1-2018-04-23.png | 2021-04-05 22:49 | 34K | |
| page-layout-wizard-img0001.png | 2021-04-05 22:50 | 34K | |
| creating-a-parametric-part-img0013.png | 2021-04-05 22:49 | 34K | |
| in-place-editing-of-groups-and-blocks-img0001.png | 2021-04-05 22:49 | 34K | |
| magnetic-point-1-2018-04-16.png | 2021-04-05 22:49 | 34K | |
| quadrant-point-snap-1-2018-04-16.png | 2021-04-05 22:50 | 34K | |
| apparent-intersection-snap-1-2018-04-16.png | 2021-04-05 22:49 | 34K | |
| projection-snap-1-2018-04-16.png | 2021-04-05 22:50 | 34K | |
| center-snap-1-2018-04-16.png | 2021-04-05 22:49 | 34K | |
| workplane-intersections-snap-1-2018-04-16-1.png | 2021-04-05 22:50 | 34K | |
| middle-point-snap-1-2018-04-16.png | 2021-04-05 22:49 | 34K | |
| intersection-snap-1-2018-04-16.png | 2021-04-05 22:49 | 34K | |
| tangent-snap-1-2018-04-16.png | 2021-04-05 22:50 | 34K | |
| divide-point-snap-1-2018-04-16.png | 2021-04-05 22:49 | 34K | |
| nearest-on-graphic-snap-1-2018-04-16.png | 2021-04-05 22:49 | 34K | |
| ortho-snap-1-2018-04-16.png | 2021-04-05 22:49 | 34K | |
| selection-info-palette-img0005.png | 2021-04-05 22:50 | 34K | |
| nearest-on-facet-snap-1-2018-04-16.png | 2021-04-05 22:49 | 34K | |
| mid-two-point-snap-1-2018-04-16.png | 2021-04-05 22:49 | 34K | |
| 3d-slice-img0023.png | 2021-04-05 22:49 | 34K | |
| vertex-snap-1-2018-04-16.png | 2021-04-05 22:50 | 34K | |
| extended-ortho-snap-1-2018-04-16.png | 2021-04-05 22:49 | 34K | |
| weather-1-2018-04-24-5.png | 2021-04-05 22:50 | 34K | |
| convert-to-arc-polyline-img0004.png | 2021-04-05 22:49 | 34K | |
| page-layout-wizard-img0012.png | 2021-04-05 22:50 | 34K | |
| editing-lights-img0001.png | 2021-04-05 22:49 | 34K | |
| radial-pattern-img0001.png | 2021-04-05 22:50 | 34K | |
| center-of-extents-snap-1-2018-04-16.png | 2021-04-05 22:49 | 34K | |
| grid-snap-1-2018-04-16.png | 2021-04-05 22:49 | 34K | |
| no-snap-1-2018-04-16.png | 2021-04-05 22:49 | 34K | |
| opposite-mirror-point-snap-1-2018-04-16.png | 2021-04-05 22:49 | 34K | |
| editing-lightworks-material-img0010.png | 2021-04-05 22:49 | 34K | |
| drawing-settings-img0003.png | 2021-04-05 22:49 | 34K | |
| deleting-objects-1-2018-04-10.png | 2021-04-05 22:49 | 34K | |
| paper-space-1-2018-04-22.png | 2021-04-05 22:50 | 34K | |
| isolate-object-1-2018-04-10.png | 2021-04-05 22:49 | 34K | |
| isolate-object-1-2018-04-17.png | 2021-04-05 22:49 | 34K | |
| copying-objects-1-2018-04-10.png | 2021-04-05 22:49 | 34K | |
| transforming-1-2018-04-10.png | 2021-04-05 22:50 | 34K | |
| edit-tool-1-2018-04-10.png | 2021-04-05 22:49 | 34K | |
| creating-a-parametric-part-img0045.png | 2021-04-05 22:49 | 34K | |
| select-edit-1-2018-04-10.png | 2021-04-05 22:50 | 34K | |
| dynamic-cut-plane-img0005.png | 2021-04-05 22:49 | 34K | |
| using-the-materials-palette-img0001.png | 2021-04-05 22:50 | 34K | |
| isolate-object-1-2018-04-17-1.png | 2021-04-05 22:49 | 34K | |
| hole-img0005.png | 2021-04-05 22:49 | 34K | |
| section-by-view-line-and-aligned-sectional-views-img0007.png | 2021-04-05 22:50 | 34K | |
| creating-lights-light-types-1-2018-04-18.png | 2021-04-05 22:49 | 34K | |
| sun-position-img0003.png | 2021-04-05 22:50 | 34K | |
| editing-redsdk-luminances-img00091.png | 2021-04-05 22:49 | 34K | |
| managing-luminances-in-the-render-manager-img0005.png | 2021-04-05 22:49 | 34K | |
| design-director-spaces-img0001.png | 2021-04-05 22:49 | 34K | |
| assemble-by-axis-img0014.png | 2021-04-05 22:49 | 34K | |
| stair-by-linework-img0007.png | 2021-04-05 22:50 | 34K | |
| lofting-1-2018-04-11.png | 2021-04-05 22:49 | 34K | |
| create-solid-from-surface-img0004.png | 2021-04-05 22:49 | 34K | |
| face2face-lofting-1-2018-04-11.png | 2021-04-05 22:49 | 34K | |
| branched-lofting-1-2018-04-11.png | 2021-04-05 22:49 | 34K | |
| point-1-2018-04-10-1.png | 2021-04-05 22:50 | 34K | |
| 3d-tools-for-smesh-creation-img0001.png | 2021-04-05 22:49 | 34K | |
| face2face-lofting-img0003.png | 2021-04-05 22:49 | 34K | |
| selection-info-palette-img0012.png | 2021-04-05 22:50 | 34K | |
| woodworking-img0009.png | 2021-04-05 22:50 | 34K | |
| sketch-style-img0014.png | 2021-04-05 22:50 | 34K | |
| weather-1-2018-04-24-7.png | 2021-04-05 22:50 | 34K | |
| line-1-2018-04-10.png | 2021-04-05 22:49 | 34K | |
| image-manager-palette-img0006.png | 2021-04-05 22:49 | 34K | |
| inserting-a-picture-img0004.png | 2021-04-05 22:49 | 34K | |
| edit-tool-in-3d-img0007.png | 2021-04-05 22:49 | 34K | |
| weather-1-2018-04-24-9.png | 2021-04-05 22:50 | 34K | |
| text-styles-img0005.png | 2021-04-05 22:50 | 34K | |
| select-by-query-img0016.png | 2021-04-05 22:50 | 34K | |
| properties-of-standard-views-img0003.png | 2021-04-05 22:50 | 34K | |
| imprint-edge-img0002.png | 2021-04-05 22:49 | 34K | |
| dynamic-cut-plane-img0011.png | 2021-04-05 22:49 | 34K | |
| hatching-1-2018-04-11.png | 2021-04-05 22:49 | 34K | |
| parts-and-assemblies-img0014.png | 2021-04-05 22:50 | 34K | |
| trim-roof-slab-img0002.png | 2021-04-05 22:50 | 34K | |
| profile-styles-img0005.png | 2021-04-05 22:50 | 34K | |
| stairs-styles-img0005.png | 2021-04-05 22:50 | 34K | |
| re-patching-img0003.png | 2021-04-05 22:50 | 34K | |
| schedule-styles-img0018.png | 2021-04-05 22:50 | 34K | |
| assemble-by-axis-img0002.png | 2021-04-05 22:49 | 35K | |
| multi-view-blocks-img0008.png | 2021-04-05 22:49 | 35K | |
| selecting-objects-img0001.png | 2021-04-05 22:50 | 35K | |
| layers-img0001.png | 2021-04-05 22:49 | 35K | |
| pen-properties-img0001.png | 2021-04-05 22:50 | 35K | |
| luminance-properties-img0002.png | 2021-04-05 22:49 | 35K | |
| 3d-slice-img0012.png | 2021-04-05 22:49 | 35K | |
| loading-a-parametric-part-into-the-library-img0012.png | 2021-04-05 22:49 | 35K | |
| offset-with-law-img0002.png | 2021-04-05 22:49 | 35K | |
| wire-wrap-img0012.png | 2021-04-05 22:50 | 35K | |
| ifc-import-img0018.png | 2021-04-05 22:49 | 35K | |
| object-trim-img0017.png | 2021-04-05 22:49 | 35K | |
| entity-marks-1-2018-04-11.png | 2021-04-05 22:49 | 35K | |
| sketch-style-img0004.png | 2021-04-05 22:50 | 35K | |
| assemble-by-edge-and-point-img0007.png | 2021-04-05 22:49 | 35K | |
| properties-of-section-lines-img0002.png | 2021-04-05 22:50 | 35K | |
| trace-by-point-img0002.png | 2021-04-05 22:50 | 35K | |
| publish-to-html-layout-img0001.png | 2021-04-05 22:50 | 35K | |
| add-roof-modifier-img0008.png | 2021-04-05 22:49 | 35K | |
| weather-1-2018-04-24-8.png | 2021-04-05 22:50 | 35K | |
| creating-a-new-lightworks-material-img0011.png | 2021-04-05 22:49 | 35K | |
| brush-styles-img0017.png | 2021-04-05 22:49 | 35K | |
| customizing-the-ui-1-2018-10-05.png | 2021-04-05 22:49 | 35K | |
| property-set-definitions-img0006.png | 2021-04-05 22:50 | 35K | |
| rail-styles-img0002.png | 2021-04-05 22:50 | 35K | |
| rendering-1-2018-04-22.png | 2021-04-05 22:50 | 35K | |
| managing-environments-in-the-render-manager-img0005.png | 2021-04-05 22:49 | 35K | |
| modify-table-img0012.png | 2021-04-05 22:49 | 35K | |
| insert-table-img0002.png | 2021-04-05 22:49 | 35K | |
| creating-a-view-img0002.png | 2021-04-05 22:49 | 35K | |
| named-view-img0002.png | 2021-04-05 22:49 | 35K | |
| selecting-smesh-edges-img0001.png | 2021-04-05 22:50 | 35K | |
| editing-stellated-polygons-img0001.png | 2021-04-05 22:49 | 35K | |
| weather-1-2018-04-24-2.png | 2021-04-05 22:50 | 35K | |
| inserting-an-underlay-in-a-drawing-1-2018-04-16.png | 2021-04-05 22:49 | 35K | |
| hatch-pattern-creator-1-2018-04-12.png | 2021-04-05 22:49 | 35K | |
| properties-window-img00031.png | 2021-04-05 22:50 | 35K | |
| grid-options-img0001.png | 2021-04-05 22:49 | 35K | |
| chamfer-with-miter-vertices-img0004.png | 2021-04-05 22:49 | 35K | |
| layer-management-1-2018-04-16.png | 2021-04-05 22:49 | 35K | |
| layer-sets-1-2018-04-16.png | 2021-04-05 22:49 | 35K | |
| offset-with-law-img0001.png | 2021-04-05 22:49 | 35K | |
| assemble-by-axis-img0001.png | 2021-04-05 22:49 | 35K | |
| pdf-underlays-1-2018-04-16-1.png | 2021-04-05 22:50 | 35K | |
| selection-info-palette-img0026.png | 2021-04-05 22:50 | 35K | |
| assemble-by-tangents-img0005.png | 2021-04-05 22:49 | 35K | |
| block-attributes-1-2018-04-12.png | 2021-04-05 22:49 | 35K | |
| 2d-3d-selector-img0004.png | 2021-04-05 22:49 | 35K | |
| favorites-img0006.png | 2021-04-05 22:49 | 35K | |
| creating-a-new-redsdk-material-img00041.png | 2021-04-05 22:49 | 36K | |
| add-top-wall-modifiers-img0002.png | 2021-04-05 22:49 | 36K | |
| favorites-img0007.png | 2021-04-05 22:49 | 36K | |
| weather-1-2018-04-24-6.png | 2021-04-05 22:50 | 36K | |
| imprint-edge-img0010.png | 2021-04-05 22:49 | 36K | |
| array-pattern-img0005.png | 2021-04-05 22:49 | 36K | |
| section-1-2018-04-17.png | 2021-04-05 22:50 | 36K | |
| extract-entity-img0003.png | 2021-04-05 22:49 | 36K | |
| weather-1-2018-04-24-3.png | 2021-04-05 22:50 | 36K | |
| weather-1-2018-04-24-10.png | 2021-04-05 22:50 | 36K | |
| holdline-blend-img0005.png | 2021-04-05 22:49 | 36K | |
| display-options-img0001.png | 2021-04-05 22:49 | 36K | |
| displaying-the-workplane-1-2018-04-18.png | 2021-04-05 22:49 | 36K | |
| display-2d-part-img0003.png | 2021-04-05 22:49 | 36K | |
| the-design-director-img0001.png | 2021-04-05 22:50 | 36K | |
| customizing-the-ui-1-2018-04-14.png | 2021-04-05 22:49 | 36K | |
| editing-3d-objects-using-selection-info-img0007.png | 2021-04-05 22:49 | 36K | |
| brush-styles-img0019.png | 2021-04-05 22:49 | 36K | |
| print-styles-img0003.png | 2021-04-05 22:50 | 36K | |
| assemble-by-edge-and-point-img0008.png | 2021-04-05 22:49 | 36K | |
| lofting-img0023.png | 2021-04-05 22:49 | 36K | |
| creating-a-new-lightworks-material-img0010.png | 2021-04-05 22:49 | 36K | |
| place-on-workplane-1-2018-04-18.png | 2021-04-05 22:50 | 36K | |
| hyperlinks-1-2018-04-10.png | 2021-04-05 22:49 | 36K | |
| twisted-extrude-img0006.png | 2021-04-05 22:50 | 36K | |
| hatch-1-2018-04-18-1.png | 2021-04-05 22:49 | 36K | |
| shelling-solids-img0005.png | 2021-04-05 22:50 | 36K | |
| pick-point-hatching-1-2018-04-18.png | 2021-04-05 22:50 | 36K | |
| path-hatching-1-2018-04-18.png | 2021-04-05 22:50 | 36K | |
| brush-properties-1-2018-04-16.png | 2021-04-05 22:49 | 36K | |
| general-properties-1-2018-04-16.png | 2021-04-05 22:49 | 36K | |
| object-properties-1-2018-04-16.png | 2021-04-05 22:49 | 36K | |
| pen-properties-1-2018-04-16.png | 2021-04-05 22:50 | 36K | |
| properties-window-3-2018-04-16.png | 2021-04-05 22:50 | 36K | |
| properties-window-img00021.png | 2021-04-05 22:50 | 36K | |
| ifc-import-img0002.png | 2021-04-05 22:49 | 36K | |
| render-manager-options-1-2018-04-16.png | 2021-04-05 22:50 | 36K | |
| creating-3d-objects-by-editing-2d-objects-img0001.png | 2021-04-05 22:49 | 36K | |
| intersection-and-projection-img0002.png | 2021-04-05 22:49 | 36K | |
| imprint-img0017.png | 2021-04-05 22:49 | 36K | |
| step-2-attach-custom-properties-to-objects-img0005.png | 2021-04-05 22:50 | 36K | |
| assemble-by-3-points-1-2018-04-24.png | 2021-04-05 22:49 | 36K | |
| assemble-by-3-points-img0002.png | 2021-04-05 22:49 | 36K | |
| ifc-import-img0005.png | 2021-04-05 22:49 | 36K | |
| ray-traced-1-2018-04-24-2.png | 2021-04-05 22:50 | 36K | |
| import-2d-pdf-tool-2018-04-14-1.png | 2021-04-05 22:49 | 36K | |
| custom-blocks-for-windows-and-doors-img0007.png | 2021-04-05 22:49 | 36K | |
| woodworking-img0004.png | 2021-04-05 22:50 | 36K | |
| creating-a-group-img0006.png | 2021-04-05 22:49 | 36K | |
| viewports-1-2018-04-19.png | 2021-04-05 22:50 | 36K | |
| lofting-img0024.png | 2021-04-05 22:49 | 36K | |
| 3d-intersect-img0002.png | 2021-04-05 22:49 | 36K | |
| lightworks-luminance-properties-img0004.png | 2021-04-05 22:49 | 36K | |
| assemble-by-3-points-img0003.png | 2021-04-05 22:49 | 36K | |
| floating-model-space-1-2018-04-19.png | 2021-04-05 22:49 | 36K | |
| imprint-img0015.png | 2021-04-05 22:49 | 36K | |
| section-img0002.png | 2021-04-05 22:50 | 36K | |
| grid-1-2018-04-25.png | 2021-04-05 22:49 | 36K | |
| assemble-by-3-points-img0006.png | 2021-04-05 22:49 | 36K | |
| inserting-viewports-1-2018-04-19.png | 2021-04-05 22:49 | 36K | |
| viewports-1-2018-04-19-1.png | 2021-04-05 22:50 | 36K | |
| creating-standard-views-img0002.png | 2021-04-05 22:49 | 36K | |
| 3d-spline-by-control-points-1-2018-04-11.png | 2021-04-05 22:49 | 36K | |
| desktop-img0001.png | 2021-04-05 22:49 | 36K | |
| selection-info-palette-img0024.png | 2021-04-05 22:50 | 36K | |
| extrude-to-face-img0006.png | 2021-04-05 22:49 | 36K | |
| ray-traced-1-2018-04-24-1.png | 2021-04-05 22:50 | 37K | |
| extract-entity-img0004.png | 2021-04-05 22:49 | 37K | |
| flange-img0004.png | 2021-04-05 22:49 | 37K | |
| changing-rows-and-columns-merging-cells-img0009.png | 2021-04-05 22:49 | 37K | |
| create-solid-from-surface-img0003.png | 2021-04-05 22:49 | 37K | |
| standard-views-1-2018-04-11.png | 2021-04-05 22:50 | 37K | |
| editing-multiple-nodes-img0006.png | 2021-04-05 22:49 | 37K | |
| toolbars-img0001.png | 2021-04-05 22:50 | 37K | |
| inserting-a-file-1-2018-04-17-1.png | 2021-04-05 22:49 | 37K | |
| intersection-and-projection-img0003.png | 2021-04-05 22:49 | 37K | |
| dimension-properties-img0020.png | 2021-04-05 22:49 | 37K | |
| editing-a-block-img0013.png | 2021-04-05 22:49 | 37K | |
| 3d-slice-img0008.png | 2021-04-05 22:49 | 37K | |
| inserting-an-ole-object-1-2018-04-17-3.png | 2021-04-05 22:49 | 37K | |
| split-face-by-isoline-img0004.png | 2021-04-05 22:50 | 37K | |
| arrow-tools-img0003.png | 2021-04-05 22:49 | 37K | |
| inserting-objects-from-other-files-1-2018-04-17.png | 2021-04-05 22:49 | 37K | |
| creating-an-underlay-style-1-2018-04-16-2.png | 2021-04-05 22:49 | 37K | |
| changing-rows-and-columns-merging-cells-img0007.png | 2021-04-05 22:49 | 37K | |
| saving-files-img0001.png | 2021-04-05 22:50 | 37K | |
| brush-styles-img0016.png | 2021-04-05 22:49 | 37K | |
| saving-and-recalling-workplanes-img0005.png | 2021-04-05 22:50 | 37K | |
| contact-manager-img0006.png | 2021-04-05 22:49 | 37K | |
| acis-1-2018-04-24.png | 2021-04-05 22:49 | 37K | |
| toolbars-and-menu-1-2018-04-24.png | 2021-04-05 22:50 | 37K | |
| 3d-properties-img0001.png | 2021-04-05 22:49 | 37K | |
| render-scene-luminance-1-2018-04-24.png | 2021-04-05 22:50 | 37K | |
| super-selector-modes-img0002.png | 2021-04-05 22:50 | 37K | |
| assemble-by-3-points-img0004.png | 2021-04-05 22:49 | 37K | |
| background-color-1-2018-04-24.png | 2021-04-05 22:49 | 37K | |
| display-options-1-2018-04-24.png | 2021-04-05 22:49 | 37K | |
| general-setup-1-2018-04-24.png | 2021-04-05 22:49 | 37K | |
| geo-location-1-2018-04-24.png | 2021-04-05 22:49 | 37K | |
| native-draw-1-2018-04-24.png | 2021-04-05 22:49 | 37K | |
| file-locations-1-2018-04-24.png | 2021-04-05 22:49 | 37K | |
| color-palette-1-2018-04-24.png | 2021-04-05 22:49 | 37K | |
| preferences-1-2018-04-24.png | 2021-04-05 22:50 | 37K | |
| desktop-1-2018-04-24.png | 2021-04-05 22:49 | 37K | |
| space-units-1-2018-04-24.png | 2021-04-05 22:50 | 37K | |
| drawing-setup-1-2018-04-24.png | 2021-04-05 22:49 | 37K | |
| grid-options-1-2018-04-24.png | 2021-04-05 22:49 | 37K | |
| angle-options-1-2018-04-24.png | 2021-04-05 22:49 | 37K | |
| symbol-libraries-1-2018-04-24.png | 2021-04-05 22:50 | 37K | |
| advanced-grid-options-1-2018-04-24.png | 2021-04-05 22:49 | 37K | |
| layers-1-2018-04-24.png | 2021-04-05 22:49 | 37K | |
| isolate-object-img0003.png | 2021-04-05 22:49 | 37K | |
| tube-flange-img0001.png | 2021-04-05 22:50 | 37K | |
| imprint-auto-detect-img0001.png | 2021-04-05 22:49 | 37K | |
| program-setup-1-2018-04-24.png | 2021-04-05 22:50 | 37K | |
| print-style-table-1-2018-04-24.png | 2021-04-05 22:50 | 37K | |
| constraints-1-2018-04-24.png | 2021-04-05 22:49 | 37K | |
| surface-from-laws-1-2018-04-12.png | 2021-04-05 22:50 | 37K | |
| render-scene-environment-1-2018-04-24.png | 2021-04-05 22:50 | 37K | |
| curve-from-law-1-2018-04-12.png | 2021-04-05 22:49 | 37K | |
| profile-styles-img0015.png | 2021-04-05 22:50 | 37K | |
| advanced-preferences-1-2018-04-24.png | 2021-04-05 22:49 | 37K | |
| property-toolbar-img0002.png | 2021-04-05 22:50 | 37K | |
| managing-luminances-in-the-render-manager-img0007.png | 2021-04-05 22:49 | 37K | |
| selection-info-palette-img0042.png | 2021-04-05 22:50 | 37K | |
| lightworks-1-2018-04-24.png | 2021-04-05 22:49 | 37K | |
| ifc-import-img0004.png | 2021-04-05 22:49 | 37K | |
| line-styles-1-2018-04-24.png | 2021-04-05 22:49 | 37K | |
| warning-dialogs-1-2018-04-24.png | 2021-04-05 22:50 | 37K | |
| auto-naming-1-2018-04-24.png | 2021-04-05 22:49 | 37K | |
| page-layout-wizard-img0006.png | 2021-04-05 22:50 | 37K | |
| workplanes-1-2018-04-11.png | 2021-04-05 22:50 | 37K | |
| edit-slope-angle-img0002.png | 2021-04-05 22:49 | 37K | |
| brush-styles-img0015.png | 2021-04-05 22:49 | 37K | |
| editing-redsdk-luminances-img00131.png | 2021-04-05 22:49 | 37K | |
| selection-info-palette-img0016.png | 2021-04-05 22:50 | 37K | |
| manipulating-paper-spaces-img0002.png | 2021-04-05 22:49 | 37K | |
| zoom.png | 2021-04-05 22:50 | 37K | |
| fragmental-views-img0004.png | 2021-04-05 22:49 | 37K | |
| add-roof-modifier-img0002.png | 2021-04-05 22:49 | 37K | |
| holdline-blend-img0007.png | 2021-04-05 22:49 | 37K | |
| unfold-face-img0007.png | 2021-04-05 22:50 | 37K | |
| lofting-img0026.png | 2021-04-05 22:49 | 38K | |
| measuring-img0002.png | 2021-04-05 22:49 | 38K | |
| profile-editing-img0005.png | 2021-04-05 22:50 | 38K | |
| assemble-by-tangents-img0002.png | 2021-04-05 22:49 | 38K | |
| step-2-attach-custom-properties-to-objects-img0008.png | 2021-04-05 22:50 | 38K | |
| quick-pull-img0007.png | 2021-04-05 22:50 | 38K | |
| extract-entity-img0006.png | 2021-04-05 22:49 | 38K | |
| editing-redsdk-luminances-img00141.png | 2021-04-05 22:49 | 38K | |
| selection-info-palette-img0029.png | 2021-04-05 22:50 | 38K | |
| table-import-xlsx-1-2018-04-18.png | 2021-04-05 22:50 | 38K | |
| table-export-xlsx-1-2018-04-18.png | 2021-04-05 22:50 | 38K | |
| surface-and-solid-conversion-operations-1-2018-04-20.png | 2021-04-05 22:50 | 38K | |
| modify-table-1-2018-04-18.png | 2021-04-05 22:49 | 38K | |
| insert-table-1-2018-04-18.png | 2021-04-05 22:49 | 38K | |
| exploding-objects-1-2018-04-20.png | 2021-04-05 22:49 | 38K | |
| exploding-solids-1-2018-04-19.png | 2021-04-05 22:49 | 38K | |
| render-manager-1-2018-04-18.png | 2021-04-05 22:50 | 38K | |
| creating-a-block-1-2018-04-20.png | 2021-04-05 22:49 | 38K | |
| pressure-load-img0003.png | 2021-04-05 22:50 | 38K | |
| stacking-objects-1-2018-04-20.png | 2021-04-05 22:50 | 38K | |
| create-solid-from-surface-img0007.png | 2021-04-05 22:49 | 38K | |
| grid-img0003.png | 2021-04-05 22:49 | 38K | |
| distributing-objects-1-2018-04-20.png | 2021-04-05 22:49 | 38K | |
| slot-1-2018-04-17.png | 2021-04-05 22:50 | 38K | |
| convert-to-curve-1-2018-04-20.png | 2021-04-05 22:49 | 38K | |
| convert-to-arc-polyline-1-2018-04-20.png | 2021-04-05 22:49 | 38K | |
| format-painter-1-2018-04-20.png | 2021-04-05 22:49 | 38K | |
| tables-1-2018-04-12.png | 2021-04-05 22:50 | 38K | |
| hatch-pattern-creator-img0003.png | 2021-04-05 22:49 | 38K | |
| circular-slot-by-center-and-radius-1-2018-04-17.png | 2021-04-05 22:49 | 38K | |
| circular-slot-1-2018-04-17.png | 2021-04-05 22:49 | 38K | |
| add-bottom-wall-modifiers-img0001.png | 2021-04-05 22:49 | 38K | |
| aligning-objects-1-2018-04-20.png | 2021-04-05 22:49 | 38K | |
| regions-1-2018-04-20.png | 2021-04-05 22:50 | 38K | |
| managing-materials-in-the-render-manager-img0007.png | 2021-04-05 22:49 | 38K | |
| interactive-tone-adjustments-img0007.png | 2021-04-05 22:49 | 38K | |
| show-normals-img0002.png | 2021-04-05 22:50 | 38K | |
| inserting-a-picture-img0010.png | 2021-04-05 22:49 | 38K | |
| imprint-edge-img0005.png | 2021-04-05 22:49 | 38K | |
| assembling-img0001.png | 2021-04-05 22:49 | 38K | |
| box-img0003.png | 2021-04-05 22:49 | 38K | |
| text-properties-img0003.png | 2021-04-05 22:50 | 38K | |
| linking-data-to-graphics-1-2018-04-23-1.png | 2021-04-05 22:49 | 38K | |
| smoothness-level-img0002.png | 2021-04-05 22:50 | 38K | |
| add-top-wall-modifiers-img0001.png | 2021-04-05 22:49 | 38K | |
| splines-and-bezier-curves-1-2018-04-17-2.png | 2021-04-05 22:50 | 38K | |
| surface-from-laws-img0012.png | 2021-04-05 22:50 | 38K | |
| sketch-1-2018-04-17.png | 2021-04-05 22:50 | 38K | |
| revision-cloud-1-2018-04-17.png | 2021-04-05 22:50 | 38K | |
| 3d-subtract-img0002.png | 2021-04-05 22:49 | 38K | |
| creating-a-parametric-part-img0017.png | 2021-04-05 22:49 | 38K | |
| print-style-table-img0001.png | 2021-04-05 22:50 | 38K | |
| merge-smesh-1-2018-04-12.png | 2021-04-05 22:49 | 38K | |
| background-color-img0001.png | 2021-04-05 22:49 | 38K | |
| autoshape-1-2018-04-17.png | 2021-04-05 22:49 | 38K | |
| editing-lightworks-material-img0009.png | 2021-04-05 22:49 | 38K | |
| editing-redsdk-luminances-img00121.png | 2021-04-05 22:49 | 38K | |
| managing-environments-in-the-render-manager-img0010.png | 2021-04-05 22:49 | 38K | |
| splines-and-bezier-curves-1-2018-04-17-1.png | 2021-04-05 22:50 | 38K | |
| surveyor-dimensions-img0001.png | 2021-04-05 22:50 | 38K | |
| inserting-viewports-img0006.png | 2021-04-05 22:49 | 38K | |
| node-editing-roof-slabs-img0003.png | 2021-04-05 22:49 | 38K | |
| display-general-img0001.png | 2021-04-05 22:49 | 38K | |
| imprint-auto-detect-img0003.png | 2021-04-05 22:49 | 39K | |
| page-layout-wizard-img0011.png | 2021-04-05 22:50 | 39K | |
| aec-dimension-styles-img0004.png | 2021-04-05 22:49 | 39K | |
| schedule-styles-img0014.png | 2021-04-05 22:50 | 39K | |
| changing-rows-and-columns-merging-cells-img0006.png | 2021-04-05 22:49 | 39K | |
| unbend-sheet-img0004.png | 2021-04-05 22:50 | 39K | |
| block-attributes-img0021.png | 2021-04-05 22:49 | 39K | |
| array-pattern-img0002.png | 2021-04-05 22:49 | 39K | |
| print-styles-1-2018-04-18.png | 2021-04-05 22:50 | 39K | |
| exploding-a-group-1-2018-04-18.png | 2021-04-05 22:49 | 39K | |
| creating-a-group-1-2018-04-18.png | 2021-04-05 22:49 | 39K | |
| external-references-1-2018-04-18.png | 2021-04-05 22:49 | 39K | |
| parametric-part-script-editor-img0002.png | 2021-04-05 22:50 | 39K | |
| block-attributes-img0009.png | 2021-04-05 22:49 | 39K | |
| roof-wall-modifier-img0003.png | 2021-04-05 22:50 | 39K | |
| assemble-by-3-points-img0007.png | 2021-04-05 22:49 | 39K | |
| edit-slope-angle-img0001.png | 2021-04-05 22:49 | 39K | |
| using-the-environments-palette-img0002.png | 2021-04-05 22:50 | 39K | |
| arrow-line-1-2018-04-17.png | 2021-04-05 22:49 | 39K | |
| arrow-arc-1-2018-04-17.png | 2021-04-05 22:49 | 39K | |
| image-map-general-img0001.png | 2021-04-05 22:49 | 39K | |
| arrow-polyline-1-2018-04-17.png | 2021-04-05 22:49 | 39K | |
| array-pattern-img0001.png | 2021-04-05 22:49 | 39K | |
| creating-sectional-and-iso-views-img0001.png | 2021-04-05 22:49 | 39K | |
| library-folders-img0003.png | 2021-04-05 22:49 | 39K | |
| managing-render-styles-in-the-render-manager-img0007.png | 2021-04-05 22:49 | 39K | |
| drawing-settings-img0010.png | 2021-04-05 22:49 | 39K | |
| subsetting-point-clouds-img0002.png | 2021-04-05 22:50 | 39K | |
| schedule-styles-img0010.png | 2021-04-05 22:50 | 39K | |
| print-styles-img0001.png | 2021-04-05 22:50 | 39K | |
| block-attributes-img0019.png | 2021-04-05 22:49 | 39K | |
| 3d-polyline-img00021.png | 2021-04-05 22:49 | 39K | |
| create-solid-from-surface-1-2018-04-19.png | 2021-04-05 22:49 | 39K | |
| edit-tool-in-3d-img0001.png | 2021-04-05 22:49 | 39K | |
| create-solid-from-face-s-1-2018-04-19-1.png | 2021-04-05 22:49 | 39K | |
| aec-dimension-styles-img0008.png | 2021-04-05 22:49 | 39K | |
| smesh-merging-img0006.png | 2021-04-05 22:50 | 39K | |
| update-viewport-boundary-img0004.png | 2021-04-05 22:50 | 39K | |
| chamfer-with-round-vertices-img0005.png | 2021-04-05 22:49 | 40K | |
| update-viewport-boundary-img0003.png | 2021-04-05 22:50 | 40K | |
| interactive-tone-adjustments-img0012.png | 2021-04-05 22:49 | 40K | |
| super-selector-modes-img0005.png | 2021-04-05 22:50 | 40K | |
| roof-wall-modifier-1-2018-04-19.png | 2021-04-05 22:50 | 40K | |
| smooth-mesh-smesh-1-2018-04-24.png | 2021-04-05 22:50 | 40K | |
| component-walls-img0001.png | 2021-04-05 22:49 | 40K | |
| curve-from-law-img0015.png | 2021-04-05 22:49 | 40K | |
| geomarks-and-tap-files-img0005.png | 2021-04-05 22:49 | 40K | |
| quicktime-movies-img0004.png | 2021-04-05 22:50 | 40K | |
| lightworks-environment-properties-1-2018-04-22.png | 2021-04-05 22:49 | 40K | |
| extrude-face-1-2018-04-24.png | 2021-04-05 22:49 | 40K | |
| join-coplanar-faces-1-2018-04-24.png | 2021-04-05 22:49 | 40K | |
| add-top-wall-modifiers-1-2018-04-19.png | 2021-04-05 22:49 | 40K | |
| split-face-by-isoline-1-2018-04-24.png | 2021-04-05 22:50 | 40K | |
| solidify-1-2018-04-24.png | 2021-04-05 22:50 | 40K | |
| smesh-merging-1-2018-04-24.png | 2021-04-05 22:50 | 40K | |
| split-face-1-2018-04-24.png | 2021-04-05 22:50 | 40K | |
| add-face-1-2018-04-24.png | 2021-04-05 22:49 | 40K | |
| smesh-symmetry-tools-1-2018-04-24-1.png | 2021-04-05 22:50 | 40K | |
| smesh-symmetry-tools-1-2018-04-24-2.png | 2021-04-05 22:50 | 40K | |
| table-styles-img0006.png | 2021-04-05 22:50 | 40K | |
| smesh-symmetry-tools-1-2018-04-24.png | 2021-04-05 22:50 | 40K | |
| roof-properties-img0004.png | 2021-04-05 22:50 | 40K | |
| door-styles-img0024.png | 2021-04-05 22:49 | 40K | |
| geomarks-and-tap-files-img0006.png | 2021-04-05 22:49 | 40K | |
| schedule-styles-img0002.png | 2021-04-05 22:50 | 40K | |
| deform-to-point-img0004.png | 2021-04-05 22:49 | 40K | |
| extruding-smesh-faces-1-2018-04-18.png | 2021-04-05 22:49 | 40K | |
| step-3-define-fields-for-the-report-img0006.png | 2021-04-05 22:50 | 40K | |
| facet-edit-1-2018-04-24.png | 2021-04-05 22:49 | 40K | |
| brush-styles-img0014.png | 2021-04-05 22:49 | 40K | |
| facet-offset-1-2018-04-24.png | 2021-04-05 22:49 | 40K | |
| terrain-modifier-img0001.png | 2021-04-05 22:50 | 40K | |
| schedule-styles-img0006.png | 2021-04-05 22:50 | 40K | |
| facet-deform-1-2018-04-24.png | 2021-04-05 22:49 | 40K | |
| advanced-grid-options-img0001.png | 2021-04-05 22:49 | 40K | |
| isolate-object-img0008.png | 2021-04-05 22:49 | 40K | |
| deform-to-point-img0003.png | 2021-04-05 22:49 | 40K | |
| add-roof-modifier-img0010.png | 2021-04-05 22:49 | 40K | |
| colors-and-brushes-img0001.png | 2021-04-05 22:49 | 40K | |
| aec-dimension-styles-img0013.png | 2021-04-05 22:49 | 40K | |
| spherical-pattern-img0001.png | 2021-04-05 22:50 | 40K | |
| 2d-3d-selector-img0012.png | 2021-04-05 22:49 | 40K | |
| transform-recorder-1-2018-04-18.png | 2021-04-05 22:50 | 40K | |
| previous-view-1-2018-04-12.png | 2021-04-05 22:50 | 40K | |
| aerial-view-1-2018-04-12.png | 2021-04-05 22:49 | 40K | |
| zooming-1-2018-04-12.png | 2021-04-05 22:50 | 40K | |
| panning-1-2018-04-12.png | 2021-04-05 22:50 | 40K | |
| creating-a-view-1-2018-04-12.png | 2021-04-05 22:49 | 40K | |
| named-view-1-2018-04-12.png | 2021-04-05 22:49 | 40K | |
| materials-img0001.png | 2021-04-05 22:49 | 40K | |
| redrawing-1-2018-04-12.png | 2021-04-05 22:50 | 40K | |
| tools-palette-img0002.png | 2021-04-05 22:50 | 40K | |
| lightworks-luminance-properties-img0006.png | 2021-04-05 22:49 | 40K | |
| pressure-load-img0008.png | 2021-04-05 22:50 | 40K | |
| modify-table-img0003.png | 2021-04-05 22:49 | 40K | |
| loading-symbol-folders-into-the-library-img0013.png | 2021-04-05 22:49 | 40K | |
| managing-render-styles-in-the-render-manager-img0002.png | 2021-04-05 22:49 | 40K | |
| creating-a-rendered-view-1-2018-04-18-1.png | 2021-04-05 22:49 | 40K | |
| text-styles-img0004.png | 2021-04-05 22:50 | 40K | |
| door-styles-img0007.png | 2021-04-05 22:49 | 40K | |
| step-3-define-fields-for-the-report-img0005.png | 2021-04-05 22:50 | 40K | |
| dimension-formatting-codes-img0003.png | 2021-04-05 22:49 | 40K | |
| aec-dimension-styles-img0003.png | 2021-04-05 22:49 | 40K | |
| tube-bend-img0001.png | 2021-04-05 22:50 | 40K | |
| tc-surface-segmentation-general-img0001.png | 2021-04-05 22:50 | 40K | |
| redsdk-volumetric-environment-img00171.png | 2021-04-05 22:50 | 40K | |
| tcw-profiles-img0004.png | 2021-04-05 22:50 | 40K | |
| node-editing-roof-slabs-img0001.png | 2021-04-05 22:49 | 41K | |
| auto-naming-img0001.png | 2021-04-05 22:49 | 41K | |
| editing-3d-objects-using-selection-info-img0015.png | 2021-04-05 22:49 | 41K | |
| terrain-modifier-img0003.png | 2021-04-05 22:50 | 41K | |
| editing-3d-objects-using-selection-info-img0026.png | 2021-04-05 22:49 | 41K | |
| page-setup-wizard-img0001.png | 2021-04-05 22:50 | 41K | |
| create-surface-from-face-s-1-2018-04-19.png | 2021-04-05 22:49 | 41K | |
| create-surface-from-profile-1-2018-04-19.png | 2021-04-05 22:49 | 41K | |
| modify-table-img0002.png | 2021-04-05 22:49 | 41K | |
| create-surface-from-solid-1-2018-04-19.png | 2021-04-05 22:49 | 41K | |
| creating-a-new-lightworks-material-img0016.png | 2021-04-05 22:49 | 41K | |
| import-terrain-1-2018-04-19.png | 2021-04-05 22:49 | 41K | |
| terrain-modifier-1-2018-04-19.png | 2021-04-05 22:50 | 41K | |
| update-viewport-boundary-1-2018-04-19.png | 2021-04-05 22:50 | 41K | |
| drawing-markers-1-2018-04-11.png | 2021-04-05 22:49 | 41K | |
| loading-a-parametric-part-into-the-library-img0008.png | 2021-04-05 22:49 | 41K | |
| modify-table-img0010.png | 2021-04-05 22:49 | 41K | |
| terrain-from-selected-points-1-2018-04-19.png | 2021-04-05 22:50 | 41K | |
| creating-sectional-and-iso-views-img0005.png | 2021-04-05 22:49 | 41K | |
| unbend-sheet-img0001.png | 2021-04-05 22:50 | 41K | |
| mirror-copy-img0006.png | 2021-04-05 22:49 | 41K | |
| create-surface-from-solid-img0003.png | 2021-04-05 22:49 | 41K | |
| center-line-1-2018-04-11.png | 2021-04-05 22:49 | 41K | |
| intersection-and-projection-img0008.png | 2021-04-05 22:49 | 41K | |
| center-mark-1-2018-04-11.png | 2021-04-05 22:49 | 41K | |
| export-general-img0001.png | 2021-04-05 22:49 | 41K | |
| create-surface-from-face-s-img0005.png | 2021-04-05 22:49 | 41K | |
| export-components-img0001.png | 2021-04-05 22:49 | 41K | |
| unwrapping-solid-body-img0001.png | 2021-04-05 22:50 | 41K | |
| lofting-img0016.png | 2021-04-05 22:49 | 41K | |
| editing-3d-objects-using-selection-info-img0011.png | 2021-04-05 22:49 | 41K | |
| general-settings-img0003.png | 2021-04-05 22:49 | 41K | |
| door-styles-img0017.png | 2021-04-05 22:49 | 41K | |
| creating-a-rendered-view-img0005.png | 2021-04-05 22:49 | 41K | |
| properties-of-standard-views-img0004.png | 2021-04-05 22:50 | 41K | |
| 3d-mesh-img0003.png | 2021-04-05 22:49 | 41K | |
| quick-pull-img0010.png | 2021-04-05 22:50 | 41K | |
| editing-redsdk-luminances-img00071.png | 2021-04-05 22:49 | 41K | |
| editing-hatch-patterns-img0004.png | 2021-04-05 22:49 | 41K | |
| dynamic-cut-plane-1-2018-04-11.png | 2021-04-05 22:49 | 41K | |
| select-by-query-1-2018-04-17.png | 2021-04-05 22:50 | 41K | |
| select-by-layer-1-2018-04-17.png | 2021-04-05 22:50 | 41K | |
| editing-3d-objects-using-selection-info-img0009.png | 2021-04-05 22:49 | 42K | |
| 3d-properties-img0003.png | 2021-04-05 22:49 | 42K | |
| select-by-entity-type-1-2018-04-17.png | 2021-04-05 22:50 | 42K | |
| extrude-to-face-img0012.png | 2021-04-05 22:49 | 42K | |
| loading-a-parametric-part-into-the-library-img0011.png | 2021-04-05 22:49 | 42K | |
| select-by-attribute-1-2018-04-17.png | 2021-04-05 22:50 | 42K | |
| trace-by-rectangle-img0001.png | 2021-04-05 22:50 | 42K | |
| branched-lofting-img0005.png | 2021-04-05 22:49 | 42K | |
| clearing-and-hiding-constructions-1-2018-04-16.png | 2021-04-05 22:49 | 42K | |
| drawing-settings-img0011.png | 2021-04-05 22:49 | 42K | |
| redsdk-volumetric-environment-img00201.png | 2021-04-05 22:50 | 42K | |
| modify-table-img0008.png | 2021-04-05 22:49 | 42K | |
| paper-space-properties-img0001.png | 2021-04-05 22:50 | 42K | |
| select-by-color-1-2018-04-17.png | 2021-04-05 22:50 | 42K | |
| editing-3d-objects-using-selection-info-img0017.png | 2021-04-05 22:49 | 42K | |
| imprint-img0012.png | 2021-04-05 22:49 | 42K | |
| deform-to-point-img0008.png | 2021-04-05 22:49 | 42K | |
| hole-img0008.png | 2021-04-05 22:49 | 42K | |
| move-1-2018-04-18.png | 2021-04-05 22:49 | 42K | |
| rotate-1-2018-04-18.png | 2021-04-05 22:50 | 42K | |
| editing-3d-objects-using-selection-info-img0025.png | 2021-04-05 22:49 | 42K | |
| scale-from-two-points-1-2018-04-18.png | 2021-04-05 22:50 | 42K | |
| uv-mapping-1-2018-04-19.png | 2021-04-05 22:50 | 42K | |
| profile-editing-img0018.png | 2021-04-05 22:50 | 42K | |
| double-line-polygon-1-2018-04-17.png | 2021-04-05 22:49 | 42K | |
| double-line-irregular-polygon-1-2018-04-17.png | 2021-04-05 22:49 | 42K | |
| dynamic-cut-plane-img0010.png | 2021-04-05 22:49 | 42K | |
| double-line-polyline-1-2018-04-17.png | 2021-04-05 22:49 | 42K | |
| double-line-rectangle-1-2018-04-17.png | 2021-04-05 22:49 | 42K | |
| double-line-perpendicular-1-2018-04-17.png | 2021-04-05 22:49 | 42K | |
| double-line-single-line-1-2018-04-17.png | 2021-04-05 22:49 | 42K | |
| scale-1-2018-04-18.png | 2021-04-05 22:50 | 42K | |
| double-line-parallel-1-2018-04-17.png | 2021-04-05 22:49 | 42K | |
| double-line-rotated-rectangle-1-2018-04-17.png | 2021-04-05 22:49 | 42K | |
| 2d-3d-selector-img0010.png | 2021-04-05 22:49 | 42K | |
| tracing-img0001.png | 2021-04-05 22:50 | 42K | |
| library-folders-img0002.png | 2021-04-05 22:49 | 42K | |
| pressure-load-img0005.png | 2021-04-05 22:50 | 42K | |
| terrain-img0008.png | 2021-04-05 22:50 | 42K | |
| custom-blocks-for-windows-and-doors-img0006.png | 2021-04-05 22:49 | 42K | |
| interactive-tone-adjustments-img0016.png | 2021-04-05 22:49 | 42K | |
| walk-through-tools-1-2018-04-11.png | 2021-04-05 22:50 | 42K | |
| editing-lightworks-material-img0002.png | 2021-04-05 22:49 | 42K | |
| inserting-a-picture-1-2018-04-17-1.png | 2021-04-05 22:49 | 42K | |
| inserting-a-picture-1-2018-04-17-2.png | 2021-04-05 22:49 | 42K | |
| fillet-with-round-vertices-img0008.png | 2021-04-05 22:49 | 42K | |
| window-styles-img0007.png | 2021-04-05 22:50 | 42K | |
| stairs-styles-img0002.png | 2021-04-05 22:50 | 42K | |
| lofting-img0025.png | 2021-04-05 22:49 | 42K | |
| inserting-a-picture-1-2018-04-17.png | 2021-04-05 22:49 | 42K | |
| imprint-edge-img0009.png | 2021-04-05 22:49 | 42K | |
| brush-properties-img0001.png | 2021-04-05 22:49 | 42K | |
| linking-data-to-graphics-1-2018-04-23.png | 2021-04-05 22:49 | 42K | |
| page-layout-wizard-img0022.png | 2021-04-05 22:50 | 43K | |
| redsdk-volumetric-environment-img00191.png | 2021-04-05 22:50 | 43K | |
| export-colors-img0001.png | 2021-04-05 22:49 | 43K | |
| tracing-img0002.png | 2021-04-05 22:50 | 43K | |
| node-editing-roof-slabs-img0009.png | 2021-04-05 22:49 | 43K | |
| patterns-1-2018-04-11.png | 2021-04-05 22:50 | 43K | |
| final-gather-img0001.png | 2021-04-05 22:49 | 43K | |
| redsdk-volumetric-environment-img00141.png | 2021-04-05 22:50 | 43K | |
| assemble-by-edge-and-point-img0002.png | 2021-04-05 22:49 | 43K | |
| quicktime-movies-img0007.png | 2021-04-05 22:50 | 43K | |
| pattern-by-polyline-1-2018-04-18.png | 2021-04-05 22:50 | 43K | |
| pattern-by-curve-1-2018-04-18.png | 2021-04-05 22:50 | 43K | |
| block-attributes-img0012.png | 2021-04-05 22:49 | 43K | |
| radial-pattern-1-2018-04-18.png | 2021-04-05 22:50 | 43K | |
| pressure-load-img0012.png | 2021-04-05 22:50 | 43K | |
| changing-rows-and-columns-merging-cells-img0001.png | 2021-04-05 22:49 | 43K | |
| smesh-merging-img0005.png | 2021-04-05 22:50 | 43K | |
| tc-surface-segmentation-properties-img0001.png | 2021-04-05 22:50 | 43K | |
| array-pattern-1-2018-04-18.png | 2021-04-05 22:49 | 43K | |
| lightworks-luminance-properties-1-2018-04-18.png | 2021-04-05 22:49 | 43K | |
| modify-table-img0001.png | 2021-04-05 22:49 | 43K | |
| editing-redsdk-luminances-img00181.png | 2021-04-05 22:49 | 43K | |
| pressure-load-img0004.png | 2021-04-05 22:50 | 43K | |
| assemble-by-edge-and-point-img0004.png | 2021-04-05 22:49 | 43K | |
| dynamic-cut-plane-img0009.png | 2021-04-05 22:49 | 43K | |
| selection-info-palette-img0018.png | 2021-04-05 22:50 | 43K | |
| create-solid-from-surface-img0006.png | 2021-04-05 22:49 | 43K | |
| aec-dimension-styles-img0011.png | 2021-04-05 22:49 | 43K | |
| facet-edit-img0009.png | 2021-04-05 22:49 | 43K | |
| materials-img0002.png | 2021-04-05 22:49 | 43K | |
| sketch-style-img0008.png | 2021-04-05 22:50 | 43K | |
| assemble-by-edge-and-point-img0003.png | 2021-04-05 22:49 | 43K | |
| tools-palette-img0008.png | 2021-04-05 22:50 | 43K | |
| copy-faces-img0004.png | 2021-04-05 22:49 | 43K | |
| camera-objects-1-2018-04-11.png | 2021-04-05 22:49 | 43K | |
| using-the-trim-tool-with-architectural-objects-img0004.png | 2021-04-05 22:50 | 43K | |
| customize-keyboard-1-2018-10-13-8.png | 2021-04-05 22:49 | 43K | |
| creating-standard-views-img0001.png | 2021-04-05 22:49 | 43K | |
| multi-line-parallel-1-2018-04-17.png | 2021-04-05 22:49 | 43K | |
| multi-line-polyline-1-2018-04-17.png | 2021-04-05 22:49 | 43K | |
| multi-line-perpendicular-1-2018-04-17.png | 2021-04-05 22:49 | 43K | |
| multi-line-single-line-1-2018-04-17.png | 2021-04-05 22:49 | 43K | |
| multi-line-irregular-polygon-1-2018-04-17.png | 2021-04-05 22:49 | 43K | |
| multi-line-rectangle-1-2018-04-17.png | 2021-04-05 22:49 | 43K | |
| multi-line-rotated-rectangle-1-2018-04-17.png | 2021-04-05 22:49 | 43K | |
| create-solid-from-surface-img0005.png | 2021-04-05 22:49 | 44K | |
| multi-line-polygon-1-2018-04-17.png | 2021-04-05 22:49 | 44K | |
| schedule-styles-img0009.png | 2021-04-05 22:50 | 44K | |
| redsdk-highlighting-img00031.png | 2021-04-05 22:50 | 44K | |
| editing-3d-objects-using-selection-info-img0021.png | 2021-04-05 22:49 | 44K | |
| creating-a-parametric-part-img0018.png | 2021-04-05 22:49 | 44K | |
| macro-recorder-img0006.png | 2021-04-05 22:49 | 44K | |
| 3d-mesh-img0005.png | 2021-04-05 22:49 | 44K | |
| tracing-img0003.png | 2021-04-05 22:50 | 44K | |
| node-editing-roof-slabs-img0004.png | 2021-04-05 22:49 | 44K | |
| changing-rows-and-columns-merging-cells-img0005.png | 2021-04-05 22:49 | 44K | |
| schedule-styles-img0008.png | 2021-04-05 22:50 | 44K | |
| selection-info-palette-img0043.png | 2021-04-05 22:50 | 44K | |
| 3d-subtract-img0003.png | 2021-04-05 22:49 | 44K | |
| interactive-tone-adjustments-img0003.png | 2021-04-05 22:49 | 44K | |
| add-slab-by-click-img0006.png | 2021-04-05 22:49 | 44K | |
| importing-point-clouds-img0004.png | 2021-04-05 22:49 | 44K | |
| environments-1-2018-04-24.png | 2021-04-05 22:49 | 44K | |
| quicktime-movies-1-2018-04-26.png | 2021-04-05 22:50 | 44K | |
| render-camera-properties-img0007.png | 2021-04-05 22:50 | 44K | |
| lightworks-environment-properties-1-2018-04-24.png | 2021-04-05 22:49 | 44K | |
| managing-environments-in-the-render-manager-1-2018-04-24.png | 2021-04-05 22:49 | 44K | |
| roof-wall-modifier-img0005.png | 2021-04-05 22:50 | 44K | |
| loading-and-saving-environments-1-2018-04-24.png | 2021-04-05 22:49 | 44K | |
| editing-lightworks-material-img0016.png | 2021-04-05 22:49 | 44K | |
| aec-dimension-styles-img0002.png | 2021-04-05 22:49 | 44K | |
| add-hole-img0004.png | 2021-04-05 22:49 | 44K | |
| roof-wall-modifier-img0006.png | 2021-04-05 22:50 | 44K | |
| roof-wall-modifier-img0004.png | 2021-04-05 22:50 | 44K | |
| properties-of-standard-views-img0002.png | 2021-04-05 22:50 | 45K | |
| render-styles-1-2018-04-24.png | 2021-04-05 22:50 | 45K | |
| loading-and-saving-render-styles-1-2018-04-24.png | 2021-04-05 22:49 | 45K | |
| inserting-a-picture-img0012.png | 2021-04-05 22:49 | 45K | |
| 3d-add-img0001.png | 2021-04-05 22:49 | 45K | |
| profile-styles-img0001.png | 2021-04-05 22:50 | 45K | |
| response-to-user-actions-img0001.png | 2021-04-05 22:50 | 45K | |
| changing-rows-and-columns-merging-cells-img0002.png | 2021-04-05 22:49 | 45K | |
| viewports-img0002.png | 2021-04-05 22:50 | 45K | |
| creating-data-link-templates-1-2018-04-23-1.png | 2021-04-05 22:49 | 45K | |
| stairs-1-2018-04-19.png | 2021-04-05 22:50 | 45K | |
| in-place-editing-of-groups-and-blocks-img0002.png | 2021-04-05 22:49 | 45K | |
| straight-stair-1-2018-04-19.png | 2021-04-05 22:50 | 45K | |
| stair-by-linework-1-2018-04-19.png | 2021-04-05 22:50 | 45K | |
| multilanding-stair-by-path-1-2018-04-19.png | 2021-04-05 22:49 | 45K | |
| miter-two-roof-slabs-1-2018-04-19.png | 2021-04-05 22:49 | 45K | |
| railings-1-2018-04-19-1.png | 2021-04-05 22:50 | 45K | |
| add-roof-modifier-1-2018-04-19.png | 2021-04-05 22:49 | 45K | |
| multi-landing-stair-1-2018-04-19.png | 2021-04-05 22:49 | 45K | |
| u-shaped-stair-1-2018-04-19.png | 2021-04-05 22:50 | 45K | |
| trim-roof-slab-1-2018-04-19.png | 2021-04-05 22:50 | 45K | |
| door-styles-img0016.png | 2021-04-05 22:49 | 45K | |
| extend-roof-slab-1-2018-04-19.png | 2021-04-05 22:49 | 45K | |
| add-roof-1-2018-04-19-1.png | 2021-04-05 22:49 | 45K | |
| add-roof-by-walls-1-2018-04-19.png | 2021-04-05 22:49 | 45K | |
| conceptual-selector-boundary-box-img0008.png | 2021-04-05 22:49 | 45K | |
| inserting-viewports-img0008.png | 2021-04-05 22:49 | 45K | |
| step-2-attach-custom-properties-to-objects-img0001.png | 2021-04-05 22:50 | 45K | |
| section-by-view-line-and-aligned-sectional-views-img0002.png | 2021-04-05 22:50 | 45K | |
| response-to-user-actions-img0002.png | 2021-04-05 22:50 | 45K | |
| changing-rows-and-columns-merging-cells-img0004.png | 2021-04-05 22:49 | 45K | |
| woodworking-1-2018-04-22.png | 2021-04-05 22:50 | 45K | |
| displaying-and-manipulating-the-grid-1-2018-04-16.png | 2021-04-05 22:49 | 45K | |
| manipulating-paper-spaces-img0001.png | 2021-04-05 22:49 | 45K | |
| block-attributes-img0013.png | 2021-04-05 22:49 | 45K | |
| lightworks-materials-1-2018-04-24.png | 2021-04-05 22:49 | 45K | |
| materials-1-2018-04-24.png | 2021-04-05 22:49 | 45K | |
| iso-grid-1-2018-04-16.png | 2021-04-05 22:49 | 46K | |
| protractor-1-2018-04-16.png | 2021-04-05 22:50 | 46K | |
| create-solid-from-surface-img0002.png | 2021-04-05 22:49 | 46K | |
| creating-construction-geometry-1-2018-04-16.png | 2021-04-05 22:49 | 46K | |
| sheet-metal-gusset-1-2018-04-24.png | 2021-04-05 22:50 | 46K | |
| extract-entity-1-2018-04-24.png | 2021-04-05 22:49 | 46K | |
| assembling-1-2018-04-24.png | 2021-04-05 22:49 | 46K | |
| imprint-1-2018-04-24.png | 2021-04-05 22:49 | 46K | |
| twist-entity-1-2018-04-24.png | 2021-04-05 22:50 | 46K | |
| chamfer-edges-1-2018-04-24.png | 2021-04-05 22:49 | 46K | |
| 3d-boolean-operations-1-2018-04-24.png | 2021-04-05 22:49 | 46K | |
| fillet-3d-1-2018-04-24.png | 2021-04-05 22:49 | 46K | |
| shelling-solids-1-2018-04-24.png | 2021-04-05 22:50 | 46K | |
| bending-and-unbending-1-2018-04-24.png | 2021-04-05 22:49 | 46K | |
| imprint-edge-1-2018-04-24.png | 2021-04-05 22:49 | 46K | |
| thread-1-2018-04-24.png | 2021-04-05 22:50 | 46K | |
| editing-lightworks-material-1-2018-04-24.png | 2021-04-05 22:49 | 46K | |
| loading-and-saving-materials-1-2018-04-24.png | 2021-04-05 22:49 | 46K | |
| tweak-face-1-2018-04-24.png | 2021-04-05 22:50 | 46K | |
| quick-pull-1-2018-04-24.png | 2021-04-05 22:50 | 46K | |
| sweep-img0015.png | 2021-04-05 22:50 | 46K | |
| tc-mesh-simplification-1-2018-04-24.png | 2021-04-05 22:50 | 46K | |
| stretch-entity-1-2018-04-24.png | 2021-04-05 22:50 | 46K | |
| hole-1-2018-04-24.png | 2021-04-05 22:49 | 46K | |
| extrude-to-face-1-2018-04-24.png | 2021-04-05 22:49 | 46K | |
| flatten-on-workplane-1-2018-04-24.png | 2021-04-05 22:49 | 46K | |
| fillet-edges-1-2018-04-24.png | 2021-04-05 22:49 | 46K | |
| rays-1-2018-04-16-1.png | 2021-04-05 22:50 | 46K | |
| select-by-entity-type-1-2018-03-31-1.png | 2021-04-05 22:50 | 46K | |
| sketch-style-img0003.png | 2021-04-05 22:50 | 46K | |
| deform-to-point-img0009.png | 2021-04-05 22:49 | 46K | |
| render-manager-options-img0003.png | 2021-04-05 22:50 | 46K | |
| rays-1-2018-04-16.png | 2021-04-05 22:50 | 46K | |
| editing-3d-objects-using-selection-info-img0019.png | 2021-04-05 22:49 | 46K | |
| customize-keyboard-1-2018-10-13-2.png | 2021-04-05 22:49 | 46K | |
| tcw-profiles-img0001.png | 2021-04-05 22:50 | 46K | |
| arranging-and-snapping-room-boxes-img0002.png | 2021-04-05 22:49 | 46K | |
| woodworking-img0006.png | 2021-04-05 22:50 | 46K | |
| inserting-a-picture-img0009.png | 2021-04-05 22:49 | 46K | |
| customize-keyboard-1-2018-10-13-3.png | 2021-04-05 22:49 | 46K | |
| block-attributes-img0007.png | 2021-04-05 22:49 | 46K | |
| redsdk-volumetric-environment-img00261.png | 2021-04-05 22:50 | 46K | |
| tcw-profiles-img0006.png | 2021-04-05 22:50 | 46K | |
| page-setup-img0002.png | 2021-04-05 22:50 | 46K | |
| stairs-styles-img0008.png | 2021-04-05 22:50 | 46K | |
| general-setup-img0001.png | 2021-04-05 22:49 | 46K | |
| library-folders-img0008.png | 2021-04-05 22:49 | 46K | |
| curve-from-law-img0010.png | 2021-04-05 22:49 | 46K | |
| warp-by-law-img0010.png | 2021-04-05 22:50 | 46K | |
| table-import-xlsx-img0004.png | 2021-04-05 22:50 | 46K | |
| unfold-face-img0006.png | 2021-04-05 22:50 | 46K | |
| smesh-merging-img0003.png | 2021-04-05 22:50 | 46K | |
| linear-copy-1-2018-04-17.png | 2021-04-05 22:49 | 46K | |
| radial-copy-1-2018-04-17.png | 2021-04-05 22:50 | 46K | |
| customize-keyboard-1-2018-10-13-4.png | 2021-04-05 22:49 | 46K | |
| fit-array-copy-1-2018-04-17.png | 2021-04-05 22:49 | 46K | |
| fit-radial-copy-1-2018-04-17.png | 2021-04-05 22:49 | 46K | |
| extract-entity-img0012.png | 2021-04-05 22:49 | 46K | |
| fit-linear-copy-1-2018-04-17.png | 2021-04-05 22:49 | 46K | |
| imprint-with-dimple-sheet-metal-img0001.png | 2021-04-05 22:49 | 46K | |
| mirror-copy-1-2018-04-17.png | 2021-04-05 22:49 | 46K | |
| vector-copy-1-2018-04-17.png | 2021-04-05 22:50 | 46K | |
| array-copy-1-2018-04-17.png | 2021-04-05 22:49 | 46K | |
| contact-manager-img0002.png | 2021-04-05 22:49 | 46K | |
| customize-keyboard-1-2018-10-13-7.png | 2021-04-05 22:49 | 46K | |
| ifc-import-img0003.png | 2021-04-05 22:49 | 46K | |
| associating-the-image-with-the-3d-object-img0002.png | 2021-04-05 22:49 | 46K | |
| 3d-spline-by-control-points-img0004.png | 2021-04-05 22:49 | 46K | |
| imprint-edge-img0006.png | 2021-04-05 22:49 | 46K | |
| trace-by-rectangle-img0003.png | 2021-04-05 22:50 | 47K | |
| customize-keyboard-1-2018-10-13-5.png | 2021-04-05 22:49 | 47K | |
| unbend-sheet-img0011.png | 2021-04-05 22:50 | 47K | |
| profile-editing-img0010.png | 2021-04-05 22:50 | 47K | |
| customize-keyboard-1-2018-10-13-6.png | 2021-04-05 22:49 | 47K | |
| unwrapping-solid-body-img0003.png | 2021-04-05 22:50 | 47K | |
| page-layout-wizard-img0023.png | 2021-04-05 22:50 | 47K | |
| tools-palette-img0004.png | 2021-04-05 22:50 | 47K | |
| parts-and-assemblies-img0008.png | 2021-04-05 22:50 | 47K | |
| library-folders-img0012.png | 2021-04-05 22:49 | 47K | |
| node-editing-roof-slabs-img0010.png | 2021-04-05 22:49 | 47K | |
| inserting-viewports-img0007.png | 2021-04-05 22:49 | 47K | |
| assemble-by-3-points-1-2018-04-24-2.png | 2021-04-05 22:49 | 47K | |
| editing-redsdk-luminances-img00111.png | 2021-04-05 22:49 | 47K | |
| point-clouds-1-2018-04-23.png | 2021-04-05 22:50 | 47K | |
| palettes-1-2018-04-23.png | 2021-04-05 22:50 | 47K | |
| flange-img0006.png | 2021-04-05 22:49 | 47K | |
| packing-general-img0001.png | 2021-04-05 22:50 | 47K | |
| importing-point-clouds-1-2018-04-23.png | 2021-04-05 22:49 | 47K | |
| subsetting-point-clouds-1-2018-04-23.png | 2021-04-05 22:50 | 47K | |
| coordinates-of-a-point-1-2018-04-23.png | 2021-04-05 22:49 | 47K | |
| triangulating-point-clouds-1-2018-04-23.png | 2021-04-05 22:50 | 47K | |
| parametric-parts-1-2018-04-23.png | 2021-04-05 22:50 | 47K | |
| updating-the-database-and-report-1-2018-04-23.png | 2021-04-05 22:50 | 47K | |
| 3d-spline-by-control-points-img0003.png | 2021-04-05 22:49 | 47K | |
| drawing-compare-1-2018-04-23.png | 2021-04-05 22:49 | 47K | |
| measuring-surface-area-1-2018-04-23.png | 2021-04-05 22:49 | 47K | |
| managing-environments-in-the-render-manager-img0002.png | 2021-04-05 22:49 | 47K | |
| brush-styles-1-2018-04-23.png | 2021-04-05 22:49 | 47K | |
| measuring-angles-1-2018-04-23.png | 2021-04-05 22:49 | 47K | |
| measuring-area-1-2018-04-23.png | 2021-04-05 22:49 | 47K | |
| measuring-volume-1-2018-04-23.png | 2021-04-05 22:49 | 47K | |
| profile-styles-img0018.png | 2021-04-05 22:50 | 47K | |
| curve-length-1-2018-04-23.png | 2021-04-05 22:49 | 47K | |
| creating-a-rendered-view-img0011.png | 2021-04-05 22:49 | 47K | |
| measuring-distance-1-2018-04-23.png | 2021-04-05 22:49 | 47K | |
| assemble-by-3-points-1-2018-04-24-1.png | 2021-04-05 22:49 | 47K | |
| node-editing-roof-slabs-img0005.png | 2021-04-05 22:49 | 47K | |
| property-toolbar-img0003.png | 2021-04-05 22:50 | 47K | |
| twist-entity-img0001.png | 2021-04-05 22:50 | 47K | |
| inserting-a-block-img0002.png | 2021-04-05 22:49 | 48K | |
| editing-imprint-parameters-img0001.png | 2021-04-05 22:49 | 48K | |
| share-1-2018-04-22.png | 2021-04-05 22:50 | 48K | |
| select-by-entity-type-1-2018-03-31.png | 2021-04-05 22:50 | 48K | |
| drawing-settings-img0012.png | 2021-04-05 22:49 | 48K | |
| linking-data-to-graphics-1-2018-04-23-2.png | 2021-04-05 22:49 | 48K | |
| door-styles-img0020.png | 2021-04-05 22:49 | 48K | |
| inserting-viewports-img0003.png | 2021-04-05 22:49 | 48K | |
| library-img0001.png | 2021-04-05 22:49 | 48K | |
| inserting-a-parametric-part-from-the-library-img0006.png | 2021-04-05 22:49 | 48K | |
| inserting-viewports-img0004.png | 2021-04-05 22:49 | 48K | |
| using-the-trim-tool-with-architectural-objects-img0003.png | 2021-04-05 22:50 | 48K | |
| aec-dimension-styles-img0015.png | 2021-04-05 22:49 | 48K | |
| smart-dimensions-1-2018-04-18.png | 2021-04-05 22:50 | 48K | |
| quick-dimensions-1-2018-04-18.png | 2021-04-05 22:50 | 48K | |
| multileader-dimensions-1-2018-04-18.png | 2021-04-05 22:49 | 48K | |
| geometric-tolerance-1-2018-04-11.png | 2021-04-05 22:49 | 48K | |
| linear-copy-img0004.png | 2021-04-05 22:49 | 48K | |
| display-2d-part-img0004.png | 2021-04-05 22:49 | 48K | |
| dimensions-1-2018-04-11.png | 2021-04-05 22:49 | 48K | |
| facet-edit-img0003.png | 2021-04-05 22:49 | 48K | |
| edit-tool-in-3d-img0008.png | 2021-04-05 22:49 | 48K | |
| section-by-workplane-img0004.png | 2021-04-05 22:50 | 48K | |
| creating-and-displaying-windows-img0001.png | 2021-04-05 22:49 | 48K | |
| 3d-spline-by-fit-points-img0004.png | 2021-04-05 22:49 | 48K | |
| editing-lightworks-material-img0012.png | 2021-04-05 22:49 | 48K | |
| shelling-solids-img0009.png | 2021-04-05 22:50 | 48K | |
| properties-of-section-lines-img0003.png | 2021-04-05 22:50 | 48K | |
| opening-files-img0001.png | 2021-04-05 22:49 | 48K | |
| window-styles-img0006.png | 2021-04-05 22:50 | 48K | |
| editing-hatch-patterns-img0002.png | 2021-04-05 22:49 | 48K | |
| door-styles-img0022.png | 2021-04-05 22:49 | 48K | |
| the-style-manager-palette-img0003.png | 2021-04-05 22:50 | 48K | |
| redsdk-materials-examples-img00321.png | 2021-04-05 22:50 | 48K | |
| inserting-a-symbol-from-the-library-into-the-drawing-img0001.png | 2021-04-05 22:49 | 48K | |
| redsdk-highlighting-img00051.png | 2021-04-05 22:50 | 48K | |
| node-editing-roof-slabs-img0012.png | 2021-04-05 22:49 | 48K | |
| managing-environments-in-the-render-manager-img0003.png | 2021-04-05 22:49 | 49K | |
| share-1-2018-04-22-1.png | 2021-04-05 22:50 | 49K | |
| contact-manager-img0004.png | 2021-04-05 22:49 | 49K | |
| door-styles-img0015.png | 2021-04-05 22:49 | 49K | |
| luminance-1-2018-04-24.png | 2021-04-05 22:49 | 49K | |
| 3d-spline-by-fit-points-img0003.png | 2021-04-05 22:49 | 49K | |
| assigning-property-sets-to-objects-img0002.png | 2021-04-05 22:49 | 49K | |
| loading-and-saving-luminances-1-2018-04-24.png | 2021-04-05 22:49 | 49K | |
| door-styles-img0021.png | 2021-04-05 22:49 | 49K | |
| sweep-img0014.png | 2021-04-05 22:50 | 49K | |
| ray-traced-1-2018-04-24-3.png | 2021-04-05 22:50 | 49K | |
| conceptual-selector-boundary-box-img0006.png | 2021-04-05 22:49 | 49K | |
| camera-objects-img0009.png | 2021-04-05 22:49 | 49K | |
| drafting-reference-point-img0006.png | 2021-04-05 22:49 | 49K | |
| fillet-with-round-vertices-img0003.png | 2021-04-05 22:49 | 49K | |
| imprint-with-chamfer-or-fillet-img0006.png | 2021-04-05 22:49 | 49K | |
| camera-objects-img0008.png | 2021-04-05 22:49 | 49K | |
| starting-turbocad-img0003.png | 2021-04-05 22:50 | 49K | |
| assemble-by-3-points-1-2018-04-24-3.png | 2021-04-05 22:49 | 49K | |
| fillet-with-miter-vertices-img0003.png | 2021-04-05 22:49 | 49K | |
| parametric-part-script-editor-img0003.png | 2021-04-05 22:50 | 49K | |
| modify-table-img0006.png | 2021-04-05 22:49 | 49K | |
| library-folders-img0010.png | 2021-04-05 22:49 | 49K | |
| unbend-sheet-img0003.png | 2021-04-05 22:50 | 49K | |
| merge-smesh-img0002.png | 2021-04-05 22:49 | 49K | |
| file-locations-img0001.png | 2021-04-05 22:49 | 49K | |
| imprint-with-dimple-sheet-metal-img0003.png | 2021-04-05 22:49 | 49K | |
| editing-3d-objects-using-selection-info-img0006.png | 2021-04-05 22:49 | 49K | |
| facet-edit-img0004.png | 2021-04-05 22:49 | 49K | |
| custom-blocks-for-windows-and-doors-img0005.png | 2021-04-05 22:49 | 50K | |
| constraints-img0001.png | 2021-04-05 22:49 | 50K | |
| editing-redsdk-luminances-img00051.png | 2021-04-05 22:49 | 50K | |
| quicktime-movies-img0005.png | 2021-04-05 22:50 | 50K | |
| tools-palette-img0006.png | 2021-04-05 22:50 | 50K | |
| loading-symbol-folders-into-the-library-img0011.png | 2021-04-05 22:49 | 50K | |
| unwrapping-solid-body-img0002.png | 2021-04-05 22:50 | 50K | |
| editing-3d-objects-using-selection-info-img0008.png | 2021-04-05 22:49 | 50K | |
| color-palette-img0001.png | 2021-04-05 22:49 | 50K | |
| acis-img0002.png | 2021-04-05 22:49 | 50K | |
| render-manager-options-img0001.png | 2021-04-05 22:50 | 50K | |
| chamfer-with-miter-vertices-img0003.png | 2021-04-05 22:49 | 50K | |
| tcw-profiles-img0003.png | 2021-04-05 22:50 | 50K | |
| custom-blocks-for-windows-and-doors-img0008.png | 2021-04-05 22:49 | 50K | |
| door-styles-img0004.png | 2021-04-05 22:49 | 50K | |
| render-manager-img0002.png | 2021-04-05 22:50 | 50K | |
| 3d-spline-by-control-points-img0005.png | 2021-04-05 22:49 | 50K | |
| 3d-spline-by-fit-points-img0005.png | 2021-04-05 22:49 | 50K | |
| smesh-merging-img0004.png | 2021-04-05 22:50 | 50K | |
| creating-a-new-redsdk-material-img00061.png | 2021-04-05 22:49 | 50K | |
| rotate-view-with-viewport-1-2018-04-22.png | 2021-04-05 22:50 | 50K | |
| creating-a-new-lightworks-material-img0005.png | 2021-04-05 22:49 | 50K | |
| editing-3d-objects-using-selection-info-img0018.png | 2021-04-05 22:49 | 50K | |
| irregular-polygon-1-2018-04-16.png | 2021-04-05 22:49 | 50K | |
| minimal-distance-1-2018-04-16.png | 2021-04-05 22:49 | 50K | |
| parallel-1-2018-04-16.png | 2021-04-05 22:50 | 50K | |
| rotated-rectangle-1-2018-04-16.png | 2021-04-05 22:50 | 50K | |
| rectangle-1-2018-04-16.png | 2021-04-05 22:50 | 50K | |
| perpendicular-1-2018-04-16.png | 2021-04-05 22:50 | 50K | |
| tangent-arc-point-1-2018-04-16.png | 2021-04-05 22:50 | 50K | |
| facet-edit-img0002.png | 2021-04-05 22:49 | 50K | |
| tangent-to-arc-1-2018-04-16.png | 2021-04-05 22:50 | 50K | |
| single-line-1-2018-04-16.png | 2021-04-05 22:50 | 50K | |
| polygon-1-2018-04-16.png | 2021-04-05 22:50 | 50K | |
| tangent-from-arc-1-2018-04-16.png | 2021-04-05 22:50 | 50K | |
| tangent-to-2-arcs-1-2018-04-16.png | 2021-04-05 22:50 | 50K | |
| polyline-1-2018-04-16.png | 2021-04-05 22:50 | 50K | |
| terrain-modifier-img0005.png | 2021-04-05 22:50 | 51K | |
| repositioning-control-handles-of-the-selector-img0003.png | 2021-04-05 22:50 | 51K | |
| block-attributes-img0017.png | 2021-04-05 22:49 | 51K | |
| ellipse-fixed-ratio-3-2018-04-16.png | 2021-04-05 22:49 | 51K | |
| circle-center-and-point-1-2018-04-16.png | 2021-04-05 22:49 | 51K | |
| circle-concentric-3-2018-04-16.png | 2021-04-05 22:49 | 51K | |
| rotated-ellipse-1-2018-04-16.png | 2021-04-05 22:50 | 51K | |
| ellipse-1-2018-04-16.png | 2021-04-05 22:49 | 51K | |
| circle-tangent-to-entities-1-2018-04-16.png | 2021-04-05 22:49 | 51K | |
| custom-blocks-for-windows-and-doors-img0009.png | 2021-04-05 22:49 | 51K | |
| circle-double-point-1-2018-04-16.png | 2021-04-05 22:49 | 51K | |
| circle-tangent-to-arc-1-2018-04-16.png | 2021-04-05 22:49 | 51K | |
| circle-triple-point-1-2018-04-16.png | 2021-04-05 22:49 | 51K | |
| circle-tangent-to-3-arcs-3-2018-04-16.png | 2021-04-05 22:49 | 51K | |
| circle-tangent-to-line-3-2018-04-16.png | 2021-04-05 22:49 | 51K | |
| starting-turbocad-img0002.png | 2021-04-05 22:50 | 51K | |
| lightworks-luminance-properties-img0002.png | 2021-04-05 22:49 | 51K | |
| lightworks-luminance-properties-img0007.png | 2021-04-05 22:49 | 51K | |
| intersection-and-projection-img0006.png | 2021-04-05 22:49 | 51K | |
| window-styles-img0010.png | 2021-04-05 22:50 | 51K | |
| edit-tool-in-3d-img0011.png | 2021-04-05 22:49 | 51K | |
| profile-editing-img0015.png | 2021-04-05 22:50 | 51K | |
| organizational-chart-1-2018-04-23.png | 2021-04-05 22:49 | 51K | |
| add-roof-modifier-img0003.png | 2021-04-05 22:49 | 51K | |
| page-layout-wizard-1-2018-04-23.png | 2021-04-05 22:50 | 51K | |
| extract-entity-img0013.png | 2021-04-05 22:49 | 51K | |
| exploding-solids-img0003.png | 2021-04-05 22:49 | 51K | |
| export-general-img0002.png | 2021-04-05 22:49 | 51K | |
| schedule-styles-img0005.png | 2021-04-05 22:50 | 51K | |
| managing-environments-in-the-render-manager-img0004.png | 2021-04-05 22:49 | 51K | |
| profile-editing-img0003.png | 2021-04-05 22:50 | 51K | |
| door-styles-img0023.png | 2021-04-05 22:49 | 51K | |
| fragmental-views-img0005.png | 2021-04-05 22:49 | 51K | |
| arc-tangent-to-arc-3-2018-04-17.png | 2021-04-05 22:49 | 52K | |
| arc-tangent-to-line-3-2018-04-17.png | 2021-04-05 22:49 | 52K | |
| managing-environments-in-the-render-manager-img0007.png | 2021-04-05 22:49 | 52K | |
| arc-elliptical-fixed-ratio-3-2018-04-17.png | 2021-04-05 22:49 | 52K | |
| arc-elliptical-3-2018-04-17.png | 2021-04-05 22:49 | 52K | |
| arc-double-point-3-2018-04-17.png | 2021-04-05 22:49 | 52K | |
| arc-tangent-to-2-entities-3-2018-04-17.png | 2021-04-05 22:49 | 52K | |
| arc-start-end-included-3-2018-04-17.png | 2021-04-05 22:49 | 52K | |
| arc-start-included-end-1-2018-04-17.png | 2021-04-05 22:49 | 52K | |
| arc-tangent-to-entities-3-2018-04-17.png | 2021-04-05 22:49 | 52K | |
| arc-rotated-elliptical-3-2018-04-17.png | 2021-04-05 22:49 | 52K | |
| arc-tangent-to-3-arcs-3-2018-04-17.png | 2021-04-05 22:49 | 52K | |
| door-styles-img0027.png | 2021-04-05 22:49 | 52K | |
| arc-concentric-3-2018-04-17.png | 2021-04-05 22:49 | 52K | |
| arc-center-and-radius-1-2018-04-17.png | 2021-04-05 22:49 | 52K | |
| tube-bend-img0003.png | 2021-04-05 22:50 | 52K | |
| add-roof-modifier-img0004.png | 2021-04-05 22:49 | 52K | |
| curve-length-img0003.png | 2021-04-05 22:49 | 52K | |
| door-styles-img0028.png | 2021-04-05 22:49 | 52K | |
| the-style-manager-palette-img0007.png | 2021-04-05 22:50 | 52K | |
| refining-img0003.png | 2021-04-05 22:50 | 52K | |
| unwrapping-tc-surface-img0013.png | 2021-04-05 22:50 | 52K | |
| shelling-solids-img0008.png | 2021-04-05 22:50 | 52K | |
| interactive-tone-adjustments-img0009.png | 2021-04-05 22:49 | 52K | |
| creating-data-link-templates-img0003.png | 2021-04-05 22:49 | 52K | |
| editing-3d-objects-using-selection-info-img0010.png | 2021-04-05 22:49 | 52K | |
| constraining-geometry-1-2018-04-10.png | 2021-04-05 22:49 | 52K | |
| subsetting-point-clouds-img0003.png | 2021-04-05 22:50 | 52K | |
| custom-properties-database-and-reports-img0001.png | 2021-04-05 22:49 | 52K | |
| curve-length-img0002.png | 2021-04-05 22:49 | 52K | |
| repositioning-control-handles-of-the-selector-img0004.png | 2021-04-05 22:50 | 52K | |
| editing-redsdk-luminances-img00021.png | 2021-04-05 22:49 | 52K | |
| hole-img0006.png | 2021-04-05 22:49 | 52K | |
| unfold-face-img0003.png | 2021-04-05 22:50 | 52K | |
| environments-img0002.png | 2021-04-05 22:49 | 53K | |
| display-2d-part-img0001.png | 2021-04-05 22:49 | 53K | |
| door-styles-img0025.png | 2021-04-05 22:49 | 53K | |
| 2d-3d-selector-img0009.png | 2021-04-05 22:49 | 53K | |
| the-camera-1-2018-04-11.png | 2021-04-05 22:50 | 53K | |
| camera-movements-1-2018-04-11.png | 2021-04-05 22:49 | 53K | |
| equal-length-constraint-1-2018-04-18.png | 2021-04-05 22:49 | 53K | |
| points-coincident-constraint-1-2018-04-18.png | 2021-04-05 22:50 | 53K | |
| connect-constraint-1-2018-04-18.png | 2021-04-05 22:49 | 53K | |
| auto-constraint-1-2018-04-18.png | 2021-04-05 22:49 | 53K | |
| concentric-constraint-1-2018-04-18.png | 2021-04-05 22:49 | 53K | |
| equal-distance-constraint-1-2018-04-18.png | 2021-04-05 22:49 | 53K | |
| midpoint-constraint-1-2018-04-18.png | 2021-04-05 22:49 | 53K | |
| change-chirality-constraint-1-2018-04-18.png | 2021-04-05 22:49 | 53K | |
| perpendicular-constraint-1-2018-04-18.png | 2021-04-05 22:50 | 53K | |
| symmetric-constraint-1-2018-04-18.png | 2021-04-05 22:50 | 53K | |
| coincident-constraint-1-2018-04-18.png | 2021-04-05 22:49 | 53K | |
| auto-dimension-1-2018-04-18.png | 2021-04-05 22:49 | 53K | |
| settings-img0002.png | 2021-04-05 22:50 | 53K | |
| parallel-constraint-1-2018-04-18.png | 2021-04-05 22:50 | 53K | |
| fix-geometry-constraint-1-2018-04-18.png | 2021-04-05 22:49 | 53K | |
| equal-radius-constraint-1-2018-04-18.png | 2021-04-05 22:49 | 53K | |
| tangent-constraint-1-2018-04-18-1.png | 2021-04-05 22:50 | 53K | |
| sketch-style-img0011.png | 2021-04-05 22:50 | 53K | |
| horizontal-vertical-constraint-1-2018-04-18-2.png | 2021-04-05 22:49 | 53K | |
| repositioning-control-handles-of-the-selector-img0001.png | 2021-04-05 22:50 | 53K | |
| curve-from-law-img0009.png | 2021-04-05 22:49 | 53K | |
| warp-by-law-img0009.png | 2021-04-05 22:50 | 53K | |
| editing-3d-objects-using-selection-info-img0013.png | 2021-04-05 22:49 | 53K | |
| step-1-define-custom-fields-1-2018-04-23.png | 2021-04-05 22:50 | 53K | |
| door-styles-img0019.png | 2021-04-05 22:49 | 53K | |
| editing-3d-objects-using-selection-info-img0027.png | 2021-04-05 22:49 | 53K | |
| step-3-define-fields-for-the-report-1-2018-04-23.png | 2021-04-05 22:50 | 53K | |
| redsdk-volumetric-environment-img00151.png | 2021-04-05 22:50 | 53K | |
| fillet-with-miter-vertices-img0008.png | 2021-04-05 22:49 | 53K | |
| print-styles-img0002.png | 2021-04-05 22:50 | 53K | |
| managing-luminances-in-the-render-manager-img0002.png | 2021-04-05 22:49 | 53K | |
| tube-bend-img0004.png | 2021-04-05 22:50 | 53K | |
| fillet-with-miter-vertices-img0011.png | 2021-04-05 22:49 | 53K | |
| stretch-entity-img0003.png | 2021-04-05 22:50 | 53K | |
| chamfer-with-miter-vertices-img0008.png | 2021-04-05 22:49 | 53K | |
| creating-data-link-templates-1-2018-04-23.png | 2021-04-05 22:49 | 54K | |
| measuring-surface-area-img0002.png | 2021-04-05 22:49 | 54K | |
| door-styles-img0006.png | 2021-04-05 22:49 | 54K | |
| mid-two-point-snap-img0002.png | 2021-04-05 22:49 | 54K | |
| render-manager-options-img0002.png | 2021-04-05 22:50 | 54K | |
| smesh-crease-img0007.png | 2021-04-05 22:50 | 54K | |
| solidify-img0004.png | 2021-04-05 22:50 | 54K | |
| spelling-tool-and-spell-options-img0003.png | 2021-04-05 22:50 | 54K | |
| render-camera-properties-1-2018-04-18-3.png | 2021-04-05 22:50 | 54K | |
| library-folders-img0001.png | 2021-04-05 22:49 | 54K | |
| door-styles-img0018.png | 2021-04-05 22:49 | 54K | |
| refining-img0002.png | 2021-04-05 22:50 | 54K | |
| tools-palette-img0005.png | 2021-04-05 22:50 | 54K | |
| 2d-3d-selector-img0003.png | 2021-04-05 22:49 | 54K | |
| the-interface-img0001.png | 2021-04-05 22:50 | 54K | |
| draw-by-layer-img0001.png | 2021-04-05 22:49 | 54K | |
| extract-entity-img0005.png | 2021-04-05 22:49 | 54K | |
| window-styles-img0017.png | 2021-04-05 22:50 | 54K | |
| unwrapping-tc-surface-img0001.png | 2021-04-05 22:50 | 54K | |
| creating-a-parametric-part-img0041.png | 2021-04-05 22:49 | 55K | |
| intersection-and-projection-img0005.png | 2021-04-05 22:49 | 55K | |
| fillet-with-miter-vertices-img0005.png | 2021-04-05 22:49 | 55K | |
| space-units-img0001.png | 2021-04-05 22:50 | 55K | |
| customize-commands-img0001.png | 2021-04-05 22:49 | 55K | |
| geomarks-and-tap-files-img0007.png | 2021-04-05 22:49 | 55K | |
| tcw-profiles-img0009.png | 2021-04-05 22:50 | 55K | |
| redsdk-volumetric-environment-img00251.png | 2021-04-05 22:50 | 55K | |
| starting-turbocad-img0001.png | 2021-04-05 22:50 | 55K | |
| fillet-with-setbacks-img0002.png | 2021-04-05 22:49 | 55K | |
| profile-editing-img0002.png | 2021-04-05 22:50 | 55K | |
| profile-editing-img0008.png | 2021-04-05 22:50 | 55K | |
| facet-offset-img0002.png | 2021-04-05 22:49 | 55K | |
| design-director-layers-1-2018-04-23-1.png | 2021-04-05 22:49 | 55K | |
| node-editing-roofs-img0001.png | 2021-04-05 22:49 | 55K | |
| imprint-img0014.png | 2021-04-05 22:49 | 55K | |
| section-by-workplane-img0002.png | 2021-04-05 22:50 | 55K | |
| triangulating-point-clouds-img0004.png | 2021-04-05 22:50 | 55K | |
| redsdk-global-environments-img00051.png | 2021-04-05 22:50 | 55K | |
| using-the-advanced-render-styles-palette-img0005.png | 2021-04-05 22:50 | 55K | |
| using-the-environments-palette-img0005.png | 2021-04-05 22:50 | 55K | |
| using-the-luminances-palette-img0006.png | 2021-04-05 22:50 | 55K | |
| using-the-materials-palette-img0007.png | 2021-04-05 22:50 | 55K | |
| redsdk-volumetric-environment-img00221.png | 2021-04-05 22:50 | 55K | |
| repositioning-control-handles-of-the-selector-img0006.png | 2021-04-05 22:50 | 55K | |
| changing-the-workplane-1-2018-04-18-5.png | 2021-04-05 22:49 | 55K | |
| colors-and-materials-img0001.png | 2021-04-05 22:49 | 55K | |
| changing-the-workplane-1-2018-04-18-6.png | 2021-04-05 22:49 | 55K | |
| editing-the-workplane-1-2018-04-18.png | 2021-04-05 22:49 | 55K | |
| changing-the-workplane-1-2018-04-18-4.png | 2021-04-05 22:49 | 55K | |
| display-intersections-with-3d-objects-1-2018-04-18-1.png | 2021-04-05 22:49 | 55K | |
| changing-the-workplane-1-2018-04-18-1.png | 2021-04-05 22:49 | 55K | |
| saving-and-recalling-workplanes-1-2018-04-18.png | 2021-04-05 22:50 | 55K | |
| changing-the-workplane-1-2018-04-18-2.png | 2021-04-05 22:49 | 55K | |
| chamfer-with-miter-vertices-img0005.png | 2021-04-05 22:49 | 55K | |
| changing-the-workplane-1-2018-04-18.png | 2021-04-05 22:49 | 55K | |
| changing-the-workplane-1-2018-04-18-3.png | 2021-04-05 22:49 | 55K | |
| displaying-the-workplane-1-2018-04-18-1.png | 2021-04-05 22:49 | 55K | |
| door-styles-img0005.png | 2021-04-05 22:49 | 56K | |
| final-gather-img0002.png | 2021-04-05 22:49 | 56K | |
| text-styles-img0001.png | 2021-04-05 22:50 | 56K | |
| selecting-smesh-faces-img0001.png | 2021-04-05 22:50 | 56K | |
| ifc-bim-data-1-2018-04-25-10.png | 2021-04-05 22:49 | 56K | |
| fillet-with-setbacks-img0001.png | 2021-04-05 22:49 | 56K | |
| editing-stairs-img0002.png | 2021-04-05 22:49 | 56K | |
| loading-symbol-folders-into-the-library-img0002.png | 2021-04-05 22:49 | 56K | |
| chamfer-with-miter-vertices-img0011.png | 2021-04-05 22:49 | 56K | |
| associating-the-image-with-the-3d-object-img0001.png | 2021-04-05 22:49 | 56K | |
| fillet-with-setbacks-img0003.png | 2021-04-05 22:49 | 56K | |
| facet-edit-img0005.png | 2021-04-05 22:49 | 56K | |
| layer-management-img0004.png | 2021-04-05 22:49 | 56K | |
| mid-two-point-snap-img0003.png | 2021-04-05 22:49 | 56K | |
| quality-rendering-in-redsdk-img00011.png | 2021-04-05 22:50 | 56K | |
| redsdk-volumetric-environment-img00211.png | 2021-04-05 22:50 | 56K | |
| woodworking-img0010.png | 2021-04-05 22:50 | 56K | |
| smeshes-and-exploding-the-primitive-img0001.png | 2021-04-05 22:50 | 56K | |
| selector-2d-parts-img0001.png | 2021-04-05 22:50 | 56K | |
| managing-materials-in-the-render-manager-img0002.png | 2021-04-05 22:49 | 56K | |
| brush-styles-img0021.png | 2021-04-05 22:49 | 56K | |
| interactive-tone-adjustments-img0005.png | 2021-04-05 22:49 | 56K | |
| add-roof-by-walls-img0002.png | 2021-04-05 22:49 | 56K | |
| colors-and-materials-img0004.png | 2021-04-05 22:49 | 56K | |
| facet-offset-img0005.png | 2021-04-05 22:49 | 56K | |
| final-gather-img0007.png | 2021-04-05 22:49 | 56K | |
| saving-views-img0001.png | 2021-04-05 22:50 | 56K | |
| editing-splines-and-bezier-curves-img0018.png | 2021-04-05 22:49 | 57K | |
| redsdk-volumetric-environment-img00161.png | 2021-04-05 22:50 | 57K | |
| fillet-with-round-vertices-img0009.png | 2021-04-05 22:49 | 57K | |
| redsdk-materials-examples-img00161.png | 2021-04-05 22:50 | 57K | |
| tcw-profiles-img0007.png | 2021-04-05 22:50 | 57K | |
| spelling-tool-and-spell-options-1-2018-04-24.png | 2021-04-05 22:50 | 57K | |
| model-shaders-and-applications-shaders-img0006.png | 2021-04-05 22:49 | 57K | |
| depth-of-field-img0001.png | 2021-04-05 22:49 | 57K | |
| redsdk-materials-examples-img00171.png | 2021-04-05 22:50 | 57K | |
| native-draw-img0003.png | 2021-04-05 22:49 | 57K | |
| roof-wall-modifier-img0002.png | 2021-04-05 22:50 | 57K | |
| final-gather-img0006.png | 2021-04-05 22:49 | 57K | |
| editing-3d-objects-using-selection-info-img0003.png | 2021-04-05 22:49 | 57K | |
| conceptual-selector-boundary-box-img0005.png | 2021-04-05 22:49 | 57K | |
| final-gather-img0003.png | 2021-04-05 22:49 | 57K | |
| profile-editing-img0011.png | 2021-04-05 22:50 | 57K | |
| profile-editing-img0016.png | 2021-04-05 22:50 | 57K | |
| sketch-style-img0009.png | 2021-04-05 22:50 | 57K | |
| inserting-an-ole-object-img0002.png | 2021-04-05 22:49 | 57K | |
| selecting-smesh-nodes-img0001.png | 2021-04-05 22:50 | 57K | |
| contact-manager-img0008.png | 2021-04-05 22:49 | 58K | |
| mirror-copy-img0005.png | 2021-04-05 22:49 | 58K | |
| library-folders-img0005.png | 2021-04-05 22:49 | 58K | |
| copy-in-place-1-2018-04-24.png | 2021-04-05 22:49 | 58K | |
| tcw-profiles-img0008.png | 2021-04-05 22:50 | 58K | |
| multiadd-vb6-1-2018-04-24.png | 2021-04-05 22:49 | 58K | |
| section-by-plane-img0002.png | 2021-04-05 22:50 | 58K | |
| using-the-ruby-console-1-2018-04-24.png | 2021-04-05 22:50 | 58K | |
| add-roof-modifier-img0006.png | 2021-04-05 22:49 | 58K | |
| 3d-mesh-img0007.png | 2021-04-05 22:49 | 58K | |
| parts-and-assemblies-img0005.png | 2021-04-05 22:50 | 58K | |
| creating-a-parametric-part-img0039.png | 2021-04-05 22:49 | 58K | |
| share-1-2018-04-24.png | 2021-04-05 22:50 | 58K | |
| contact-manager-1-2018-04-24.png | 2021-04-05 22:49 | 58K | |
| proportional-editing-img0003.png | 2021-04-05 22:50 | 58K | |
| exporting-point-clouds-img0003.png | 2021-04-05 22:49 | 58K | |
| subsetting-point-clouds-img0004.png | 2021-04-05 22:50 | 58K | |
| block-attributes-img0014.png | 2021-04-05 22:49 | 58K | |
| add-roof-modifier-img0005.png | 2021-04-05 22:49 | 58K | |
| customize-keyboard-1-2018-04-25.png | 2021-04-05 22:49 | 58K | |
| redsdk-materials-examples-img00151.png | 2021-04-05 22:50 | 58K | |
| interactive-tone-adjustments-img0002.png | 2021-04-05 22:49 | 58K | |
| section-by-closed-polyline-img0002.png | 2021-04-05 22:50 | 58K | |
| space-units-img0003.png | 2021-04-05 22:50 | 58K | |
| holdline-blend-img0003.png | 2021-04-05 22:49 | 58K | |
| render-manager-img0001.png | 2021-04-05 22:50 | 58K | |
| ifc-bim-data-1-2018-04-22.png | 2021-04-05 22:49 | 59K | |
| section-by-line-img0003.png | 2021-04-05 22:50 | 59K | |
| dimension-properties-img0015.png | 2021-04-05 22:49 | 59K | |
| 3d-add-img0003.png | 2021-04-05 22:49 | 59K | |
| inserting-a-parametric-part-from-the-library-img0001.png | 2021-04-05 22:49 | 59K | |
| fillet-with-variable-radius-img0003.png | 2021-04-05 22:49 | 59K | |
| 2d-geometric-parameters-1-2018-04-24.png | 2021-04-05 22:49 | 59K | |
| layer-management-img0003.png | 2021-04-05 22:49 | 59K | |
| creating-lights-light-types-img0005.png | 2021-04-05 22:49 | 59K | |
| add-slab-by-click-img0002.png | 2021-04-05 22:49 | 59K | |
| add-roof-modifier-img0007.png | 2021-04-05 22:49 | 59K | |
| house-wizard-toolset-1-2018-04-19.png | 2021-04-05 22:49 | 59K | |
| 3d-properties-img0004.png | 2021-04-05 22:49 | 59K | |
| acis-img0007.png | 2021-04-05 22:49 | 59K | |
| delete-room-boxes-1-2018-04-19.png | 2021-04-05 22:49 | 59K | |
| hide-show-room-boxes-1-2018-04-19.png | 2021-04-05 22:49 | 59K | |
| insert-room-boxes-1-2018-04-19.png | 2021-04-05 22:49 | 59K | |
| editing-3d-objects-using-selection-info-img0014.png | 2021-04-05 22:49 | 59K | |
| house-setup-1-2018-04-19.png | 2021-04-05 22:49 | 59K | |
| house-wizard-1-2018-04-19.png | 2021-04-05 22:49 | 59K | |
| interactive-handles-img0003.png | 2021-04-05 22:49 | 59K | |
| twist-entity-img0002.png | 2021-04-05 22:50 | 60K | |
| drafting-reference-point-img0004.png | 2021-04-05 22:49 | 60K | |
| redsdk-materials-examples-img00241.png | 2021-04-05 22:50 | 60K | |
| fillet-3d-img0001.png | 2021-04-05 22:49 | 60K | |
| window-styles-img0005.png | 2021-04-05 22:50 | 60K | |
| profile-styles-img0012.png | 2021-04-05 22:50 | 60K | |
| ambient-occlusion-img0002.png | 2021-04-05 22:49 | 60K | |
| ambient-occlusion-img0003.png | 2021-04-05 22:49 | 60K | |
| redsdk-materials-examples-img00311.png | 2021-04-05 22:50 | 60K | |
| redsdk-highlighting-img00041.png | 2021-04-05 22:50 | 60K | |
| weld-symbols-1-2018-04-24.png | 2021-04-05 22:50 | 60K | |
| profile-along-path-1-2018-04-24.png | 2021-04-05 22:50 | 60K | |
| text-along-curve-1-2018-04-24.png | 2021-04-05 22:50 | 60K | |
| surface-roughness-1-2018-04-24.png | 2021-04-05 22:50 | 60K | |
| thread-3d-1-2018-04-24.png | 2021-04-05 22:50 | 60K | |
| colors-and-materials-img0002.png | 2021-04-05 22:49 | 60K | |
| ambient-occlusion-img0001.png | 2021-04-05 22:49 | 61K | |
| interactive-handles-img0005.png | 2021-04-05 22:49 | 61K | |
| sky-information-img00061.png | 2021-04-05 22:50 | 61K | |
| selecting-smesh-nodes-img0002.png | 2021-04-05 22:50 | 61K | |
| editing-3d-objects-using-selection-info-img0029.png | 2021-04-05 22:49 | 61K | |
| section-by-closed-polyline-img0003.png | 2021-04-05 22:50 | 61K | |
| redsdk-volumetric-environment-img00181.png | 2021-04-05 22:50 | 61K | |
| section-by-line-img0002.png | 2021-04-05 22:50 | 61K | |
| solidify-img0003.png | 2021-04-05 22:50 | 61K | |
| page-layout-wizard-img0015.png | 2021-04-05 22:50 | 61K | |
| redsdk-materials-examples-img00291.png | 2021-04-05 22:50 | 61K | |
| drafting-reference-point-img0005.png | 2021-04-05 22:49 | 61K | |
| roof-properties-1-2018-04-23.png | 2021-04-05 22:50 | 61K | |
| tools-palette-img0007.png | 2021-04-05 22:50 | 61K | |
| roof-properties-1-2018-04-23-1.png | 2021-04-05 22:50 | 61K | |
| fillet-with-round-vertices-img0007.png | 2021-04-05 22:49 | 61K | |
| chamfer-with-round-vertices-img0004.png | 2021-04-05 22:49 | 61K | |
| redsdk-materials-examples-img00281.png | 2021-04-05 22:50 | 62K | |
| editing-3d-objects-using-selection-info-img0022.png | 2021-04-05 22:49 | 62K | |
| ribbon-ui-2018-04-22-12.png | 2021-04-05 22:50 | 62K | |
| smesh-symmetry-tools-img0013.png | 2021-04-05 22:50 | 62K | |
| stairs-styles-img0006.png | 2021-04-05 22:50 | 62K | |
| editing-lightworks-material-img0013.png | 2021-04-05 22:49 | 62K | |
| tc-coordinates-export-1-2018-04-23-2.png | 2021-04-05 22:50 | 62K | |
| advanced-grid-options-img0003.png | 2021-04-05 22:49 | 62K | |
| quality-rendering-in-redsdk-img00021.png | 2021-04-05 22:50 | 62K | |
| window-styles-img0018.png | 2021-04-05 22:50 | 62K | |
| section-by-plane-img0003.png | 2021-04-05 22:50 | 62K | |
| skylight-portals-img0002.png | 2021-04-05 22:50 | 62K | |
| cad-course-ui-2018-04-07-11.png | 2021-04-05 22:49 | 62K | |
| rail-styles-img0010.png | 2021-04-05 22:50 | 62K | |
| convert-to-slab-img0004.png | 2021-04-05 22:49 | 62K | |
| viewport-properties-img0005.png | 2021-04-05 22:50 | 62K | |
| fillet-with-round-vertices-img0005.png | 2021-04-05 22:49 | 62K | |
| skylight-portals-img0003.png | 2021-04-05 22:50 | 62K | |
| page-layout-wizard-img0004.png | 2021-04-05 22:50 | 62K | |
| creating-lights-light-types-img0007.png | 2021-04-05 22:49 | 62K | |
| lightworks-luminance-properties-img0005.png | 2021-04-05 22:49 | 62K | |
| selector-mode-img0002.png | 2021-04-05 22:50 | 62K | |
| editing-3d-objects-using-selection-info-img0020.png | 2021-04-05 22:49 | 63K | |
| final-gather-img0005.png | 2021-04-05 22:49 | 63K | |
| refining-the-image-img0004.png | 2021-04-05 22:50 | 63K | |
| section-by-workplane-img0003.png | 2021-04-05 22:50 | 63K | |
| library-folders-img0006.png | 2021-04-05 22:49 | 63K | |
| profile-styles-img0013.png | 2021-04-05 22:50 | 63K | |
| ribbon-ui-2018-04-22-13.png | 2021-04-05 22:50 | 63K | |
| ribbon-ui-2018-04-22.png | 2021-04-05 22:50 | 64K | |
| symbol-libraries-img0001.png | 2021-04-05 22:50 | 64K | |
| creating-lights-light-types-img0011.png | 2021-04-05 22:49 | 64K | |
| rail-styles-img0008.png | 2021-04-05 22:50 | 64K | |
| drafting-reference-point-img0003.png | 2021-04-05 22:49 | 64K | |
| ribbon-ui-2018-04-22-9.png | 2021-04-05 22:50 | 64K | |
| other-cad-formats-img00211.png | 2021-04-05 22:49 | 64K | |
| terrain-img0006.png | 2021-04-05 22:50 | 64K | |
| cad-course-ui-2018-04-07-13.png | 2021-04-05 22:49 | 64K | |
| window-styles-img0028.png | 2021-04-05 22:50 | 64K | |
| print-options-1-2018-04-22-1.png | 2021-04-05 22:50 | 64K | |
| cad-course-ui-2018-04-07-24.png | 2021-04-05 22:49 | 64K | |
| contact-manager-img00011.png | 2021-04-05 22:49 | 64K | |
| model-shaders-and-applications-shaders-img0003.png | 2021-04-05 22:49 | 64K | |
| cad-course-ui-2018-04-07-10.png | 2021-04-05 22:49 | 65K | |
| cad-course-ui-2018-04-07-23.png | 2021-04-05 22:49 | 65K | |
| ambient-occlusion-img0007.png | 2021-04-05 22:49 | 65K | |
| spelling-tool-and-spell-options-img0004.png | 2021-04-05 22:50 | 65K | |
| inserting-a-parametric-part-from-the-library-img0002.png | 2021-04-05 22:49 | 65K | |
| dimension-formatting-codes-img0001.png | 2021-04-05 22:49 | 65K | |
| window-styles-img0004.png | 2021-04-05 22:50 | 65K | |
| interactive-handles-img0002.png | 2021-04-05 22:49 | 65K | |
| cad-course-ui-2018-04-07-21.png | 2021-04-05 22:49 | 65K | |
| drafting-reference-point-img0007.png | 2021-04-05 22:49 | 65K | |
| cad-course-ui-2018-04-07-20.png | 2021-04-05 22:49 | 65K | |
| final-gather-img0004.png | 2021-04-05 22:49 | 65K | |
| cad-course-ui-2018-04-07-18.png | 2021-04-05 22:49 | 65K | |
| terrain-img0007.png | 2021-04-05 22:50 | 65K | |
| hole-patterns-img0004.png | 2021-04-05 22:49 | 66K | |
| modify-table-1-2018-02-23.png | 2021-04-05 22:49 | 66K | |
| slab-styles-img0009.png | 2021-04-05 22:50 | 66K | |
| cad-course-ui-2018-04-07-15.png | 2021-04-05 22:49 | 66K | |
| redsdk-materials-examples-img00271.png | 2021-04-05 22:50 | 66K | |
| 2d-3d-selector-img0005.png | 2021-04-05 22:49 | 66K | |
| cad-course-ui-2018-04-07-12.png | 2021-04-05 22:49 | 66K | |
| ambient-occlusion-img0009.png | 2021-04-05 22:49 | 66K | |
| creating-lights-light-types-img0009.png | 2021-04-05 22:49 | 67K | |
| spelling-tool-and-spell-options-img0001.png | 2021-04-05 22:50 | 67K | |
| ambient-occlusion-img0008.png | 2021-04-05 22:49 | 67K | |
| 3d-print-img0002.png | 2021-04-05 22:49 | 67K | |
| cad-course-ui-2018-04-07-19.png | 2021-04-05 22:49 | 67K | |
| cad-course-ui-2018-04-07-16.png | 2021-04-05 22:49 | 67K | |
| editing-3d-objects-using-selection-info-img0016.png | 2021-04-05 22:49 | 67K | |
| xclip-img0003.png | 2021-04-05 22:50 | 67K | |
| unfold-face-img0008.png | 2021-04-05 22:50 | 67K | |
| cad-course-ui-2018-04-07-9.png | 2021-04-05 22:49 | 67K | |
| cad-course-ui-2018-04-07-7.png | 2021-04-05 22:49 | 67K | |
| design-director-layers-img0004.png | 2021-04-05 22:49 | 67K | |
| inserting-viewports-img0001.png | 2021-04-05 22:49 | 67K | |
| ribbon-ui-2018-04-22-10.png | 2021-04-05 22:50 | 67K | |
| editing-lightworks-material-img0004.png | 2021-04-05 22:49 | 67K | |
| geo-location-img0002.png | 2021-04-05 22:49 | 67K | |
| editing-redsdk-luminances-img00081.png | 2021-04-05 22:49 | 67K | |
| editing-redsdk-luminances-img00061.png | 2021-04-05 22:49 | 67K | |
| hole-patterns-img0006.png | 2021-04-05 22:49 | 67K | |
| editing-3d-objects-using-selection-info-img0012.png | 2021-04-05 22:49 | 68K | |
| 2d-3d-selector-img0008.png | 2021-04-05 22:49 | 68K | |
| shelling-solids-img0003.png | 2021-04-05 22:50 | 68K | |
| slab-styles-img0008.png | 2021-04-05 22:50 | 68K | |
| shelling-solids-img0002.png | 2021-04-05 22:50 | 68K | |
| cad-course-ui-2018-04-07-6.png | 2021-04-05 22:49 | 68K | |
| window-styles-img0024.png | 2021-04-05 22:50 | 68K | |
| smesh-crease-img0002.png | 2021-04-05 22:50 | 68K | |
| colors-and-brushes-img0020.png | 2021-04-05 22:49 | 68K | |
| cad-course-ui-2018-04-07-17.png | 2021-04-05 22:49 | 68K | |
| cad-course-ui-2018-04-07-14.png | 2021-04-05 22:49 | 68K | |
| thick-profile-img0002.png | 2021-04-05 22:50 | 69K | |
| external-references-img0002.png | 2021-04-05 22:49 | 69K | |
| moving-smesh-nodes-edges-and-faces-img0001.png | 2021-04-05 22:49 | 69K | |
| window-styles-img0029.png | 2021-04-05 22:50 | 69K | |
| measuring-volume-img0002.png | 2021-04-05 22:49 | 69K | |
| cad-course-ui-2018-04-07-8.png | 2021-04-05 22:49 | 69K | |
| import-2d-pdf-tool-2018-02-23.png | 2021-04-05 22:49 | 69K | |
| page-layout-wizard-img0002.png | 2021-04-05 22:50 | 69K | |
| create-solid-from-face-s-img0003.png | 2021-04-05 22:49 | 69K | |
| inserting-a-file-img0002.png | 2021-04-05 22:49 | 70K | |
| managing-environments-in-the-render-manager-img0006.png | 2021-04-05 22:49 | 70K | |
| editing-redsdk-luminances-img00041.png | 2021-04-05 22:49 | 70K | |
| window-styles-img0026.png | 2021-04-05 22:50 | 70K | |
| fillet-3d-img0002.png | 2021-04-05 22:49 | 70K | |
| selector-mode-img0003.png | 2021-04-05 22:50 | 70K | |
| visual-representation-img0007.png | 2021-04-05 22:50 | 70K | |
| wal.png | 2021-04-05 22:50 | 71K | |
| database-connection-palette-img0023.png | 2021-04-05 22:49 | 71K | |
| editing-redsdk-luminances-img00171.png | 2021-04-05 22:49 | 71K | |
| parts-and-assemblies-img0015.png | 2021-04-05 22:50 | 71K | |
| redsdk-global-environments-img00091.png | 2021-04-05 22:50 | 71K | |
| quick-pull-img0004.png | 2021-04-05 22:50 | 71K | |
| editing-redsdk-luminances-img00101.png | 2021-04-05 22:49 | 71K | |
| smesh-symmetry-tools-img0003.png | 2021-04-05 22:50 | 71K | |
| extruding-smesh-faces-img0001.png | 2021-04-05 22:49 | 71K | |
| smesh-crease-img0003.png | 2021-04-05 22:50 | 71K | |
| parts-and-assemblies-img0001.png | 2021-04-05 22:50 | 71K | |
| use-patterns-as-compound-profiles-img0001.png | 2021-04-05 22:50 | 71K | |
| woodworking-img0008.png | 2021-04-05 22:50 | 71K | |
| favorites-img0004.png | 2021-04-05 22:49 | 72K | |
| stretch-entity-img0004.png | 2021-04-05 22:50 | 72K | |
| ambient-occlusion-img0004.png | 2021-04-05 22:49 | 72K | |
| delete-hole-img0003.png | 2021-04-05 22:49 | 72K | |
| design-director-layers-img0006.png | 2021-04-05 22:49 | 72K | |
| stretch-entity-img0001.png | 2021-04-05 22:50 | 72K | |
| creating-and-displaying-windows-img0002.png | 2021-04-05 22:49 | 72K | |
| ribbon-ui-2018-04-22-2.png | 2021-04-05 22:50 | 72K | |
| smesh-symmetry-tools-img0004.png | 2021-04-05 22:50 | 72K | |
| rail-styles-img0006.png | 2021-04-05 22:50 | 72K | |
| smesh-symmetry-tools-img0005.png | 2021-04-05 22:50 | 73K | |
| ribbon-ui-2018-04-22-5.png | 2021-04-05 22:50 | 73K | |
| model-shaders-and-applications-shaders-img0005.png | 2021-04-05 22:49 | 73K | |
| synchronizing-data-and-graphics-1-2018-04-23.png | 2021-04-05 22:50 | 73K | |
| using-the-advanced-render-styles-palette-1-2018-03-02-2.png | 2021-04-05 22:50 | 73K | |
| ribbon-ui-2018-04-22-1.png | 2021-04-05 22:50 | 73K | |
| ribbon-ui-2018-04-22-3.png | 2021-04-05 22:50 | 73K | |
| create-surface-from-face-s-img0003.png | 2021-04-05 22:49 | 73K | |
| ribbon-ui-2018-04-22-6.png | 2021-04-05 22:50 | 73K | |
| add-slab-by-click-img0004.png | 2021-04-05 22:49 | 73K | |
| unwrapping-tc-surface-img0012.png | 2021-04-05 22:50 | 73K | |
| favorites-img0001.png | 2021-04-05 22:49 | 73K | |
| parts-and-assemblies-img0007.png | 2021-04-05 22:50 | 73K | |
| database-connection-palette-img0021.png | 2021-04-05 22:49 | 73K | |
| visual-representation-img0008.png | 2021-04-05 22:50 | 73K | |
| smeshes-and-exploding-the-primitive-img0002.png | 2021-04-05 22:50 | 74K | |
| add-slab-by-click-img0003.png | 2021-04-05 22:49 | 74K | |
| creating-lights-light-types-img0003.png | 2021-04-05 22:49 | 74K | |
| ribbon-ui-2018-04-22-4.png | 2021-04-05 22:50 | 74K | |
| ambient-occlusion-img0005.png | 2021-04-05 22:49 | 74K | |
| tc-coordinates-export-1-2018-04-23-4.png | 2021-04-05 22:50 | 74K | |
| xclip-img0005.png | 2021-04-05 22:50 | 74K | |
| stretch-entity-img0005.png | 2021-04-05 22:50 | 75K | |
| ambient-occlusion-img0006.png | 2021-04-05 22:49 | 75K | |
| ribbon-ui-2018-04-22-7.png | 2021-04-05 22:50 | 75K | |
| stretch-entity-img0006.png | 2021-04-05 22:50 | 75K | |
| exploding-viewports-1-2018-04-22.png | 2021-04-05 22:49 | 75K | |
| visual-representation-img0002.png | 2021-04-05 22:50 | 75K | |
| acis-img0006.png | 2021-04-05 22:49 | 75K | |
| fragmental-views-img0001.png | 2021-04-05 22:49 | 76K | |
| selection-info-palette-img0028.png | 2021-04-05 22:50 | 76K | |
| window-styles-img0023.png | 2021-04-05 22:50 | 76K | |
| creating-a-parametric-part-img0047.png | 2021-04-05 22:49 | 77K | |
| render-manager-img0014.png | 2021-04-05 22:50 | 77K | |
| window-styles-img0027.png | 2021-04-05 22:50 | 77K | |
| ribbon-ui-2018-04-22-11.png | 2021-04-05 22:50 | 77K | |
| wall-side-img0003.png | 2021-04-05 22:50 | 77K | |
| window-styles-img0016.png | 2021-04-05 22:50 | 77K | |
| editing-redsdk-luminances-img00151.png | 2021-04-05 22:49 | 77K | |
| window-styles-img0020.png | 2021-04-05 22:50 | 77K | |
| smesh-crease-img0005.png | 2021-04-05 22:50 | 77K | |
| hole-patterns-img0003.png | 2021-04-05 22:49 | 77K | |
| redsdk-global-environments-img00041.png | 2021-04-05 22:50 | 78K | |
| creating-a-rendered-view-img0009.png | 2021-04-05 22:49 | 78K | |
| rail-styles-img0007.png | 2021-04-05 22:50 | 78K | |
| smesh-crease-img0001.png | 2021-04-05 22:50 | 78K | |
| 2d add.jpg | 2021-04-05 22:49 | 78K | |
| smesh-crease-img0006.png | 2021-04-05 22:50 | 79K | |
| window-styles-img0019.png | 2021-04-05 22:50 | 79K | |
| 2d intersect.jpg | 2021-04-05 22:49 | 79K | |
| lighting-img0001.png | 2021-04-05 22:49 | 79K | |
| 2d subtract.jpg | 2021-04-05 22:49 | 79K | |
| manipulating-paper-spaces-img0003.png | 2021-04-05 22:49 | 79K | |
| render-manager-img0012.png | 2021-04-05 22:50 | 79K | |
| dynamic-cut-plane-img0008.png | 2021-04-05 22:49 | 79K | |
| unwrapping-tc-surface-img0003.png | 2021-04-05 22:50 | 79K | |
| delete-hole-img0002.png | 2021-04-05 22:49 | 80K | |
| map-img0007.png | 2021-04-05 22:49 | 80K | |
| sky-information-img00071.png | 2021-04-05 22:50 | 80K | |
| window-styles-img0021.png | 2021-04-05 22:50 | 80K | |
| r2.png | 2021-04-05 22:50 | 81K | |
| window-styles-img0015.png | 2021-04-05 22:50 | 81K | |
| creating-a-rendered-view-img0003.png | 2021-04-05 22:49 | 81K | |
| environments-img0003.png | 2021-04-05 22:49 | 81K | |
| unwrapping-surfaces-img0009.png | 2021-04-05 22:50 | 81K | |
| synchronizing-data-and-graphics-img0007.png | 2021-04-05 22:50 | 81K | |
| creating-a-new-lightworks-material-img0006.png | 2021-04-05 22:49 | 82K | |
| exploding-solids-img0006.png | 2021-04-05 22:49 | 82K | |
| add-hole-img0001.png | 2021-04-05 22:49 | 82K | |
| woodworking-img0003.png | 2021-04-05 22:50 | 82K | |
| stretch-entity-img0002.png | 2021-04-05 22:50 | 83K | |
| dynamic-cut-plane-img0007.png | 2021-04-05 22:49 | 83K | |
| brush-styles-img0022.png | 2021-04-05 22:49 | 83K | |
| ribbon-ui-2018-04-22-8.png | 2021-04-05 22:50 | 84K | |
| window-styles-img0022.png | 2021-04-05 22:50 | 84K | |
| redsdk-volumetric-environment-img00241.png | 2021-04-05 22:50 | 85K | |
| wire-wrap-img0004.png | 2021-04-05 22:50 | 85K | |
| using-the-advanced-render-styles-palette-1-2018-04-23.png | 2021-04-05 22:50 | 85K | |
| luminances-palette-1-2018-04-23.png | 2021-04-05 22:49 | 85K | |
| parametric-part-script-editing-1-2018-04-23.png | 2021-04-05 22:50 | 85K | |
| parametric-part-script-editor-palette-1-2018-04-23.png | 2021-04-05 22:50 | 85K | |
| calculator-palette-variables-palette-1-2018-04-23.png | 2021-04-05 22:49 | 85K | |
| database-connection-palette-1-2018-04-23.png | 2021-04-05 22:49 | 85K | |
| materials-palette-1-2018-04-23.png | 2021-04-05 22:49 | 85K | |
| using-the-materials-palette-1-2018-04-23.png | 2021-04-05 22:50 | 85K | |
| library-1-2018-04-23.png | 2021-04-05 22:49 | 85K | |
| library-palette-1-2018-04-23.png | 2021-04-05 22:49 | 85K | |
| geomarks-and-tap-files-1-2018-04-23.png | 2021-04-05 22:49 | 86K | |
| environments-palette-1-2018-04-23.png | 2021-04-05 22:49 | 86K | |
| using-the-environments-palette-1-2018-04-23.png | 2021-04-05 22:50 | 86K | |
| tc-explorer-palette-1-2018-04-23.png | 2021-04-05 22:50 | 86K | |
| the-tc-explorer-palette-1-2018-04-23.png | 2021-04-05 22:50 | 86K | |
| style-manager-1-2018-04-23.png | 2021-04-05 22:50 | 86K | |
| the-style-manager-palette-1-2018-04-23.png | 2021-04-05 22:50 | 86K | |
| design-director-1-2018-04-23.png | 2021-04-05 22:49 | 86K | |
| design-director-cameras-1-2018-04-23.png | 2021-04-05 22:49 | 86K | |
| design-director-categories-1-2018-04-23.png | 2021-04-05 22:49 | 86K | |
| design-director-graphics-1-2018-04-23.png | 2021-04-05 22:49 | 86K | |
| design-director-layers-1-2018-04-23-2.png | 2021-04-05 22:49 | 86K | |
| design-director-lights-1-2018-04-23.png | 2021-04-05 22:49 | 86K | |
| design-director-options-1-2018-04-23.png | 2021-04-05 22:49 | 86K | |
| design-director-spaces-1-2018-04-23.png | 2021-04-05 22:49 | 86K | |
| design-director-views-1-2018-04-23.png | 2021-04-05 22:49 | 86K | |
| design-director-workplanes-1-2018-04-23.png | 2021-04-05 22:49 | 86K | |
| event-viewer-1-2018-04-23.png | 2021-04-05 22:49 | 86K | |
| the-design-director-1-2018-04-23.png | 2021-04-05 22:50 | 86K | |
| macro-recorder-1-2018-04-23.png | 2021-04-05 22:49 | 86K | |
| macrorecorder-palette-1-2018-04-23.png | 2021-04-05 22:49 | 86K | |
| drafting-palette-1-2018-04-23-1.png | 2021-04-05 22:49 | 86K | |
| drafting-palette-creating-standard-views-1-2018-04-23.png | 2021-04-05 22:49 | 86K | |
| measurement-info-1-2018-04-23.png | 2021-04-05 22:49 | 86K | |
| tools-palette-1-2018-04-23.png | 2021-04-05 22:50 | 86K | |
| image-manager-palette-1-2018-04-23.png | 2021-04-05 22:49 | 86K | |
| selection-info-1-2018-04-23.png | 2021-04-05 22:50 | 86K | |
| selection-info-palette-1-2018-04-23.png | 2021-04-05 22:50 | 86K | |
| tc-coordinates-export-1-2018-04-23-5.png | 2021-04-05 22:50 | 86K | |
| colors-and-brushes-1-2018-04-23.png | 2021-04-05 22:49 | 86K | |
| blocks-palette-1-2018-04-23.png | 2021-04-05 22:49 | 86K | |
| geomarks-and-tap-files-img0004.png | 2021-04-05 22:49 | 86K | |
| surface-from-laws-img0003.png | 2021-04-05 22:50 | 86K | |
| creating-a-new-lightworks-material-img0012.png | 2021-04-05 22:49 | 86K | |
| design-director-cameras-img0001.png | 2021-04-05 22:49 | 86K | |
| redsdk-materials-examples-img00261.png | 2021-04-05 22:50 | 86K | |
| render-manager-img0013.png | 2021-04-05 22:50 | 86K | |
| depth-of-field-img0004.png | 2021-04-05 22:49 | 87K | |
| add-hole-img0003.png | 2021-04-05 22:49 | 87K | |
| schedule-styles-img0001.png | 2021-04-05 22:50 | 87K | |
| associating-the-image-with-the-3d-object-img0003.png | 2021-04-05 22:49 | 87K | |
| unwrapping-the-mesh-img0001.png | 2021-04-05 22:50 | 87K | |
| visual-representation-img0001.png | 2021-04-05 22:50 | 88K | |
| unwrapping-surfaces-img0010.png | 2021-04-05 22:50 | 88K | |
| wall-side-img0002.png | 2021-04-05 22:50 | 88K | |
| array-pattern-img0006.png | 2021-04-05 22:49 | 89K | |
| redsdk-material-concepts-and-properties-img00181.png | 2021-04-05 22:50 | 89K | |
| window-styles-img0025.png | 2021-04-05 22:50 | 89K | |
| isolate-object-img0002.png | 2021-04-05 22:49 | 89K | |
| depth-of-field-img0003.png | 2021-04-05 22:49 | 89K | |
| multi-text-1-2018-02-23.png | 2021-04-05 22:49 | 89K | |
| skylight-portals-img0004.png | 2021-04-05 22:50 | 89K | |
| unwrapping-surfaces-img0005.png | 2021-04-05 22:50 | 90K | |
| unwrapping-tc-surface-img0005.png | 2021-04-05 22:50 | 90K | |
| exploding-solids-img0004.png | 2021-04-05 22:49 | 90K | |
| xclip-img0002.png | 2021-04-05 22:50 | 90K | |
| design-director-layers-1-2018-04-23.png | 2021-04-05 22:49 | 90K | |
| editing-lightworks-material-img0006.png | 2021-04-05 22:49 | 90K | |
| redsdk-materials-examples-img00231.png | 2021-04-05 22:50 | 90K | |
| sky-information-img00051.png | 2021-04-05 22:50 | 90K | |
| dynamic-cut-plane-img0006.png | 2021-04-05 22:49 | 91K | |
| warning-dialogs-img0006.png | 2021-04-05 22:50 | 91K | |
| unwrapping-tc-surface-img0009.png | 2021-04-05 22:50 | 91K | |
| updating-the-database-and-report-1-2018-02-23-3.png | 2021-04-05 22:50 | 91K | |
| shelling-solids-img0006.png | 2021-04-05 22:50 | 92K | |
| smesh-symmetry-tools-img0008.png | 2021-04-05 22:50 | 92K | |
| advanced-grid-options-img0004.png | 2021-04-05 22:49 | 92K | |
| proportional-editing-img0002.png | 2021-04-05 22:50 | 92K | |
| warning-dialogs-img0003.png | 2021-04-05 22:50 | 92K | |
| starting-turbocad-1-2018-04-22.png | 2021-04-05 22:50 | 92K | |
| wire-wrap-img0005.png | 2021-04-05 22:50 | 93K | |
| unwrapping-the-mesh-img0008.png | 2021-04-05 22:50 | 93K | |
| wall.jpg | 2021-04-05 22:50 | 93K | |
| pressure load.jpg | 2021-04-05 22:50 | 93K | |
| deform to point.jpg | 2021-04-05 22:49 | 93K | |
| redsdk-materials-examples-img00251.png | 2021-04-05 22:50 | 93K | |
| redsdk-material-concepts-and-properties-img00191.png | 2021-04-05 22:50 | 94K | |
| warning-dialogs-img0002.png | 2021-04-05 22:50 | 94K | |
| shelling-solids-img0007.png | 2021-04-05 22:50 | 94K | |
| render-manager-img0003.png | 2021-04-05 22:50 | 95K | |
| inserting-a-picture-img0013.png | 2021-04-05 22:49 | 95K | |
| redsdk-materials-examples-img00091.png | 2021-04-05 22:50 | 95K | |
| redsdk-materials-examples-img00071.png | 2021-04-05 22:50 | 95K | |
| cache-properties-1-2018-04-22.png | 2021-04-05 22:49 | 95K | |
| redsdk-materials-examples-img00081.png | 2021-04-05 22:50 | 95K | |
| redsdk-materials-examples-img00051.png | 2021-04-05 22:50 | 95K | |
| importing-point-clouds-img0006.png | 2021-04-05 22:49 | 96K | |
| redsdk-materials-examples-img00061.png | 2021-04-05 22:50 | 96K | |
| redsdk-materials-examples-img00101.png | 2021-04-05 22:50 | 96K | |
| unwrapping-the-mesh-img0009.png | 2021-04-05 22:50 | 97K | |
| unwrapping-tc-surface-img0004.png | 2021-04-05 22:50 | 97K | |
| use-patterns-as-compound-profiles-img0002.png | 2021-04-05 22:50 | 97K | |
| warning-dialogs-img0004.png | 2021-04-05 22:50 | 97K | |
| add-hole-img0002.png | 2021-04-05 22:49 | 97K | |
| depth-of-field-img0002.png | 2021-04-05 22:49 | 97K | |
| redsdk-material-concepts-and-properties-img00201.png | 2021-04-05 22:50 | 97K | |
| warning-dialogs-img0005.png | 2021-04-05 22:50 | 97K | |
| rail-styles-img0009.png | 2021-04-05 22:50 | 98K | |
| 3d-add-img0002.png | 2021-04-05 22:49 | 98K | |
| other-cad-formats-img00051.png | 2021-04-05 22:49 | 98K | |
| unwrapping-tc-surface-img0008.png | 2021-04-05 22:50 | 98K | |
| warning-dialogs-img0001.png | 2021-04-05 22:50 | 98K | |
| woodworking-img0005.png | 2021-04-05 22:50 | 99K | |
| kmz-and-kml-img0001.png | 2021-04-05 22:49 | 99K | |
| print-options-1-2018-04-22-2.png | 2021-04-05 22:50 | 100K | |
| render-manager-img0016.png | 2021-04-05 22:50 | 100K | |
| drafting-reference-point-img0002.png | 2021-04-05 22:49 | 100K | |
| editing-lightworks-material-img0007.png | 2021-04-05 22:49 | 101K | |
| custom-blocks-for-windows-and-doors-img0003.png | 2021-04-05 22:49 | 101K | |
| tc-coordinates-export-1-2018-04-23-1.png | 2021-04-05 22:50 | 101K | |
| smesh-symmetry-tools-img0012.png | 2021-04-05 22:50 | 101K | |
| redsdk-materials-examples-img00301.png | 2021-04-05 22:50 | 101K | |
| r3.png | 2021-04-05 22:50 | 102K | |
| door-styles-img0013.png | 2021-04-05 22:49 | 102K | |
| inserting-an-underlay-in-a-drawing-img0002.png | 2021-04-05 22:49 | 103K | |
| packing-general-img0002.png | 2021-04-05 22:50 | 103K | |
| smesh-symmetry-tools-img0011.png | 2021-04-05 22:50 | 104K | |
| r1.png | 2021-04-05 22:50 | 106K | |
| by fit points.jpg | 2021-04-05 22:49 | 106K | |
| editing-lightworks-material-img0008.png | 2021-04-05 22:49 | 106K | |
| default-user-interface-2018-04-25-14.png | 2021-04-05 22:49 | 106K | |
| default-user-interface-2018-04-25-16.png | 2021-04-05 22:49 | 106K | |
| unwrapping-tc-surface-img0011.png | 2021-04-05 22:50 | 107K | |
| wire-wrap-img0003.png | 2021-04-05 22:50 | 107K | |
| default-user-interface-2018-04-25-15.png | 2021-04-05 22:49 | 107K | |
| redsdk-materials-examples-img00211.png | 2021-04-05 22:50 | 107K | |
| redsdk-materials-examples-img00221.png | 2021-04-05 22:50 | 107K | |
| hole-patterns-img0005.png | 2021-04-05 22:49 | 108K | |
| redsdk-materials-examples-img00191.png | 2021-04-05 22:50 | 108K | |
| redsdk-materials-examples-img00201.png | 2021-04-05 22:50 | 109K | |
| lightworks-2-2018-02-23-1.png | 2021-04-05 22:49 | 109K | |
| sky-information-img00031.png | 2021-04-05 22:50 | 110K | |
| isolate-object-img0007.png | 2021-04-05 22:49 | 110K | |
| wire-wrap-img0006.png | 2021-04-05 22:50 | 110K | |
| smesh-symmetry-tools-img0002.png | 2021-04-05 22:50 | 110K | |
| slab by click.jpg | 2021-04-05 22:50 | 110K | |
| add hole.jpg | 2021-04-05 22:49 | 111K | |
| convert to slab.jpg | 2021-04-05 22:49 | 111K | |
| redsdk-materials-examples-img00141.png | 2021-04-05 22:50 | 111K | |
| default-user-interface-2018-04-25-19.png | 2021-04-05 22:49 | 111K | |
| default-user-interface-2018-04-25-13.png | 2021-04-05 22:49 | 111K | |
| deletehole.jpg | 2021-04-05 22:49 | 111K | |
| slab.jpg | 2021-04-05 22:50 | 111K | |
| redsdk-material-concepts-and-properties-img00231.png | 2021-04-05 22:50 | 111K | |
| step.png | 2021-04-05 22:50 | 111K | |
| smesh-symmetry-tools-img0010.png | 2021-04-05 22:50 | 111K | |
| smesh-symmetry-tools-img0006.png | 2021-04-05 22:50 | 112K | |
| sky-information-img00041.png | 2021-04-05 22:50 | 112K | |
| unwrapping-tc-surface-img0006.png | 2021-04-05 22:50 | 112K | |
| u3d.png | 2021-04-05 22:50 | 112K | |
| unwrapping-tc-surface-img0010.png | 2021-04-05 22:50 | 112K | |
| default-user-interface-2018-04-25-1.png | 2021-04-05 22:49 | 113K | |
| local-menu-1-2018-10-16-1.png | 2021-04-05 22:49 | 113K | |
| tcw-profiles-img0010.png | 2021-04-05 22:50 | 114K | |
| starting-turbocad-img0005.png | 2021-04-05 22:50 | 114K | |
| custom-blocks-for-windows-and-doors-img0010.png | 2021-04-05 22:49 | 114K | |
| default-user-interface-2018-04-25-4.png | 2021-04-05 22:49 | 114K | |
| default-user-interface-2018-04-25-11.png | 2021-04-05 22:49 | 115K | |
| default-user-interface-2018-04-25-8.png | 2021-04-05 22:49 | 115K | |
| default-user-interface-2018-04-25-5.png | 2021-04-05 22:49 | 115K | |
| redsdk-materials-examples-img00181.png | 2021-04-05 22:50 | 115K | |
| lightworks-2-2018-02-23.png | 2021-04-05 22:49 | 115K | |
| insert-opening-img0006.png | 2021-04-05 22:49 | 116K | |
| House setup.jpg | 2021-04-05 22:49 | 116K | |
| default-user-interface-2018-04-25-18.png | 2021-04-05 22:49 | 117K | |
| creating-a-rendered-view-img0010.png | 2021-04-05 22:49 | 117K | |
| window-styles-img0013.png | 2021-04-05 22:50 | 118K | |
| smesh-symmetry-tools-img0007.png | 2021-04-05 22:50 | 118K | |
| render-manager-img0005.png | 2021-04-05 22:50 | 119K | |
| door-styles-img0008.png | 2021-04-05 22:49 | 120K | |
| profile-styles-img0021.png | 2021-04-05 22:50 | 121K | |
| table-export-xlsx-1-2018-04-23.png | 2021-04-05 22:50 | 121K | |
| default-user-interface-2018-04-25-9.png | 2021-04-05 22:49 | 121K | |
| viewport-properties-1-2018-04-22-1.png | 2021-04-05 22:50 | 121K | |
| default-user-interface-2018-04-25-3.png | 2021-04-05 22:49 | 121K | |
| default-user-interface-2018-04-25-2.png | 2021-04-05 22:49 | 123K | |
| unwrapping-the-mesh-img0002.png | 2021-04-05 22:50 | 123K | |
| editing-lightworks-material-img0011.png | 2021-04-05 22:49 | 123K | |
| default-user-interface-2018-04-25-7.png | 2021-04-05 22:49 | 124K | |
| unwrapping-the-mesh-img0011.png | 2021-04-05 22:50 | 125K | |
| profile-styles-img0019.png | 2021-04-05 22:50 | 125K | |
| sky-information-img00021.png | 2021-04-05 22:50 | 125K | |
| redsdk-volumetric-environment-img00071.png | 2021-04-05 22:50 | 125K | |
| window-styles-img0008.png | 2021-04-05 22:50 | 125K | |
| profile-styles-img0014.png | 2021-04-05 22:50 | 126K | |
| custom-blocks-for-windows-and-doors-img0004.png | 2021-04-05 22:49 | 126K | |
| managing-environments-in-the-render-manager-img0012.png | 2021-04-05 22:49 | 126K | |
| node-editing-roofs-1-2018-04-23-1.png | 2021-04-05 22:49 | 126K | |
| window-styles-img0012.png | 2021-04-05 22:50 | 126K | |
| node-editing-roofs-1-2018-04-23.png | 2021-04-05 22:49 | 128K | |
| lightworks-2-2018-02-23-2.png | 2021-04-05 22:49 | 129K | |
| default-user-interface-2018-04-25-12.png | 2021-04-05 22:49 | 131K | |
| updating-the-database-and-report-1-2018-02-23-5.png | 2021-04-05 22:50 | 131K | |
| default-user-interface-2018-04-25-6.png | 2021-04-05 22:49 | 132K | |
| proportional-editing-img0008.png | 2021-04-05 22:50 | 132K | |
| default-user-interface-2018-04-25-17.png | 2021-04-05 22:49 | 132K | |
| 3d add.jpg | 2021-04-05 22:49 | 133K | |
| 3d slice.jpg | 2021-04-05 22:49 | 133K | |
| 3d intersect.jpg | 2021-04-05 22:49 | 133K | |
| proportional-editing-img0005.png | 2021-04-05 22:50 | 133K | |
| 3d subtract.jpg | 2021-04-05 22:49 | 134K | |
| redsdk-material-concepts-and-properties-img00121.png | 2021-04-05 22:50 | 134K | |
| render-manager-img0006.png | 2021-04-05 22:50 | 134K | |
| proportional-editing-img0006.png | 2021-04-05 22:50 | 135K | |
| sky-information-img00011.png | 2021-04-05 22:50 | 137K | |
| render-manager-img0004.png | 2021-04-05 22:50 | 139K | |
| proportional-editing-img0007.png | 2021-04-05 22:50 | 139K | |
| map-img0001.png | 2021-04-05 22:49 | 139K | |
| unwrapping-the-mesh-img0006.png | 2021-04-05 22:50 | 142K | |
| assembly by facet.jpg | 2021-04-05 22:49 | 147K | |
| unwrapping-the-mesh-img0004.png | 2021-04-05 22:50 | 148K | |
| assembly by 3.jpg | 2021-04-05 22:49 | 148K | |
| graphic.jpg | 2021-04-05 22:49 | 148K | |
| customize-keyboard-1-2018-10-13-10.png | 2021-04-05 22:49 | 148K | |
| assembly by axis.jpg | 2021-04-05 22:49 | 148K | |
| assembly by tangents.jpg | 2021-04-05 22:49 | 148K | |
| assembly by edge.jpg | 2021-04-05 22:49 | 148K | |
| bend by sketch.jpg | 2021-04-05 22:49 | 149K | |
| unfold face.jpg | 2021-04-05 22:50 | 149K | |
| proportional-editing-img0004.png | 2021-04-05 22:50 | 149K | |
| warp entity by law.jpg | 2021-04-05 22:50 | 149K | |
| bend to path.jpg | 2021-04-05 22:49 | 150K | |
| refining-the-image-img0003.png | 2021-04-05 22:50 | 150K | |
| tube bend.jpg | 2021-04-05 22:50 | 150K | |
| unbend sheet.jpg | 2021-04-05 22:50 | 150K | |
| bend sheet.jpg | 2021-04-05 22:49 | 150K | |
| tube flange.jpg | 2021-04-05 22:50 | 150K | |
| flange sheet.jpg | 2021-04-05 22:49 | 150K | |
| proportional-editing-img0001.png | 2021-04-05 22:50 | 151K | |
| profile-styles-img0002.png | 2021-04-05 22:50 | 154K | |
| unwrapping-surfaces-img0007.png | 2021-04-05 22:50 | 154K | |
| unwrapping-the-mesh-img0010.png | 2021-04-05 22:50 | 158K | |
| curve-from-law-img0013.png | 2021-04-05 22:49 | 161K | |
| use-patterns-as-compound-profiles-img0004.png | 2021-04-05 22:50 | 162K | |
| tc-coordinates-export-1-2018-04-23-3.png | 2021-04-05 22:50 | 164K | |
| lightworks-2-2018-02-23-3.png | 2021-04-05 22:49 | 165K | |
| 3d line.png | 2021-04-05 22:49 | 167K | |
| redsdk-material-concepts-and-properties-img00221.png | 2021-04-05 22:50 | 169K | |
| isolate-object-img0006.png | 2021-04-05 22:49 | 171K | |
| rendering-1-2018-04-23.png | 2021-04-05 22:50 | 172K | |
| multiple images.png | 2021-04-05 22:49 | 176K | |
| roof.png | 2021-04-05 22:50 | 176K | |
| trim e.png | 2021-04-05 22:50 | 178K | |
| use-patterns-as-compound-profiles-img0003.png | 2021-04-05 22:50 | 181K | |
| redsdk-material-concepts-and-properties-img00211.png | 2021-04-05 22:50 | 182K | |
| map-img0006.png | 2021-04-05 22:49 | 183K | |
| generic-1-2018-04-18.png | 2021-04-05 22:49 | 194K | |
| pdf underlay.png | 2021-04-05 22:50 | 194K | |
| select-by-fence-1-2018-04-17.png | 2021-04-05 22:50 | 196K | |
| unwrapping-surfaces-img0006.png | 2021-04-05 22:50 | 202K | |
| porting-of-redsdk-render-attributes-to-lightworks-2018-04-25.png | 2021-04-05 22:50 | 204K | |
| use-patterns-as-compound-profiles-img0005.png | 2021-04-05 22:50 | 212K | |
| splines-and-bezier-curves-1-2018-04-17.png | 2021-04-05 22:50 | 215K | |
| arrow-curve-1-2018-04-17.png | 2021-04-05 22:49 | 218K | |
| slab.png | 2021-04-05 22:50 | 223K | |
| hatch.png | 2021-04-05 22:49 | 226K | |
| unwrapping-surfaces-img0008.png | 2021-04-05 22:50 | 228K | |
| redsdk-volumetric-environment-img00231.png | 2021-04-05 22:50 | 241K | |
| porting-of-redsdk-render-attributes-to-lightworks-2018-04-25-4.png | 2021-04-05 22:50 | 243K | |
| bisector-1-2018-04-16.png | 2021-04-05 22:49 | 247K | |
| TAP.png | 2021-04-05 22:49 | 251K | |
| redsdk-material-concepts-and-properties-img00171.png | 2021-04-05 22:50 | 267K | |
| extent.png | 2021-04-05 22:49 | 299K | |
| texture.png | 2021-04-05 22:50 | 355K | |
| lightworks-2-2018-02-23-5.png | 2021-04-05 22:49 | 366K | |
| lightworks-2-2018-02-23-4.png | 2021-04-05 22:49 | 448K | |
| Quick pull.png | 2021-04-05 22:49 | 474K | |
| porting-of-redsdk-render-attributes-to-lightworks-2018-04-25-3.png | 2021-04-05 22:50 | 485K | |
| image1.png | 2021-04-05 22:49 | 839K | |
| thick.png | 2021-04-05 22:50 | 1.9M | |
|
|---|
